The graphs of the fuctions f and g are shown below, find all values of x for which f(x) < g(x). 30 points!!!

The Graphs Of The Fuctions F And G Are Shown Below, Find All Values Of X For Which F(x) &lt; G(x). 30

Answers

Answer 1

Answer: [tex]-10 < x < 0, x > 12[/tex]

Step-by-step explanation:

[tex]f(x) < g(x)[/tex] when the graph of [tex]f(x)[/tex] is below the graph of [tex]g(x)[/tex].


Related Questions

The image of the point (1, 1) under a translation is (0, 3). Find the coordinates of the image of the point (-4, "-1) under the same translation.

Answers

The image of the point (-4, -1) after the translation is:

(-3, 1)

How to identify the translation?

A translation:

Tᵃ'ᵇ applied to a point (x, y) gives:

Tᵃ'ᵇ(x, y) = (x + a, y + b).

In this case, we know that:

Tᵃᵇ(1, 1) = (1 + a, 1 + b) = (0, 3)

Then:

1 + a = 0

1 + b = 3

Solving these we get:

a = 1

b = 3 - 1 = 2

The translation is:

T¹'²

Applying this to the point (-4, -1) gives:

T¹'²(-4, -1) = (-4 + 1, -1 + 2) = (-3, 1)

Learn more about translations:

https://brainly.com/question/24850937

#SPJ1

How to solve? Please help i will give good rating.​

Answers

Answer:

6.  Draw a vertical line that goes though points (4,7) and (4,9).  For a relation to be a function, each input has to have only one output.  The input 4 cannot have the output of 7 and 9.  This proves that this is not a function

7. The range is 91, 3, 6, 10 and 15)

Step-by-step explanation:

The range is the answer if you put in the x for range that they give you.

For example:

x ( x+ 1)/2  If I put in 1 for x, I will get

1(1+1)/2

2/2

1

When the input is 1, the output is one.  You that for each of the domains given and you will find the ranges (outputs) that I have written above.

a train increased its prices from £663 to £895.05 how much has this increased in a percentage

Answers

Answer:

The price has increased 35%

Step-by-step explanation:

Given

Initial price = £663,New price = £895.05.

Find the percent increase

Find the amount of increase:

£895.05  - £663 = £232.05

Find the percent value of the increase over the initial price:

232.05/663 × 100% = 35%

5. Identify whether each unit measures length, volume, or weight (or mass).
1.
Mile
Cup.
Pound
Centimeter
2.
3.
4.
5.
Liter
6.
Gram
7.
Pint
8.
Yard
9. Kilogram
10. Teaspoon,
11. Milliliter

Answers

Answer:

See below

Step-by-step explanation:

Length (L), volume (V), weight(W), or mass(M)

Mile     L

Cup           V

Pound   W

Centimeter L

Liter     V

Gram   M

Pint           V

Yard   L

Kilogram   M

Teaspoon  V

Milliliter    V

1. Mile

2. Cup

3. Pound

4. Centimeter

5. Liter

6. Gram

7. Pint

8. Yard

9. Kilogram

10. Teaspoon,

11. Milliliter

Suppose a golf ball bounces off a wall at a point P, and that
line mis perpendicular to the wall at point P.
What is the measure of the angle of reflection?
A. 50°
B. 40°
C. 140°
D. 90°

Answers

40 degrees because reflection is is the same like a mirror

Select the correct answer.
Function g is a transformation of the parent cosine function such that g(x) = 3 cos (x + 2) + 1. Which graph represents function g?

Answers

Option C gives the graph of Function g is a transformation of the parent cosine function such that g(x) = 3 cos(x + 2) + 1 as it the graph of cosine function.

What is cosine function?

The ratio between the adjacent side and the hypotenuse is known as the cosine function (or cos function) in triangles. One of the three primary trigonometric functions, cosine is the complement of sine (co+sine) and one of the three main trigonometric functions.

What is Graph?

