Which steps show how to use the distributive property to evaluate 9 - 32? A. 9(32) = 9(30 + 2) = 9.30 + 9 - 2 = 270 + 18 = 288 0 B. 9(32) = 9(30 + 2) = 9 - 30 + 30 - 2 = 270 + 60 = 330 OC. 9(32) = 9(30 + 2) = 9.30 – 9.2 = 270 – 18 = 252 O D. 9(32) = 9(30 + 2) = 9.30 + 2 = 270 + 2 = 272

Answers

Answer 1

to find the distribution of

[tex]9\cdot32[/tex]

rewrite 32 as an addition

[tex]32=30+2[/tex]

rewrite the product

[tex]9\cdot(30+2)[/tex]

distribute the 9

[tex]\begin{gathered} 9\cdot30=270 \\ 9\cdot2=18 \\ \\ 9\cdot(30+2)=9\cdot30+9\cdot2 \\ 9\cdot(30+2)=270+18 \\ 9\cdot32=288 \end{gathered}[/tex]


Related Questions

Explain how you know 437,160 is greater than 43,716.4 grade student

Answers

437,160 is read as four hundred thirty-seven thousand one hundred sixty and 43,716 is read as fourty-three thousand seven hundred sixteen.

The first number has hundreds of thousand and the second one only has tens of thousand. It means that the first number is greater than the second one.

Another way to know this is because of the number of figures before the decimal point. The first number has 6 figures before the decimal point and the second one only has 5.

That way, we know that 437,160 is greater than 43,716.

Is the graph of the distance a person has driven over time an example of a continuous or discrete graph?

Answers

Let us first understand what are discrete and continuous variables.

Discrete variable:

A discrete variable is countable in a finite amount of time.

For example:

The number of coins in your pocket

The number of trees in the garden

It is not possible to have 2.5 coins or 7.3 trees

Continuous variable:

A continuous variable can take any numeric value.

For example:

The height of the tree

The room temperature

These values can be in decimal like 7.3, 0.23 etc

Now let us come to the question, the distance a person has driven can take any value

for example, it can be 50 miles or 23.4 miles or 120.5 miles

So, decimal values are possible

This means that it must be a continuous graph

The distance a person has driven over time an example of a continuous graph.

Two lines are shown on the grid below.Read the statements below about the graph of the two lines.Which statements are true about the two lines on the graph?A.I,II, and IV onlyB.II,III, and IV onlyC.II and III only D.I,II,III,and IV

Answers

Answer:

B. II, III, and IV only

Explanation:

Vertical lines have an undefined slope and the equation of these lines is x = c, where c is a constant value

Horizontal lines have a slope equal to 0 and the equation of these lines is y = c, where c is a constant value.

Therefore, the statements that are true about the graph are:

The equation of line b is y = -5

Line b has a slope of 0

The equation of line a is x = 3

What is the mean and median of the data set

Answers

The mean of a data set is the sum of the data divided by the total number of data.

The median of a data set is the middle number in the set (after the numbers have been arranged from least to greatest, or, if there is an even number of data, the median is the average of the two middle numbers.

You have the next data set:

[tex]\begin{gathered} \lbrace11,11,11,11,12,12,12,13,13,13,13,13,13,14,15,15,15,15,15, \\ 15,16,16,16,16,16,17,17,17\rbrace \end{gathered}[/tex]

A total of 28 data.

The mean is equal to the sum of the 28 numbers and then divided into 28:

[tex]undefined[/tex]

URGENT!! ILL GIVE
BRAINLIEST! AND 100 POINTS

Answers

Answer:

perimeter: add p + m + n

area: use (p × m)/2

find missing side: use p^2 + m^2 = n^2

he multiplication table below can be used to find equivalent ratios.

A multiplication table.

