Answer:
FALSE
Explanation:
as the moon orbits earth, the ABSOLUTE position of the moon, earth, and the sun change. the moons orbit around earth is ABSOLUTELY STRAIGHT with respect to earths orbit around the sun. the amount of the moon's surface that is lit by the sun changes.Your friend phred says ""i decided to make one of those online personality tests as a project in my psychology class. how hard can it be?"" part a: explain whether or not phred should use the following personality theories as a basis for his online personality test. • psychoanalytic perspective• humanistic theory• trait theory
Fredd must use the trait theory for the online personality tests because it is based on distinctive features.
What is the trait theory?The trait theory is a model that states people have certain basic personality traits which are distinctive features.
The trait theory is always based on the strength of these basic human trait characteristics.
The trait theory is based on three types of features capable of being used to describe personality, which include stability, consistency and individual differences.
Learn more about the trait theory here:
https://brainly.com/question/4443909
One square megameter is equal to 1. 0×106 square kilometers. How many square megameters are in 4,000,000 square kilometers?
Answer:
One has 1E6 km^2 / MM
4E6 km^2 / (1E6 km^2/MM) = 4 MM or 4 megameter
In 4000,000 square kilometers, there are 4 square megameters if the one square megameter is equal to 1. 0×106 square kilometers.
What is unit conversion?It is defined as the conversion from one quantity unit to another quantity unit followed by the process of division, and multiplication by a conversion factor.
We have:
One square megameter = [tex]1\times10^6[/tex]
Let's suppose the x square megameters in the 4,000,000 square kilometers
Then x can be found as follows:
[tex]\rm x = \frac{4,000,000}{1\times10^6}[/tex]
x = 4 square megamters
Thus, in 4000,000 square kilometers, there are 4 square megameters if the one square megameter is equal to 1. 0×106 square kilometers.
Learn more about the unit conversion here:
brainly.com/question/14350438
#SPJ4
A brass ring of diameter 10. 00 cm at 14. 3°c is heated and slipped over an aluminum rod of diameter 10. 01 cm at 14. 3°c. Assume the average coefficients of linear expansion are constant
Temperature for combination be cooled to separate the brass ring of diameter 10.00 cm at 14.3°c and an aluminum rod of diameter 10.01 cm at 14.3°c is -204.7° C, which is not attainable.
What is linear expansion?The linear expansion is the expansions of metal when they are heated and their length is changed along one direction.
A brass ring of diameter 10. 00 cm at 14. 3°c is heated and slipped over an aluminum rod of diameter 10. 01 cm at 14. 3°c. Assume the average coefficients of linear expansion are constant
(a) To what temperature must the combination be cooled to separate the two metals?
To find the temperature, use the following formula,
[tex]T=T_o+\dfrac{d_o^A-d_o^B}{\alpha _Ad_o^A-\alpha _Ad_o^B}[/tex]
Put the values,
[tex]T=14.3+\dfrac{10.01-10}{(19\times10^{-6})(10.01)-(24\times10^{-6})(10)}\\T=-204.7^o C[/tex]
Thus, temperature for combination be cooled to separate the brass ring of diameter 10.00 cm at 14.3°c and an aluminum rod of diameter 10.01 cm at 14.3°c is -204.7° C, which is not attainable.
Learn more about the linear expansion here;
https://brainly.com/question/1217769
#SPJ4
2. A spring has a spring constant of 80 N∙m−1. What is the force required to (a) compress the spring by 5 cm and (b) expand the spring by 15 cm?
Please show all your work.
#a
5cm=0.05mForce:-
F=-kxF=-80(0.05)F=-4N#b
15cm=0.15mForce:-
F=-kxF=-80(0.15)F=-12NChoose all the answers that apply.
The United States
launched the first man into space
built the first space station
sent the first animal into space
was the first country to send a person to the moon
successfully landed å spacecraft on the moon
Answer:
launched the first man into space
was the first country to send a person to the moon
successfully landed å spacecraft on the moon
A direct current of 3.0 A flows through a circuit consisting of a battery and a 6.0 A resistor. Calculate the potential difference across the resistor. a
Question :-
A Direct Current of 3.0 A flows through a Circuit consisting of a Battery and a 6.0 Ohm's Resistor. Calculate the Potential Difference across the Resistor .Answer :-
Potential Difference is 18 Volt's .Explanation :-
As per the provided information in the given question, we have been given that the Current of the Device is 3.0 Ampere . The Resistance is given as 6.0 Ohm's . And, we have been asked to calculate the Potential Difference .
