NEEED HELP PLSSSS . Find x in triangles Geometry.

NEEED HELP PLSSSS . Find X In Triangles Geometry.

Answers

Answer 1

Answer:

10) x = 76,12) x = 8, Perimeter = 77 units

=========================

Question 10

The triangle is isosceles as marked.

The two opposite angles of equal sides are equal, one of them is x and the angle in between them is 28°.

Use angle sum of the triangle:

2x + 28 = 1802x = 152x = 76

Question 12

Same as previous question, we have an isosceles triangle. Equal sides are:

3x + 5 = 5x - 115x - 3x = 5 + 112x = 16x = 8

Find the perimeter by substituting the value of x:

P = 3*8 + 5 + 5*8 - 11 + 2*8 + 3 = 77 units


Related Questions

Question 2 of 10
Multiply the following complex numbers:
(4-6) (6-8)
OA. -24-68i
OB. 72 +68i
O C. -24 +68/
OD. 72-68i

Answers

-24-68i is solution of complex number.

What is the best definition of a complex number?

Complex numbers are those that are expressed as a+ib, where a, b are actual numbers, and I is a fictitious number termed a "iota."Real and imaginary components are split into two separate numbers, which are referred to as complex numbers. The foundation of more complex mathematics, like algebra, are complex numbers. They have numerous practical applications, particularly in the fields of electronics and electromagnetism.

(4-6i)(6-8i)

= 24-32i-36i+48i²

= 24 + -68i - 48

= -24-68i

Learn more about Complex numbers

brainly.com/question/20566728

#SPJ13

The complete question is -

Multiply the following complex numbers (4-6i)(6-8i)

equationsWrite a system of equations to describe the situation below, solve using elimination, and fill inche blanks.lada gets paid at home for doing extra chores. Last week, she did 1 load of laundry and 8oads of dishes, and her parents paid her $26. The week before, she finished 3 loads ofaundry and 8 loads of dishes, earning a total of $30. How much does Jada earn forcompleting each type of chore?

Answers

In this problem, we are going to write and solve a system of equations based on a real world situation.

Last week, she did 1 load of laundry and 8 loads of dishes, and her parents paid her $26. The week before, she finished 3 loads of laundry and 8 loads of dishes, earning a total of $30.

To begin, we need to create variables for the unknown cost of each chore.

Let x represent laundry, and let y represent dishes.

From the first equation, we can write the equation:

[tex]x+8y=26[/tex]

We can write the second equation as:

[tex]3x+8y=30[/tex]

Together, we have the system:

[tex]\begin{cases}x+8y={26} \\ 3x+8y={30}\end{cases}[/tex]

Multiply the first equation by -1, then add it to the second equation:

[tex]\begin{gathered} \begin{cases}-1(x+8y={26)} \\ 3x+8y={30}\end{cases} \\ \\ \begin{cases}-x-8y={-26} \\ 3x+8y={30}\end{cases} \\ \\ (-x+3x)+(-8y+8y)=-26+30 \\ 2x=4 \end{gathered}[/tex]

We can divide the remaining equation by 2 on both sides:

[tex]\begin{gathered} \frac{2x}{2}=\frac{4}{2} \\ \\ x=2 \end{gathered}[/tex]

Lada made $2 per load of laundry.

We can use the value of x in the first equation to find the value of y. Substitute x = 2:

[tex]2+8y=26[/tex]

Subtract 2 from both sides:

[tex]8y=24[/tex]

Divide by 8 on both sides:

[tex]y=3[/tex]

Lada made $3 per load of dishes.

it usually takes davin 1 3/4 hours to get to his aunt's house . due to labor day traffic this year it took 3 1/5 hours .how much longer did it take this year

Answers

It took David 1 [tex]\frac{3}{4}[/tex] hours more to reach her aunt's home due to labor day traffic.

What is unitary method?

The unitary method is a method in which you find the value of a single unit and then the value of a required number of units.

Given is Davin who needs 1 3/4 hours to get to his aunt's house. However, due to the labor day traffic this year it took him 3 1/5 years.

We have to find the difference between the time span Davin took to reach his aunt's house.

Time taken by Davin without the labor day traffic = T[N] = 1 3/4 = 7/4 hours

Time taken by Davin with the labor day traffic = T[L] = 3 1/5 = 16/5 hours

Difference in time spans = T[D] = T[L] - T[N]

T[D] = 16/5 - 7/4

T[D] = 3.2 - 1.75

T[D] = 1.45 = 1 + 0.45

T[D] = 1 [tex]\frac{3}{4}[/tex] hours  

Davin took 1 [tex]\frac{3}{4}[/tex] hours more.