Which ratio is equivalent to the ratio 18:24?
15:20
20:15
30:36
36:30

Answers

Answer:

15:20

Step-by-step explanation:

18:24 can be written [tex]\frac{18}{24}[/tex]  if I simplify this by dividing the top and bottom by 6, I get [tex]\frac{3}{4}[/tex]

I am looking for what other ration will reduce to [tex]\frac{3}{4}[/tex]

[tex]\frac{15}{20}[/tex]  Divide the top and bottom by 5 and you will get [tex]\frac{3}{4}[/tex]

find the x value (6x+9)° (4x-19)°

Answers

In this problem m and n are parallel lines, and the first angle is an exteriar angle an the secon is a interior angle.

this two condition give us that the two angles are complementary anlges so the sum of them should be 180 so:

[tex]6x+9+4x-19=180[/tex]

and we can solve for x so:

[tex]\begin{gathered} 10x-10=180 \\ 10x=180+10 \\ x=\frac{190}{10} \\ x=19 \end{gathered}[/tex]

Which phrase represents this expression?

5 + 4 ÷ 2

Responses

the product of 5 and the quotient of 4 and 2
the product of 5 and the quotient of 4 and 2

the product of 5 and 4 is divided by 2
the product of 5 and 4 is divided by 2

the sum of 5 and 4 is divided by 2
the sum of 5 and 4 is divided by 2

the sum of 5 and the quotient of 4 and 2

Answers

Answer is the last one, the sun of 5 and the quotient of 4 and 2

Reason

According to the PEMDAS rule, we multiply and divide before add and subtract

So we find the “quotient” or divide 4 by 2 first. Then we add 5 to the quotient which is a “sum” of 5 and quotient

Function g is a transformation of the parent function exponential function. Which statements are true about function g?

Answers

For the given function, The following are true statements:

Four units separate function g from function f.There is a y-intercept for function g. (0,4)Function g has a range of (3,∞ ).Over the range (-, ∞), function g is positive.

It may be seen from the graph below that

The g function's graph is 4 units higher than the parent exponential function's graph.

All of the input values for which the function is defined are referred to as the function's domain. The domain of the function is (-, ∞ ) according to the graph of function g.

The location where a function's graph crosses the y-axis is known as the y-intercept. G's graph crosses the y-axis at (0, 4). As a result, the Function g's y-intercept is (0,4).

growing function g across the range (- ∞, 0).

Function output values are referred to as the function's range. It can be seen from the graph that the range of function g is (3, ∞ ).

To learn more about functions, https://brainly.com/question/21145944

#SPJ9

A 33-inch piece of steel is cut into three pieces so that the second piece is twiceas long as the first piece, and the third piece is one inch more than five times thelength of the first piece. What is the length of the first piece?

Answers

Let;

x = the length of the first piece

y=the length of the second piece

z=the length of the third piece

From the question;

"the second piece is twice as long as the first piece" can be written in equation as:

y = 2x

"the third piece is one inch more than five times the length of the first piece"

can be written as :

z= 5x+ 1

Total length of the 3 pieces = 33

This implies:

x + y + z =33

substitute y=2x and z=5x+1 into the above

x + 2x + 5x+1 = 33

8x + 1 = 33

subtract 1 from both-side of the equation

8x = 33 -1

8x = 32

divide both-side of the equation by 8

x= 32/8

x= 4

The length of the first piece is 4-inches

Find all solutions of the equation in the interval [0,2pi). csc =7/4 If there is more than one solution, separate them with commas.Do not round any intermediate computations. Give your answer(s) in radians, and round your answer(s) to the nearest hundredth

Answers

Since the cosecant is the inverse of the sine, we can write the following:

[tex]\begin{gathered} \csc (\theta)=\frac{7}{4} \\ \sin (\theta)=\frac{1}{\csc(\theta)}=\frac{1}{\frac{7}{4}}=\frac{4}{7} \end{gathered}[/tex]

Then, using a calculator, we can calculate the angle that has a sine of 4/7:

[tex]\begin{gathered} \theta=\sin ^{-1}(\frac{4}{7})_{} \\ \theta=34.85\degree \end{gathered}[/tex]

There is one more angle between 0 and 2π that has the same value of 4/7 for the sine, and it's the supplementary angle to the one we found:

[tex]\theta_2=180-\theta_1=180-34.85=145.15\degree[/tex]

Therefore the answers are 34.85° and 145.15°.

Converting to radians, we have:

[tex]\begin{gathered} 34.85\cdot\frac{\pi}{180}=0.61 \\ 145.15\cdot\frac{\pi}{180}=2.53 \end{gathered}[/tex]

So the final answer is 0.61 and 2.53.

