5 (u - 5) + 6u = 8 solve for u and simplifly your answer as much as possible
Answer:
u = 3
Step-by-step explanation:
Step 1: Distribute 5 in u - 5
[tex]\displaystyle{5\cdot u - 5\cdot 5 +6u=8}\\\\\displaystyle{5u-25+6u=8}[/tex]
Step 2: Add like terms together (u-term)
[tex]\displaystyle{11u-25=8}[/tex]
Step 3: Add both sides by 25
[tex]\displaystyle{11u-25+25=8+25}\\\\\displaystyle{11u=33}[/tex]
Step 4: Divide both sides by 11
[tex]\displaystyle{\dfrac{11u}{11}=\dfrac{33}{11}}\\\\\displaystyle{u=3}[/tex]
Answer Check
Step 1: Substitute u = 3 in the equation
[tex]\displaystyle{5(3-5)+6(3)=8}[/tex]
Step 2: Evaluate & Simplify
[tex]\displaystyle{5(-2)+18=8}\\\\\displaystyle{-10+18=8}\\\\\displaystyle{8=8}[/tex]
Since the equation is true after substituting u = 3. Therefore, the answer is u = 3.
Please let me know if you have any questions!
2,048 rounded to the nearest tenth?
answer to the question that you have
2,048.0
2050 because
1-9 = ones place
10-99 = tenth place
100-999 = hundrends place
1000 - 999999 - thousands place
and you round to the nearest 0 if it is 5 or up and if it is 1 to 4 it stays the same
Evaluate cos 150° without using a calculator.Ο Α.√32B. 2O C. -1/2OD. -32
Note that:
[tex]\begin{gathered} cos(A+B)=cosAcosB-sinAsinB \\ cos(150^0)=cos(90+60) \end{gathered}[/tex]Applying the addition formula given above to cos 150:
[tex]\begin{gathered} cos(150)=cos(90)cos(60)-sin(90)sin(60) \\ \\ cos(150)=0(\frac{1}{2})-1(\frac{\sqrt{3}}{2}) \\ \\ cos(150)=0-\frac{\sqrt{3}}{2} \\ \\ cos \end{gathered}[/tex]can you show how to solve this proplem
In the given figure : lines l and m are parallel and a, b are transversal
Since, the lines a and b are parallel and l act as a transversal.
Then,
[tex]\begin{gathered} \angle BAC=\angle ACb\text{ (alternate interior angles)} \\ \text{ Substitute the values} \\ 2x=46 \\ x=\frac{46}{2} \\ x=23 \end{gathered}[/tex]x = 23
Answer : x = 23
ASAP NEED HELP WILL GIVE BRAINLIEST
The value of the unknown angle x is 22 degrees.
How to find the angle x?SV is a parallel to RU.
RV is a transversal line that cut across the parallel lines SV and RU.
Therefore,
x = ∠V(alternate angles)
Alternate angles are congruent.
Hence,
∠V + 44 + 5x + 4 = 180 (sum of angles in a triangle)
x + 44 + 5x + 4 = 180
x + 5x + 48 = 180
6x + 48 = 180
6x = 180 - 48
6x = 132
divide both sides by 6
x = 132 /6
x = 22 degrees
learn more on angles here: https://brainly.com/question/10254268
#SPJ1
same as my last two questions
The intervals to the given function are as follows:
Domain: (-∞,∞).Range: (-∞,∞).Rel. maximums: (1.366, -0.652).Rel. minimums: (-0.366, -5.848) and (2,-1).End behavior: As x -> -∞, f(x) -> ∞, and as x -> ∞, f(x) -> ∞.Inc. intervals: (-0.366, 1.366) U (2, ∞).Dec. intervals: (-∞, -0.366) U (1.366, 2).Domain and rangeDomain: Set of values of the input of the function, hence the values of x in the graph of the function.Range: Set of values of the output of the function, hence the values of y in the graph of the function.This function is defined(values of x) for all real values and also assumes all real values(values of y), hence both the domain and the range are of the function are given by the interval (-∞,∞).
Increasing and decresingFrom the graph, the function is classified as decreasing or increasing according to the direction of movement in the graph, as follows:
Decreasing: Right and down.Increasing: Right and up.Hence the intervals are given as follows:
Increasing: (-0.366, 1.366) U (2, ∞).Decreasing: (-∞, -0.366) U (1.366, 2).Relative maximum and relative minimumThe relative minimum is when the graph of the function changes from decreasing to increasing, hence it is at these two following points:
(-0.366, -5.848) and (2,-1).
