Jane made this picture to represent a chemical reaction:

Two circles, one white and the other gray are shown on the left. A small portion of the two circles overlap and the label below the circles is XY. An arrow pointing right is shown on the right of the overlapping circles. There are two circles on the right of the arrow, one white and the other gray, and there is a plus sign between them. The white circle is labeled X and the gray circle is labeled Y.

Which of the following statements best explains the type of chemical reaction represented by Jane's picture? (5 points)

It represents a synthesis reaction because one combined reactant forms multiple products.

It represents a synthesis reaction because the same atoms are present in the reactants and products.

It represents a decomposition reaction because one reactant breaks apart and forms two products.

It represents a decomposition reaction because the total mass of the products is less than the mass of the reactant.

Explanation:

it shows covalent bonds

The type of bond the diagram shows is covalent bond. As shown the sharing of electrons in the diagram.

Bonds are defined as any of the interactions that lead to atoms joining together to form molecules, ions, crystals, and other stable species that make up the familiar materials found in everyday life. The ability to build molecules is made possible by a chemical bond, which is a strong attraction between atoms, ions, or molecules. Chemical bonds that hold molecules together also form temporary connections vital for life.

Covalent bond are defined as a type of chemical link where atoms share electrons to create electron pairs. Low melting and boiling temperatures, low vaporization heat, low water solubility, and poor conductivity are four characteristics of covalent compounds.

Thus, the type of bond the diagram shows is covalent bond. As shown the sharing of electrons in the diagram.

To learn more about bonds, refer to the link below:

https://brainly.com/question/13559044

#SPJ2

The neutral atom of lead must have 82 protons while ions can have b or less than 82.

The atomic number of an element is the number of protons in the nucleus of the element.

Also, for neutral atoms, the number of protons equals the number of electrons.

In ionic form, the number of protons/electrons of an atom may vary and be different from that of the neutral form.

Positive charges mean that the ion has less proton than its neutral version while negative charges mean that it has more electrons than its neutral version.

Thus, the neutral atom of lead will contain an equal number of protons as the electrons while its ionic form can have more or less than 82 protons.

More on atoms can be found here: https://brainly.com/question/803445?referrer=searchResults

Answer:

Looking at the table, Silver is definitely the most conductible metal there. It has the lowest electrical resistivity which means it allows for an easier flow of electrons, and it also has a higher thermal conductivity which means it would exhibit a higher conductivity. Diamond has the highest thermal conductivity, but the electrical resistivity is extremely high and due to its giant covalent/tetrahedral molecular structure (being an allotrope of Carbon), electrons can't necessarily jump around. Diamond wouldn't be a conductor at all.

The most simplest composition and structures provide a higher thermal conductivity. For example, with Diamond, we know that it is a structure made of covalent bonds of carbon, so its thermal conductivity is high.

Answer:

Q1

Copper

Explanation:

Copper is a good conductor of electricity, its resistance is high, and its chemical activity is weak

Q2

The thermal conductivity of a specific material is highly dependent on a number of factors. These include the temperature gradient, the properties of the material, and the path length that the heat follows.

Answer:

Raise

Explanation:

H+ ions are acidic and lower the PH of water.

Answer:

I got it Right in Study Island

Explanation:

Answer:

Fatty Acids

A lipid is an organic compound such as fat or oil. Organisms use lipids to store energy, but lipids have other important roles as well. Lipids consist of repeating units called fatty acids. Fatty acids are organic compounds that have the general formula CH3(CH2)nCOOH" role="presentation" style="display: inline-table; font-style: normal; font-weight: normal; line-height: normal; font-size: 17.6px; text-indent: 0px; text-align: left; text-transform: none; letter-spacing: normal; word-spacing: normal; overflow-wrap: normal; white-space: nowrap; float: none; direction: ltr; max-width: none; max-height: none; min-width: 0px; min-height: 0px; border: 0px; padding: 0px; margin: 0px; position: relative;">CH3(CH2)nCOOHCH3(CH2)nCOOH, where n" role="presentation" style="display: inline-table; font-style: normal; font-weight: normal; line-height: normal; font-size: 17.6px; text-indent: 0px; text-align: left; text-transform: none; letter-spacing: normal; word-spacing: normal; overflow-wrap: normal; white-space: nowrap; float: none; direction: ltr; max-width: none; max-height: none; min-width: 0px; min-height: 0px; border: 0px; padding: 0px; margin: 0px; position: relative;">nn usually ranges from 2 to 28 and is always an even number. There are two types of fatty acids: saturated fatty acids and unsaturated fatty acids.

Saturated Fatty Acids

In saturated fatty acids, carbon atoms are bonded to as many hydrogen atoms as possible. This causes the molecules to form straight chains, as shown in the figure below. The straight chains can be packed together very tightly, allowing them to store energy in a compact form. This explains why saturated fatty acids are solids at room temperature. Animals use saturated fatty acids to store energy.