X+87°2x⁰ i have to solve for x it’s a 180 angle HELP ME!!!!!!!!!

Answers

X+87°+2x°=180°(Angles on a straight line )
Collect Like terms
X+2x°=180°-87°
3x=93°
Divide both sides by 3 to eliminate the coefficient of “x”
3x/3=93°/3
X=31°

6) Write the equation of the line, in point-slope form, that passes through the point (-2,5) and has a slopeof 3.

Answers

Write the equation of the line, in point-slope form, that passes through the point (-2,5) and has a slope

of 3

___________________________________________________

The point-slope form

y-y1 = m (x-x1)

The slope (m)= 3

The point (x1, y1) = (-2,5)

____________

Replacing

y-5 =3 (x- (-2))

_______________

Answer

(y-5) =3 (x +2)

Do you have any questions regarding the solution?

Solve each equation for the variable. h/2 + 3.5 = 7.1

Answers

To answer this question, we can proceed as follows:

[tex]\frac{h}{2}+3.5=7.1[/tex]

1. Subtract 3.5 to both sides of the equation:

[tex]\frac{h}{2}+3.5-3.5=7.1-3.5\Rightarrow\frac{h}{2}+0=3.6[/tex]

2. Multiply by 2 to both sides of the equation:

[tex]2\cdot\frac{h}{2}=2\cdot3.6\Rightarrow h=7.2[/tex]

We can check this result as follows:

[tex]\frac{7.2}{2}+3.5=3.6+3.5=7.1\Rightarrow7.1=7.1[/tex]

This result is TRUE. Then, the value for h = 7.2.

9. If L 1 equals 120 then what is the measure of its supplement <2=

Answers

Supplementary angles are angles whose addition sums up to 180 degrees.

Therefore, if angle 1 measures 120, then its supplement which is angle 2, must mean both add up to 180.

Hence, you have

Angle 1 + Angle 2 = 180

120 + Angle 2 = 180

Subtract 120 from both sides of the equation

Angle 2 = 180 - 120

Angle 2 = 60 degrees

By definiton, two angles are complimentary angles if they both add up to 90 degrees. Hence if angle L5 equals 50 degrees, then its compliment would be derived as 90 - 50 which equals 40. The compliment of angle L5 which is 50 degrees, equals 40 degrees.

helppppppppppppppppppppppppppp

Answers

Step-by-step explanation:

make the fractions decimals and put them on the plot

Complete the table .....Which parts of the arithmetic sequence in the left of the table match up with the linear function on the right?

Answers

Let's expand the formula for arithmetic sequence.

[tex]\begin{gathered} a_n=a_1+d(n-1) \\ a_n=a_1+dn-d \\ a_n=dn+(a_1-d) \end{gathered}[/tex]

The linear function is:

[tex]f(x)=ax+b_{}[/tex]

Matching both equations, we can say:

[tex]\begin{gathered} a_n\gg\gg f(x) \\ d\gg\gg a \\ n\gg\gg x \\ a_1-d\gg\gg b \end{gathered}[/tex]

On a 7 question multiple-choice test, where each question has 2 answers, what would be the probability of getting at least one question wrong?Give your answer as a fraction

Answers

Solution

- This is a Binomial probability question. The formula for Binomial probability is:

[tex]\begin{gathered} P(r)=\sum\text{ }^nC_rp^rq^{n-r} \\ where, \\ n=The\text{ total number of trials} \\ r=\text{ The number of successful trials\lparen where answer is correct\rparen} \\ p=\text{ The probability of success \lparen The probability of getting a question } \\ right) \end{gathered}[/tex]

- We have been given:

[tex]\begin{gathered} n=7 \\ \text{ since there can only be two answers, it means that the} \\ \text{ probability of getting a question correct is:} \\ p=\frac{1}{2} \\ q=1-p=\frac{1}{2} \\ \\ \text{ The probability of getting at least 1 question wrong means the } \\ probability\text{ of getting 1, 2, 3, 4, 5, 6, or 7 question wrong.} \\ \\ \text{ Instead of calculating all these probabilities, we can simply say} \\ P(1)+P(2)+P(3)+P(4)+P(5)+P(6)+P(7)=1-P(0) \end{gathered}[/tex]

