What is the Lewis structure for Iodide?

Answers

Answer 1

Answer:

In the Lewis structure for IF5 you'll need to put a total of 12 valence electrons on the Iodine atom in order to draw the Lewis structure. Remember that Iodine (I) can hold more than eight valence electrons. For the IF5 Lewis structure, calculate the total number of valence electrons for the IF5 molecule

Explanation:

I be knowing hope this helps


Related Questions

Describe the S-wave shadow effect of earth quakes.

Answers

Answer: The shadow zone is the area of the earth from angular distances of 104 to 140 degrees from a given earthquake that does not receive any direct P waves. The shadow zone results from S waves being stopped entirely by the liquid core and P waves being bent (refracted) by the liquid core.

Explanation: 104 to 140 degrees from a given earthquake

Look at the diagram below. What type of bond does it show?

Answers

Explanation:

it shows covalent bonds

The type of bond the diagram shows is covalent bond. As shown the sharing of electrons in the diagram.

What are bonds?

Bonds are defined as any of the interactions that lead to atoms joining together to form molecules, ions, crystals, and other stable species that make up the familiar materials found in everyday life. The ability to build molecules is made possible by a chemical bond, which is a strong attraction between atoms, ions, or molecules. Chemical bonds that hold molecules together also form temporary connections vital for life.

Covalent bond are defined as a type of chemical link where atoms share electrons to create electron pairs. Low melting and boiling temperatures, low vaporization heat, low water solubility, and poor conductivity are four characteristics of covalent compounds.

Thus, the type of bond the diagram shows is covalent bond. As shown the sharing of electrons in the diagram.

To learn more about bonds, refer to the link below:

https://brainly.com/question/13559044

#SPJ2

50 points for anyone who answeres properly. How does a structure of a triglyceride differ from the reaction of fructose?

Triglycerides and fructose are both monomers, but they differ in how they bond to other monomers.

Fructose forms large polymers by the process of hydrolysis, while a triglyceride forms monomers by the process of dehydration.

Fructose is a form of carbohydrate, while a triglyceride is a lipid.

A triglyceride is a polymer, while fructose is a monomer.

Answers

Answer:

Fatty Acids

A lipid is an organic compound such as fat or oil. Organisms use lipids to store energy, but lipids have other important roles as well. Lipids consist of repeating units called fatty acids. Fatty acids are organic compounds that have the general formula CH3(CH2)nCOOH" role="presentation" style="display: inline-table; font-style: normal; font-weight: normal; line-height: normal; font-size: 17.6px; text-indent: 0px; text-align: left; text-transform: none; letter-spacing: normal; word-spacing: normal; overflow-wrap: normal; white-space: nowrap; float: none; direction: ltr; max-width: none; max-height: none; min-width: 0px; min-height: 0px; border: 0px; padding: 0px; margin: 0px; position: relative;">CH3(CH2)nCOOHCH3(CH2)nCOOH, where n" role="presentation" style="display: inline-table; font-style: normal; font-weight: normal; line-height: normal; font-size: 17.6px; text-indent: 0px; text-align: left; text-transform: none; letter-spacing: normal; word-spacing: normal; overflow-wrap: normal; white-space: nowrap; float: none; direction: ltr; max-width: none; max-height: none; min-width: 0px; min-height: 0px; border: 0px; padding: 0px; margin: 0px; position: relative;">nn usually ranges from 2 to 28 and is always an even number. There are two types of fatty acids: saturated fatty acids and unsaturated fatty acids.

Saturated Fatty Acids

In saturated fatty acids, carbon atoms are bonded to as many hydrogen atoms as possible. This causes the molecules to form straight chains, as shown in the figure below. The straight chains can be packed together very tightly, allowing them to store energy in a compact form. This explains why saturated fatty acids are solids at room temperature. Animals use saturated fatty acids to store energy.

Figure 14.2.1" role="presentation" style="display: inline-table; font-style: normal; font-weight: normal; line-height: normal; font-size: 16px; text-indent: 0px; text-align: left; text-transform: none; letter-spacing: normal; word-spacing: normal; overflow-wrap: normal; white-space: nowrap; float: none; direction: ltr; max-width: none; max-height: none; min-width: 0px; min-height: 0px; border: 0px; padding: 0px; margin: 0px; position: relative;">14.2.114.2.1: Structures of saturated and unsaturated fatty acids.