The relative maximum is when the function changes from increasing to decreasing, hence it is at this following point:
(1.366, -0.652).
End behaviorThe end behavior of the function is given by the limits of the function when x go to infinity, looking to the left and to the right of the graph of the function, hence:
Left: Moves up, hence as x -> -∞, f(x) -> ∞.Right: Moves up, hence as x -> ∞, f(x) -> ∞.More can be learned about functions at https://brainly.com/question/28949511
#SPJ1
Write an explicit formula for an, the nth term of the sequence
64, -16, 4,....
The formula for the given arithmetic series for the term aₙ will be aₙ=a₁+(n-1)d.
What is arithmetic series?An arithmetic series is the sum of a sequence like 2,..., where each term is calculated by adding (or subtracting) a constant from the previous one. An ordered group of numbers with a shared difference between each succeeding term is known as an arithmetic sequence. For instance, the common difference in the arithmetic series 3, 9, 15, 21, and 27 is 6.So, the possible sequence of -64, -16, 4:
We can notice the sequence as -(4³), -(4²), 4, 4², 4³.So, the formula for the aₙ term will be:
aₙ = a₁ + (n - 1)dTherefore, the formula for the given arithmetic series for the term aₙ will be aₙ = a₁ + (n - 1)d.
Know more about arithmetic series here:
https://brainly.com/question/6561461
#SPJ13
The correct question is given below:
Write an explicit formula for an, the nth term of the sequence
-64, -16, 4,....
5. Identify whether each unit measures length, volume, or weight (or mass).
1.
Mile
Cup.
Pound
Centimeter
2.
3.
4.
5.
Liter
6.
Gram
7.
Pint
8.
Yard
9. Kilogram
10. Teaspoon,
11. Milliliter
Answer:
See below
Step-by-step explanation:
Length (L), volume (V), weight(W), or mass(M)
Mile L
Cup V
Pound W
Centimeter L
Liter V
Gram M
Pint V
Yard L
Kilogram M
Teaspoon V
Milliliter V
1. Mile
2. Cup
3. Pound
4. Centimeter
5. Liter
6. Gram
7. Pint
8. Yard
9. Kilogram
10. Teaspoon,
11. Milliliter
Question 2 of 10
Multiply the following complex numbers:
(4-6) (6-8)
OA. -24-68i
OB. 72 +68i
O C. -24 +68/
OD. 72-68i
-24-68i is solution of complex number.
What is the best definition of a complex number?
Complex numbers are those that are expressed as a+ib, where a, b are actual numbers, and I is a fictitious number termed a "iota."Real and imaginary components are split into two separate numbers, which are referred to as complex numbers. The foundation of more complex mathematics, like algebra, are complex numbers. They have numerous practical applications, particularly in the fields of electronics and electromagnetism.(4-6i)(6-8i)
= 24-32i-36i+48i²
= 24 + -68i - 48
= -24-68i
Learn more about Complex numbers
brainly.com/question/20566728
#SPJ13
The complete question is -
Multiply the following complex numbers (4-6i)(6-8i)
The two angles pictured below are vertical angles.
Two lines intersect. The vertical angles measure eighty-four degrees and eight times x minus twelve.
What is the value of x?
The value of x in the vertical angles is 12.
What are vertically opposite angles?When two lines intersect each other, then the opposite angles, formed due to intersection are called vertical angles or vertically opposite angles.
In other words, vertically opposite angles are angles that are opposite one another at a specific vertex and are created by two straight intersecting lines.
Vertically opposite angles are congruent.
Therefore, the vertical angles measures 84 degrees and 8x - 12.
Let's find the value of x using the principle of vertically opposite angles.
Therefore,
84 = 8x - 12
add 12 to both sides of the equation
84 + 12 = 8x - 12 + 12
96 = 8x
divide both sides by 8
x = 96 / 8
x = 12
learn more on vertically opposite angles here: https://brainly.com/question/18045519
#SPJ1
The table shows a proportional relationship.
x 12 8 24
y 3 2 6
Describe what the graph of the proportional relationship would look like.
A line passes through the point (0, 0) and continues through the point (3, 12).
A line passes through the point (0, 0) and continues through the point (2, 8).
A line passes through the point (0, 0) and continues through the point (6, 24).
