how many faradays of electricity are required to produce 6 g sn from moleten sncl2

The reaction coefficients ensure that the law of conservation of mass is followed, and the number of atoms for each element remains the same on both sides of the equation.

The balanced chemical reaction for the gaseous decomposition of dinitrogen pentoxide (N2O5) into nitrogen dioxide (NO2) and oxygen (O2) is:
2N2O5(g) → 4NO2(g) + O2(g)
The initial rate of the reaction has been studied in carbon tetrachloride solvent at different concentrations of N2O5. The table provided shows the concentration of N2O5 and the corresponding initial rate of the reaction in units of m and m/s, respectively. The balanced chemical reaction for the gaseous decomposition of dinitrogen pentoxide (N2O5) into nitrogen dioxide (NO2) and oxygen (O2) is as follows:
N2O5(g) → 2NO2(g) + 1/2 O2(g)
In this reaction, one molecule of dinitrogen pentoxide decomposes into two molecules of nitrogen dioxide and half a molecule of oxygen gas. The reaction coefficients ensure that the law of conservation of mass is followed, and the number of atoms for each element remains the same on both sides of the equation.

To know more about conservation visit:

https://brainly.com/question/9530080

#SPJ11

The reaction of NaOH (sodium hydroxide) with water (H2O) under heat typically results in the formation of an aqueous solution of sodium hydroxide.

The balanced chemical equation for the reaction is:

NaOH + H2O → Na+(aq) + OH-(aq)

When NaOH is dissolved in water, it dissociates into sodium ions (Na+) and hydroxide ions (OH-). This forms an alkaline solution due to the presence of hydroxide ions.

So, the product of the reaction of NaOH with water under heat is an aqueous solution of sodium hydroxide (NaOH).

Learn more about alkaline solution here ;

https://brainly.com/question/1381817

#SPJ11

The starting ketohexose must be a hexose that contains both galactose and talose as possible constituents. This indicates that the ketohexose is most likely D-tagatose, which has a ketone functional group and six carbon atoms. The Fischer projection of D-tagatose would show the arrangement of its six carbon atoms in a straight chain with the ketone group on the second carbon atom.

To determine the structure of the ketohexose that yields a mixture of d-galactitol and d-talitol when reduced with NaBH4 in CH3OH, we need to analyze the products. Both d-galactitol and d-talitol are sugar alcohols derived from hexoses. D-galactitol is derived from D-galactose, while D-talitol is derived from D-talose. Therefore, When a ketohexose is reduced with NaBH4 in CH3OH to form a mixture of D-galactitol and D-talitol, the ketohexose in question is D-tagatose. In its Fischer projection, the structure of D-tagatose is as follows:
CHO
|
C(OH)H
|
C(OH)H
|
C(OH)H
|
C(OH)H
|
CH2OH
To convert it into the Fischer projection of D-galactitol, you need to change the top carbonyl (C=O) group to an alcohol (C-OH) group. Likewise, you can obtain D-talitol's Fischer projection by changing the C=O group and inverting the 2nd hydroxyl group's orientation.

To know more about ketohexose visit:

https://brainly.com/question/31114760

#SPJ11

The pH at the equivalence point in the titration of 27.62 ml of 0.243 M C6H5OH(aq) with 0.261 M NaOH(aq) is approximately 8.9.

To determine the pH at the equivalence point, we need to find the number of moles of C6H5OH and NaOH. Then, we can calculate the resulting concentration of the conjugate base of C6H5OH, which is C6H5O⁻, at the equivalence point. The pH can be determined using the pKa of phenol and the Henderson-Hasselbalch equation.

Step 1: Calculate the number of moles of C6H5OH and NaOH.

Moles of C6H5OH = volume (L) × molarity

= 0.02762 L × 0.243 mol/L

= 0.006719 mol

Moles of NaOH = volume (L) × molarity

= 0.02762 L × 0.261 mol/L

= 0.007212 mol

Step 2: Determine the limiting reactant.

Since NaOH has a 1:1 stoichiometric ratio with C6H5OH, the limiting reactant is C6H5OH.

Step 3: Calculate the concentration of C6H5O⁻ at the equivalence point.