- Thus, we have:

[tex]\begin{gathered} P(0)=^7C_0(\frac{1}{2})^0(\frac{1}{2})^7 \\ P(0)=\frac{1}{128} \\ \\ 1-P(0)=1-\frac{1}{128}=\frac{127}{128} \end{gathered}[/tex]

Final Answer

The answer is

[tex]\frac{127}{128}[/tex]

A toy car that is 0.5 ft long is used to model the actions of an actual car that is 15 ft long. Which ratio shows the relationship between the sizes of the model and the actual car? A. 2:5 B. 5:2 C. 30:1 D. 1:30

Answers

A toy car that is 0.5 ft long is used to model the actions of an actual car that is 15 ft long. Which ratio shows the relationship between the sizes of the model and the actual car?



A. 2:5



B. 5:2



C. 30:1



D. 1:30

_____________________

0.5 ft the toy car: 15 the actual car

0.5*2 =1

15 *2 = 30

1: 30

_____________________________________

The ratio1:30​ shows the relationship between the sizes of the model and the actual car

____________

Do you have any questions regarding the solution?

b. Write
√x
as a single radical in simplest form.
5√x

Answers

Answer:

(tenth root of x to the third power)

see image

Step-by-step explanation:

To do this problem you need to know how to convert radicals to an expression with a fraction exponent(and back to radicals again), ALSO exponent rules for division ALSO subtracting fractions.

Square root x can be written as x^ 1/2

fifth root x can be written as x^ 1/5

When you are dividing expressions with the same base, exponent rules say to SUBTRACT the exponents.

1/2 - 1/5 change to common denominator

5/10 - 2/10

= 3/10

x^1/2 / x^1/5 =

x^ (1/2 - 1/5) =

x^ (5/10-2/10) =

x^ 3/10

Then change back to a radical. Remember "down and out" or "roots are down" and "up, up, up" or "exponents are up"

the number down below goes out (outside) the radical. And the number up top is up and exponents are up, up, up

see image.

x^3/10 =

tenth root (x^3)

see image.

2000.5 - 351.748 +62.1

Answers

Given the expression :

[tex]2000.5-351.748+62.1[/tex]

At first make all the decimal digits equally for all terms

The maximum decimal is 3 so, add 00 to the first and the last terms

So,

[tex]\begin{gathered} 2000.5-351.748+62.1 \\ =2000.500-351.748+62.100 \\ =1710.852 \end{gathered}[/tex]

So, the answer is : 1,710.852

Complete the table for y=-3x + 5 and graph the resulting line. -

Answers

We fill the table as follows:

*We assign values for x and solve for y, that is:

*x = 0:

[tex]y=-3(0)+5\Rightarrow y=5[/tex]

So, the value of y when x = 0 is 5.

*x = 1:

[tex]y=-3(1)+5\Rightarrow y=2[/tex]

So, the value of y when x = 1 is 2.

*x = 2:

[tex]y=-3(2)+5\Rightarrow y=-1[/tex]

So, the value of y when x = 2 is -1.

*x = 3:

[tex]y=-3(3)+5\Rightarrow y=-4[/tex]

So, the value of y when x = 3 is -4.

***The table should look like this:

x | y

0 | 5

1 | 2

2 | -1

3 | -4

***The graph is:

A 14 m long ladder is placed against a tree. The top of the ladder reaches a point
13 m up the tree.

How far away is the base of the ladder from the base of the tree?

Give your answer in metres (m) to 1 d.p.

Answers

Answer:

Approximately 5.2 meters

Step-by-step explanation:

This formation will make a right triangle. The ground to the point in the tree is one of the legs. The base of the tree to the base of ladder is another leg and the length of the ladder is the hypotenuse. In this case, we already have the hypotenuse and one of the legs, so we need to find the value of another leg.

We can do so by using the Pythagorean Theorem which is [tex]a^2+b^2=c^2\\[/tex].

a and b represent the values of the two legs, and c is the hypotenuse. Since we already have the hypotenuse, we can change this equation a bit to find the other leg.