A line passes through the point (0, 0) and continues through the point (12, 3).
A graph which best describes what the proportional relationship would be D. A line that passes through the point (0, 0) and continues through the point (12, 3).
What is a graph?In Mathematics, a graph is used to graphically represent data points on both the horizontal and vertical lines of a cartesian coordinate, which are the x-axis and y-axis respectively.
Additionally, a graph which shows a proportional relationship between two variables would always have a straight line with its data points passing through the origin (0, 0).
Since the graph represents a proportional relationship we will get;
Constant of proportionality, we get;
k = 12/3 = 8/2 = 24/6
k = 4
Ratio,
24:6
= 12:3.
Therefore, A line that passes through the point (0, 0) and continues through the point (12, 3).
Read more on graphs here:
brainly.com/question/4546414
#SPJ1
Question 1 3 pts Isis has 4.8 m of ribbon for crafts. She wants to share it evenly with 12 friends. How many centimeters of ribbon would 5 friends get?
We will investigate the equal distribution of ribbon amoung her friends.
Isis has a ribbon for crafts for a certain length ( L ):
[tex]L\text{ = 4.8 m}[/tex]Isis has ( n ) number of friends amoung which she wants to equally distribute the length ( L ) of her ribbon:
[tex]n\text{ = 12}[/tex]Under the assumption of equal distribution we can divide the total length of ribbon ( L ) amoung Isis ( n ) of friends to determine what length ( l ) each friend got:
[tex]\begin{gathered} l\text{ = }\frac{L}{n} \\ \\ l\text{ = }\frac{4.8}{12} \\ \\ l\text{ = 0.4 m or 40 cm} \end{gathered}[/tex]So each friend of Isis got a piece of 40 cm length of the ribbon. So the length of the ribbon accumulated for 5 friends would involves the direct multiplication of 5 number of friends and length of each piece ( l ):
[tex]\begin{gathered} 5\text{ friends got = 5 }\cdot\text{ l} \\ 5\text{ friends got = 5 }\cdot\text{ 40} \\ 5\text{ friends got = }200\text{ cm} \end{gathered}[/tex]Therefore, the answer to the question is:
[tex]200\text{ cm}[/tex]The manager at the local auto shop has found that the probability that a car brought into the shop requires an oil change is 0.68, the probability that a car brought into the shop requires brake repair is 0.32, and the probability that a car requiresboth anoil change and brake repair is 0.11. For a car brought into the shop, determine the probability that the car will require an oil change or brake repair.The probability that the car requires an oil change or brake repair is
Remember that
P(A or B)=P(A)+P(B)-P(A and B)
In this problem, we have that
Event A and Event B are not independent
we have
P(A)=0.68
P(B)=0.32
P(A and B)=0.11
substitute
P(A or B)=0.68+0.32-0.11
P(A or B)=0.89
The answer is 0.89Triangle TAB has a perimeter of 40 cmeters. Could the measures of the sides as shown actually represent the measures of the sides of the triangle? Justify your answer.
EXPLANATION
We can apply the Obtuse Triangle Theorem to check if the the measures of the sides appropiately represents the measures of the triangle:
Perimeter = 40 cm = 4x + 2x + 2 + x + 3
Adding like terms:
40 = 7x + 5
Subtracting 5 to both sides:
40 - 5 = 7x
Adding like terms:
35 = 7x
Dividing both sides by 7:
35/7 = x
Simplifying:
[tex]5=x[/tex]Then, by the obtuse triangle theorem, the following relationship should be fulfilled.
Factorise 4x^2+13x-15
The factors of the given quadratic equations are [tex]\frac{-13+\sqrt{409} }{8}[/tex] and [tex]\frac{-13-\sqrt{409} }{8}[/tex]
What is factorization?
When we try to write the given equation in terms of linear values from which we calculate the roots of the given equation then we say that we have factorized them. Root of a equation means a value which satisfies a equation.