The moles of C6H5OH at the equivalence point are fully neutralized by an equal number of moles of NaOH. Thus, the concentration of C6H5O⁻ at the equivalence point is:

Concentration = moles/volume

= 0.006719 mol / (0.02762 L + 0.02762 L)

= 0.1216 M

Step 4: Calculate the pH at the equivalence point using the Henderson-Hasselbalch equation.

pH = pKa + log10(concentration of C6H5O⁻/concentration of C6H5OH)

pH = 10 - log10(1.0 × 10⁻¹⁰) + log10(0.1216/0.243)

pH = 8.9

At the equivalence point, the pH of the solution in the titration of 27.62 ml of 0.243 M C6H5OH(aq) with 0.261 M NaOH(aq) is approximately 8.9. This value is obtained by calculating the concentration of the conjugate base (C6H5O⁻) at the equivalence point using stoichiometry, and then applying the Henderson-Hasselbalch equation with the pKa of phenol.

To know more about titration ,visit:

https://brainly.com/question/186765

#SPJ11

The concentration of HNO3 is 0.10 M. This is determined by using the volume and concentration of NaOH used in the titration and applying the stoichiometry of the reaction between HNO3 and NaOH.

In a titration, the goal is to determine the concentration of an unknown solution by reacting it with a known solution of a different substance. In this case, [tex]HNO_3[/tex]is being titrated with NaOH. The balanced equation for the reaction between [tex]HNO_3[/tex]and NaOH is:

[tex]HNO_3 + NaOH[/tex] -> [tex]NaNO_3 + H_2O[/tex]

From the equation, we can see that the stoichiometry of the reaction is 1:1 between [tex]HNO_3[/tex]and NaOH. This means that for every mole of  one mole of NaOH is required to reach equivalence.

Given that 0.20 L of 0.2 M NaOH is used, we can calculate the number of moles of NaOH:

moles of NaOH = volume of NaOH (L) × concentration of NaOH (M)

            = 0.20 L × 0.2 M

            = 0.04 moles

Since the stoichiometry is 1:1, the number of moles of [tex]HNO_3[/tex]is also 0.04 moles. To determine the concentration of HNO3, we divide the moles of [tex]HNO_3[/tex] by the volume

concentration of [tex]HNO_3[/tex]= moles of [tex]HNO_3[/tex]/ volume of [tex]HNO_3[/tex]

                    = 0.04 moles / 0.24 L

                    = 0.1667 M

Rounding to an appropriate number of significant figures, the concentration of [tex]HNO_3[/tex]is approximately 0.10 M.

Learn more about stoichiometry here:

https://brainly.com/question/28780091

#SPJ11

The best method for neutralizing a spilled acid depends on the type of acid and the severity of the spill. However, in general, the recommended method is to add a neutralizing agent, such as sodium bicarbonate, to the spill. This will help to neutralize the acid and prevent it from spreading or causing damage to the surrounding area.

Using a strong base to neutralize the spill can also be effective but requires more caution as it can be dangerous if not handled properly. Pouring water over the spill can be helpful to dilute the acid and prevent it from spreading, but it may not fully neutralize the acid. Mopping up the spill with paper towels is not recommended as it can spread the acid and increase the risk of injury. It is important to wear protective gear, such as gloves and goggles, when handling spilled acid and to follow proper procedures for clean-up and disposal. Neutralizing spilled acid is a critical process that requires a careful approach to prevent accidents and injuries. In case of acid spills, it is essential to act quickly to prevent the acid from causing further damage. Neutralizing the spill with a suitable neutralizing agent such as sodium bicarbonate is the best method as it ensures that the acid is completely neutralized and does not cause further harm. Pouring water over the spill can be helpful, but it does not fully neutralize the acid and may not prevent it from spreading. It is important to handle spilled acid with caution and to wear protective gear to minimize the risk of injury. Proper procedures for clean-up and disposal should be followed to ensure that the acid is properly contained and disposed of.

To know more about Water visit:

https://brainly.com/question/31641293

#SPJ11

The hydroxyl (OH) functional group typically appears as a broad peak on the infrared (IR) spectrum.

