Please help! Thanks thO!

Please Help! Thanks ThO!

Answers

Answer 1

Answer:

8

Step-by-step explanation:

The sum of two interior angles in a triangle is equal to an exterior angle

7x - 4 + 9x + 4 = 128° add like terms

16x = 128 divide both sides by 16

x = 8


Related Questions

-6t-7=17 what does t equal

Answers

Answer:

t=-4

Step-by-step explanation:

I know you don't care about any explanation, and just want the answer, but to get this, you can add 7 to both sides. Then you get -6t=24. Divide both sides by -6 and you get -4

17. Let f(x) = 2x2 + 5x + 6 and g(x) = 3x2 + 4x – 10.
a Find f(x) + g(x)
b. Find f(x) – g(x)

Answers

Step-by-step explanation:

f(x)+g(x)=(2x^2 + 5x +6) + (3x^2 +4x - 10)

Combine like terms

5x^2 + 9x -4

f(x)-g(x)=(2x^2 + 5x +6) - (3x^2 +4x - 10)

Distribute the negative

(2x^2 + 5x +6) + (-3x^2 -4x + 10)

Combine like terms

-x^2 +x +16

f(x)+g(x)= (2x^2+5x+6)+(3x^2+4x-10)= 5x^2 + 9x -4.
f(x)-g(x)= (2x^2+5x-6)-(3x^2+4x-10)= 2x^2+5x-6 (-3x^2 - 4x +10)= -x^2 +x+4

At a food festival, 3/8 of the dishes were from china. Another 12.5% of the dishes were from japan. What percent of the dishes were from the other countries?

Answers

Answer: 50%

Step-by-step explanation:

Let x = Total dishes.

Dishes from China = [tex]\dfrac38x[/tex]

Dishes from Japan  = [tex]12.5\% \text{ of }x= 0.125x[/tex]

Total dishes  from China and Japan = [tex]\dfrac38 x+0.125x=0.375x+0.125x=0.5x[/tex]

Dishes from other countries [tex]= x- 0.5x= 0.5x[/tex]

Percent of dishes from other countries= [tex]\dfrac{0.5x}{x}\times100\%= 50\%[/tex]

Hence, dishes from other countries = 50%

At the Roseville Middle School Spring Festival, Ellen is running the egg-dying station. She
needs 5 tablespoons of vinegar for every 2 color tablets she uses. Ellen plans to use 16 color
tablets.
How many tablespoons of vinegar will Ellen need?
HELP THIS IS AN EMERGENCY

Answers

Answer:

40 tablespoons of vinegar

Step-by-step explanation:

the ratio is 2-5 so if you have 16-x you divide 16 by 2 and multiply with your quotient to the 5, which would be

2-5

16-x

16-5^8

16-40

An expression is a way of writing a statement with more than two variables or numbers with operations such as addition, subtraction, multiplication, and division.

5 tablespoons = 2 color tablets.

40 tablespoons = 16 color tablets

The number of tablespoons of vinegar required is 40.

What is an expression?

An expression is a way of writing a statement with more than two variables or numbers with operations such as addition, subtraction, multiplication, and division.

Example: 2 + 3x + 4y = 7 is an expression.

We have,

She needs 5 tablespoons of vinegar for every 2 color tablets she uses.

This means,

5 tablespoons = 2 color tablets.

Multiply 8 on both sides.

8 x 5 tablespoons = 8 x 2 color tablets.

40 tablespoons = 16 color tablets

Thus,

The number of tablespoons of vinegar required is 40.

Learn more about expressions here:

https://brainly.com/question/3118662

#SPJ5

What is the image point of (3, -3) after a translation left 3 units and up 4 units?.

Answers

Answer:

(0, 1)

Step-by-step explanation:

(x, y)

Left and Right movement deals with the x value

Up and Down movement deals with the y value

3 units left = -3

4 units up = +4

(x - 3, y + 4)

(3 - 3, -3 + 4)

(0, 1)

The image point of (3, -3) after a translation of [tex](-3, 4)[/tex] is [tex](0,1)[/tex].