Therefore, it took David 1 [tex]\frac{3}{4}[/tex] hours more to reach her aunt's home due to labor day traffic.

To solve more questions on unitary method, visit the link below-

https://brainly.com/question/13659834

#SPJ1

Which is greater 12.5 or |-13|?

Answers

From the question, we are asked to find which is great between 12.5 or |-13|

recall:

|-13|

The absolute value is the distance between a number and zero. The distance between -13 and 0 is 13.

The absolute symbol makes any number positive.

So, |-13| is the greater because |-13| = 13.

So, between 12.5 and |-13|, |-13| is greater since it is same as 13.

The manager at the local auto shop has found that the probability that a car brought into the shop requires an oil change is 0.68, the probability that a car brought into the shop requires brake repair is 0.32, and the probability that a car requiresboth anoil change and brake repair is 0.11. For a car brought into the shop, determine the probability that the car will require an oil change or brake repair.The probability that the car requires an oil change or brake repair is

Answers

Remember that

P(A or B)=P(A)+P(B)-P(A and B)

In this problem, we have that

Event A and Event B are not independent

we have

P(A)=0.68

P(B)=0.32

P(A and B)=0.11

substitute

P(A or B)=0.68+0.32-0.11

P(A or B)=0.89

The answer is 0.89

Factorise 4x^2+13x-15​

Answers

The factors of the given quadratic equations are [tex]\frac{-13+\sqrt{409} }{8}[/tex] and [tex]\frac{-13-\sqrt{409} }{8}[/tex]

What is factorization?

When we try to write the given equation in terms of linear values from which we calculate the roots of the given equation then we say that we have factorized them. Root of a equation means a value which satisfies a equation.

We are given a quadratic equation

[tex]4x^2+13x-15[/tex]

We use quadratic formula to compute the factor of the equation

[tex]x=\frac{-b}{2a}[/tex]±[tex]\frac{\sqrt{b^2-4ac} }{2a}[/tex]

[tex]x=\frac{-13}{8}[/tex]±[tex]\frac{\sqrt{169+240} }{8}[/tex]

[tex]x=\frac{-13}{8}[/tex]±[tex]\frac{\sqrt{409} }{8}[/tex]

Therefore the factors are [tex]\frac{-13+\sqrt{409} }{8}[/tex] and [tex]\frac{-13-\sqrt{409} }{8}[/tex]

To learn more about factorization please refer

https://brainly.com/question/25829061

#SPJ13

How to solve? Please help i will give good rating.​

Answers

Answer:

6.  Draw a vertical line that goes though points (4,7) and (4,9).  For a relation to be a function, each input has to have only one output.  The input 4 cannot have the output of 7 and 9.  This proves that this is not a function

7. The range is 91, 3, 6, 10 and 15)

Step-by-step explanation:

The range is the answer if you put in the x for range that they give you.

For example:

x ( x+ 1)/2  If I put in 1 for x, I will get

1(1+1)/2

2/2

1

When the input is 1, the output is one.  You that for each of the domains given and you will find the ranges (outputs) that I have written above.

5. Identify whether each unit measures length, volume, or weight (or mass).
1.
Mile
Cup.
Pound
Centimeter
2.
3.
4.
5.
Liter
6.
Gram
7.
Pint
8.
Yard
9. Kilogram
10. Teaspoon,
11. Milliliter

Answers

Answer:

See below

Step-by-step explanation:

Length (L), volume (V), weight(W), or mass(M)

Mile     L

Cup           V

Pound   W

Centimeter L

Liter     V

Gram   M

Pint           V

Yard   L

Kilogram   M

Teaspoon  V

Milliliter    V

1. Mile

2. Cup

3. Pound

4. Centimeter

5. Liter

6. Gram

7. Pint

8. Yard

9. Kilogram

10. Teaspoon,

11. Milliliter


Write an explicit formula for an, the nth term of the sequence
64, -16, 4,....

Answers

The formula for the given arithmetic series for the term aₙ will be aₙ=a₁+(n-1)d.

What is arithmetic series?An arithmetic series is the sum of a sequence like 2,..., where each term is calculated by adding (or subtracting) a constant from the previous one. An ordered group of numbers with a shared difference between each succeeding term is known as an arithmetic sequence. For instance, the common difference in the arithmetic series 3, 9, 15, 21, and 27 is 6.