As we know ,
V = I RWhere ,
V denotes to Potential DifferenceI denotes to CurrentR denotes to ResistanceTherefore , by Substituting the given values in the above Formula :-
[tex] \sf {\dag \: \: \: Potential \: Difference \: = \: Current \: \times \: Resistance} [/tex]
[tex] \sf {\Longrightarrow \: \: \: \sf Potential \: Difference \: = \: 3.0 \: \times \: 6.0} [/tex]
[tex] \sf {\Longrightarrow \: \: \: \sf Potential \: Difference \: = \: 3 \: \times \: 6} [/tex]
[tex] \bf {\Longrightarrow \: \: \: \bf {Potential \: Difference \: = \: 18 \: }} [/tex]
Hence :-
Potential Difference = 18 Volt's .[tex] \underline {\rule {210pt}{4pt}} [/tex]
Additional Information :-
[tex] \Longrightarrow \: \: \: \sf {Voltage \: = \: Current \: \times \: Resistance} [/tex]
[tex]\Longrightarrow \: \: \: \sf {Current \: = \: \dfrac {Voltage}{Resistance} } [/tex]
[tex]\Longrightarrow \: \: \: \sf {Resistance \: = \: \dfrac {Voltage}{Current} } [/tex]
[tex] \underline {\rule {210pt}{4pt}} [/tex]
Note :-
Kindly Scroll the Screen from Right to Left for Better View .why is an iceberg more dense than a ship?
Answer:
icebergs float on water because ice is less dense than water. The same is true for a boat: a boat floats on water because, overall, it is less dense than the water.
Explanation:
You are riding your bike downtown at a speed of 15 m/s and you see
a red light ahead. You gently brake over a distance of 50 m and come
to a complete stop. What is your acceleration during this time?
The acceleration of the rider initially going at a speed of 15m/s but comes to a stop at 50m is 2.25m/s².
How to calculate acceleration?The acceleration of a moving body can be calculated by using the following formula:
v² = u² + 2as
Where;
v = final speed u = initial speeda = accelerations = distance15² = 0² + 2×a×50
225 = 0 + 100a
a = 225/100
a = 2.25m/s²
Therefore, the acceleration of the rider initially going at a speed of 15m/s but comes to a stop at 50m is 2.25m/s².
Learn more about acceleration at: https://brainly.com/question/12134554
A plot of the maxwell distribution for the same gas against temperature shows that.
If the barge is made out of 4.8- cm -thick steel plate on each of its four sides and its bottom, what mass of coal can the barge carry in freshwater without sinking
The maximum mass of coal that the barge will carry in freshwater without sinking is 0.111 kg.
Volume of the bargeThe volume of the barge is calculated as follows;
V = L³
V = (4.8 cm)³
V = 110.6 cm³
Density of the bargeFor the barge to float in freshwater, its density must be less or equal to density of water.
density(barge) = density(water)
density(barge) = 1 g/cm³
Maximum mass to be carried by the barge without sinkingmass = density x volume
mass = 1 g/cm³ x 110.6 cm³
mass = 110.6 g
mass = 0.111 kg
Thus, the maximum mass of coal that the barge will carry in freshwater without sinking is 0.111 kg.
Learn more about density here: https://brainly.com/question/6838128
Plsss help with this, will give brainliest!!!
Answer:
c
True
True
False
True
**
metals, non-metal, high, lower
Explanation:
A current of 5. 0 amperes is passing through a piece of wire. Determine how long it takes for 30 coulombs of charge to pass through this wire
The time taken for the charge to pass through the cross-section of the wire is 6.0s.
Given the data in the question;
Current; [tex]I = 5.0A[/tex]
Charge; [tex]Q = 30C[/tex]
Time; [tex]t = \ ?[/tex]
CurrentCurrent is simply the rate of flow of charged particles i.e electrons caused by EMF or voltage.
If a charge passes through the cross-section of a conductor in a given time, the current I is expressed as;
[tex]I = \frac{Q}{t}[/tex]
Where Q is the charge and t is time elapsed.
