Which of the follow can NOT be possible
error that occurs during a lab experiment?
human error
pure reactants were used
thing
O unexpected products were produced
the reaction didn't go to completion

Answers

Answer 1

Answer:did h find the answer

Explanation:


Related Questions

I NEED THIS LESS THAN 7 MINUTES IYS 15 POINTS!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!! What is the difference between a balanced equation and an unbalanced equation?
All of the answers are correct.
A balanced equation obeys the law of conservation of mass, an unbalanced equation does not. An unbalanced equation shows the conservation of mass.
Balanced equations do not show equal numbers of atoms on each side of the equation.

Answers

Answer:

Balanced equation have equal number of atoms of different elements in the side of reactants and products.

Answer:

- A balanced chemical equation has an equal numbers of atoms of different elements in the side of reactants and products.

- An unbalanced chemical equation has an unequal number of atoms of one or more elements in the reaction.

Explanation:

What factor determines whether an acid or base is strong or weak?

A)The number of hydroxide ions.
B)The number of hydronium ions.
C)The extent to which the acid or base ionizes.

Answers

Answer:

i think it's c

Explanation:

How are stoichiometric calculations performed for redox reactions?

Answers

Answer:

(b) Both Assertion and Reason are correct but Reason is not the correct explanation for Assertion

Explanation:

According to the law of conservation of mass, matter can neither be created nor be destroyed. However, it can be transformed from one form into another. During chemical reactions, atoms or ions are exchanged between reactants to form products. Thus, all the stoichiometric calculations are based on law of conservation of mass.

During redox reactions, one species is oxidized and other species is reduced. This involves electron transfer.

If you want to change the type of element your atom is, you can either
(2 RIGHT CHOICES)
add a proton
add a neutron
add an electron

Answers

Answer:

Add a proton and add a neutron

If you wanted to completely react 150 grams of FeBry, how many moles of sulfuric acid (H,SO) will you need to use?​

Answers

Answer:

Sulfuric acid, spent appears as a black oily liquid. Corrosive to metals and tissue. Density 15 lb /gal.

Explanation:

What is one thing that is the same about a mole of sodiums and a mole of carbons?
A) The weight
B) All of these
C) The total number of atoms
D) The mass

Answers

C the total number of atoms

how many atoms in 1kg of platinum
a 2.5x10^24

b 3.1x10^24

Answers

Answer:

3.1x10^24 it will be in 1 kg of platinum

Krupton (Kr) is a

A. Gas
B. Metal
C. Non of these
D. Metalloid​

Answers

B is gas


The chemical element krypton is classed as a noble gas and a nonmetal.







Love you

Answer: C. None of these

Explanation: Krypton is a noble gas, on the right side of the period table, making it a non-metal.

____H3PO4 + ____ KOH --> ______K3PO4 + ____H2O can someone please balance that chemical equation?

Answers

Answer:

H3PO4 + 3KOH ----> K3PO4 + 3H2O

Explanation:

The valency of K element is + 1 while that of PO4 compound is -3

Hence, at least 3 K atoms are needed to combine with PO4 to form K3PO4 compound.

Hence, the revised equation will be

H3PO4 + 3KOH ----> K3PO4 + 3H2O

Now, the number of atoms and charges of each element is a given equation are equal on both the left and right hand side.

A basketball inflated to a pressure of 2.25 atm is increased in temperature from 275 K to 317 K.What will be the new pressure, in torr, if the volume remains constant?

Answers

Answer:

[tex]P_2=1971.2torr[/tex]

Explanation:

Hello there!

In this case, by recalling the Gay-Lussac's gas law, as a directly proportional relationship between pressure and temperature, we can write:

[tex]\frac{P_2}{T_2} =\frac{P_1}{T_1}[/tex]

Thus, by solving for the required final pressure, in atmospheres first, we solve for P2 as follows:

[tex]P_2 =\frac{P_1T_2}{T_1}\\\\P_2=\frac{2.25atm*317K}{275K}\\\\P_2=2.59atm[/tex]

Which in Torricelli is:

[tex]P_2=2.59atm *\frac{760torr}{1atm}\\\\P_2=1971.2torr[/tex]

Best regards!