So, the possible sequence of -64, -16, 4:

We can notice the sequence as -(4³), -(4²), 4, 4², 4³.

So, the formula for the aₙ term will be:

aₙ = a₁ + (n - 1)d

Therefore, the formula for the given arithmetic series for the term aₙ will be aₙ = a₁ + (n - 1)d.

Know more about arithmetic series here:

https://brainly.com/question/6561461

#SPJ13

The correct question is given below:

Write an explicit formula for an, the nth term of the sequence

-64, -16, 4,....

Hakeem is the oldest of three siblings who ages are consecutive integers. If the sum of their ages are 69, find Hakeem age

Answers

Answer:

24

Step-by-step explanation:

Hakeem is the oldest of three siblings who ages are consecutive integers. If the sum of their ages are 69, find Hakeem age.

It should be noted that:

= 22 + 23 + 24

= 69

Hakeem's age is 24

Ten bags of oranges were sold to a family of eight.each family member ate six oranges, what fraction of the oranges were eaten?

Answers

The fraction of oranges eaten by the family is 3/5

Given,

Number of oranges in a bag = 8 oranges

Number of bags sold to a family = 10 bags

Number of members in the family = 6 members

Number oranges ate by each member of the family = 6 oranges

We have to find the fraction of the oranges eaten by the family members;

Here,

8 oranges in 1 bag and 10 bags sold.

So, total number of oranges sold = 8 x 10 = 80 oranges

Each member ate 6 oranges and there are 8 members.

So, total number of oranges eaten by them = 6 x 8 = 48 oranges

Now,

The fraction of oranges eaten by the family = 48/80 = 6/10 = 3/5

That is,

3/5th of oranges were eaten by the family.

Learn more about fraction of oranges here;

https://brainly.com/question/3352145

#SPJ1

Which inequality statements are true? Select all that apply.-0.7<-0.40.5 -0.6-0.8<-0.70.6 > 0.4

Answers

Answer:

-0.7 < -0.4

0.5 > -0.6

-0.8 < -0.7

0.6 > 0.4

Explanation:

The symbol < means less than and the symbol > means greater than.

On the other hand, if we identify each number on a number line, we get:

Therefore, the true statements are:

-0.7 < -0.4

0.5 > -0.6

-0.8 < -0.7

0.6 > 0.4

Because, for example, -0.7 is on the left of -0.4 which means that -0.7 is less than -0.4.

0.5 in on the right of -0.6 which means that 0.5 is greater than -0.6.

m(x) = | x + 1 |
Graph

Answers

The value of x = 1/M-1 , x = -1/M+1

What is Graph?

The graph of a function f is the set of ordered pairs where "displaystyle f(x)=y" exists. In the common scenario when x and f(x) are real integers, these pairings represent Cartesian coordinates of points in two-dimensional space and hence constitute a subset of this plane.

M(x) = |x + 1|

|x + 1| = M(x)

x + 1 = M(x)

x + 1 = -M(x)

Adding (-x) both side

x + 1 + (- x) = M(x) + (- x)

x + 1 + (- x) = -M(x) + (- x)

x + 1 - x = M(x) - x

x + 1 - x = -M(x) - x

1 = M(x) - x

1  = -M(x) - x

M(x) - x = 1

-M(x) - x  = 1

x(M-1)  = 1

x(-M-1)  = 1

Dividing both side with (M - 1) and (-M - 1)

x(M-1)/(M - 1)   = 1/(M - 1)

x(-M-1)/(-M - 1)  = 1 /(-M - 1)

x = 1/(M - 1)

x = 1/(-M - 1)

Hence, x = 1/M-1 , x = -1/M+1

To learn more about Graph click on the link

https://brainly.com/question/4025726

#SPJ9

determine the measure of angle j.

Answers

The measure of the value of ∠j is 10°.

What are a few properties of a triangle considering its angles?
A triangle's outer angle is the sum of its internal angles' two opposite sides.
The sum of two linear angles is supplementary.

Given, the three angles of the triangle are measured as (5x - 3)°,
(4x - 2)° and .
Also, the exterior angle of the triangle is (10x - 20)°.
Following the literature established above, considering that a triangle's outer angle is the product of its internal angles' two opposite sides, we have: (5x - 3) + (4x - 2) = 10x - 20 ⇒ 9x - 5 = 10x - 20 ⇒ 10x - 9x = 20 - 5
⇒ x = 15 --(i)
Again, since the sum of two linear angles is supplementary, we have using (i):
j + (10x - 20) = 180 ⇒ j + 150 - 20 = 180 ⇒ j = 10°
Therefore, the measure of the value of ∠j is 10°.