Determination of the coordinates of resulting point after translation

Geometrically speaking, a translation is determined by following formula:

[tex]V'(x,y) = V(x,y) + T(x,y)[/tex] (1)

Where:

[tex]V(x,y)[/tex] - Original point[tex]T(x,y)[/tex] - Translation vector[tex]V'(x,y)[/tex] - Resulting point

If we know that [tex]V(x,y) = (3, -3)[/tex] and [tex]T(x,y) = (-3, 4)[/tex], then the coordinates of the resulting point are, respectively:

[tex]V'(x,y) = (3, -3) + (-3, 4)[/tex]

[tex]V'(x,y) = (0, 1)[/tex]

The image point of (3, -3) after a translation of [tex](-3, 4)[/tex] is [tex](0,1)[/tex]. [tex]\blacksquare[/tex]

To learn more on translations, we kindly invite to check this verified question: https://brainly.com/question/17485121

If f(x) = x2 + 2x + 3, what is the average rate of change of Rx) over the interval (-4, 6]?

Answers

Answer:

Step-by-step explanation:

The average rate of change of a function over an interval is simply the slope over the interval because:

[tex]let \: g(x)=f'(x)\\\frac{\int\limits^b_a {g(x)} \, dx }{b-a}(the\:average\:value\:of\:g)=\frac{f(b)-f(a)}{b-a}[/tex]

We have to know f(6) and f(-4)

[tex]f(x) = x^2 + 2x + 3\\f(6) = 6^2 + 2(6) + 3\\f(6) = 36 + 12 + 3\\f(6) = 51\\\\f(-4) = (-4)^2 + 2(-4) + 3\\f(-4) = 16 - 8 + 3\\f(-4) = 11\\\\\frac{f(6)-f(-4)}{6-(-4)} = \frac{51-11}{10} = \frac{40}{10} = 4[/tex]

I need help on the word problem with

Answers

hirhgkjsdbgkgbdk kbfsbjd jsbfbdh jabjdbshd jsjdsfkj

Answer: x>11

Step-by-step explanation:

What is this expression in simplified form? √32 x √24
A. 16√3
B. 64√12
C. √768
D. 32√3

Answers

Answer:

16 sqrt(3) x -> A. 16√3

Step-by-step explanation:

Simplify the following:

sqrt(32) sqrt(24) x

Hint: | Simplify radicals.

sqrt(32) = sqrt(2^5) = 2^2 sqrt(2):

2^2 sqrt(2) sqrt(24) x

Hint: | Evaluate 2^2.

2^2 = 4:

4 sqrt(2) sqrt(24) x

Hint: | Simplify radicals.

sqrt(24) = sqrt(2^3×3) = 2 sqrt(2) sqrt(3):

4 sqrt(2)×2 sqrt(2) sqrt(3) x

Hint: | For a>=0, sqrt(a) sqrt(b) = sqrt(a b). Apply this to sqrt(2) sqrt(3).

sqrt(2) sqrt(3) = sqrt(2×3):

4 sqrt(2)×2 sqrt(2×3) x

Hint: | Multiply 2 and 3 together.

2×3 = 6:

4 sqrt(2)×2 sqrt(6) x

Hint: | Multiply 4 and 2 together.

4×2 = 8:

8 sqrt(2) sqrt(6) x

Hint: | For a>=0, sqrt(a) sqrt(b) = sqrt(a b). Apply this to sqrt(2) sqrt(6).

sqrt(2) sqrt(6) = sqrt(2×6):

8 sqrt(2×6) x

Hint: | Multiply 2 and 6 together.

2×6 = 12:

8 sqrt(12) x

Hint: | Simplify radicals.

sqrt(12) = sqrt(2^2×3) = 2 sqrt(3):

8×2 sqrt(3) x

Hint: | Multiply 8 and 2 together.

8×2 = 16:

Answer: 16 sqrt(3) x

Answer:

16√3

Step-by-step explanation:

I got it on test

Here are the first four terms of an arithmetic sequence. 3 10 17 24 Find, in terms of n, an expression for the nth term of this arithmetic sequence.