We substitute our given values into the expression above to determine the time it took the charge to pass through this wire.
[tex]I = \frac{Q}{t}\\ \\5.0A = \frac{30C}{t} \\\\t = \frac{30C}{5.0A} \\\\t = 6.0s[/tex]
Therefore, the time taken for the charge to pass through the cross-section of the wire is 6.0s.
Learn more about current: https://brainly.com/question/3192435
The time taken by 30 coulombs of charge to pass through this wire is 6 seconds.
What is current?The pace at which electrons flow past a point in an electrical circuit is referred to as current.
Current is the ratio of charge and time. Given that the current is equal to 5.0 Amp, while the charge is equal to 30C. Therefore, the time will be equal to,
[tex]I=\dfrac{Q}{t}\\\\5 =\dfrac{30}{t}\\\\t = 6\rm\ sec[/tex]
Hence, the time taken by 30 coulombs of charge to pass through this wire is 6 seconds.
Learn more about Current:
https://brainly.com/question/13076734
#SPJ4
An atom or ion has the abbreviated electron configuration [kr]. Select the species that it could not be
An atom or ion which does not have the same electronic configuration as the species [kr] is K+
The complete question is given below:
An atom or ion has the abbreviated electron configuration (Kr). Select the species that it could not A. Br" B. K+ C. Sr24 D. Rbt E. Se-
What is an atom?An atom can be defined as the smallest particle of an element which can take part in a chemical reaction.
Some elements are
Monoatomic; eg: CDiatomic; eg: O2Triatomic and othersPolyatomicSo therefore, an atom or ion which does not have the same electronic configuration as the species [kr] is K+
Learn more about atoms or ions of elements:
https://brainly.com/question/6258301
The number of electrons in the atom comprised the atomic number and the electronic configuration. The ionic species that lacks the same configuration as Kr is potassium ion.
What is atom?An atom is the smallest unit of the matter with the presence of electrons, protons and neutrons as the subatomic particles. The electrons are present in the orbital and the loss and gain of the electrons adds charge to the atom.
The number of electrons in Kr atom is 36. The number of electrons in the following species is:
[tex]\rm Br^-=36\\Sr^{2+}=36\\K^+=18\\Rb^+=36\\[/tex]
Thus, the atom or ionic species that lacks the same configuration as Kr is potassium ion.
Learn more about atom, here:
https://brainly.com/question/1566330
#SPJ4
What is fission and how is it related to atomic energy
Answer:
Fission is the release of atomic energy related to the splitting of nuclei.
M = M1 + M2 + E where E = m c^2 energy from conversion of mass
if the daughter nuclei are less in total mass than the parent nucleus then the difference is released as atomic energy where E = m c^2 and m is the mass that has been lost in the conversion.
If an electron, moving from east to the west, enters a uniform magnetic field what is the direction of the magnetic field
Answer:
The electron moves undeflected through the field
Sound can't travel through a
Question 4 options:
A. liquid.
B. vacuum.
C. solid.
D. gas.
Answer:
Vacuum
Explanation:
Sound waves can travel through any medium, such as a solid, a liquid, or a gas. However, sound doesn’t travel through a vacuum, which is why sounds can't be heard in outer space.
PF
The following equation illustrates the chemical reaction that occurs in a plant.
water + carbon dioxide + light energy → sugar + oxygen
Based on the law of conservation of energy, what happened to the light energy in the reaction?
A. It was produced by the plant.
B. It was changed into oxygen gas.
C. It was destroyed during the chemical reaction.
D. It was converted into chemical energy stored in the sugar.
Answer:
option d
it was converted into chemical energy stored in the sugar
Answer:
D. It was converted into chemical energy stored in the sugar.
Explanation:
A. It was produced by the plant. This is false because light energy is a reactant and not a product formed by the plant.
B. It was changed into oxygen gas. This is false because light energy could not be transformed to oxygen gas by any chemical means. Instead, carbon dioxide leads to oxygen being produced by the plant.
C. It was destroyed during the chemical reaction. This is false, it cannot be destroyed during the chemical reaction. Instead, it was used up and converted into chemical energy stored in the sugar.
