Answer:
Rise over Run, the slope in this graph would be 3/4
Step-by-step explanation:
You count the number of spaces it takes to move up, then you move right, towards the line. You write the rise number on top and the number moving right (run) on the bottom, (rise over run).
I hope this helps you, if not let me know in the comments :)
riddle
What runs around the whole yard without moving?
Answer:
a yard stick, maybe I'm right
Answer:
a fence
Step-by-step explanation:
HAHAHA LOL
Luis had 4 boxes of party favors. One full box contained 16 bags of favors and each bag had 5 items in it. What is the total number
items that Luis had in his possession?
O A. 360
B. 320
O C. 170
OD. 7.5
80% of the doctors surveyed believe exercising 30 minutes a day help you live a healthier life. If 240 doctors believe in exercising, how many were surveyed.
Answer:
300 is what I got
Step-by-step explanation:
Which expression is equivalent to – (4-3)?
A. -2(to the power of 2) + 3
B. -2(to the power of 2)– 3
C. -3 - 2(to the power of 2)
D. -3 +2(to the power of 2)
Answer:
answer is really hard and small, but I can't help because I don't know,
sorry not sorry
lol
regards,
Rosemary
Help pls help pls help pls help pls help pls
Answer:
Domain: -2 < x ≤ 3
General Formulas and Concepts:
Algebra I
Domain is the set of x-values that can be inputted into function f(x)Step-by-step explanation:
Since domain encompasses x values only, we are looking at the x-values of the graph. We see that our x-values span from -2 to 3. However, since x = -2 is a open dot, it is NOT included in the domain. Since x = 3 is a closed dot, it IS included in the domain:
(-2, 3] or -2 < x ≤ 3
Answer:
ramen is the true answer to lifes problems
Step-by-step explanation:
Please help me out!!!!!
Help asap
A local hamburger shop sold a combined total of 555 hamburgers and cheeseburgers on Saturday. There were 55 more cheeseburgers sold than hamburgers. How many hamburgers were sold on Saturday?
Answer:
There were 250 hamburgers sold on Saturday.
Step-by-step explanation:
∵ A local hamburger shop sold a combined total of 555 hamburgers
and cheeseburgers on Saturday
→ Assume that the shop sold x hamburgers
∵ The shop sold x hamburgers
∵ There were 55 more cheeseburgers sold than hamburgers
→ That means the number of cheeseburgers is greater than the
number of hamburger by 55
∴ The shop sold x + 55 cheeseburgers
∵ The shop sold 555 burgers
→ Add the two types of burgers and equate the sum by 555
∴ x + x + 55 = 555
∴ 2x + 55 = 555
→ Subtract 55 from both sides
∴ 2x + 55 - 55 = 555 - 55
∴ 2x = 500
→ Divide both sides by 2 to find x
∵ [tex]\frac{2x}{2}[/tex] = [tex]\frac{500}{2}[/tex]
∴ x = 250
∵ x represents the number of hamburgers
∴ There were 250 hamburgers sold on Saturday.
Divide (-3x^2 - 9x) ÷ (x + 3)
please explain/show work! <33
Step-by-step explanation:
[tex]( - 3 {x}^{2} - 9x) \div (x + 3) [/tex]
This is the original equation so you will open the brackets.
[tex] - 3 {x}^{2} - 9x \div x + 3[/tex]
The x will cross the division sign making it times x.
[tex]3 {x}^{2} - 9x \times x = 3[/tex]
So you will proceed to multiply the 9x by x making it;
[tex]3 {x}^{2} - 9 {x}^{2} = 3 [/tex]
So you will subtract 9x² from 3x² which won't be possible so it will be negative.
[tex] - 6 {x}^{2} = 3 [/tex]
Then you will square root both sides making it;
[tex] - \sqrt{6 {x}^{2} } = \sqrt{3} [/tex]
So the ² will cancel the √ leaving
-6x=√3
-6x=1.73(Divide both sides by -6)
x=0.288
That's the final answer.
Find the 39th term of the following sequence. 17,11, 5, -1
Answer:
-330
Step-by-step explanation:
a39= 17+ (39-1) * -6
17+ 38 = 55
55*-6 = -330
Here are the first four terms of an arithmetic sequence. 3 10 17 24 Find, in terms of n, an expression for the nth term of this arithmetic sequence.