What type of circuit has a broken path that does NOT let current flow through it?
A : Closed circuit
B: Open circut
C : Toggle
D : Switch

Answers

Answer:

B

Explanation:

Question :What's oxidation?

Answers

Answer:

The process or result of oxidizing or being oxidized.(Rust)

Explanation:

Pluto

Write a net ionic equation for the reaction that occurs when aqueous solutions of nitric acid and sodium hydroxide are combined.
Be sure to specify states such as (aq) or (s).

Answers

Answer:

H^+(aq) +  OH^-(aq) -------> H2O(l)

Explanation:

We must first write the molecular reaction equation as follows;

HNO3(aq) + NaOH(aq) ------>NaNO3(aq) + H2O(l)

The complete ionic equation is;

H^+(aq) + NO3^-(aq) + Na^+(aq) + OH^-(aq) -------> Na^+(aq) + NO3^-(aq) + H2O(l)

The net ionic equation therefore is;

H^+(aq) +  OH^-(aq) -------> H2O(l)

Can somebody help me pls pls pls pls pls

Answers

Answer:

1.5e + 24 I think, hope this can help

what are the Common compounds of niobium in which it is found

(include common names and their chemical formulas)

plssss help

Answers

Explanation:

Common Compounds of Niobium Nb

[Nb+3, Nb+5]

Compound NameFormulaMolar Mass

Niobium(III) OxideNb2O3233.811

Niobium(III) SulfateNb2(SO4)3474.0006

Niobium(V) PhosphateNb3(PO4)5753.576

Niobium(V) BromideNbBr5492.4264

Niobium(V) PentoxideNb2O5265.8098

Niobium OxychlorideNbOCl3215.2648

Niobium(V) IodideNbI5727.4287

Niobium(V) PentachlorideNbCl5270.1714

Niobium(V) ThiocyanateNb(SCN)5383.3184

Niobium(III) ChlorideNbCl3199.2654

Niobium(V) Dihydrogen PhosphateNb(H2PO4)5577.84259

Niobium NitrideNbN106.9131

Niobium(III) DichromateNb2(Cr2O7)3833.77676

Niobium HydroxideNb(OH)3143.9284

Niobium(V) PerchlorateNb(ClO4)5590.15938

Niobium(V) HypochloriteNb(ClO)5350.16838

Niobium(III) HypochloriteNb(ClO)3247.26358

Niobium(V) CarbonateNb2(CO3)5485.85726

Niobium(III) TartrateNb2(C4H4O6)3630.02564

Niobium(III) ChromateNb2(CrO4)3533.79386

Niobium(V) HexafluorosilicateNb2(SiF6)5896.192356

When
Mercury
orbits
the
Sun,
it
gets
as
close
as
4.8
x
107
miles
to
the
Earth.

It
gets
as
far
as
1.38
x
108
miles
to
the
Earth.

What
is
the
difference
of
these
two distances

Answers

Answer:

hdkdjfjhdakdhevghggggfdffggggfggcdhxgjcfogogi

9. Circle the atom in each pair that has the greater ionization energy.

A) Li or Be
B) Ca or Ba
C) Na or K
D) P or Ar
E) Cl or Si
F) Li or K

Answers

A: BE has more ionization energy than LI

B: CA has more ionization energy than BA.
C: NA has more ionization energy than K

D: AR has more ionization energy than P

E: CI has a more ionization energy than SI
F: LI has more ionization energy than K


If any of these are wrong feel free to correct me in the comments.

A) Be

B) Ca

C) Na

D) Ar

E) Cl

F)  Li

This question simply deals with ionization energy trends across the periodic table or down the group.

Ionization energy is the energy that is needed to remove an electron from its orbital around an atom in such a manner that it will no longer be associated with that same atom.

Now, from studies, it has been found that Ionization energy decreases down a group but it tends to increase as we go from the left to right going across the periodic table.

A) Li(Lithium) and Be(Berrylium) belong to the same period which is period 2 on the periodic table. Berrylium comes after berrylium in that period and as such from the rule earlier, berrylium will have the greater ionization energy.