Let's assign the missing value, b in the theorem.

The new equation will be [tex]b^2=c^2-a^2[/tex].

We can insert the values for c and a and solve for b.

The new equation will be [tex]b^2 = 14^2-13^2[/tex].

[tex]b^2=196-169[/tex]

[tex]b^2=27[/tex]

[tex]\sqrt{b^2} =\sqrt{27}[/tex]

The square root of [tex]b^2[/tex] cancels out.

The approximate square root of 27 is 5.19 which we can round to 5.2.

1. what is the area of the board shown on the scale drawing? explain how you found the area.2. how can Adam use the scale factor to find the area of the actual electronics board? remember, he uses a different method than Jason.3. what is the area of the actual electronics board?

Answers

Answer:

1. 1800 square cm.

2. See below

3. 45000 square cm.

Explanation:

Part 1

The dimensions of the drawing are 36cm by 50cm.

[tex]\begin{gathered} \text{The area of the board}=36\times50 \\ =1800\operatorname{cm}^2 \end{gathered}[/tex]

Part 2

Given a scale factor, k

If the area of the scale drawing is A; then we can find the area of the actual board by multiplying the area of the scale drawing by the square of k.

Part 3

[tex]\begin{gathered} \text{Area of the scale drawing}=1800\operatorname{cm}^2 \\ \text{Scale Factor,k=5} \end{gathered}[/tex]

Therefore, the area of the actual drawing will be:

[tex]\begin{gathered} 1800\times5^2 \\ =45,000\operatorname{cm}^2 \end{gathered}[/tex]

The height of a pole is 15 feet. A line with banners is connected to the top of the poleto a point that is 8 feet from the base of the pole on the ground. How long would theline with banners need to be in order for the pole to be at a 90° angle with the ground?Explain your reasoning.

Answers

In order to have a 90º angle (right angle) the length of the line with banners needs to fullfit the Pythagorean theorem: In a right triangle the squared hypotenuse is equal to the sum of the legs squared:

[tex]h^2=l^2+l^2[/tex]

In the given situation the hypotenusa is the line with banners, and the legs are the pole and the 8ft ground from the base of the pole to the end of the line with banners:

h= x

l= 15ft

l= 8ft

[tex]x^2=(15ft)^2+(8ft)^2[/tex]

Solve the equation to find the value of x:

[tex]\begin{gathered} x^2=225ft^2+64ft^2 \\ x^2=289ft^2 \\ x=\sqrt[]{289ft^2} \\ x=17ft \end{gathered}[/tex]Then, to make a right triangle the length of the line witg banners need to be 17ft

what does this mean i dont get it please help me thanks, :)

Answers

It means that you are supposed to group The like terms together and simplify them

you will find that 2t is the liketerm with -5t and -u is a like term with -6u

As a results we have

[tex] = 2t - 5t - u - 6u \\ = - 3t - 7u[/tex]

as indicated I have shown you the answer .

good luck

Hi, can you help me to solve this problem please!

Answers

We have the following function

[tex]f(x)=7+6x[/tex]

Now, we must replace the variable x by the given value, that is,

[tex]f(10)=7+6(10)[/tex]

which gives

[tex]\begin{gathered} f(10)=7+60 \\ f(10)=67 \end{gathered}[/tex]

Therefore, the answer is f(10)=67

(2, -3) (4, -2)

Slope intercept

Answers

The slope of the given coordinates is m = 1/2.

What is the slope?A line's steepness can be determined by looking at its slope. The slope is calculated mathematically as "rise over run" (change in y divided by change in x). The slope-intercept form of an equation is used whenever the equation of a line is expressed in the form y = mx + b. M represents the line's slope. B is the b in the point where the y-intercept is located (0, b). For instance, the slope and y-intercept of the equation y = 3x - 7 are 3 and 0, respectively.

So, the slope of (2, -3) (4, -2):

The slope formula: m = y₂ - y₁/x₂ - x₁

Now, solve for slope by putting the values as follows:

m = y₂ - y₁/x₂ - x₁m = -2 - (-3)/4 - 2m = -2 + 3/2m = 1/2

Therefore, the slope of the given coordinates is m = 1/2.