Figure 14.2.1" role="presentation" style="display: inline-table; font-style: normal; font-weight: normal; line-height: normal; font-size: 16px; text-indent: 0px; text-align: left; text-transform: none; letter-spacing: normal; word-spacing: normal; overflow-wrap: normal; white-space: nowrap; float: none; direction: ltr; max-width: none; max-height: none; min-width: 0px; min-height: 0px; border: 0px; padding: 0px; margin: 0px; position: relative;">14.2.114.2.1: Structures of saturated and unsaturated fatty acids.

Unsaturated Fatty Acids

In unsaturated fatty acids, some carbon atoms are not bonded to as many hydrogen atoms as possible due to the presence of one or more double bonds in the carbon chain. Instead, they are bonded to other groups of atoms. Wherever carbon binds with these other groups of atoms, it causes chains to bend (see figure above). The bent chains cannot be packed together very tightly, so unsaturated fatty acids are liquids at room temperature. Plants use unsaturated fatty acids to store energy.

Figure 14.2.2" role="presentation" style="display: inline-table; font-style: normal; font-weight: normal; line-height: normal; font-size: 16px; text-indent: 0px; text-align: left; text-transform: none; letter-spacing: normal; word-spacing: normal; overflow-wrap: normal; white-space: nowrap; float: none; direction: ltr; max-width: none; max-height: none; min-width: 0px; min-height: 0px; border: 0px; padding: 0px; margin: 0px; position: relative;">14.2.214.2.2: Saturated fatty acids have only single bonds while monounsaturated fats have one double bond and polyunsaturated fats have more than one double bond.

Lipids and Diet

Unsaturated fat is generally considered to be healthier because it contains fewer calories than an equivalent amount of saturated fat. Additionally, high consumption of saturated fats is linked to an increased risk of cardiovascular disease. Some examples of foods with high concentrations of saturated fats include butter, cheese, lard, and some fatty meats. Foods with higher concentrations of unsaturated fats include nuts, avocado, and vegetable oils such as canola oil and olive oil.

Fructose is a simple carbohydrate sugar, while triglycerides are the lipids or the fats of the body. Thus, option C is accurate.

Triglycerides are lipids of the body that are formed of fatty acids and glycerols. It makes the body fat of the animals and of the plants. They are stored in cells for future use and provide energy when needed.

Fructose is a monomer that is the simplest carbohydrate sugar and is generally found in sugarcane, honey, watermelon, grapes, apples, etc.

Therefore, option C. fructose is sugar and triglyceride is fat is correct.

Learn more about triglycerides and fats here:

https://brainly.com/question/17576593

#SPJ2

The bonding activity that occurs between phosphorus and chlorine is Covalent Bonding

Covalent bonding is an interaction between two atomic elements that share electrons between themselves.

In Phosphorus Pentachlorine PCl₅, covalent bonding occurs between Phosphorus and Chlorine.

This is because, Phosphorus is the central atom that is attached to 5 different chlorine atoms, each chlorine atom needs one electron each to complete its octet rule and since phosphorus has five valence electrons in its outermost shell, it shares it with each of the chlorine atoms.

Learn more about covalent bonding here:

https://brainly.com/question/1853488

Answer:

Covalent Bonding

Answer:

In the picture A kettle is boiling water and evaporating it we can see the water vapours coming out of the kettle and there is a paper on top of the kettle from where the water vapours are coming out .

Explanation:

is this right ?? i hope it helps

The statement that compounds have the same physical and chemical properties as the elements they are made from is false.

Compounds are substances formed when two or more elements are chemically combined together.

For example, water is a chemical compound formed when hydrogen and oxygen are chemically combined in a ratio of 2 to 1.

Therefore, the statement that compounds have the same physical and chemical properties as the elements they are made from is false.

Learn more about compounds at: https://brainly.com/question/10942055

Answer:

C

Explanation:

Acids contain H plus ions. When within a solution or neutralised these ions are released.

The substance which gives H+ ion are called as acid. Vinegar is an acid because it will release H+ in water. Therefore, option C is correct.

Acetic acid and water are combined to create vinegar through a two-step fermentation process. First, yeast consume any liquid derived from a plant source, such as fruits, whole grains, potatoes, or rice, and feed on the sugar or starch therein. It ferments into alcohol.

White vinegar typically contains 93–96% water and 4-7% acetic acid. It can be used to cook, bake, clean, and control weeds. It may also help with weight loss and decrease cholesterol and blood sugar levels.

The sugar is converted to ethanol (ethyl alcohol) by yeast and bacteria in a two-step fermentation process, which is followed by the production of acetic acid. Vinegar is acidic because it contains acetic acid.

Thus, option C is correct.

To learn more about vinegar, follow the link;

https://brainly.com/question/4239583

#SPJ2

Ignore me I dont know what im doing.

Answer:

Mass of 0.5 moles of CO2 is 22 gm.

Explanation:

1 mole of CO2 = 44 gm

0.5 mole of CO2 = 0.5 × 44 = 22 gm

Answer:

it conducts electricity when dissolved in water

Explanation:

the water molecules bond to positive and negative ions results to breaking of lattice and it's fixed position broken

Answer:

year 1 is 5.5%

year 2 is 7.5%

year 3 is 10.2%

Explanation:

since,

length of the transect covered in seaweed / total lenth of transect x 100

then,

0.55 / 10.0 x 100 = 5.5

and

0.75 / 10.0 x 100 = 7.5

and

1.02 / 10.0 x 100 = 10.2

you could also just move the decimal to the right once

:)

Answer:

the act of watching somebody/something carefully, especially to learn something

Explanation:

hope this helps you!