B) Ca(Calcium) and Ba(Barium) belong to the same group 2 in the periodic table with barium further down the group. Thus, from the trend, Ca(Calcium) will have the greater ionization energy.

C) Na(Sodium) and K(Potassium) belong to the same group 1 in the periodic table with potassium further down the group. Thus, from the trend, Na(Sodium) will have the greater ionization energy.

D) P(Phosphorus) and Ar(Argon) belong to the same period which is period 3 on the periodic table. Argon comes after Phosphorus in that period and as such from the rule earlier, argon will have the greater ionization energy.

E) Cl(Chlorine) and Si(Silicon) belong to the same period which is period 3 on the periodic table. Cl(Chlorine) comes after Si(Silicon) in that period and as such from the rule earlier, Cl(Chlorine) will have the greater ionization energy.

F) Li(Lithium) and K(Potassium) belong to the same group 1 in the periodic table with potassium further down the group. Thus, from the trend,  Li(Lithium) will have the greater ionization energy.

Read more at: brainly.in/question/13610645

how are a dog, a dolphin, and a bat similar to a human?

Answers

Answer:

The more structures that are similar, the more closely related organisms are in their evolutionary past. For example, a human, a dog, a fruit bat, and a dolphin all have the same pattern of bone structure in the upper extremity—one bone connected to two bones, connected to many bones, connected to finger-like bones.

Answer:

Explanation:

they are all made of cells

What is the temperature

Answers

Answer:

I think it mught be 12.9?

Answer:

the average sum of kinetic energy of all the molecules present in a body is called temperature. it's 12.9

hope it is helpful to you

What is a reducing agent?​

Answers

Answer: Its an element or compound that loses (or "donates") an electron to an electron recipient (oxidizing agent) in a redox chemical reaction.

CREDIT: Wikipedia

Answer:A reducing agent typically is in one of its lower possible oxidation states and is known as the electron donor.

Example: Examples of reducing agents include the earth metals, formic acid, oxalic acid, and sulfite compounds.

I NEED HELP ASAP!! What is the difference between the experimental group and a control group?​

Answers

I believe the control group is what doesn't change in the experiment, and the experimental group is what is being tested / receives the treatment :)

A 4.5L container of gas has a pressure of 3.0 atm at a temperature of 100 C. The container is expanded to 6L, and the temperature is increased to 200 C.

A) 2.85 atm

B) 5.3 atm

C) 1.05 atm

D) 100 K

Answers

I think it’s D or A

All of the facts about our star the Sun listed below are true EXCEPT which option?
A. the sun is the smallest object in our Solar System.

B. the sun is an average-sized yellow star.

C. the sun is located in an arm of the spiral shaped Milky Way galaxy.

D. the sun appears brighter because it is much closer to Earth than other stars

Answers

Answer:

A

Explanation:

The sun is the smallest object in our solar system

Answer:

A. the sun is the smallest object in our solar system

Explanation:

In 2009, the Hubble Space Telescope discovered the smallest object ever seen in visible light at the time within the Kuiper Belt. The Kuiper Belt Object (KBO) found was a mere 3,200 feet (975 meters) across and was 4.2 billion miles away.

please join me for dinner tonight.(write the sentence kind).give the right answer for this question ​

Answers

Answer:

Sentence type wish

The answer to the question: No.

Answer:

Will you join me for dinner tonight?

Explanation:

like and rate and brainiest plz

Which of the following phases of matter has a fixed volume but not a fixed shape?
A Liquid B Gas C Solid D Plasma

Answers

Answer:

C. solid

Explanation:

Solid is a hard and not able to flow; not like a liquid or gas. Having no holes; not hollow. Something that is not liquid and gas. Solid has fixed volume but not a fixed shape.

The liquid is something that flows freely; a substance that is not solid or gas.

Gas is a substance that neither liquid nor solid, e.g. air.

Plasma is an electrically neutral ionized gas in an electric discharge; distinctly different from solids and liquids and normal gases.

Therefore, the correct answer is C. solid.