To learn more about this, tap on the link below:
https://brainly.com/question/25215131

#SPJ9

Suppose a golf ball bounces off a wall at a point P, and that
line mis perpendicular to the wall at point P.
What is the measure of the angle of reflection?
A. 50°
B. 40°
C. 140°
D. 90°

Answers

40 degrees because reflection is is the same like a mirror

The image of the point (1, 1) under a translation is (0, 3). Find the coordinates of the image of the point (-4, "-1) under the same translation.

Answers

The image of the point (-4, -1) after the translation is:

(-3, 1)

How to identify the translation?

A translation:

Tᵃ'ᵇ applied to a point (x, y) gives:

Tᵃ'ᵇ(x, y) = (x + a, y + b).

In this case, we know that:

Tᵃᵇ(1, 1) = (1 + a, 1 + b) = (0, 3)

Then:

1 + a = 0

1 + b = 3

Solving these we get:

a = 1

b = 3 - 1 = 2

The translation is:

T¹'²

Applying this to the point (-4, -1) gives:

T¹'²(-4, -1) = (-4 + 1, -1 + 2) = (-3, 1)

Learn more about translations:

https://brainly.com/question/24850937

#SPJ1

Triangle TAB has a perimeter of 40 cmeters. Could the measures of the sides as shown actually represent the measures of the sides of the triangle? Justify your answer.

Answers

EXPLANATION

We can apply the Obtuse Triangle Theorem to check if the the measures of the sides appropiately represents the measures of the triangle:

Perimeter = 40 cm = 4x + 2x + 2 + x + 3

Adding like terms:

40 = 7x + 5

Subtracting 5 to both sides:

40 - 5 = 7x

Adding like terms:

35 = 7x

Dividing both sides by 7:

35/7 = x

Simplifying:

[tex]5=x[/tex]

Then, by the obtuse triangle theorem, the following relationship should be fulfilled.

ABCD is a quadrilateral
Work out the length of BC
Give your answer correct to 1 decimal place.

Answers

Using the law of cosines, the length of BC in the given quadrilateral is: 8.1 cm.

What is the Law of Cosines?

The law of cosines that can be used to find the length of a side of a triangle with a known included angle and two sides is:

c² = a² + b² - 2 × a × b × Cos C.

Considering right triangle ABD,

BD = a

DC = b

BC = c

Use the Pythagorean theorem to find the length of BD in the quadrilateral as shown in the diagram:

BD = √(7.5² + 5²)

BD = √(7.5² + 5²)

BD = 9.0 cm

Use the law of cosines to find the length of BC:

BC² = BD² + DC² - 2 × BD × DC × Cos <BDC.

Substitute

BC² = 9.0² + 13² - 2 × 9.0 × 13 × Cos 38

BC² = 250 - 184.4

BC² = 65.6

BC = √65.6

BC = 8.1 cm

Learn more about the law of cosines on:

https://brainly.com/question/4372174

#SPJ1

What is 1 1/4 Divided by 10

Answers

Answer: 0.125

Step-by-step explanation:

1 1/4 is equal to 5/4

5/4 is equal to 1.25

then you would do 1.25 divided by 10

once you do that you would get your answer of 0.125!

Answer:

11/4÷10 =

11/4 ×1/10=

11/40=

0.275

Step-by-step explanation:

you can ask questions for clarification

Which number line and equation show how to find the distance from -2 to 5? O O A. 1-2-(-5) 2 3 12-1-5) sing O c. 1-2-5 D. 2-5

Answers

To find the distance between two numbers on the number line, you have tu use absolute value

So, if I want to know the distance from -2 to 5, all I have to do is to substract 5 from -2 and then apply absolute value, like this:

[tex]\mleft|-2-5\mright|\text{ = }\mleft|-7\mright|\text{ = 7}[/tex]

And the number line should look like this:

Evaluate cos 150° without using a calculator.Ο Α.√32B. 2O C. -1/2OD. -32

Answers

Answer:

Explanation:

Note that:

[tex]\begin{gathered} cos(A+B)=cosAcosB-sinAsinB \\ cos(150^0)=cos(90+60) \end{gathered}[/tex]

Applying the addition formula given above to cos 150:

[tex]\begin{gathered} cos(150)=cos(90)cos(60)-sin(90)sin(60) \\ \\ cos(150)=0(\frac{1}{2})-1(\frac{\sqrt{3}}{2}) \\ \\ cos(150)=0-\frac{\sqrt{3}}{2} \\ \\ cos \end{gathered}[/tex]

can you show how to solve this proplem

Answers

In the given figure : lines l and m are parallel and a, b are transversal

Since, the lines a and b are parallel and l act as a transversal.