Unsaturated Fatty Acids

In unsaturated fatty acids, some carbon atoms are not bonded to as many hydrogen atoms as possible due to the presence of one or more double bonds in the carbon chain. Instead, they are bonded to other groups of atoms. Wherever carbon binds with these other groups of atoms, it causes chains to bend (see figure above). The bent chains cannot be packed together very tightly, so unsaturated fatty acids are liquids at room temperature. Plants use unsaturated fatty acids to store energy.

Figure 14.2.2" role="presentation" style="display: inline-table; font-style: normal; font-weight: normal; line-height: normal; font-size: 16px; text-indent: 0px; text-align: left; text-transform: none; letter-spacing: normal; word-spacing: normal; overflow-wrap: normal; white-space: nowrap; float: none; direction: ltr; max-width: none; max-height: none; min-width: 0px; min-height: 0px; border: 0px; padding: 0px; margin: 0px; position: relative;">14.2.214.2.2: Saturated fatty acids have only single bonds while monounsaturated fats have one double bond and polyunsaturated fats have more than one double bond.

Lipids and Diet

Unsaturated fat is generally considered to be healthier because it contains fewer calories than an equivalent amount of saturated fat. Additionally, high consumption of saturated fats is linked to an increased risk of cardiovascular disease. Some examples of foods with high concentrations of saturated fats include butter, cheese, lard, and some fatty meats. Foods with higher concentrations of unsaturated fats include nuts, avocado, and vegetable oils such as canola oil and olive oil.

Fructose is a simple carbohydrate sugar, while triglycerides are the lipids or the fats of the body. Thus, option C is accurate.

What are triglycerides and fructose?

Triglycerides are lipids of the body that are formed of fatty acids and glycerols. It makes the body fat of the animals and of the plants. They are stored in cells for future use and provide energy when needed.

Fructose is a monomer that is the simplest carbohydrate sugar and is generally found in sugarcane, honey, watermelon, grapes, apples, etc.

Therefore, option C. fructose is sugar and triglyceride is fat is correct.

Learn more about triglycerides and fats here:

https://brainly.com/question/17576593

#SPJ2


4. A photon has an energy of 2.93x10^-25 Jouls. What is the
frequency? What is the wavelength in nm?

Answers

Answer:

Hope this answer helps

Explanation:

question: the diagram below shows the major parts of the digestive system.
what part of the digestive system is labeled by the number 1?
A.
small intestine
B.
esophagus
C.
stomach
D.
mouth

Answers

D . mouth bc the esophagus is like the throat

Answer:

I got it Right in Study Island

Explanation:

Given that the molar mass of NaCl is 58. 44 g/mol, what is the molarity of a solution that contains 87. 75 g of NaCl in 500. ML of solution? Use Molarity equals StartFraction moles of solute over liters of solution EndFraction. 0. 333 M 0. 751 M 1. 50 M 3. 00 M.

Answers

Answer:

D

Explanation:

Given that the molar mass of NaCl is 58.44 g/mol, we want to determine the molarity of a solution that contains 87.75 g of NaCl in 500. mL of solution.

Recall that molarity is given by:

[tex]\displaystyle \text{M} = \frac{\text{ mols solute}}{\text{ liters soln.}}[/tex]

Therefore, we can convert the amount of NaCl in the solution to moles of NaCl and the volume from milliliters to liters:

[tex]\displaystyle \begin{aligned} \text{M} & = \frac{(87.75 \text{ g NaCl})}{(500. \text{ mL soln.})} \cdot \frac{1 \text{ mol NaCl}}{58.44 \text{ g NaCl}} \cdot \frac{1000 \text{ mL soln.}}{1 \text{ L soln.}} \\ \\ & = 3.00\text{ } \frac{\text{mol NaCl}}{\text{ L soln.}} \\ \\ & = 3.00 \text{ M} \end{aligned}[/tex]

Hence, our answer is D.

mass of 0.5 moles of co2

Answers

Answer:

Mass of 0.5 moles of CO2 is 22 gm.