A graph is a structure that resembles a set of objects in mathematics, more specifically in graph theory, in which some pairs of the objects are conceptually "related." The objects are represented by mathematical abstractions known as vertices, and each pair of connected vertices is referred to as an edge.

Choice C provides a graph of the parent cosine function is transformed into function g such that g(x) = 3 cos(x + 2) + 1 on the cosine function graph.

To know more about graph,

https://brainly.com/question/17267403?referrer=searchResults

#SPJ13

Answer:

see photo

be sure to look closely, the top curves go to 4 and the bottom goes to -2, there are 2 with this same shape but the other one does not go high enough.

Step-by-step explanation:

Plato/Edmentum

determine the measure of angle j.

Answers

The measure of the value of ∠j is 10°.

What are a few properties of a triangle considering its angles?
A triangle's outer angle is the sum of its internal angles' two opposite sides.
The sum of two linear angles is supplementary.

Given, the three angles of the triangle are measured as (5x - 3)°,
(4x - 2)° and .
Also, the exterior angle of the triangle is (10x - 20)°.
Following the literature established above, considering that a triangle's outer angle is the product of its internal angles' two opposite sides, we have: (5x - 3) + (4x - 2) = 10x - 20 ⇒ 9x - 5 = 10x - 20 ⇒ 10x - 9x = 20 - 5
⇒ x = 15 --(i)
Again, since the sum of two linear angles is supplementary, we have using (i):
j + (10x - 20) = 180 ⇒ j + 150 - 20 = 180 ⇒ j = 10°
Therefore, the measure of the value of ∠j is 10°.

To learn more about this, tap on the link below:
https://brainly.com/question/25215131

#SPJ9


Write an explicit formula for an, the nth term of the sequence
64, -16, 4,....

Answers

The formula for the given arithmetic series for the term aₙ will be aₙ=a₁+(n-1)d.

What is arithmetic series?An arithmetic series is the sum of a sequence like 2,..., where each term is calculated by adding (or subtracting) a constant from the previous one. An ordered group of numbers with a shared difference between each succeeding term is known as an arithmetic sequence. For instance, the common difference in the arithmetic series 3, 9, 15, 21, and 27 is 6.

So, the possible sequence of -64, -16, 4:

We can notice the sequence as -(4³), -(4²), 4, 4², 4³.

So, the formula for the aₙ term will be:

aₙ = a₁ + (n - 1)d

Therefore, the formula for the given arithmetic series for the term aₙ will be aₙ = a₁ + (n - 1)d.

Know more about arithmetic series here:

https://brainly.com/question/6561461

#SPJ13

The correct question is given below:

Write an explicit formula for an, the nth term of the sequence

-64, -16, 4,....

Which is greater 12.5 or |-13|?

Answers

From the question, we are asked to find which is great between 12.5 or |-13|

recall:

|-13|

The absolute value is the distance between a number and zero. The distance between -13 and 0 is 13.

The absolute symbol makes any number positive.

So, |-13| is the greater because |-13| = 13.

So, between 12.5 and |-13|, |-13| is greater since it is same as 13.

Which inequality statements are true? Select all that apply.-0.7<-0.40.5 -0.6-0.8<-0.70.6 > 0.4

Answers

Answer:

-0.7 < -0.4

0.5 > -0.6

-0.8 < -0.7

0.6 > 0.4

Explanation:

The symbol < means less than and the symbol > means greater than.

On the other hand, if we identify each number on a number line, we get:

Therefore, the true statements are:

-0.7 < -0.4

0.5 > -0.6

-0.8 < -0.7

0.6 > 0.4

Because, for example, -0.7 is on the left of -0.4 which means that -0.7 is less than -0.4.

0.5 in on the right of -0.6 which means that 0.5 is greater than -0.6.

Given h(t) = –16t2 + 32t + 5, what is the value of h(2)? *Type in your answer. h(2) =

Answers

The value of the function h(2) for h(t) = -16t2 + 32t + 5 is h(2) = 5

How to determine the function value?