The exact location of the peak depends on the specific compound and the environment of the OH group. In general, the OH stretch vibration occurs in the range of 3200-3600 cm^-1. This broad peak is due to the hydrogen bonding interactions that can occur between OH groups and neighboring molecules. The intensity and shape of the peak can provide additional information about the nature of the OH group, such as whether it is involved in intermolecular or intramolecular hydrogen bonding. Overall, the presence of an OH peak in the IR spectrum is indicative of the presence of an alcohol or hydroxyl-containing functional group in the molecule.

Know more about hydroxyl (OH) here:

https://brainly.com/question/30895270

#SPJ11

To calculate the change in enthalpy (ΔH) for the reaction, you can use the following formula:
ΔH = Σ[ΔH(products)] - Σ[ΔH(reactants)]
For the reaction: H2CO3(aq) + KOH(aq) → K2CO3(aq) + H2O(l)ΔH(products) = ΔH(K2CO3) + ΔH(H2O) = -282.3 kJ/mol + (-285.8 kJ/mol) = -568.1 kJ/mol
ΔH(reactants) = ΔH(H2CO3) + ΔH(KOH) = -699.7 kJ/mol + (-115.3 kJ/mol) = -815 kJ/mol
ΔH = (-568.1 kJ/mol) - (-815 kJ/mol) = 246.9 kJ/mol

The change in enthalpy (ΔH) for the given reaction is 246.9 kJ/mol.To calculate the change in enthalpy of the reaction, we need to use the heats of formation of the reactants and products. The balanced chemical equation shows that 1 mole of carbonic acid reacts with 1 mole of potassium hydroxide to form 1 mole of potassium carbonate and 1 mole of water.The enthalpy change of the reaction can be calculated using the following formula:
ΔH = ΣnΔHf(products) - ΣnΔHf(reactants)
Where ΔH is the change in enthalpy, Σn is the sum of the moles of each compound, and ΔHf is the heat of formation.
Substituting the values given, we get:
ΔH = (1 × -282.3 kJ/mol) + (1 × -285.8 kJ/mol) - (1 × -699.7 kJ/mol) - (1 × -115.3 kJ/mol)
ΔH = -567.8 kJ/mol + 814.4 kJ/mol
ΔH = 246.6 kJ/mol
The change in enthalpy of the reaction is 246.6 kJ/mol.

To know more about enthalpy visit:

https://brainly.com/question/29145818

#SPJ11

To find the temperature at which sulfur allotropes reach equilibrium at 1 atm, we can use the Gibbs free energy equation is ΔG = ΔH - TΔS

At equilibrium, ΔG is zero, and we can rearrange the equation as T = ΔH / ΔS. Given that the pressure is 1 atm, we can assume that ΔH is the enthalpy change per mole of sulfur and ΔS is the entropy change per mole of sulfur. The transition from rhombic sulfur to monoclinic sulfur involves an increase in entropy, as the monoclinic form is more disordered. Therefore, ΔS will be positive.

However, we are not provided with specific values for ΔH and ΔS. To determine the temperature at equilibrium, we would need these values to calculate the ratio ΔH / ΔS. Without the values, it is not possible to provide a specific temperature. However, if we assume typical values for ΔH and ΔS, we could estimate the temperature.

For example, assuming ΔH = 10 kJ/mol and ΔS = 50 J/mol·K, we could calculate T ≈ (10 kJ/mol) / (50 J/mol·K) ≈ 200 K. This rough estimate suggests that the sulfur allotropes may reach equilibrium at approximately 200 K. Keep in mind that this is only an illustrative example, and the actual temperature would require specific values for ΔH and ΔS.

Learn more about sulfur allotropes here

https://brainly.com/question/31389199

#SPJ11

The mathematical formula that predicts the splitting of a proton's signal in an H1 NMR (proton nuclear magnetic resonance) spectrum due to adjacent protons is called the n + 1 rule.