Answer:
[tex]a_{n}[/tex] = 7n - 4
Step-by-step explanation:
The n th term of an arithmetic sequence is
[tex]a_{n}[/tex] = a₁ + (n - 1)d
where a₁ is the first term and d the common difference
Here a₁ = 3 and d = a₂ - a₁ = 10 - 3 = 7 , thus
[tex]a_{n}[/tex] = 3 + 7(n - 1) = 3 + 7n - 7 = 7n - 4
ABC is congruent to EDC, BC = 5 units and DE = 12 units. What is the length of AE?
Answer:
AE = 26 units
Step-by-step explanation:
Given that ABC is congruent to EDC, therefore, the corresponding angles and corresponding lengths of ∆ABC and ∆EDC are equal to each other in measure.
AE = 2(AC) = 2(CE) or
AE = AC + CE
Let's find the AC using Pythagorean Theorem, since the ∆s are both right triangles.
BA is congruent to DE.
Since DE = 12 units, therefore, BA = 12 units.
BC = 5 units (given)
Using Pythagorean Theorem:
AC² = BA² + BC²
AC² = 12² + 5² (substitution)
AC² = 144 + 25 = 169
AC = √169
AC = 13 units
Since ∆ABC = ∆EDC, therefore:
AE = 2(AC)
AE = 2(13)
AE = 26 units
what is 2 over 5 simplafied
Answer:
2/5 simplified is 1/2.5 or .4
Step-by-step explanation:
You simplify by dividing the numerator by the denominator. Thus 2/5 is
.40.
Hope this helps!
What is an equation of the line that passes through the points (7, 6) and (-2, -3)?
Answer:
y=1x-1
Step-by-step explanation:
m=y2-y1/x2-x1
-3-6=(-9)
-2-7=(-9)
-9/-9=1
6=1*7+b
1*7=7
7-7=0
6-7=-1
b=-1
y=1x-1
hope this helps :3
if it did pls mark brainliest
HeLp Me pLz
What is the shape of the cross section of the figure that is perpendicular to the triangular bases and passes through a vertex of the triangular bases?
A triangular prism.
a parallelogram that is not a rectangle
a rectangle
a triangle that must have the same dimensions as the bases
a triangle that may not have the same dimensions as the bases
Given: AB ∩ CD ∩ GF = O, E ∈ interior of ∠GOB, H ∈ interior of ∠AOF. Without changing the picture indicate: Vertical angle to ∠GOB: ____________
Answer:
The verticle angle to GOB is AOF.
Step-by-step explanation:
Look at the picture, it's pretty clear
17. Let f(x) = 2x2 + 5x + 6 and g(x) = 3x2 + 4x – 10.
a Find f(x) + g(x)
b. Find f(x) – g(x)
Step-by-step explanation:
f(x)+g(x)=(2x^2 + 5x +6) + (3x^2 +4x - 10)
Combine like terms
5x^2 + 9x -4
f(x)-g(x)=(2x^2 + 5x +6) - (3x^2 +4x - 10)
Distribute the negative
(2x^2 + 5x +6) + (-3x^2 -4x + 10)
Combine like terms
-x^2 +x +16
Learn with an example
A triangle has angle measurements of 121°, 35°, and 24°. What kind of triangle is it?
acute
right
obtuse
Answer:
Obtuse
Step-by-step explanation:
because 121
Which of the following mixtures will have a stronger coffee flavor? explain please thank you!!
A) Mixture B
B) Mixture A
C) Both the mixtures are equally strong.
At a food festival, 3/8 of the dishes were from china. Another 12.5% of the dishes were from japan. What percent of the dishes were from the other countries?
Answer: 50%
Step-by-step explanation:
Let x = Total dishes.
Dishes from China = [tex]\dfrac38x[/tex]
Dishes from Japan = [tex]12.5\% \text{ of }x= 0.125x[/tex]
Total dishes from China and Japan = [tex]\dfrac38 x+0.125x=0.375x+0.125x=0.5x[/tex]
Dishes from other countries [tex]= x- 0.5x= 0.5x[/tex]
Percent of dishes from other countries= [tex]\dfrac{0.5x}{x}\times100\%= 50\%[/tex]
Hence, dishes from other countries = 50%
What is the image point of (3, -3) after a translation left 3 units and up 4 units?.