From the question, the function definition is given as

h(t) = -16t2 + 32t + 5

First, we express the exponent in the function properly

This is represented as

h(t) = -16t² + 32t + 5

The function value to calculate is given as

h(2)

This means that we calculate h(t) when t = 2

So, we have

h(2) = -16(2)² + 32(2) + 5

Evaluate the exponents

h(2) = -16(4) + 32(2) + 5

So, we have

h(2) = 5

Hence, the function value is 5

Read more about functions at

https://brainly.com/question/28532394

#SPJ1

Which is the better buy? 2-gallon container of laundry detergent for $23.36. or 17-cup container of laundry detergent for $20.06

Answers

we gotta know the conversion between cups and gallons

We know

1 cup (US) = 0.0625 gallons

So, 2 gallon would be 2/0.0625 = 32 cups

So, the problem in cups is:

32 cups = $23.36

17 cups = $20.06

Definitely 32 cups for 23.36 is better buy

2 gallons for $23.36 is the better buy

Note:

23.36/32 = $0.73 per cup

20.06/17 = $1.18 per cup

How much greater is 8.5 x 10^-2 than 6.6 × 10^-5 ?

Answers

Answer:

1288 times greater

Step-by-step explanation:

(8.5x10^-2)/(6.6x10^-5)

(8.5/6.6)*(10^-2/10^-5)

(1.29)*(10^3)

1288 times greater

Ten bags of oranges were sold to a family of eight.each family member ate six oranges, what fraction of the oranges were eaten?

Answers

The fraction of oranges eaten by the family is 3/5

Given,

Number of oranges in a bag = 8 oranges

Number of bags sold to a family = 10 bags

Number of members in the family = 6 members

Number oranges ate by each member of the family = 6 oranges

We have to find the fraction of the oranges eaten by the family members;

Here,

8 oranges in 1 bag and 10 bags sold.

So, total number of oranges sold = 8 x 10 = 80 oranges

Each member ate 6 oranges and there are 8 members.

So, total number of oranges eaten by them = 6 x 8 = 48 oranges

Now,

The fraction of oranges eaten by the family = 48/80 = 6/10 = 3/5

That is,

3/5th of oranges were eaten by the family.

Learn more about fraction of oranges here;

https://brainly.com/question/3352145

#SPJ1

equationsWrite a system of equations to describe the situation below, solve using elimination, and fill inche blanks.lada gets paid at home for doing extra chores. Last week, she did 1 load of laundry and 8oads of dishes, and her parents paid her $26. The week before, she finished 3 loads ofaundry and 8 loads of dishes, earning a total of $30. How much does Jada earn forcompleting each type of chore?

Answers

In this problem, we are going to write and solve a system of equations based on a real world situation.

Last week, she did 1 load of laundry and 8 loads of dishes, and her parents paid her $26. The week before, she finished 3 loads of laundry and 8 loads of dishes, earning a total of $30.

To begin, we need to create variables for the unknown cost of each chore.

Let x represent laundry, and let y represent dishes.

From the first equation, we can write the equation:

[tex]x+8y=26[/tex]

We can write the second equation as:

[tex]3x+8y=30[/tex]

Together, we have the system:

[tex]\begin{cases}x+8y={26} \\ 3x+8y={30}\end{cases}[/tex]

Multiply the first equation by -1, then add it to the second equation:

[tex]\begin{gathered} \begin{cases}-1(x+8y={26)} \\ 3x+8y={30}\end{cases} \\ \\ \begin{cases}-x-8y={-26} \\ 3x+8y={30}\end{cases} \\ \\ (-x+3x)+(-8y+8y)=-26+30 \\ 2x=4 \end{gathered}[/tex]

We can divide the remaining equation by 2 on both sides:

[tex]\begin{gathered} \frac{2x}{2}=\frac{4}{2} \\ \\ x=2 \end{gathered}[/tex]

Lada made $2 per load of laundry.