Answer:

A. Liquid

Explanation:

the guy above me is wrong

Which of the answers does not represent a common type of air pollution? A) agricultural ammonia B) carbon monoxide exhaust C) sulfur oxide D) synthetic organic compounds E) industrial nitrogen oxide​

Answers

Answer:

D)

synthetic organic compounds

Explanation:

synthetic organic compounds are water pollutants


17. When you hold a soda can in your hand, you possess trillions and trillions of aluminum atoms. In one paragraph, using
your own words, explain how ions of aluminum atoms would generally interact based on their charges, and how that
interaction is overcome through metallic bonding to form the can that you hold.
PLEASE PUT REAL ANSWER OR I WILL REPORT YOU
MARKING BRAINLYEST TO FIRST PERSON

Answers

In the early 1900's, Paul Drüde came up with the "sea of electrons" metallic bonding theory by modeling metals as a mixture of atomic cores (atomic cores = positive nuclei + inner shell of electrons) and valence electrons. Metallic bonds occur among metal atoms. Whereas ionic bonds join metals to non-metals, metallic bonding joins a bulk of metal atoms. A sheet of aluminum foil and a copper wire are both places where you can see metallic bonding in action.

Metals tend to have high melting points and boiling points suggesting strong bonds between the atoms. Even a soft metal like sodium (melting point 97.8°C) melts at a considerably higher temperature than the element (neon) which precedes it in the Periodic Table. Sodium has the electronic structure 1s22s22p63s1. When sodium atoms come together, the electron in the 3s atomic orbital of one sodium atom shares space with the corresponding electron on a neighboring atom to form a molecular orbital - in much the same sort of way that a covalent bond is formed.

The difference, however, is that each sodium atom is being touched by eight other sodium atoms - and the sharing occurs between the central atom and the 3s orbitals on all of the eight other atoms. Each of these eight is in turn being touched by eight sodium atoms, which in turn are touched by eight atoms - and so on and so on, until you have taken in all the atoms in that lump of sodium. All of the 3s orbitals on all of the atoms overlap to give a vast number of molecular orbitals that extend over the whole piece of metal. There have to be huge numbers of molecular orbitals, of course, because any orbital can only hold two electrons.

The electrons can move freely within these molecular orbitals, and so each electron becomes detached from its parent atom. The electrons are said to be delocalized. The metal is held together by the strong forces of attraction between the positive nuclei and the delocalized electrons Hope this helped

How many particles are in a 34 g sample of Al2(SO4)3?
please help!

Answers

Answer:

5.98 × 10^22 particles

Explanation:

To get the number of particles (nA) in a substance, we multiply the number of moles of the substance by Avogadro's number (6.02 × 10^23)

The mass of Al2(SO4)3 given in this question is as follows: 34grams.

To convert this mass value to moles, we use;

Mole = mass/molar mass

Molar Mass of Al2(SO4)3 = 27(2) + {(32 + 16(4) }3

= 54 + (32 + 64)3

= 54 + 288

= 342g/mol

mole (n) = 34/342

n = 0.0994mol

number of particles (nA) of Al2(SO4)3 = 0.0994 × 6.02 × 10^23

= 0.598 × 10^23

= 5.98 × 10^22 particles

Select the correct answer.
John is riding a ski lift to the top of Wildcat Mountain. He removes his gloves and rapidly rubs his hands together to warm them up. What
happens when John rubs his hands?
O A. The skin on his hands rapidly conducts heat, similar to metal.
O B. He traps heat between his hands because skin is an insulator. IS
O C. The particles In his hands vibrate faster because of friction.
O D. Thermal energy moves from his fingertips to his palms.
O E. He simulates a fever that'll raise his core body temperature.

Answers

Answer:

Fairly certain it's C. The particles In his hands vibrate faster because of friction :)

Answer:

C

Explanation:

Y’all Someone plz help me with these problems.

Girl I will report if u troll or link

Answers

Answer:

A. 650 moles of sulphur.

B. 30 g of FeS₂

Explanation:

The balanced equation for the reaction is given below:

Fe + 2S —> FeS₂

From the balanced equation above,

1 mole of Fe reacted with 2 moles of S to produce 1 mole of FeS₂.

A. Determination of the mole of sulphur needed for the reaction.

From the balanced equation above,

2 moles of S reacted to produce 1 mole of FeS₂.