We are given a quadratic equation
[tex]4x^2+13x-15[/tex]
We use quadratic formula to compute the factor of the equation
[tex]x=\frac{-b}{2a}[/tex]±[tex]\frac{\sqrt{b^2-4ac} }{2a}[/tex]
[tex]x=\frac{-13}{8}[/tex]±[tex]\frac{\sqrt{169+240} }{8}[/tex]
[tex]x=\frac{-13}{8}[/tex]±[tex]\frac{\sqrt{409} }{8}[/tex]
Therefore the factors are [tex]\frac{-13+\sqrt{409} }{8}[/tex] and [tex]\frac{-13-\sqrt{409} }{8}[/tex]
To learn more about factorization please refer
https://brainly.com/question/25829061
#SPJ13
Given h(t) = –16t2 + 32t + 5, what is the value of h(2)? *Type in your answer. h(2) =
The value of the function h(2) for h(t) = -16t2 + 32t + 5 is h(2) = 5
How to determine the function value?From the question, the function definition is given as
h(t) = -16t2 + 32t + 5
First, we express the exponent in the function properly
This is represented as
h(t) = -16t² + 32t + 5
The function value to calculate is given as
h(2)
This means that we calculate h(t) when t = 2
So, we have
h(2) = -16(2)² + 32(2) + 5
Evaluate the exponents
h(2) = -16(4) + 32(2) + 5
So, we have
h(2) = 5
Hence, the function value is 5
Read more about functions at
https://brainly.com/question/28532394
#SPJ1
given the domain {-2,2,4} what is the range for relation 3x+y=3a (-9,3,9)b (9,-3,-9)c (-3,9,15)d (0,5,7)
the relation is 3x + y = 3
so,
y = 3x - 3
the domain is the values of x
so, substitute with each value of {-2,2,4} at the last equation of y
when x = -2 , y = 3*-2 - 3 = -6 - 3 = -9
when x = 2 , y = 3 * 2 - 3 = 6 - 3 = 3
when x = 4 , y = 3 * 4 - 3 = 12 - 3 = 9
so, the range will be {-9 , 3 , 9}
The correct answer is option a. (-9,3,9)x
Find the union, AUB, for of the following pair of sets. Enter "DNE" for the empty set.A = (-∞, - 5], B = [5, ∞)
Given
Two sets A = (-∞, - 5], B = [5, ∞)
Find
union, AUB
Explanation
Union of two sets A and B is the set of all elements that are present in A or in B
so , here A = (-∞, - 5], B = [5, ∞)
then union of set A and B is given by
[tex]A\cup B=(-\infty,-5]\cup[5,\infty)[/tex]Final Answer
Therefore., the union of A and B is (-∞, - 5] U [5, ∞)
How to solve? Please help i will give good rating.
Answer:
6. Draw a vertical line that goes though points (4,7) and (4,9). For a relation to be a function, each input has to have only one output. The input 4 cannot have the output of 7 and 9. This proves that this is not a function
7. The range is 91, 3, 6, 10 and 15)
Step-by-step explanation:
The range is the answer if you put in the x for range that they give you.
For example:
x ( x+ 1)/2 If I put in 1 for x, I will get
1(1+1)/2
2/2
1
When the input is 1, the output is one. You that for each of the domains given and you will find the ranges (outputs) that I have written above.
PLSS HELP I NEED ASAP
Answer:
m = -5
n = -2
Step-by-step explanation:
5m + 6n = -37
10m + 4n = -58 multiply first equation by -2
-2 × 5m + 6n = -37
-10m + (-12n) = 74 now add two equations up
10m - 10m + 4n - 12n = 74 - 58 add/ subtract like terms
-8n = 16 divide both sides by -8
n = -2
to find the value of m, replace n with -2 in the first equation
5m + 6*(-2) = -37
5m - 12 = -37 add 12 to both sides
5m = -25 divide both sides by 5
m = -5
a train increased its prices from £663 to £895.05 how much has this increased in a percentage
Answer:
The price has increased 35%
Step-by-step explanation:
GivenInitial price = £663,New price = £895.05.Find the percent increaseFind the amount of increase:
£895.05 - £663 = £232.05Find the percent value of the increase over the initial price:
232.05/663 × 100% = 35%Which number line and equation show how to find the distance from -2 to 5? O O A. 1-2-(-5) 2 3 12-1-5) sing O c. 1-2-5 D. 2-5
To find the distance between two numbers on the number line, you have tu use absolute value
So, if I want to know the distance from -2 to 5, all I have to do is to substract 5 from -2 and then apply absolute value, like this:
[tex]\mleft|-2-5\mright|\text{ = }\mleft|-7\mright|\text{ = 7}[/tex]And the number line should look like this:
equationsWrite a system of equations to describe the situation below, solve using elimination, and fill inche blanks.lada gets paid at home for doing extra chores. Last week, she did 1 load of laundry and 8oads of dishes, and her parents paid her $26. The week before, she finished 3 loads ofaundry and 8 loads of dishes, earning a total of $30. How much does Jada earn forcompleting each type of chore?