Explanation:

1 mole of CO2 = 44 gm

0.5 mole of CO2 = 0.5 × 44 = 22 gm

I hope you can see because I really need help! I’ll give you 5 stars!

Answers

Answer:

In the picture A kettle is boiling water and evaporating it we can see the water vapours coming out of the kettle and there is a paper on top of the kettle from where the water vapours are coming out .

Explanation:

is this right ?? i hope it helps

what are the products of any combustion reaction involving a hydrocarbon

Answers

Answer:

The products of the combustion of hydrocarbons are carbon dioxide and water. Many hydrocarbons are used as fuel because their combustion releases very large amounts of heat energy.

Answer:

The products of the combustion of hydrocarbons are carbon dioxide and water. Many hydrocarbons are used as fuel because their combustion releases very large amounts of heat energy.

Explanation:

True or false? In giant covalent structures the atoms form strong bonds by sharing electrons.

Answers

Answer:

True

Explanation:

its true don't lie on here please

In giant covalent structures such as graphite or diamond, the atoms form strong bonds by sharing electrons. Therefore, the given statement is true.

What is a covalent bond?

A covalent bond can be defined as a chemical connection formed by the sharing of electron sets between particles. A covalent bond can be created by the mutual sharing of electrons from both atoms.

The pair of electrons that are shared in this kind of bonding is known as the shared or bonding pair. Covalent bonds are the sharing of bonding pairs of electrons that will provide the stability of the atom in its outer shell.

Elements that have very high ionization energies are incapable of exchanging electrons or elements having low electron affinity cannot accept electrons. Covalent bonding between two non-metallic atoms is characterized by the equal sharing of electrons between the atoms and covalent bonds with an electronegativity difference of participating atoms is more than 2.0.

Therefore, a giant structure like a diamond has strong covalent bonds that require a lot of energy to break.

Learn more about covalent bond, here:

brainly.com/question/10777799

#SPJ2

hydrogen ions ________ acidity of the water which is a key point.

Answers

Answer:

Raise

Explanation:

H+ ions are acidic and lower the PH of water.

Which of the following best describes a balanced reaction?
A) A reaction that has the sam number and type of atoms on each side of the equation
B) A reaction that has the same number of atoms on each side of the equation
C) A reaction that has the and type of atoms on each side of the equation
D) A reaction that has the same number of molecules on each side of the equation

Answers

Answer:

A reaction that has the same number and type of atoms on each side of the equation

Explanation:

A pex

If a car is traveling 100 km/h and comes to a stop in 3 minutes,what is acceleration of a passenger who is using vehicle restraint?

Answers

We are given

Final velocity of car is, v= 0 Initial velocity of car is, u= 100 km/hr Time taken, t is = 3 minutes or 180 sec

Here

[tex]\qquad[/tex][tex] \pink{\bf \longrightarrow Initial\: velocity = 100 \:km/hr}[/tex]

[tex]\qquad[/tex][tex] \sf \longrightarrow Initial\: velocity = \dfrac{ 100 \times 1000}{3600} \:m/s[/tex]

[tex]\qquad[/tex][tex]\pink{ \bf \longrightarrow Initial\: velocity = 27.78\: m/s} [/tex]

Now –

[tex]\qquad[/tex]____________________________

[tex]\qquad[/tex][tex] \purple{\bf \longrightarrow Acceleration = \dfrac{Final\: Velocity -Initial \:Velocity }{Time}}[/tex]

[tex]\qquad[/tex][tex] \purple{\bf \longrightarrow Acceleration = \dfrac{v -u}{t}}[/tex]

[tex]\qquad[/tex][tex] \sf \longrightarrow Acceleration = \dfrac{(0- 27.78)}{1800}[/tex]

[tex]\qquad[/tex][tex] \sf \longrightarrow Acceleration =\cancel{ \dfrac{- 27.78}{1800}}[/tex]

[tex]\qquad[/tex][tex] \purple{\bf \longrightarrow Acceleration = -0.015 \: m/s^2} [/tex]

[tex]\qquad[/tex]_______________________________

Calculate the following. Be sure to follow significant figure rules.