Answer:

hope this helps

Explanation:

noun

noun1.

noun1.the act of watching somebody/something carefully, especially to learn something

Answer:

Hope this answer helps

Explanation:

try putting 66 grams CO2 for answer

Answer: In the core of the Sun hydrogen is being converted into helium. This is called nuclear fusion. It takes four hydrogen atoms to fuse into each helium atom. During the process some of the mass is converted into energy.

Answer:

D

Explanation:

Given that the molar mass of NaCl is 58.44 g/mol, we want to determine the molarity of a solution that contains 87.75 g of NaCl in 500. mL of solution.

Recall that molarity is given by:

[tex]\displaystyle \text{M} = \frac{\text{ mols solute}}{\text{ liters soln.}}[/tex]

Therefore, we can convert the amount of NaCl in the solution to moles of NaCl and the volume from milliliters to liters:

[tex]\displaystyle \begin{aligned} \text{M} & = \frac{(87.75 \text{ g NaCl})}{(500. \text{ mL soln.})} \cdot \frac{1 \text{ mol NaCl}}{58.44 \text{ g NaCl}} \cdot \frac{1000 \text{ mL soln.}}{1 \text{ L soln.}} \\ \\ & = 3.00\text{ } \frac{\text{mol NaCl}}{\text{ L soln.}} \\ \\ & = 3.00 \text{ M} \end{aligned}[/tex]

Hence, our answer is D.

Answer: The shadow zone is the area of the earth from angular distances of 104 to 140 degrees from a given earthquake that does not receive any direct P waves. The shadow zone results from S waves being stopped entirely by the liquid core and P waves being bent (refracted) by the liquid core.

Explanation: 104 to 140 degrees from a given earthquake

Answer:

b a c a b

Explanation:

Answer:

Nomenclature is the process of naming chemical compounds with different names so that they can be easily identified as separate chemicals. ... For example, organic compounds include molecules with carbon rings and/or chains with hydrogen atoms (see picture below).01-Jul-2014

Nomenclature: Iron (II) Chloride

Compound: FeCl2

Answer:

A reaction that has the same number and type of atoms on each side of the equation

Explanation:

A pex

Answer:

Mole is a number that connects mass of a substance with its number of particles. 2500 g of O2 = 1/32 x 2500 = 78.125 moles

Explanation:

have a great day

We are given –

Here–

[tex]\qquad[/tex][tex] \pink{\bf \longrightarrow Initial\: velocity = 100 \:km/hr}[/tex]

[tex]\qquad[/tex][tex] \sf \longrightarrow Initial\: velocity = \dfrac{ 100 \times 1000}{3600} \:m/s[/tex]

[tex]\qquad[/tex][tex]\pink{ \bf \longrightarrow Initial\: velocity = 27.78\: m/s} [/tex]

Now –

[tex]\qquad[/tex]____________________________

[tex]\qquad[/tex][tex] \purple{\bf \longrightarrow Acceleration = \dfrac{Final\: Velocity -Initial \:Velocity }{Time}}[/tex]

[tex]\qquad[/tex][tex] \purple{\bf \longrightarrow Acceleration = \dfrac{v -u}{t}}[/tex]

[tex]\qquad[/tex][tex] \sf \longrightarrow Acceleration = \dfrac{(0- 27.78)}{1800}[/tex]

[tex]\qquad[/tex][tex] \sf \longrightarrow Acceleration =\cancel{ \dfrac{- 27.78}{1800}}[/tex]

[tex]\qquad[/tex][tex] \purple{\bf \longrightarrow Acceleration = -0.015 \: m/s^2} [/tex]

[tex]\qquad[/tex]_______________________________

Answer:

Quantum number

Explanation:

The mass of water, H₂O produced from the reaction is 72.06 g

We'll begin by calculating the mass of NH₄NO₃ that reacted and the mass of H₂O produced from the balanced equation.

NH₄NO₃ —> N₂O + 2H₂O

Molar mass of NH₄NO₃ = 80.03 g/mol

Mass of NH₄NO₃ from the balanced equation = 1 × 80.03 = 80.03 g

Molar mass of H₂O = 18.01 g/mol

Mass of H₂O from the balanced equation = 2 × 18.01 = 36.02 g

From the balanced equation above,

80.03 g of NH₄NO₃ reacted to produce 36.02 g of H₂O

Finally, we shall determine the mass of H₂O produced by the reaction of 160.1 g of NH₄NO₃.

From the balanced equation above,

80.03 g of NH₄NO₃ reacted to produce 36.02 g of H₂O.

Therefore,

160.1 g of NH₄NO₃ will react to produce = (160.1 × 36.02) / 80.03 = 72.06 g of H₂O.

Thus, the mass of water, H₂O produced from the reaction is 72.06 g

Learn more on stiochoimetry: https://brainly.com/question/15048051