D. It was converted into chemical energy stored in the sugar. This is true.
hope this helps!! p.s. i really need brainliest :)
A body of mass 5kg is ejected vertically from the ground when a force of 600N acts on it for 0.1s.Calculate the velocity with which the body leaves the ground.
1200
Explanation:
F = m x (v / t)
v / t = F / m
v = (F / m) / t
v = (600 / 5) / 0.1
v = 120 / 0.1
v = 1200 m / s
7. An object with a mass of 2.0 kg is accelerated from rest. The above graph shows the magnitude of the net force
as a function of time. At t = 4.0 s the object's velocity is closest to which of the following?
a. 2.0 m/s
b. 4.0 m/s
C. 10 m/s
d. 13 m/s
The object's velocity accelerating from rest from the applied force and time is closest to 4 m/s.
Velocity of the object
The velocity of the object can be determied by applying Newton's second law of motion as shown below;
F = ma
where;
F is the applied forcem is the mass of the objecta is the acceleration of the objectThe acceleration of the object is calculated as follows;
a = F/m
at time, t 4.0 s, the corresponding force = 2 N
a = 2/2
a = 1 m/s²
Velocity of the object is calculated as;
v = u + at
v = 0 + 1 x 4
v = 4 m/s
Thus, the object's velocity accelerating from rest from the applied force and time is closest to 4 m/s.
Learn more about velocity here: https://brainly.com/question/6504879
Complete the mechanism for the given reaction by adding the missing bonds, charges, nonbonding electrons, and curved arrows
The mechanism for the given reaction by adding the missing bonds, charges, nonbonding electrons, and curved arrows is as represented in the attached image.
Mechanism of Organic ReactionsThe representation of an organic reaction mechanism typically includes designation of the overall reaction type (which may be substitution, addition, elimination, oxidation, reduction, or rearrangement), the presence of any reactive intermediates, the nature of the reagent that initiates the reaction, the presence of any catalysis as facilitated by a catalyst, and ultimately it's stereochemistry.
Read more on mechanism of Organic Reactions;
https://brainly.com/question/20067487
The mechanism for the given reaction is depicted in the attached picture by adding missing bonds, charges, nonbonding electrons, and curved arrows.
What is organic reaction mechanisms?The existence of any reactive intermediates, the nature of the reagent that begins the reaction, the presence of any catalysis as helped by a catalyst.
Finally the stereochemistry of an organic reaction mechanism are all included in the depiction of an organic reaction mechanism.
Hence the mechanism for the given reaction is depicted in the attached picture by adding missing bonds, charges, nonbonding electrons, and curved arrows.
To learn more about the organic reaction mechanisms refer to the link;
https://brainly.com/question/3918297
#SPJ4
What is the molarity of 3 moles of nacl in 12 liters of water
Answer:
your mom g
Explanation:
DRACO SEASON WITH THE BOOK BAG
Money functions primarily as a medium of
a unit of
and a store of value.
.
Answer:
buying and selling goods and services. and exchange account
Explanation:
:)
Answer:
when money is used to intermediate the exchange of goods and services
In one to two sentences, describe the relationship between harmonics and resonance frequency in a piano.
Most vibrating things have several resonant frequencies, and musical instruments often vibrate at harmonics of the fundamental frequency. An integer (whole number) multiple of the fundamental frequency is defined as a harmonic.
In a Piano the relation between harmonic and resonance frequency is n_{1} : n_{2} : n_{3} = 1:2:3.
What is harmonic and resonance ?"It is wave having frequency which is multiple integral of the fundamental frequency. The fundamental frequency is called first Harmonic. If a body starts vibration under impact of external vibrational force , is called Resonance. Since a Piano can produce all type of frequencies due to resonance therefore it produces melodious sound. Hence relation between harmonic and resonance frequency is n_{1} : n_{2} : n_{3}= 1:2:3."
Know more about harmonic and resonance here
https://brainly.com/question/3207671
#SPJ2
A bowling ball pushes a pin down. What is the reaction force?
A. The pin pushes back on the bowling ball.
B. The lane pushes back onto the bowling ball
C. The lane pushes back onto the pin
Radio galaxies have twin radio jets that emanate from a central core. An astronomer
finds a radio galaxy whose frequency is 20 MHz. What wavelength of radio waves
does the galaxy emit?