Know more about slopes here:

https://brainly.com/question/3493733

#SPJ13

The correct question is shown below:

Find the slope using the coordinates (2, -3) (4, -2).


Figure RSTU has coordinates R = (3,4), S = (7.2), T = (5, 10), and U = (12,8). The figure is dilated from the origin by a scale factor r . Select the correct coordinates of R. A R' = (3,2) B R' = (1.5, 4) C R' = (3.5, 4.5) D R' = (1.5, 2) * Select the correct answer. 1 point Ο Α OB D

Answers

Answer

Option D is correct.

R' (1.5, 2)

Explanation

A dilation means the size is increased or decreased. If the scale factor is less than 1, then the size is decreased, but if the scale factor is more than 1, it means the figure is enlarged.

Dilating about the origin just multiplies the coordinates by the scale factor. So, dilating (x, y) about the origin by a scale factor k, gives new coordinates (kx, ky).

For this question, we need to dilate R (3, 4) by a scale factor, r = ½

R' = [½(3), ½(4)] = (1.5, 2)

Hope this Helps!!!

how many pennies are in a dollar

Answers

Answer: 100

Step-by-step explanation:

$1 =100 pennies

Other Questions
Estimate the time it would take you to drive 278 miles at38 miles per hour. Round to the nearest hour Factoring64v^4-225w^10I come up with (8v^2+15w^2)(8v^2-15w^5) can I simplify it? a compound is found to contain 13.65 % carbon and 86.35 % fluorine by mass. what is the empirical formula for this compound? to answer the question, enter the elements in the order presented above. Abby scored 88, 91, 95, and 89 on her first four history quizzes. What score does Abby need to get on her fifth quiz to have an average of exactly 90 on her history quizzes? a.85b.86c.87a.88 Can you please help with 44For the following exercise, sketch a graph of the hyperbola, labeling vertices and foci describe the similarities and differences in the spatial organization of cities in western europe and north america in terms of the following aspects. a. geographic size b. height and design of buildings in central business district c. public space d. patterns of economic class e. ethnic neighborhoods Question 16 of 25According to the Gibbs free energy equation, AG = AH-TAS, when is areaction always spontaneous?A. When AH and AS are both positiveB. When AH is negative and AS is positiveC. When AH is positive and AS is negativeD. When AH and AS are both negativeSUBMIT Lines a and b are parallel. Line c is perpendicular to line a. Must it also be perpendicular to line b? Explain your thinking. An artist is going to cut four similar righttriangles from a rectangular piece of paperlike the one shown to the right. What is thedistance from B and D to the diagonal AC?Write an equation and solve, showing ALLthe work. The data in this table represents a linear function. What is the slope of this line? In ABC, mA=45. The altitude divides side AB into two parts of 20 and 21 units. Find BC. You have 4/5 of a pizza left over from your pool party. If you sent 4/9 of the leftover pizza home with your friends how much of the pizza do you have left in the box I need answer for this word problems you have to shown that you can make several lattes then you add milk and begin to stirring. you use a total of 30 ounces of liquid. write an equation that represents the situation and explain what the variable represents. the festival we celebrate 13 FUNDRAISER The Cougar Pep Squad wants to sell T-shirts in the bookstore forthe spring dance. The cost in dollars to order T-shirts in their school colors isrepresented by the equation C = 2t + 3.a. Make a table of values that represents this relationship.b. Rewrite the equation in function notation.c. Graph the function.d. Describe the relationship between the number of T-shirts and the cost. Whats the analysis, interpretation, and evaluation of this artwork If the government levies a $5 tax per mp3 player on buyers of mp3 players, then the price paid by buyers of mp3 players would likely. monthly sale of beer at a bar is believed to be approximately normally distributed with mean 2450 units and standard 400 units.to determine the level of orders and stock ,the management wants to find two value symmetrically on either side of mean,such that the probability that sales of beer during the month will be between the two values is 0.95 and 0.99 find the required value in a certain school district in a large metropolitan area, the sat scores over that past five years are normally distributed with a mean of 1468. furthermore, p 20 p20 is 1216. what is the p 98 p98 score for this population? This relation map is the musician to the instrument they play. is this relation a function?