Answers

Answer:

[tex]a_{n}[/tex] = 7n - 4

Step-by-step explanation:

The n th term of an arithmetic sequence is

[tex]a_{n}[/tex] = a₁ + (n - 1)d

where a₁ is the first term and d the common difference

Here a₁ = 3 and d = a₂ - a₁ = 10 - 3 = 7 , thus

[tex]a_{n}[/tex] = 3 + 7(n - 1) = 3 + 7n - 7 = 7n - 4

which expression is equivalent to sin(pi/12)cos(7pi/12)-cos(pi/12)sin(7pi/12)? a) cos(-pi/2) b) sin(-pi/2) c) cos(2pi/3) d) sin(2pi/3)

Answers

Answer:A

Step-by-step explanation:

Edge 2020

[tex]sin(\frac{\pi }{12})cos(\frac{7\pi}{12}) -cos(\frac{\pi }{12})sin(\frac{7\pi }{12})[/tex] is equivalent to [tex]sin(\frac{-\pi }{2} )[/tex].

What is trigonometric expression?

Trigonometric expressions are non-routine appearing problems. They are unfamiliar because the language of trigonometry looks foreign and complicated. In order to learn how to simplify or reduce the complexity of trigonometric expressions, we first need to examine the identities we need to utilize.

It is one of the identities of trigonometry

sinAcosB - cosAsinB = sin(A - B)

Given expression

[tex]sin(\frac{\pi }{12})cos(\frac{7\pi}{12}) -cos(\frac{\pi }{12})sin(\frac{7\pi }{12})[/tex]

It is in form of sinAcosB - cosAsinB = sin(A - B)

⇒ [tex]sin(\frac{\pi }{12})cos(\frac{7\pi}{12}) -cos(\frac{\pi }{12})sin(\frac{7\pi }{12})[/tex] = [tex]sin(\frac{\pi }{12}-\frac{7\pi }{12} )[/tex]

⇒ [tex]sin(\frac{\pi }{12})cos(\frac{7\pi}{12}) -cos(\frac{\pi }{12})sin(\frac{7\pi }{12})[/tex] = [tex]sin(\frac{-6\pi }{12} )[/tex]

⇒ [tex]sin(\frac{\pi }{12})cos(\frac{7\pi}{12}) -cos(\frac{\pi }{12})sin(\frac{7\pi }{12})[/tex] = [tex]sin(\frac{-\pi }{2} )[/tex]

Hence [tex]sin(\frac{\pi }{12})cos(\frac{7\pi}{12}) -cos(\frac{\pi }{12})sin(\frac{7\pi }{12})[/tex] is equivalent to [tex]sin(\frac{-\pi }{2} )[/tex].

Find out more information about trigonometric expression here

https://brainly.com/question/2142049

#SPJ2

solve the equation
-4(x - 26) = -200

Answers

Answer:

x=76

Step-by-step explanation:

-4(x - 26) = -200

x-26=50

x=50+26

x=76

I hope this helped you! If it did, please consider rating, pressing thanks, and giving my answer 'Brainliest.' Have a great day! :)

Step-by-step explanation:

-4x+104=-200

-4x=-200-104

-4x=-304

x=-304÷(-4)

×=76

What is the value of c?

Answers

The answer is 71 degrees, considering that one is a right angle we know that it is 90 degrees and because all of the angles of a triangle added up is 180 we can do 180 - (90 + 42) = 48, 48 is a, then we know that angle B is on a supplementary angle with a so it would be 90 - a = b, plug it in it would be 90 - 48 = 42 then we would do the same thing to find angle c, 180 - (42 + 67) which equals 71

Please help me out!!!!!

Answers

im a little rusty on this but i believe it is y =-(x+3)-5

Lin’s bike travels 100 meters when her wheels rotate 55 times. What is the circumference of her wheels?

____ m

Answers

Answer:

the circumference of her wheel is 1.81 m

Lin’s bike travels 100 meters when her wheels rotate 55 times.

here, n = 55 rotation and D = 100 meter.

Diameter is the distance bike travel

n is the number of times rotation

C is the circumference of the wheel

Determine the values of X

Answers

66+52+x=180
118+x=180
x=180-118
x=62


Hope this helps :)

Step-by-step explanation:

x+66+52=180

x=180-66-52

x=180-118

x=62

write the coordinates obtained after the given translation​

Answers

Answer:You would just have to add 4 to all of the x values and add 5 to all the y values

Step-by-step explanation:

J : (3,2)
K : (5,2)
L : (4,5)

What is an equation of the line that passes through the points (7, 6) and (-2, -3)?