We can use the value of x in the first equation to find the value of y. Substitute x = 2:

[tex]2+8y=26[/tex]

Subtract 2 from both sides:

[tex]8y=24[/tex]

Divide by 8 on both sides:

[tex]y=3[/tex]

Lada made $3 per load of dishes.

The table shows a proportional relationship.


x 12 8 24
y 3 2 6


Describe what the graph of the proportional relationship would look like.
A line passes through the point (0, 0) and continues through the point (3, 12).
A line passes through the point (0, 0) and continues through the point (2, 8).
A line passes through the point (0, 0) and continues through the point (6, 24).
A line passes through the point (0, 0) and continues through the point (12, 3).

Answers

A graph which best describes what the proportional relationship would be D. A line that passes through the point (0, 0) and continues through the point (12, 3).

What is a graph?

In Mathematics, a graph is used to graphically represent data points on both the horizontal and vertical lines of a cartesian coordinate, which are the x-axis and y-axis respectively.

Additionally, a graph which shows a proportional relationship between two variables would always have a straight line with its data points passing through the origin (0, 0).

Since the graph represents a proportional relationship we will get;

Constant of proportionality, we get;

k = 12/3 = 8/2 = 24/6

k = 4

Ratio,

24:6

= 12:3.

Therefore, A line that passes through the point (0, 0) and continues through the point (12, 3).

Read more on graphs here:

brainly.com/question/4546414

#SPJ1

Evaluate cos 150° without using a calculator.Ο Α.√32B. 2O C. -1/2OD. -32

Answers

Answer:

Explanation:

Note that:

[tex]\begin{gathered} cos(A+B)=cosAcosB-sinAsinB \\ cos(150^0)=cos(90+60) \end{gathered}[/tex]

Applying the addition formula given above to cos 150:

[tex]\begin{gathered} cos(150)=cos(90)cos(60)-sin(90)sin(60) \\ \\ cos(150)=0(\frac{1}{2})-1(\frac{\sqrt{3}}{2}) \\ \\ cos(150)=0-\frac{\sqrt{3}}{2} \\ \\ cos \end{gathered}[/tex]

given the domain {-2,2,4} what is the range for relation 3x+y=3a (-9,3,9)b (9,-3,-9)c (-3,9,15)d (0,5,7)

Answers

the relation is 3x + y = 3

so,

y = 3x - 3

the domain is the values of x

so, substitute with each value of {-2,2,4} at the last equation of y

when x = -2 , y = 3*-2 - 3 = -6 - 3 = -9

when x = 2 , y = 3 * 2 - 3 = 6 - 3 = 3

when x = 4 , y = 3 * 4 - 3 = 12 - 3 = 9

so, the range will be {-9 , 3 , 9}

The correct answer is option a. (-9,3,9)x

Which number line and equation show how to find the distance from -2 to 5? O O A. 1-2-(-5) 2 3 12-1-5) sing O c. 1-2-5 D. 2-5

Answers

To find the distance between two numbers on the number line, you have tu use absolute value

So, if I want to know the distance from -2 to 5, all I have to do is to substract 5 from -2 and then apply absolute value, like this:

[tex]\mleft|-2-5\mright|\text{ = }\mleft|-7\mright|\text{ = 7}[/tex]

And the number line should look like this:

Triangle TAB has a perimeter of 40 cmeters. Could the measures of the sides as shown actually represent the measures of the sides of the triangle? Justify your answer.

Answers

EXPLANATION

We can apply the Obtuse Triangle Theorem to check if the the measures of the sides appropiately represents the measures of the triangle:

Perimeter = 40 cm = 4x + 2x + 2 + x + 3

Adding like terms:

40 = 7x + 5

Subtracting 5 to both sides:

40 - 5 = 7x

Adding like terms:

35 = 7x

Dividing both sides by 7:

35/7 = x

Simplifying:

[tex]5=x[/tex]

Then, by the obtuse triangle theorem, the following relationship should be fulfilled.