In this problem, we are going to write and solve a system of equations based on a real world situation.
Last week, she did 1 load of laundry and 8 loads of dishes, and her parents paid her $26. The week before, she finished 3 loads of laundry and 8 loads of dishes, earning a total of $30.
To begin, we need to create variables for the unknown cost of each chore.
Let x represent laundry, and let y represent dishes.
From the first equation, we can write the equation:
[tex]x+8y=26[/tex]We can write the second equation as:
[tex]3x+8y=30[/tex]Together, we have the system:
[tex]\begin{cases}x+8y={26} \\ 3x+8y={30}\end{cases}[/tex]Multiply the first equation by -1, then add it to the second equation:
[tex]\begin{gathered} \begin{cases}-1(x+8y={26)} \\ 3x+8y={30}\end{cases} \\ \\ \begin{cases}-x-8y={-26} \\ 3x+8y={30}\end{cases} \\ \\ (-x+3x)+(-8y+8y)=-26+30 \\ 2x=4 \end{gathered}[/tex]We can divide the remaining equation by 2 on both sides:
[tex]\begin{gathered} \frac{2x}{2}=\frac{4}{2} \\ \\ x=2 \end{gathered}[/tex]Lada made $2 per load of laundry.
We can use the value of x in the first equation to find the value of y. Substitute x = 2:
[tex]2+8y=26[/tex]Subtract 2 from both sides:
[tex]8y=24[/tex]Divide by 8 on both sides:
[tex]y=3[/tex]Lada made $3 per load of dishes.
ABCD is a quadrilateral
Work out the length of BC
Give your answer correct to 1 decimal place.
Using the law of cosines, the length of BC in the given quadrilateral is: 8.1 cm.
What is the Law of Cosines?The law of cosines that can be used to find the length of a side of a triangle with a known included angle and two sides is:
c² = a² + b² - 2 × a × b × Cos C.
Considering right triangle ABD,
BD = a
DC = b
BC = c
Use the Pythagorean theorem to find the length of BD in the quadrilateral as shown in the diagram:
BD = √(7.5² + 5²)
BD = √(7.5² + 5²)
BD = 9.0 cm
Use the law of cosines to find the length of BC:
BC² = BD² + DC² - 2 × BD × DC × Cos <BDC.
Substitute
BC² = 9.0² + 13² - 2 × 9.0 × 13 × Cos 38
BC² = 250 - 184.4
BC² = 65.6
BC = √65.6
BC = 8.1 cm
Learn more about the law of cosines on:
https://brainly.com/question/4372174
#SPJ1
Tanya is training a turtle for a turtle race. For every 1/2 of an hour that the turtle is crawling, he can travel 1/20 of a mile. At what rate is the turtle crawling in miles per hour
If Tanya is training a turtle for a turtle race. For every 1/2 of an hour that the turtle is crawling, he can travel 1/20 of a mile. The rate that the turtle is crawling in miles per hour is: 0.2 miles /hour .
Determining the Unit rate per mileGiven data:
1/2 of an hour = 1/20 of a mile
Now let determine the unit rate
Unit rate that the turtle is crawling is: (1/20)/(1/2)
Hence,
Unit rate = (1/20)×(2/1)
Unit rate = 2/20 miles/hour
Unit rate = 0.2 miles /hour
Therefore the rate is 0.2 miles per hour.
Learn more about unit rate here: https://brainly.com/question/19493296
#SPJ1
If for every 1/2 of an hour that the turtle is crawling, he can travel 1/20 of a mile. then 0.1mile/ hour is the rate at which turtle travel per hour.
What is Ratio?A ratio is an ordered pair of numbers a and b, written a / b where b does not equal 0.
Given that,
A turtle is trained by Tanya,
For every 1/2 of an hour that the turtle is crawling, he can travel 1/20 of a mile.
We need to find at what rate the turtle is travelling per hour.
Let x be the distance travelled by turtle in hour.
1/20/1/2=x/1
Apply cross multiplication
x/2=1/20
x=2/20
x=0.1 miles / hour
Hence 0.1 miles per hour is the turtle travelling per hour.
To learn more on Ratios click:
https://brainly.com/question/1504221
#SPJ1
How much greater is 8.5 x 10^-2 than 6.6 × 10^-5 ?