Answers

Answer:

y=1x-1

Step-by-step explanation:

m=y2-y1/x2-x1

-3-6=(-9)

-2-7=(-9)

-9/-9=1

6=1*7+b

1*7=7

7-7=0

6-7=-1

b=-1

y=1x-1

hope this helps :3

if it did pls mark brainliest

T-shirts and More Print Shop will print any image on a mouse pad for a cost of $2 per mouse pad and a one-time charge of $12 to set up the mouse pad design. The total cost of an order was $562. How many mouse pads were printed?


A:47


B:275


C:550


D:281

Answers

Answer: 275

Step-by-step explanation:

-3(2x+1) is 20 greater than the value of 8x+5 : what does x equal

Answers

Answer:

-2

Step-by-step explanation:

HELP ASP!!❤️
WILL GIVE BRAINLIEST!...

Find the slope of the line. Enter your answer in simplest form.

Answers

Answer:

[tex]m=\frac{-4}{3}[/tex]

General Formulas and Concepts:

Order of Operations: BPEMDASSlope Formula: [tex]m=\frac{y_2-y_1}{x_2-x_1}[/tex]

Step-by-step explanation:

Step 1: Define

Point (-6, 5)

Point (3, -7)

Step 2: Find slope m

Substitute:                    [tex]m=\frac{-7-5}{3-(-6)}[/tex]Simplify:                        [tex]m=\frac{-7-5}{3+6}[/tex]Subtract/Add:               [tex]m=\frac{-12}{9}[/tex]Simplify:                        [tex]m=\frac{-4}{3}[/tex]

Answer:

the slope is -4/3

Step-by-step explanation:

m=y2-y1/x2-x1

-7-5=(-12)

3-(-6)=9

-12/9

-12/3=(-4)

9/3=3

-4/3

hope this helps :3

if it did pls mark brainliest

write 56.78 correct to one significant number

Answers

Answer:

60

Step-by-step explanation:

There are 9.4 hours of music left on Nate's playlist and this is 47% of the total memory how much memory does Nate's MP3 player have? Please answer

Answers

Answer:

Nate's MP3 has 20 hours of memory.

Step-by-step explanation:

1. multiply 9.4 times 100

2. divide that by 47

3. you get your answer of 20 hours

ABC is congruent to EDC, BC = 5 units and DE = 12 units. What is the length of AE?

Answers

Answer:

AE = 26 units

Step-by-step explanation:

Given that ABC is congruent to EDC, therefore, the corresponding angles and corresponding lengths of ∆ABC and ∆EDC are equal to each other in measure.

AE = 2(AC) = 2(CE) or

AE = AC + CE

Let's find the AC using Pythagorean Theorem, since the ∆s are both right triangles.

BA is congruent to DE.

Since DE = 12 units, therefore, BA = 12 units.

BC = 5 units (given)

Using Pythagorean Theorem:

AC² = BA² + BC²

AC² = 12² + 5² (substitution)

AC² = 144 + 25 = 169

AC = √169

AC = 13 units

Since ∆ABC = ∆EDC, therefore:

AE = 2(AC)

AE = 2(13)

AE = 26 units


[tex]4x + 5y = 19 \\ x + 5y = 13[/tex]
I need some help putting it in ordered pair​

Answers

Subtract 5y from both sides of the equation
X=13-5y

What is the value of p? Please provide an explanation, thanks!

Answers

Answer:

p = 2?

Step-by-step explanation:

6 - 4 = 2

4 + _ = 6 (2)

2 + 2 = 4

Answer:

Step-by-step explanation:

6p - 4 + 4p + 6 + p + 2 = 180

11p + 4 = 180

11p = 176

p = 16

3x - 7 = 29
What is x

Answers

Answer:

x = 12

General Formulas and Concepts:

Pre-Algebra

Order of Operations: BPEMDASEquality Properties

Step-by-step explanation:

Step 1: Define equation

3x - 7 = 29

Step 2: Solve for x

Add 7 on both sides:                    3x = 36Divide 3 on both sides:                x = 12

Step 3: Check

Plug in x to verify it's a solution.

Substitute:                    3(12) - 7 = 29Multiply:                        36 - 7 = 29Subtract:                       29 = 29

Here we see that 29 does indeed equal 29.

∴ x = 12 is a solution of the equation.

Brainliest 5 stars Thanks! (running out of time and points sorry)

Answers

The answer is c f(-8)=0

HeLp Me pLz

What is the shape of the cross section of the figure that is perpendicular to the triangular bases and passes through a vertex of the triangular bases?