Factorise 4x^2+13x-15​

Answers

The factors of the given quadratic equations are [tex]\frac{-13+\sqrt{409} }{8}[/tex] and [tex]\frac{-13-\sqrt{409} }{8}[/tex]

What is factorization?

When we try to write the given equation in terms of linear values from which we calculate the roots of the given equation then we say that we have factorized them. Root of a equation means a value which satisfies a equation.

We are given a quadratic equation

[tex]4x^2+13x-15[/tex]

We use quadratic formula to compute the factor of the equation

[tex]x=\frac{-b}{2a}[/tex]±[tex]\frac{\sqrt{b^2-4ac} }{2a}[/tex]

[tex]x=\frac{-13}{8}[/tex]±[tex]\frac{\sqrt{169+240} }{8}[/tex]

[tex]x=\frac{-13}{8}[/tex]±[tex]\frac{\sqrt{409} }{8}[/tex]

Therefore the factors are [tex]\frac{-13+\sqrt{409} }{8}[/tex] and [tex]\frac{-13-\sqrt{409} }{8}[/tex]

To learn more about factorization please refer

https://brainly.com/question/25829061

#SPJ13

ABCD is a quadrilateral
Work out the length of BC
Give your answer correct to 1 decimal place.

Answers

Using the law of cosines, the length of BC in the given quadrilateral is: 8.1 cm.

What is the Law of Cosines?

The law of cosines that can be used to find the length of a side of a triangle with a known included angle and two sides is:

c² = a² + b² - 2 × a × b × Cos C.

Considering right triangle ABD,

BD = a

DC = b

BC = c

Use the Pythagorean theorem to find the length of BD in the quadrilateral as shown in the diagram:

BD = √(7.5² + 5²)

BD = √(7.5² + 5²)

BD = 9.0 cm

Use the law of cosines to find the length of BC:

BC² = BD² + DC² - 2 × BD × DC × Cos <BDC.

Substitute

BC² = 9.0² + 13² - 2 × 9.0 × 13 × Cos 38

BC² = 250 - 184.4

BC² = 65.6

BC = √65.6

BC = 8.1 cm

Learn more about the law of cosines on:

https://brainly.com/question/4372174

#SPJ1

can you show how to solve this proplem

Answers

In the given figure : lines l and m are parallel and a, b are transversal

Since, the lines a and b are parallel and l act as a transversal.

Then,

[tex]\begin{gathered} \angle BAC=\angle ACb\text{ (alternate interior angles)} \\ \text{ Substitute the values} \\ 2x=46 \\ x=\frac{46}{2} \\ x=23 \end{gathered}[/tex]

x = 23

Answer : x = 23

Question 2 of 10
Multiply the following complex numbers:
(4-6) (6-8)
OA. -24-68i
OB. 72 +68i
O C. -24 +68/
OD. 72-68i

Answers

-24-68i is solution of complex number.

What is the best definition of a complex number?

Complex numbers are those that are expressed as a+ib, where a, b are actual numbers, and I is a fictitious number termed a "iota."Real and imaginary components are split into two separate numbers, which are referred to as complex numbers. The foundation of more complex mathematics, like algebra, are complex numbers. They have numerous practical applications, particularly in the fields of electronics and electromagnetism.

(4-6i)(6-8i)

= 24-32i-36i+48i²

= 24 + -68i - 48

= -24-68i

Learn more about Complex numbers

brainly.com/question/20566728

#SPJ13

The complete question is -

Multiply the following complex numbers (4-6i)(6-8i)

The manager at the local auto shop has found that the probability that a car brought into the shop requires an oil change is 0.68, the probability that a car brought into the shop requires brake repair is 0.32, and the probability that a car requiresboth anoil change and brake repair is 0.11. For a car brought into the shop, determine the probability that the car will require an oil change or brake repair.The probability that the car requires an oil change or brake repair is

Answers

Remember that

P(A or B)=P(A)+P(B)-P(A and B)

In this problem, we have that

Event A and Event B are not independent

we have

P(A)=0.68

P(B)=0.32

P(A and B)=0.11

substitute

P(A or B)=0.68+0.32-0.11

P(A or B)=0.89

The answer is 0.89

What is 1 1/4 Divided by 10

Answers

Answer: 0.125

Step-by-step explanation:

1 1/4 is equal to 5/4

5/4 is equal to 1.25

then you would do 1.25 divided by 10

once you do that you would get your answer of 0.125!