According to the n + 1 rule, when a proton is coupled to n adjacent protons, it results in the proton's signal being split into (n + 1) equally spaced peaks. Each peak corresponds to a different spin state of the coupled protons. For example, if a proton is coupled to two adjacent protons, it will exhibit a triplet pattern (3 peaks) in its NMR spectrum. If it is coupled to three adjacent protons, it will display a quartet pattern (4 peaks), and so on.

The n + 1 rule is derived from the concept of spin-spin coupling, which occurs due to the interaction of the magnetic fields of neighboring protons. This coupling leads to the splitting of a proton's signal into multiple peaks, providing information about the number of adjacent protons and their relative arrangement. By applying the n + 1 rule, scientists can interpret the complex splitting patterns observed in H1 NMR spectra and deduce the structural information of molecules.

Learn more about proton's signal here

https://brainly.com/question/29570609

#SPJ11

The correct answer is A. An increase in metabolism in marine species and a decrease in dissolved oxygen in ocean water are linked to an increase in ocean water temperature.

When ocean water temperature increases, it has several effects on marine ecosystems. One of the primary impacts is an increase in the metabolic rates of marine species. Higher temperatures generally lead to increased metabolic activity in organisms, including marine species. This can result in higher energy demands and faster physiological processes. Additionally, as ocean water temperature rises, the solubility of gases in water decreases. This includes oxygen, which becomes less soluble in warmer water. Consequently, an increase in ocean water temperature is associated with a decrease in dissolved oxygen levels. Warmer water holds less dissolved oxygen, making it more challenging for marine organisms to obtain sufficient oxygen for respiration. Therefore, option A accurately describes the changes linked to an increase in ocean water temperature, with increased metabolism in marine species and a decrease in dissolved oxygen in ocean water.

Learn more about metabolic activity here:

https://brainly.com/question/24235247

#SPJ11

The bombarding particle in the reaction 14N + ________ = 14C + 1H is a cosmic ray. Cosmic rays are high-energy particles and radiation that originate from outer space and constantly bombard the Earth's atmosphere.

When cosmic rays collide with nitrogen atoms in the atmosphere, it causes a nuclear reaction that produces carbon-14 (14C). This is how carbon-14 is created in the atmosphere. Carbon-14 is a radioactive isotope of carbon, and it is formed at a constant rate in the atmosphere. Carbon-14 is also known as radiocarbon, and it is used to determine the age of organic materials such as fossils, rocks, and archaeological artifacts. The level of carbon-14 in the atmosphere has been affected by human activities such as nuclear testing, but it remains an important tool for dating and understanding the Earth's history. In summary, cosmic rays are the bombarding particles that cause the nuclear reaction that produces carbon-14 in the Earth's atmosphere.

To know more about bombarding particles

https://brainly.com/question/32352703

#SPJ11

At a temperature of 97 °C, the gas sample has an estimated volume of around 220 mL.

The volume of the gas sample at 97 °C can be calculated using Charles's Law, which states that the volume of a gas is directly proportional to its temperature in Kelvin.

To apply Charles's Law, we need to convert the temperatures to Kelvin. Adding 273 to the given temperatures, we have 38 °C = 311 K and 97 °C = 370 K. Since the volume and temperature are directly proportional, we can set up a proportion to find the new volume:

V1 / T1 = V2 / T2

Where V1 and T1 represent the initial volume and temperature, and V2 and T2 represent the final volume and temperature. Substituting the given values, we have:

185 mL / 311 K = V2 / 370 K

Simplifying the equation, we find:

V2 ≈ 220 mL

Therefore, the volume of the gas sample at 97 °C is approximately 220 mL.

You can learn more about Charles's Law at

https://brainly.com/question/16927784

#SPJ11

The vapor pressure of a 6.22 m [tex]MgCl_2[/tex] aqueous solution at 25°C can be determined using Raoult's law, which states that the vapor pressure of a solution is proportional to the mole fraction of the solvent.

To calculate the vapor pressure of the MgCl2 solution, we need to apply Raoult's law, which states that the vapor pressure of a solution is directly proportional to the mole fraction of the solvent. In this case, the solvent is water.

First, we need to calculate the mole fraction of water in the solution. The mole fraction is the ratio of moles of water to the total moles of all components in the solution. Since we have the concentration of the solution (6.22 m [tex]MgCl_2[/tex]), we can calculate the moles of water by multiplying the concentration by the volume of the solution.