Therefore, Xmol of S will react to produce 325 moles of FeS₂ i.e

Xmol of S = 2 × 325

Xmol of S = 650 moles

Thus, 650 moles of sulphur are needed for the reaction.

B. Determination of the mass of FeS₂ produced by the reaction of 0.5 mole of sulphur.

From the balanced equation above,

2 moles of S reacted to produce 1 mole of FeS₂.

Therefore, 0.5 mole of S will react to produce = (0.5 × 1)/2 = 0.25 mole of FeS₂.

Finally, we shall determine the mass of 0.25 mole of FeS₂. This can be obtained as follow:

Mole of FeS₂ = 0.25 mole

Molar mass of FeS₂ = 56 + (32×2)

= 56 + 64

= 120 g/mol

Mass of FeS₂ =?

Mass = mole × molar mass

Mass of FeS₂ = 0.25 × 120

Mass of FeS₂ = 30 g

Thus, 30 g of FeS₂ were obtained from the reaction.

Other Questions
True or false. A president can get rid of a Congressman if he does not like him or her. 1. Which functional group is found in an ester? (1 point) Where has the ebola virus infected humans?1. Throughout the world2. Africa, Italy, and the Philippines3. Africa and the United States4. Only Africa HELPPPPPP I NEED THIS DONE BY TODAY!!!! Which side of the brain do you think is the most dominant - the right or the left? Why Consumers know that some fraction x of all new cars produced and sold in the market are defective. The defective ones cannot be identified except by those who own them. Cars do not depreciate with use. Consumers are risk-neutral and value nondefective cars at $10,000 each. New cars sell for $5,000 and used ones for $2,500. What is the fraction x What are the steps you would take to find the area of the shaded region? Check all that apply. What is the circumference of the circle with a radius of 3.22 Round to the nearest tenth. Why did the Allies want to attack the Ottoman Empire at the Dardanelles? What countries fought in the Gallipoli campaign? How many casualties did each country suffer? 2. P337. 23. A large box contains 10,000 ball bearings. A random sample of 120 is chosen. The sample mean diameter is 10 mm, and the standard deviation is 0.24 mm. True or false: (a) A 95% con dence interval for the mean diameter of the 120 bearings in the sample is 1 ???? (1:96)(0:24)= p 120. (b) A 95% con dence interval for the mean diameter of the 10,000 bearings in the sample is 1 ???? (1:96)(0:24)= p 120. (c) A 95% con dence interval for the mean diameter of the 10,000 bearings in the sample is 1 ???? (1:96)(0:24)= p 10; 000. Given that -5 < -3, which statement is not true?-5 is to the left of -3 on the number line.-3 is to the right of -5 on the number line.-3 > -5-3 is less than -5, she has not been teaching English now Correct the following standard Help! Quick! Find the area of the composite figure PLEASE HELP! SPANISH!Choose the correct answer to fill in the blanks.1. A Marco y Juan _____ los brazos.a. les duelenb. le duelec. les dueled. te duelen What circumstances, attitudes, and events led to war in Europe in 1914? Ms. Sanchez has $200 to spend on parking and admission to a museum. The parking will cost $10 and admission tickets cost $15.50 per person, including tax. Write and solve an equation that can be used to determine the number of people that she can bring to the museum, including herself. 1. When the quantity supplied is larger than the quantity demanded.: When the quantity supplied is larger than the quantity demanded. 2. The quantity that is supplied and demanded at the equilibrium price.: The quantity that is supplied and demanded at the equilibrium price. 3. The point at which the quantity supplied equals the quantity demanded.: The point at which the quantity supplied equals the quantity demanded. 4. The price that equates the quantity supplied with the quantity demanded.: The price that equates the quantity supplied with the quantity demanded. 5. When the quantity demanded is larger than the quantity supplied.: When the quantity demanded is larger than the quantity supplied. Column B a.Equilibrium Price b.Excess Supply c.Equilibrium d.Excess Demand e.Equilibrium Quantity I will give brainleist pls how did Pony boy locate himself to jay mountain Which of the following best describes Americans before the founding of Earth Day? Steam Workshop Downloader