Answer:

11/4÷10 =

11/4 ×1/10=

11/40=

0.275

Step-by-step explanation:

you can ask questions for clarification

5 (u - 5) + 6u = 8 solve for u and simplifly your answer as much as possible

Answers

Answer:

u = 3

Step-by-step explanation:

Step 1: Distribute 5 in u - 5

[tex]\displaystyle{5\cdot u - 5\cdot 5 +6u=8}\\\\\displaystyle{5u-25+6u=8}[/tex]

Step 2: Add like terms together (u-term)

[tex]\displaystyle{11u-25=8}[/tex]

Step 3: Add both sides by 25

[tex]\displaystyle{11u-25+25=8+25}\\\\\displaystyle{11u=33}[/tex]

Step 4: Divide both sides by 11

[tex]\displaystyle{\dfrac{11u}{11}=\dfrac{33}{11}}\\\\\displaystyle{u=3}[/tex]

Answer Check

Step 1: Substitute u = 3 in the equation

[tex]\displaystyle{5(3-5)+6(3)=8}[/tex]

Step 2: Evaluate & Simplify

[tex]\displaystyle{5(-2)+18=8}\\\\\displaystyle{-10+18=8}\\\\\displaystyle{8=8}[/tex]

Since the equation is true after substituting u = 3. Therefore, the answer is u = 3.

Please let me know if you have any questions!

ASAP NEED HELP WILL GIVE BRAINLIEST

Answers

The value of the unknown angle x is 22 degrees.

How to find the angle x?

SV is a parallel to RU.

RV is a transversal line that cut across the parallel lines SV and RU.

Therefore,

x = ∠V(alternate angles)

Alternate angles are congruent.

Hence,

∠V + 44 + 5x + 4 = 180 (sum of angles in a triangle)

x + 44 + 5x + 4 = 180

x + 5x + 48  = 180

6x + 48 = 180

6x = 180 - 48

6x = 132

divide both sides by 6

x = 132  /6

x = 22 degrees

learn more on angles here: https://brainly.com/question/10254268

#SPJ1

it usually takes davin 1 3/4 hours to get to his aunt's house . due to labor day traffic this year it took 3 1/5 hours .how much longer did it take this year

Answers

It took David 1 [tex]\frac{3}{4}[/tex] hours more to reach her aunt's home due to labor day traffic.

What is unitary method?

The unitary method is a method in which you find the value of a single unit and then the value of a required number of units.

Given is Davin who needs 1 3/4 hours to get to his aunt's house. However, due to the labor day traffic this year it took him 3 1/5 years.

We have to find the difference between the time span Davin took to reach his aunt's house.

Time taken by Davin without the labor day traffic = T[N] = 1 3/4 = 7/4 hours

Time taken by Davin with the labor day traffic = T[L] = 3 1/5 = 16/5 hours

Difference in time spans = T[D] = T[L] - T[N]

T[D] = 16/5 - 7/4

T[D] = 3.2 - 1.75

T[D] = 1.45 = 1 + 0.45

T[D] = 1 [tex]\frac{3}{4}[/tex] hours  

Davin took 1 [tex]\frac{3}{4}[/tex] hours more.

Therefore, it took David 1 [tex]\frac{3}{4}[/tex] hours more to reach her aunt's home due to labor day traffic.

To solve more questions on unitary method, visit the link below-

https://brainly.com/question/13659834

#SPJ1

m(x) = | x + 1 |
Graph

Answers

The value of x = 1/M-1 , x = -1/M+1

What is Graph?