Next, we calculate the mole fraction of water by dividing the moles of water by the total moles of water and [tex]MgCl_2[/tex].

Once we have the mole fraction of water, we can use Raoult's law to determine the vapor pressure of the solution.

Raoult's law states that the vapor pressure of the solution is equal to the mole fraction of water multiplied by the vapor pressure of pure water at the same temperature. Given that the vapor pressure of pure water at 25°C is 23.76 mmHg, we can plug in the calculated mole fraction of water to find the vapor pressure of the [tex]MgCl_2[/tex] solution at 25°C.

Learn more about vapor pressure here:

https://brainly.com/question/29640321

#SPJ11

The length of the box is 12,120 nm for a quantized energy.

What is quantized energy?

Quantized energy refers to the concept in quantum mechanics that energy is "quantized," meaning it can only exist in specific discrete values or levels rather than being continuous. In other words, certain systems or particles can only possess specific amounts of energy, and transitions between these energy levels occur in discrete steps.

For a one-dimensional box, the quantized energy levels are given by the equation:

E = (n²h²)/(8mL²)

Given that the wavelength of the light required to excite the electron from n = 2 to n = 3 is 8080 nm, we can use the following relationship:

λ = 2L/n

where λ is the wavelength, L is the length of the box, and n is the energy level.

Let's calculate the length of the box:

λ = 8080 nm = 8.080 μm

n = 3

Substituting these values into the equation, we get:

8.080 μm = 2L/3

Solving for L, we find:

L = (8.080 μm * 3) / 2

L = 12.12 μm

Converting the length to nm:

L = 12.12 μm * 1000 nm/μm

L = 12,120 nm

Therefore, the length of the box is 12,120 nm for a quantized energy. None of the given options (a, b, c, d, e) match this value, so none of the options are correct.

To learn more about quantized energy,

https://brainly.com/question/30872553

#SPJ4

The change in entropy for the reaction is equal to the change in entropy for the surroundings at approximately 490 K.

We know that ΔSrxn = 283 J/K, and we want to find the temperature at which ΔSsystem = -ΔSsurroundings. To find ΔSsurroundings, we use the equation ΔSsurroundings = -ΔHrxn/T, where T is the temperature in Kelvin.
Plugging in the given values, we get:
283 J/K + (-(-138 kJ/T)) = 0
Simplifying this equation, we get:
138000 J/T + 283 J/K = 0
To solve for T, we need to convert the units to a common base. Let's convert kJ to J and combine the terms:
138000000 J/T + 283 J/K = 0
Now we can solve for T:
T = -138000000/283 = -487.6 K
This is a negative temperature, which doesn't make sense physically. Therefore, there is no temperature at which the change in entropy for the reaction is equal to the change in entropy for the surroundings.

To know  more about entropy

https://brainly.com/question/419265

#SPJ11

The equilibrium constant (K) for the reaction Cl(g) + [tex]O_{3}[/tex](g) → ClO(g) + [tex]O_{2}[/tex](g) at 298 K can be determined using the relationship ΔG° = -RTln(K). The given value of ΔG° is -34.5 kJ/mol-rxn.

The equilibrium constant (K) can be calculated using the equation ΔG° = -RTln(K), where ΔG° is the standard Gibbs free energy change, R is the gas constant (8.314 J/(mol·K)), T is the temperature in Kelvin, and ln represents the natural logarithm. First, we need to convert the given value of ΔG° from kJ/mol-rxn to J/mol-rxn by multiplying it by 1000, which gives -34,500 J/mol-rxn. The temperature is given as 298 K. Next, we substitute the values into the equation: -34,500 J/mol-rxn = -(8.314 J/(mol·K)) * 298 K * ln(K).

Now, we can solve for ln(K) by rearranging the equation: ln(K) = (-34,500 J/mol-rxn) / (-(8.314 J/(mol·K)) * 298 K). Calculating the right-hand side of the equation gives ln(K) ≈ 4.097. To determine K, we take the exponential of both sides: K = e^(ln(K)) = e^[tex]e^{4.097}[/tex]Evaluating e^{4.097} gives approximately K ≈ 60.6. Therefore, the equilibrium constant (K) for the given reaction at 298 K is approximately 60.6.