A triangular prism.
a parallelogram that is not a rectangle
a rectangle
a triangle that must have the same dimensions as the bases
a triangle that may not have the same dimensions as the bases

Answers

The answer is a papallelogram that is not a rectangle.

What is the volume of a cylinder with a radius of 1.5 inches and a height of 9 inches round your answer to the nearest hundredthWhat is the volume of a cylinder with a radius of 1.5 inches and a height of 9 inches round your answer to the nearest hundredth

Answers

Answer:

V = 63.62

Step-by-step explanation:

Answer: 63.62 cubic inches

Step-by-step explanation:

REMEMBER :: VOLUME OF CYLINDER = πr^2h

r= 1.5 in.

h= 9 in.

V= π (1.5)^2 (9)

V= π (2.25) (9)

V= π (20.25)

V~63.6172512...

nearest hundredth = 63.62 cubic inches

3. Solve for a
5(a-2) = 2(10+a)

it’s due by midnight and can you also tell me how you got the answer

Answers

Answer:

a=10

Step-by-step explanation:

distribute on both sides to get

5a-10=20+2a

add/subtract like terms

5a-2a=3a

20+10=30

so the equation is

3a=30

divide 30 by 3 and you get 10

Answer:

a = 10

Step-by-step explanation:

[tex]5(a - 2) = 2(10 + a) \\ \\ 5a - 10= 20 + 2a\\ \\ 5a - 2a= 20 + 10\\ \\ 3a = 30\\ \\ a = \frac{30}{3} \\ \\ \huge \red{ \boxed{a = 10}}[/tex]

Other Questions
3. Bakit mahalagang maukoy ang mga katangian ng isip at kilos-loob sa pangaraw-araw na buhay? Question 1 of 10Which of Saturn's moons has an atmosphere that is most like Earth's?O A. PandoraB. Atlas C. TitanOD. EuropaSUBMIT How many milliliters of 2.00 M H2SO4 will react with 28.0 g of NaOH? How should Jason communicate his health concerns to his parents? He should tell his parents he does not feel well enough to go to school. He should describe all of his symptoms to his parents and ask to see a doctor. He should avoid worrying his parents and not tell them until he has been sick for seven days. He should tell his parents that he will see the school nurse if he does not feel better. Helppp plsssssss helppp is my answer correct?? A force of 30 Newtons is used to push a basket along the floor a total distance of 3 meters. How much work is done on the basket? what force pulls down the top of a wave Write a polynomial function in factored form of least that the given zeros and a leading coefficient of 1.1. -6, 3, 52. 2, -2, -6iWrite a polynomial function in standard form of least degree that have real coefficients, the given zeros, and a leading coefficient of 1. 3. -1, 1, 74. 3, -3, -2i There are 28 red pens and 84 black pens in a bag.Write down the ratio of the number of red pens to the number of black pens.Give your ratio in its simplest form. Explain One similarity between the trade in the Indian Ocean networks before the arrival of the Portuguese and the trade after their arrival c. 1450 - c. 1750. * Games with this rating contain content which the ESRB believes is generally suitable for those aged 17 years and older. Question 4 options:A T TeenB eC Early ChildhoodC M MatureD E Everyone speech about children day A _______ is when a state legislature decides to allow the people of the state to vote directly on an issue.A) resolutionB) popular referendum indirect processC) legislative referendum When the Greeks grew close to the Persians, they had to break into a run to avoid the Persian a. cavalry b. arrows c. cannon d. elephants Whose name do u love best?!Mine: SkylarSister: SamaraOther sister: MadisonOther sister: KayseeBrother: JaekobOther brother: IsaacOther brother: BrandonChoose 3 names of who u love better!Whoever gets the ones i love is brainliest! A chemical company makes up batches of copper sulfate solution by adding 250 kg of copper sulfate powder to 1000 liters of water. A laboratory chemist wants to make a solution of identical concentration, but only needs 350 mL (0.35 liters) of solution.How much copper sulfate powder should the chemist add to the water? Enter your answer in the box below in decimal format.The mass of copper sulfate that the chemist should add is______ kg.help me please Which organization created a shared economy?European UnionWorld Trade OrganizationNorth American Free Trade AgreementsAssociation of Southeast Asian Nations I need help with Kumon math level I 187 B Highland climates are most affected by __________.