Answer:
1288 times greater
Step-by-step explanation:
(8.5x10^-2)/(6.6x10^-5)
(8.5/6.6)*(10^-2/10^-5)
(1.29)*(10^3)
1288 times greater
m(x) = | x + 1 |
Graph
The value of x = 1/M-1 , x = -1/M+1
What is Graph?
The graph of a function f is the set of ordered pairs where "displaystyle f(x)=y" exists. In the common scenario when x and f(x) are real integers, these pairings represent Cartesian coordinates of points in two-dimensional space and hence constitute a subset of this plane.
M(x) = |x + 1|
|x + 1| = M(x)
x + 1 = M(x)
x + 1 = -M(x)
Adding (-x) both side
x + 1 + (- x) = M(x) + (- x)
x + 1 + (- x) = -M(x) + (- x)
x + 1 - x = M(x) - x
x + 1 - x = -M(x) - x
1 = M(x) - x
1 = -M(x) - x
M(x) - x = 1
-M(x) - x = 1
x(M-1) = 1
x(-M-1) = 1
Dividing both side with (M - 1) and (-M - 1)
x(M-1)/(M - 1) = 1/(M - 1)
x(-M-1)/(-M - 1) = 1 /(-M - 1)
x = 1/(M - 1)
x = 1/(-M - 1)
Hence, x = 1/M-1 , x = -1/M+1
To learn more about Graph click on the link
https://brainly.com/question/4025726
#SPJ9
Select the correct answer.
Function g is a transformation of the parent cosine function such that g(x) = 3 cos (x + 2) + 1. Which graph represents function g?
Option C gives the graph of Function g is a transformation of the parent cosine function such that g(x) = 3 cos(x + 2) + 1 as it the graph of cosine function.
What is cosine function?The ratio between the adjacent side and the hypotenuse is known as the cosine function (or cos function) in triangles. One of the three primary trigonometric functions, cosine is the complement of sine (co+sine) and one of the three main trigonometric functions.
What is Graph?A graph is a structure that resembles a set of objects in mathematics, more specifically in graph theory, in which some pairs of the objects are conceptually "related." The objects are represented by mathematical abstractions known as vertices, and each pair of connected vertices is referred to as an edge.
Choice C provides a graph of the parent cosine function is transformed into function g such that g(x) = 3 cos(x + 2) + 1 on the cosine function graph.
To know more about graph,
https://brainly.com/question/17267403?referrer=searchResults
#SPJ13
Answer:
see photo
be sure to look closely, the top curves go to 4 and the bottom goes to -2, there are 2 with this same shape but the other one does not go high enough.
Step-by-step explanation:
Plato/Edmentum
What is 1 1/4 Divided by 10
Answer: 0.125
Step-by-step explanation:
1 1/4 is equal to 5/4
5/4 is equal to 1.25
then you would do 1.25 divided by 10
once you do that you would get your answer of 0.125!
Answer:
11/4÷10 =
11/4 ×1/10=
11/40=
0.275
Step-by-step explanation:
you can ask questions for clarification
it usually takes davin 1 3/4 hours to get to his aunt's house . due to labor day traffic this year it took 3 1/5 hours .how much longer did it take this year
It took David 1 [tex]\frac{3}{4}[/tex] hours more to reach her aunt's home due to labor day traffic.
What is unitary method?The unitary method is a method in which you find the value of a single unit and then the value of a required number of units.
Given is Davin who needs 1 3/4 hours to get to his aunt's house. However, due to the labor day traffic this year it took him 3 1/5 years.
We have to find the difference between the time span Davin took to reach his aunt's house.
Time taken by Davin without the labor day traffic = T[N] = 1 3/4 = 7/4 hours
Time taken by Davin with the labor day traffic = T[L] = 3 1/5 = 16/5 hours
Difference in time spans = T[D] = T[L] - T[N]
T[D] = 16/5 - 7/4
T[D] = 3.2 - 1.75
T[D] = 1.45 = 1 + 0.45
T[D] = 1 [tex]\frac{3}{4}[/tex] hours
Davin took 1 [tex]\frac{3}{4}[/tex] hours more.
Therefore, it took David 1 [tex]\frac{3}{4}[/tex] hours more to reach her aunt's home due to labor day traffic.
To solve more questions on unitary method, visit the link below-
https://brainly.com/question/13659834
#SPJ1