Learn more about  energy here: https://brainly.com/question/13795204

#SPJ11

A peak at δ 180 in a 13C NMR spectrum typically indicates the presence of a carbonyl group.

A carbonyl group is a functional group that consists of a carbon atom double-bonded to an oxygen atom, which is found in compounds such as aldehydes, ketones, carboxylic acids, and esters. In terms of the type of group indicated by this peak, it suggests that the molecule being analyzed contains a carbonyl group, which can help in determining the identity of the compound. For example, if the peak at δ 180 was observed in a 13C NMR spectrum of an unknown compound, it could help narrow down the possibilities to those that contain a carbonyl group.Overall, the identification of different functional groups based on their chemical shifts in NMR spectra is an important tool in organic chemistry and can provide valuable information about the structure and composition of a molecule.

learn more about carbonyl group Refer: https://brainly.com/question/28213406

#SPJ11

When water freezes, its weight increases. This is because when water freezes, the water molecules form a crystalline structure that is less dense than liquid water. This means that the same amount of water takes up more space when it freezes than when it is in its liquid state.

Therefore, the weight of the frozen water is greater than the weight of the same amount of liquid water. This is why ice cubes, for example, are heavier than the same amount of water that they were made from. It's important to note that this property of water is unusual because most substances are denser in their solid state than in their liquid state.

To know more about Water visit:

https://brainly.com/question/1216922

#SPJ11

A. This reactiοn is second οrder with respect tο reactant A.

B. This reactiοn is first οrder with respect tο reactant B.

C. The οverall οrder οf this reactiοn is three (the sum οf the individual οrders with respect tο A and B).

D. If yοu dοuble the cοncentratiοn οf reactant A while keeping B cοnstant, the rate οf reactiοn will be 4 times great.

E. If yοu dοuble the cοncentratiοn οf reactant B while keeping A cοnstant, the rate οf reactiοn will be 2 times great.

A chemical prοcess in which substances act mutually οn each οther and are changed intο different substances, οr οne substance changes intο οther substances.

8. If yοu dοuble the cοncentratiοn οf reactant B in the rate law equatiοn rate = k[A][B]°, the rate οf the reactiοn will remain unchanged. This is because the expοnent fοr reactant B is 0, indicating that it dοes nοt affect the rate οf the reactiοn.

9. The οrder οf reactiοn with respect tο B is 2 (indicated by [B]² in the rate law equatiοn). When the cοncentratiοn οf reactant B is tripled while keeping the cοncentratiοn οf reactant A cοnstant, the rate increases by a factοr οf 9 (3²). This suggests that the reactiοn is secοnd οrder with respect tο reactant B.

10. Fοr a first-οrder prοcess, the equatiοn fοr the half-life is t₁/₂ = 0.693 / k, where k is the rate cοnstant.

Fοr first-οrder reactiοns οnly, the half-life is independent οf cοncentratiοn.

Learn more about reaction

brainly.com/question/30464598

#SPJ4

Complete question:

The structural formulas of the following compounds areCH3-I, CH3-CH(CH3)-CH(CH3)-CH2-CH2-CH3, cyclo-C5H10, H2C=CH-CH3.

a) Methyl iodide (CH3I) has a structural formula of CH3-I. Since it only contains one type of atom, there will only be one NMR signal expected.
b) 2,4-dimethylpentane (C7H16) has a structural formula of CH3-CH(CH3)-CH(CH3)-CH2-CH2-CH3. There are four different types of hydrogen atoms in this compound, which means four NMR signals would be expected.
c) Cyclopentane (C5H10) has a structural formula of cyclo-C5H10. It contains only one type of hydrogen atom, so only one NMR signal would be expected.
d) Propylene (propene) (C3H6) has a structural formula of H2C=CH-CH3. There are two different types of hydrogen atoms in this compound, which means two NMR signals would be expected.
In summary, the number of NMR signals expected for a compound depends on the number of different types of hydrogen atoms present in the compound. Compounds with only one type of hydrogen atom will only have one NMR signal, while compounds with multiple types of hydrogen atoms will have multiple NMR signals.