1.) 1.2 m + 2.35 m =

Answers

1.2 + 2.35 = 3.6m (2sf)

Ignore me I dont know what im doing.

4
Which statement about an ionic compound is not correct?
A It conducts electricity when dissolved in water.
B It has a high melting point due to strong attractive forces between ions.
с It has a regular lattice of oppositely charged ions in a 'sea of electrons'.
D The ionic bonds are formed between metallic and non-metallic elements.

Answers

Answer:

it conducts electricity when dissolved in water

Explanation:

the water molecules bond to positive and negative ions results to breaking of lattice and it's fixed position broken

Pls help if you only know the correct answer! Thanks! :)

Answers

Answer:

i think itd be an  exothermic reaction

Explanation:

An exothermic process releases heat, causing the temperature of the immediate surroundings to rise.

It takes 25 mL of 0.20 M of hydrochloric acid (HCI) to neutralize 50 mL of
sodium hydroxide (NaOH). What is the concentration of sodium
hydroxide?

Answers

Answer:

0.1 M

Explanation:

(25 mL) (0.20 M) / 50 mL = 0.1 M

What do you think will happen to the Sun when all the hydrogen in it fuses to become helium?

Answers

Answer: In the core of the Sun hydrogen is being converted into helium. This is called nuclear fusion. It takes four hydrogen atoms to fuse into each helium atom. During the process some of the mass is converted into energy.

PLEASE PEOPLE I NEED HELP PLEASE IF YOU SEE THIS HELP ME ! :,( !!!!! PLEASEEEEEEEEE


PLEASE NO LINKSSS !!!!! HELP ME THIS ITS FOR HOMEWORK PLEASE HELPP!

Answers

Answer:

year 1 is 5.5%

year 2 is 7.5%

year 3 is 10.2%

Explanation:

since,

length of the transect covered in seaweed / total lenth of transect x 100

then,

0.55 / 10.0 x 100 = 5.5

and

0.75 / 10.0 x 100 = 7.5

and

1.02 / 10.0 x 100 = 10.2

you could also just move the decimal to the right once

:)

Vinegar is an acid. Based on
what you know about the
properties of acids and bases,
which would you expect from
vinegar?
A. It should feel slippery.
B. It will release OH-in water.
C. It will release H+ in water.

Answers

Answer:

C

Explanation:

Acids contain H plus ions. When within a solution or neutralised these ions are released.

The substance which gives H+ ion are called as acid. Vinegar is an acid because it will release H+ in water. Therefore, option C is correct.

What is vinegar ?

Acetic acid and water are combined to create vinegar through a two-step fermentation process. First, yeast consume any liquid derived from a plant source, such as fruits, whole grains, potatoes, or rice, and feed on the sugar or starch therein. It ferments into alcohol.

White vinegar typically contains 93–96% water and 4-7% acetic acid. It can be used to cook, bake, clean, and control weeds. It may also help with weight loss and decrease cholesterol and blood sugar levels.

The sugar is converted to ethanol (ethyl alcohol) by yeast and bacteria in a two-step fermentation process, which is followed by the production of acetic acid. Vinegar is acidic because it contains acetic acid.

Thus, option C is correct.

To learn more about vinegar, follow the link;

https://brainly.com/question/4239583

#SPJ2

Lead has an atomic number of 82. Which statement describes all neutral atoms and ions of lead?
Neutral atoms of lead must have 82 electrons. Ions must have 82 electrons, as well.

Neutral atoms of lead must have 82 neutrons, but ions can have more or fewer.

Neutral atoms of lead must have 82 protons. Ions must have 82 protons, as well.

Neutral atoms of lead must have 82 protons, but ions can have more or fewer.

Answers

The neutral atom of lead must have 82 protons while ions can have b or less than 82.

The atomic number of an element is the number of protons in the nucleus of the element.

Also, for neutral atoms, the number of protons equals the number of electrons.

In ionic form, the number of protons/electrons of an atom may vary and be different from that of the neutral form.