Then,

[tex]\begin{gathered} \angle BAC=\angle ACb\text{ (alternate interior angles)} \\ \text{ Substitute the values} \\ 2x=46 \\ x=\frac{46}{2} \\ x=23 \end{gathered}[/tex]

x = 23

Answer : x = 23

3. 40 ounces of granola costs $6.52
a. How much does granola cost per ounce? (Give your answer to the nearest cent.) pleasee help

Answers

Answer: $0.2

Step-by-step explanation:

To find the answer you divide 6.52 by 40 which will get 0.163. To check the answer and make sure its correct you can multiply 0.163 by 40 to get 6.52 making the answer correct so 0.2 is the answer to the nearest cent. Hope this helps :)

Here is the answer again

The table shows a proportional relationship.


x 12 8 24
y 3 2 6


Describe what the graph of the proportional relationship would look like.
A line passes through the point (0, 0) and continues through the point (3, 12).
A line passes through the point (0, 0) and continues through the point (2, 8).
A line passes through the point (0, 0) and continues through the point (6, 24).
A line passes through the point (0, 0) and continues through the point (12, 3).

Answers

A graph which best describes what the proportional relationship would be D. A line that passes through the point (0, 0) and continues through the point (12, 3).

What is a graph?

In Mathematics, a graph is used to graphically represent data points on both the horizontal and vertical lines of a cartesian coordinate, which are the x-axis and y-axis respectively.

Additionally, a graph which shows a proportional relationship between two variables would always have a straight line with its data points passing through the origin (0, 0).

Since the graph represents a proportional relationship we will get;

Constant of proportionality, we get;

k = 12/3 = 8/2 = 24/6

k = 4

Ratio,

24:6

= 12:3.

Therefore, A line that passes through the point (0, 0) and continues through the point (12, 3).

Read more on graphs here:

brainly.com/question/4546414

#SPJ1

Given h(t) = –16t2 + 32t + 5, what is the value of h(2)? *Type in your answer. h(2) =

Answers

The value of the function h(2) for h(t) = -16t2 + 32t + 5 is h(2) = 5

How to determine the function value?

From the question, the function definition is given as

h(t) = -16t2 + 32t + 5

First, we express the exponent in the function properly

This is represented as

h(t) = -16t² + 32t + 5

The function value to calculate is given as

h(2)

This means that we calculate h(t) when t = 2

So, we have

h(2) = -16(2)² + 32(2) + 5

Evaluate the exponents

h(2) = -16(4) + 32(2) + 5

So, we have

h(2) = 5

Hence, the function value is 5

Read more about functions at

https://brainly.com/question/28532394

#SPJ1

a train increased its prices from £663 to £895.05 how much has this increased in a percentage

Answers

Answer:

The price has increased 35%

Step-by-step explanation:

Given

Initial price = £663,New price = £895.05.

Find the percent increase

Find the amount of increase:

£895.05  - £663 = £232.05

Find the percent value of the increase over the initial price:

232.05/663 × 100% = 35%

Which is the better buy? 2-gallon container of laundry detergent for $23.36. or 17-cup container of laundry detergent for $20.06

Answers

we gotta know the conversion between cups and gallons

We know

1 cup (US) = 0.0625 gallons

So, 2 gallon would be 2/0.0625 = 32 cups

So, the problem in cups is:

32 cups = $23.36

17 cups = $20.06

Definitely 32 cups for 23.36 is better buy

2 gallons for $23.36 is the better buy

Note:

23.36/32 = $0.73 per cup

20.06/17 = $1.18 per cup

ASAP NEED HELP WILL GIVE BRAINLIEST

Answers

The value of the unknown angle x is 22 degrees.

How to find the angle x?

SV is a parallel to RU.

RV is a transversal line that cut across the parallel lines SV and RU.

Therefore,

x = ∠V(alternate angles)

Alternate angles are congruent.