The wavelength of the radio waves emitted by the radio galaxies which have twin radio jets that emanate from a central core is determined as 15 m.
Wavelength of the radio wavesThe wavelength of the radio waves is the distance traveled by the radio waves. The magnitude of the wavelength is determined from the ratio of speed of radio waves to the frequency of the radio waves.
v = fλ
where;
v is the speed of the radio wavesf is the frequency of the radio wavesλ is the wavelength of the radio wavesRadio wave is an example of electromagnetic radiation, and it travels at the same speed as light (3 x 10⁸ m/s).
λ = v/f
λ = (3 x 10⁸ ) / (20 x 10⁶)
λ = 15 m
Thus, the wavelength of the radio waves emitted by the galaxy is 15 m.
Learn more about wavelength here: https://brainly.com/question/10728818
A solid cylinder with diameter 20cm has an angular velocity of 10m/s and angular momentum of 2kgm^2/s. What is its mass?
Hi there!
Recall the equation for angular momentum:
[tex]L = I\omega[/tex]
L = Angular momentum (kgm²/s)
I = Moment of Inertia (kgm²)
ω = angular velocity (rad/s)
We know that the Moment of Inertia of a solid cylinder is equivalent to:
[tex]I = \frac{1}{2}MR^2[/tex]
M = mass (kg)
R = radius (m)
Plug in the givens to solve for the moment of inertia. Remember to divide the diameter by 2 for the radius, and to convert to meters.
[tex]r = \frac{d}{2} = 20/2 = 10 cm \\\\10 cm = 0.1 m[/tex]
[tex]I = \frac{1}{2}M(0.1^2) = 0.005 M[/tex]
We can rearrange the equation of angular momentum to solve for mass.
[tex]L = 0.005M * \omega\\\\\frac{L}{0.005 \omega} = M \\\\M = \frac{2}{0.005(10)} = \boxed{ 40 kg}[/tex]
how do greenhouse gases affect global temperatures
Answer:
Less heat radiates into space, and Earth is warmer
please solve this as fast as you can
B
The combustion of the fuel in the helicopter is chemical energy. The vertical change in height is the result of kinetic energy. Because the helicopter is hovering in the air, it has gravitational potential.
Answer:
this would be B friend :)
Explanation:
Which of the following is an example of the Doppler effect?
A. Two identical musical instruments being played next to each other will produce a sound twice as loud as if only one were played.
B. The siren of a police car sounds different when the car is coming toward you than it does when it passes you.
C. A hiker shouts "hello" into a canyon and hears it repeated back several times before it fades away.
D. Vibrations from a tuning fork pass through the air and cause a nearby dish of water to produce ripples of the same frequency.
b is your answers in this thread
A ray of light makes an angle of 25° with the normal to a plane mirror. If the mirror is turned through 6. 0°, making the angle of incidence 31°, through what angle is the reflected ray rotated?
The reflected ray of a ray of light that makes an angle of 25° with the normal to a plane mirror and its is turned through 60°, making the angle of incidence to be 31° is rotated through 12°.
What is reflection?Freflection can be defined as the turning back of a ray of light when its strikes a plane's surface.
There are 2 laws of reflection
Laws of reflection(1) The first law of reflection states that the incident ray the reflected ray and the normal all at the point of incidence lie in the same plane
(2) The second law of reflection states that the angle of incident is equal to the angle of reflection.
From the question, if the incidence ray is rotated through 6°, then the reflected ray is rotated through 12°
Hence, The reflected ray is rotated through 12°.
Learn more about reflection here: https://brainly.com/question/1908648
The reflection resulting in a 31° angle of incidence and the angle is the reflected ray rotated will be 12°
What is the law of reflection?The law of reflection specifies that upon reflection from a downy surface, the slope of the reflected ray is similar to the slope of the incident ray.
The reflected ray is consistently in the plane determined by the incident ray and perpendicular to the surface at the point of reference of the incident ray.
When the light rays descend on the smooth surface, the angle of reflection is similar to the angle of incidence, also the incident ray, the reflected ray, and the normal to the surface all lie in a similar plane.
As a result, the reflected light is rotated by 12°.
To learn more about the law of reflection refer to the link;
brainly.com/question/12029226
#SPJ4