Positive charges mean that the ion has less proton than its neutral version while negative charges mean that it has more electrons than its neutral version.

Thus, the neutral atom of lead will contain an equal number of protons as the electrons while its ionic form can have more or less than 82 protons.

More on atoms can be found here: https://brainly.com/question/803445?referrer=searchResults

what is an observation?​

Answers

Answer:

the act of watching somebody/something carefully, especially to learn something

Explanation:

hope this helps you!

Answer:

hope this helps

Explanation:

noun

noun1.

noun1.the act of watching somebody/something carefully, especially to learn something

Please help !!!!!!!!

1) Write the equation for the reaction between the hydrocarbon and bromine using fully displayed formulae for the hydrocarbon and the organic product.

2) The reaction between methane and bromine gas in the presence of UV light also causes the bromine to lose color.

(a) Write an equation for this reaction

(b) This reaction is described as a substitution reaction. whereas the reaction between X and bromine is an addition reaction. Using the equations you have already written , explain the difference between addition and substitution

Answers

1) CH2 (gas) + Br (solid) -> BrC (solid) + H2 (gas)
2) a) CH4 + Br2 -> CH3Br + HBr
2) b) methane + bromine is substitution because one hydrogen atom from methane is replaced by one bromine atom. addition reaction takes place when one molecule combines with another to form a larger molecule so therefore a molecule from X and bromine combine to form XBr.

what is the relationship between electron affinity and atomic radius? why do you think this relationship occurs?

Answers

Electron affinity increases from left to right within a period. This is caused by the decrease in atomic radius. Electron affinity decreases from top to bottom within a group. This is caused by the increase in atomic radius.

give explanation ~~

Why are cloudy nights warmer than clear nights?​

Answers

Clouds are a source of Infrared Radiation. When cloud coverage increases, the infrared radiation also increases. So the clouds basically act as space heaters. This emits energy towards the ground, which is what makes cloudy nights warmer. While with clear sky’s all the heat from the day just escapes back into the atmosphere so the temperatures will be colder.

4. Which of the following statements accurately compares the wavelengths of the waves shown below?

A) wave 1 has a smaller wavelength than wave 2

B) wave 1 has a larger wavelength than wave 2

C) wave 2 has a larger wavelength than wave 1

D) wave 1 and wave 2 have the same wavelength

Answers

Answer:

B. wave 1 has a larger wavelength than wave 2

Wave 1 has larger wavelength than wave 2. Hence, option B is correct.

What is Wavelength?

Wavelength is defined as "the difference between two successive crests and troughs of the wave. The wavelength described the how long wave is. It is measure in the direction of wave.

Wavelength is usually denoted by the Greek letter ( λ ).

Wavelength is equal to the speed ( V ) of wave train to divided by frequency ( F ). It is given as,

λ = V ÷ F

Here,

λ = wavelength

V = speed

F = frequency

The distance between one crests (top) to another crests is a Wavelength. Alternately the distance between one troughs (bottom) to another troughs is wavelength.

The distance between two  crests in wave 1  is more comparatively wave 2 so , wave 1 will have larger wavelength than wave 2.

Therefore, wavelength is used for measuring the radiation.

To learn more about wavelength follow the link;

https://brainly.com/question/12924624

#SPJ2

in three to five sentences, predict the bonding activity between phosphorus and chlorine. why do you think they would bond that way?​

Answers

The bonding activity that occurs between phosphorus and chlorine is Covalent Bonding

Covalent bonding is an interaction between two atomic elements that share electrons between themselves.

In Phosphorus Pentachlorine PCl₅, covalent bonding occurs between Phosphorus and Chlorine.

This is because, Phosphorus is the central atom that is attached to 5 different chlorine atoms, each chlorine atom needs one electron each to complete its octet rule and since phosphorus has five valence electrons in its outermost shell, it shares it with each of the chlorine atoms.

Learn more about covalent bonding here:

https://brainly.com/question/1853488

Answer:

Covalent Bonding

What is the enthalpy of combustion when 1 mol C6H6(g) completely reacts with oxygen? 2C6H6(g) 15O2(g) mc001-1. Jpg 12CO2(g) 6H2O(g) â€""6339 kJ/mol â€""3169 kJ/mol 1268 kJ/mol 6339 KJ/mol.