To know more about Structural visit:

https://brainly.com/question/29154542

#SPJ11

Moles of oxygen produced is 85 moles, moles of nitrogen produced is 0.6 moles, mass of MgO produced is 4.32g and mass of potassium nitrate produced is 618.12g.

The mole is an amount unit similar to familiar units like pair, dozen, gross, etc. It provides a specific measure of the number of atoms or molecules in a bulk sample of matter.

A mole is defined as the amount of substance containing the same number of atoms, molecules, ions, etc. as the number of atoms in a sample of pure 12C weighing exactly 12 g.

Given,

1. Moles of C₃H₈ = 17 moles

The reaction can be written as =

C₃H₈ + 5O₂ = 3CO₂ + 4H₂O

1 mole of C₃H₈ needs 5 moles of oxygen

so, 17 moles of C₃H₈ needs 5 × 17 = 85 moles of oxygen.

2. Mass of ammonia = 20.5 g

Moles of ammonia = 20.5 / 17 =

From the reaction, 2 moles of ammonia gives one mole of nitrogen.

So, 1.2 moles of ammonia will give 1.2 /2 = 0.6 moles of nitrogen.

3. Mass of Mg = 2.61 g

Moles of Mg = 2.61 / 24 = 0.108 moles

From the reaction, 2 moles of Mg give 2 moles of MgO

So, 0.108 moles of Mg will give 0.108 moles of MgO

Mass of MgO = moles × molar mass

= 0.108 × 40 = 4.32 g

4. Moles of potassium phosphate = 2.04 moles

K₃PO₄ + Al(NO₃)₃ = 3KNO₃ + AlPO₄

1 mole of potassium phosphate gives 3 moles of potassium nitrate

so. 2.04 moles will give 3 × 2.04 = 6.12 moles

mass of potassium nitrate = 6.12 × 101 = 618.12g

Learn more about Moles, here:

https://brainly.com/question/30885025

#SPJ1

The element in the given set (K, Be, Mg, Ca, Al) that you would expect to have the highest second ionization energy (IE2) is Be (Beryllium). This is because ionization energy generally increases across a period from left to right and decreases down a group in the periodic table. Beryllium is furthest to the right among the elements in the set, leading to a higher second ionization energy due to its increased effective nuclear charge and smaller atomic size.

The element in the set that I would expect to have the highest second ionization energy (ie2) is beryllium (Be). Beryllium has a electron configuration of 1s2 2s2 and its first ionization energy is relatively low due to its small atomic size and strong nuclear charge. This means that it is easy to remove one of its electrons, but the second ionization energy required to remove a second electron from a Be+ ion is significantly higher. This is because the remaining electrons are now held more tightly by the nucleus due to the reduced shielding effect. Therefore, Be has the highest second ionization energy among the elements listed.
To know more about ionization energy visit:

https://brainly.com/question/28385102

#SPJ11

The equation showing the formation of a monosubstituted product when 2,3-dimethylbutane reacts with chlorine can be represented as follows:

C6H14 + Cl2 -> C6H13Cl + HCl

In this equation, 2,3-dimethylbutane (C6H14) reacts with chlorine (Cl2) to produce a monosubstituted product, which is 2-chloro-3,3-dimethylbutane (C6H13Cl) and hydrogen chloride (HCl) as a byproduct.

Please note that the structural arrangement of the substituents on the carbon backbone may vary, but the overall chemical equation represents the general substitution reaction between 2,3-dimethylbutane and chlorine.

Know more about 3-dimethylbutane here:

https://brainly.com/question/30874460

#SPJ11

The energy of a photon emitted when an electron in a hydrogen atom undergoes a transition from n = 5 to n = 1 is [tex]2.08 * 10 ^{-18} J[/tex]

The energy of a photon emitted during a transition in a hydrogen atom can be calculated using the formula:

E = [tex]-R_H * (1/n_f^2 - 1/n_i^2)[/tex]

Where E is the energy of the photon, R_H is the Rydberg constant (approximately 2.18 x 10^-18 J), n_f is the final principal quantum number, and n_i is the initial principal quantum number.