Hence,

∠V + 44 + 5x + 4 = 180 (sum of angles in a triangle)

x + 44 + 5x + 4 = 180

x + 5x + 48  = 180

6x + 48 = 180

6x = 180 - 48

6x = 132

divide both sides by 6

x = 132  /6

x = 22 degrees

learn more on angles here: https://brainly.com/question/10254268

#SPJ1

Select the correct answer.
Function g is a transformation of the parent cosine function such that g(x) = 3 cos (x + 2) + 1. Which graph represents function g?

Answers

Option C gives the graph of Function g is a transformation of the parent cosine function such that g(x) = 3 cos(x + 2) + 1 as it the graph of cosine function.

What is cosine function?

The ratio between the adjacent side and the hypotenuse is known as the cosine function (or cos function) in triangles. One of the three primary trigonometric functions, cosine is the complement of sine (co+sine) and one of the three main trigonometric functions.

What is Graph?

A graph is a structure that resembles a set of objects in mathematics, more specifically in graph theory, in which some pairs of the objects are conceptually "related." The objects are represented by mathematical abstractions known as vertices, and each pair of connected vertices is referred to as an edge.

Choice C provides a graph of the parent cosine function is transformed into function g such that g(x) = 3 cos(x + 2) + 1 on the cosine function graph.

To know more about graph,

https://brainly.com/question/17267403?referrer=searchResults

#SPJ13

Answer:

see photo

be sure to look closely, the top curves go to 4 and the bottom goes to -2, there are 2 with this same shape but the other one does not go high enough.

Step-by-step explanation:

Plato/Edmentum

How much greater is 8.5 x 10^-2 than 6.6 × 10^-5 ?

Answers

Answer:

1288 times greater

Step-by-step explanation:

(8.5x10^-2)/(6.6x10^-5)

(8.5/6.6)*(10^-2/10^-5)

(1.29)*(10^3)

1288 times greater

Other Questions
a country's trade balance will fall if either a. investment falls or saving rises. b. investment or saving rise. c. investment or saving fall. d. saving falls or investment rises. HELPPPPPPPPPPPPPOPOPP Which identifies the main cause of the English Civil War?A) Henry VIII broke with the Catholic Church.B) The printing press spread a message of rebellion.C) Charles ruled as a tyrant and angered Puritans.D) Puritan factions feuded amongst themselves. Can you Help me with this i cannot do ir Solve the problem. Use 3.14 as the approximate value of pie Write an equation for the graph below in point-slope form and then solve rewrite in slope-intercept form. What mathematical concept did the Mayans include in their calculations? Which of the binomials below is a factor of this expression?25x^2-4y^2z^2answer- 5x-2yz How can we explain the fact that millions of kids watch violent TV shows and remain nonviolent? If there is a TVviolence link, how can we explain the fact that violence rates may have been higher in the Old West than they are today? Do you think kids in violent gangs stay home and watch TV shows? A friend plans to purchase a 72-inch tv at a particular store for a cost of $1500. The store is offering 25% off any one item. He also has an internet coupon for an additional 10% off any discounted price. How much will your friend save (a) in dollar amount and (b) in percent? 2. Holden is willing to spend thirteen dollars on the three witches at the Lavender Room. However, when Sunny and Maurice confront him laterasking him for five more dollarshe refuses to comply. Analyze Holdens inconsistency here, and examine how his willingness to spend money on women varies.the book is (The Catcher in the rye) 15% of $764.69rounded to the nearest cent. Identify the type of neuron that carry information from the sense organs such as the tongue, nose, skin, ears, and eyes to the spinal cord and the brain so that the stimuli received from these organs can be processedSensory neuron Interneurons Motor neuron a person with schizophrenia who hears all the animals around her making plans to get her ready for the ball, and comes to think of herself as cinderella, is experiencing a(n) hallucination and a delusion of . a. auditory; grandeur b. gustatory, persecution c. olfactory; reference d. tactile; control explain how you got the answer please How to draw the graphs of the following non-linear functions?y=x^2 + 1y=3^x + 1 Two functions are shown. f(x) = 29(0.5)* g(x) = 18x + 14 What is the value of f(2) + g(4)? A pet boarder keeps a dog-to-cat ratio of 5:2. If the boarder has room for 98 animals, then how many of them can be dogs in a ratio Evaluate the expression (4x^3y^-2)(3x^-2y^4) for x = 2 and y = 1. A redox reaction:A. is a reaction where oxygen is returned it its natural state.B. is a reduction reaction where oxygen is removed.C. is comprised of two half reactions, a reduction and an oxidation.D. is a reaction where oxygen is added to a compound.