Answers

The enthalpy of combustion of 1 mole of benzene is 3169 kJ/mol .

The first step in answering this question is to obtain the balanced thermochemical equation of the reaction. The thermochemical equation shows the amount of heat lost or gained.

The thermochemical equation for the combustion of benzene is;

2 C6H6(l) + 15 O2(g) → 12 CO2(g) + 6 H2O(g) ΔrH° = -3169 kJ/mol

We can see that 1 mole of benzene releases about 3169 kJ/mol of heat.

Learn more: https://brainly.com/question/13164491

Answer:

-3169 kJ/mol

Explanation:

How many moles is 2.50 grams of oxygen?

Answers

Answer:

Mole is a number that connects mass of a substance with its number of particles. 2500 g of O2 = 1/32 x 2500 = 78.125 moles

Explanation:

have a great day

Which statement about the Periodic Table is correct?
A Elements are arranged in order of decreasing proton number.
B Group number is the number of electron shells in atoms of the elements in the group.
C Group numbers can be used to predict the charges of ions.
D Metallic character increases left to right across a period.

Answers

answer :c

explanation :

group numbers can be used to determine the number of electrons in the outer most shell thus if the group numbers are above four then the elemnts are negative ions if less than four then posetive

Other Questions
algebra 1F(x) passes through 0, -1 and 5 , 14G(x) passes through -6 , -1 and -1, 14Describe two types of transformations that can be used to transform f(x) to g(x)Solve for k in each type of transformation.Write an equation for each type of transformation that can be used to transform f(x) to g(x). Which inequality represents all the solutions of 8(6x 7) < 5(9x 4)? Just gonna attach a picture of the problem so its easier Ryan and Caiden both bought roses from the market. If Ryan paid $174.93 for 7 dozen roses, how much did Caiden pay for 4 dozen roses? Will give the crown thing DOES ANYONE KNOW PLEASE HELP ! a toy rocket is launched from the top of a 48 foot hill. the rockets initial upward velocity is 32 feet per second and its height (h) at any given second (t) is modeled by the equation : h= -16t^2 + 32t +48. Find the highest point the rocket reaches. show your work Label the following topographic map. Click on a label below the map to select it, and then click on the appropriate box on the map to place the label.Gentle slopedepression600 feet950 feetriver is flowing SEriver is flowing NW Can someone help me please? The following are the ages of 13 mathematics teachers in a school district.29, 30, 32, 38, 39, 43, 43, 44, 45, 46, 46, 57, 60Notice that the ages are ordered from least to greatest.Give the five-number summary and the interquartile range for the data set.Five-number summaryMinimum:aLower quartile:Median:0Upper quartile:Maximum:Interquartile range: The sporting goods store with 30% off all items . If a skateboard is normally $70 , what would be the approximate sale price of the skateboard The first four terms of a sequence are shown below: 9, 5, 1, 3 Which of the following functions best defines this sequence? f(1) = 9, f(n 1) = f(n) 4; for n 1 f(1) = 9, f(n 1) = f(n) 4; for n 1 f(1) = 9, f(n 1) = f(n) 5; for n 1 f(1) = 9, f(n 1) = f(n) 5; for n 1. The three nuclides, U-233, U-235, and U-238, are isotopes of uranium because they have the same number of protons per atom and QRS is similar to XYZ.of QR=5,QS=7,and XY=30 find the value of XZ Question in picture Florida's history during the late 1800s was most affected by U.S. foreignrelations with which country?BrazilGreat BritainMexicoSpainYo Porqu Antonio no se va a trabajar a la hora hoy? Look at the examples in highlighted text in the passage. Which one supports the theme Of knightly virtue? BRAINLIEST TO CORRECT question for companion how long does better than bouillon last after opening A movie theater charges $9.75 per ticket. Monday through Thursday they make on average $2720.25 daily. How manycustomers do they have on an average Tuesday?a. 279 customersc. 70 customersb. 272 customersD. 26552 customers