The graph of a function f is the set of ordered pairs where "displaystyle f(x)=y" exists. In the common scenario when x and f(x) are real integers, these pairings represent Cartesian coordinates of points in two-dimensional space and hence constitute a subset of this plane.

M(x) = |x + 1|

|x + 1| = M(x)

x + 1 = M(x)

x + 1 = -M(x)

Adding (-x) both side

x + 1 + (- x) = M(x) + (- x)

x + 1 + (- x) = -M(x) + (- x)

x + 1 - x = M(x) - x

x + 1 - x = -M(x) - x

1 = M(x) - x

1  = -M(x) - x

M(x) - x = 1

-M(x) - x  = 1

x(M-1)  = 1

x(-M-1)  = 1

Dividing both side with (M - 1) and (-M - 1)

x(M-1)/(M - 1)   = 1/(M - 1)

x(-M-1)/(-M - 1)  = 1 /(-M - 1)

x = 1/(M - 1)

x = 1/(-M - 1)

Hence, x = 1/M-1 , x = -1/M+1

To learn more about Graph click on the link

https://brainly.com/question/4025726

#SPJ9

Other Questions
Kristy downloads two songs to her MP3 player. The songs are 3 1/10 minutes and 4 2/3 minutes long. About how many minutes of memory will these two songs use altogether? the income and substitution effects account for: group of answer choices the upward sloping supply curve. the downward sloping demand curve. shifts in the demand curve. movements along a given supply curve. why did alexander graham bell call for the banning of marriage between two deaf people Is 4 a factor of 64? How do you know? in the video, jason oxman, ceo of electronic transaction association, refers to the fact that some credit card car rental insurance programs do not cover particular types of cars and trucks. according to the text, this is referred to as a(n) coverage. miranda and jason are in the tutoring business. miranda is willing to tutor as long as she gets $20, while jason will not tutor unless he gets $35. if the most that someone would pay for tutoring is $30, how much producer surplus is earned? Which line best completes the idea of the poem?O The sea's dangers fill my sight.O On the beach, I'll fly a kite.It's fun to watch the sky at night.O The ocean's beauty is pure delight.What is the anwser to this problem? what is the momentum of an 7.2- kgkg bowling ball rolling at 3.0 m/sm/s ? express your answer to two significant figures and include the appropriate units. A parabola can be drawn given a focus of (7,-3) and a directrix of y=-7. Writethe equation of the parabola in any form. what are some shared properties of both transition metals and alkali metals. Why might learning to farm have ledearly farmers to create new tools?Notebook Jungkook has 84 coins. Of the coins, 7/12 are nickels, 3/12 are dimes, and the rest are quarters. What is the raito of Jungkook's nickels to dimes to quarters? In glycolysis, a glucose molecule is split into two molecules of ______, and energy is harvested as atp and nadh. Zimak bought 3 xylobars and 5 yackities from the intergalactic Candy store for 1.75 Jeejuju paid 1.88 and got 4 xylobars and 1 yackity.How much would dado pay fir 1 xylobar and 2 yakities? does The replication of DNA occur during anaphase? The function table below is intended to represent the relationship y=-5x+1. However, one of the entries for y does not correctly fit the relationship with x. tanya bought the company's first video teleconferencing system, and she involved all of the company's department heads in the decision. she spent weeks evaluating options, inviting rfps, and negotiating with vendors before she finally made a purchase decision. this buying situation would most likely be classified as a what is the adjusted cash balance per bank, if the cash balance per bank statement is $12,150; there are $6,245 of outstanding checks; and $2,385 of deposits in transit? An archery bow is drawn a distance d = 0.39 m and loaded with an arrow of mass m = 0.088 kg. The bow acts as a spring with a spring constant of k = 195 N/m, and the arrow flies with negligible air resistance. To simplify your work, let the gravitational potential energy be zero at the initial height of the arrow. If the arrow is shot at an angle of = 45 above the horizontal, how high, in meters above the initial height, will the arrow be when it reaches its peak? 54 is 120 percent of what number ?