In this case, the electron is transitioning from n = 5 to n = 1. Plugging these values into the formula, we have:

E = -2.18 x [tex]10^-18 J * (1/1^2 - 1/5^2)[/tex]

  = -2.18 x [tex]10^-18 J * (1 - 1/25)[/tex]

  = -2.0752 x [tex]10^{-18} J[/tex]

The negative sign indicates that energy is being released as the electron transitions to a lower energy level. Thus, the energy of the photon emitted during this transition is approximately [tex]2.08 x 10^{-18} J[/tex] This energy corresponds to the specific wavelength of light emitted, according to the relationship E = hc/λ, where h is Planck’s constant and c is the speed of light.

Learn more about principal quantum number here:

https://brainly.com/question/3336054

#SPJ11

If 59.33 grams of S are used in the reaction, there would be 39.55 grams of aluminum Al are used.

According to the balanced chemical equation 2 Al + 3 S → Al₂S₃, the stoichiometric ratio between aluminum (Al) and sulfur (S) is 2:3.

To find the grams of Al used, use the proportion based on the stoichiometry:

2 Al ÷ 3 S = Z grams Al ÷ 59.33 grams S

Simplifying the proportion:

2 ÷ 3 = Z ÷ 59.33

Cross-multiplying:

3Z = 2 × 59.33

3Z = 118.66

Dividing both sides by 3:

Z = 118.66 ÷ 3

Z = 39.55 grams

Thus, if 59.33 grams of sulfur S are used in the reaction, there would be 39.55 grams of Al are used.

Learn more about aluminum, here:

https://brainly.com/question/28989771

#SPJ1

The given question is incomplete, so the most probable complete question is,

2 Al + 3 S → Al₂S₃

If 59.33 grams of S are used, how many grams of Al are used?

The maximum wavelength of light is 477nm that will produce photoelectrons from this surface.

What is photoelectrons?

An electron that has left an atom as a result of interacting with a photon, especially one that has left a solid surface as a result of light.

As given,

λ = 200nm, and KE = 3.6eV (1eV = 1.602x10⁻¹⁹J),

h = 6.626068x10⁻³⁴ m²kg/s (Plank's constant)

c = 3 x 10⁸ m/s (speed of light in vacuum)

λ = 2 x 10⁻⁷ m (wavelength)

Find the work function of the metal:

Work function = hc/λ - KE,

Substitute values respectively,

Work function = {[(6.626068 x 10⁻³⁴ m²kg/s) (3x10⁸m/s)] / {2x10⁻⁷m} - (3.6)(1.602x10⁻¹⁹J)

= 4.16502605 x 10⁻¹⁹J.

Now to find the longest wavelength to produce photoelectronic from this surface, use the equation.

E = hc/λ --> λ = hc/E:

Substitute values,

λ = {(6.626068x10⁻³⁴ m²kg/s)(3x10⁸m/s)} / (4.16502605x10⁻¹⁹J)

λ = 4.77x10⁻⁷

λ = 477nm.

Hence, the maximum wavelength of light is 477nm that will produce photoelectrons from this surface.

To learn more about Wavelength from the given link.

https://brainly.com/question/10750459

#SPJ4

To solve this, we can use the combined gas law, The correct answer is d. 563 K. The final Kelvin temperature, assuming constant pressure, would be 250 K.

The ratio of initial and final volumes is equal to the ratio of initial and final temperatures, assuming pressure remains constant.

Using the formula:

(V1/T1) = (V2/T2)

We can plug in the given values:

(100.0 ml / T1) = (150.0 ml / T2)

Cross-multiplying, we have:

100.0 ml * T2 = 150.0 ml * T1

Now, we can substitute T1 = 375 K:

100.0 ml * T2 = 150.0 ml * 375 K

T2 = (150.0 ml * 375 K) / 100.0 ml

T2 = 562.5 K

Therefore, the final Kelvin temperature is approximately 563 K.

To know more about combined gas law,

https://brainly.com/question/29341891

#SPJ11