Answer:
(0, 1)
Step-by-step explanation:
(x, y)
Left and Right movement deals with the x value
Up and Down movement deals with the y value
3 units left = -3
4 units up = +4
(x - 3, y + 4)
(3 - 3, -3 + 4)
(0, 1)
The image point of (3, -3) after a translation of [tex](-3, 4)[/tex] is [tex](0,1)[/tex].
Determination of the coordinates of resulting point after translationGeometrically speaking, a translation is determined by following formula:
[tex]V'(x,y) = V(x,y) + T(x,y)[/tex] (1)
Where:
[tex]V(x,y)[/tex] - Original point[tex]T(x,y)[/tex] - Translation vector[tex]V'(x,y)[/tex] - Resulting pointIf we know that [tex]V(x,y) = (3, -3)[/tex] and [tex]T(x,y) = (-3, 4)[/tex], then the coordinates of the resulting point are, respectively:
[tex]V'(x,y) = (3, -3) + (-3, 4)[/tex]
[tex]V'(x,y) = (0, 1)[/tex]
The image point of (3, -3) after a translation of [tex](-3, 4)[/tex] is [tex](0,1)[/tex]. [tex]\blacksquare[/tex]
To learn more on translations, we kindly invite to check this verified question: https://brainly.com/question/17485121
3. Solve for a
5(a-2) = 2(10+a)
it’s due by midnight and can you also tell me how you got the answer
Answer:
a=10
Step-by-step explanation:
distribute on both sides to get
5a-10=20+2a
add/subtract like terms
5a-2a=3a
20+10=30
so the equation is
3a=30
divide 30 by 3 and you get 10
Answer:
a = 10
Step-by-step explanation:
[tex]5(a - 2) = 2(10 + a) \\ \\ 5a - 10= 20 + 2a\\ \\ 5a - 2a= 20 + 10\\ \\ 3a = 30\\ \\ a = \frac{30}{3} \\ \\ \huge \red{ \boxed{a = 10}}[/tex]
Suppose that 2000 is placed in an account that pays 13% interest compounded each year. Assume that no withdrawals are made from the account. Do not do any rounding.
A:Find the amount in the account at the end of 1 year.
B: Find the amount in the account at the end of 2 years.
The amount will be $2260 in the account at the end of 1 year. The amount will be $2553.8 in the account at the end of 2 years.
What is Compound interest?Compound interest is defined as interest paid on the original principal and the interest earned on the interest of the principal.
A = P(1+r/100)ⁿ
Where:
A = the future value of the investment or loan
P = the principal investment or loan amount
r = the interest rate (decimal)
n = the number of compound periods
As per the question, the given data will be:
p = $2000
r = 13%
t = 1 year
To calculate the amount in the account at the end of 1 year.
A = P(1+r/100)ⁿ
Substitute the values of p,r, and t in the formula,
A = 2000(1 + 13/100)¹
A = 2000(1 + 0.13)¹
A = 2000(1.13)
A = $2260
To calculate the amount in the account at the end of 2 years.
A = 2000(1 + 13/100)²
A = 2000(1 + 0.13)²
A = 2000(1.13)²
A = $2553.8
Thus, the amount will be $2260 in the account at the end of 1 year. The amount will be $2553.8 in the account at the end of 2 years.
To learn more about Compound interest click here:
brainly.com/question/25857212
#SPJ2
Does this image have a set of inputs to a set of possible outputs where each input is related to exactly one outputs Yes or No?
Explain your answer
Answer: Yes
This graph passes the vertical line test. This is a test where we try to draw a single vertical line through more than one point on the curve. In this case, such a thing is not possible. Any input x leads to exactly one output y. This graph is a function.
Bernard says “When you halve a whole number that ends in 8, you always
get a number that ends in 4”
Write down an example to show that Bernard is wrong.
is this a trick question?
Answer:
Bernad is WRONG.
Step-by-step explanation:
Let us take the number '18' (ends with 8)
The half of 18 is '9' (doesn't end with 4)
Let us take the number '38' (ends with 8)
The half of 38 is '19' (doesn't end with 4)
Therefore, Bernard is wrong.
Bernard is wrong because When you halve a whole number that ends in 8, you always cannot get a number that ends in 4”
What is an arithmetic operation?It is defined as the operation in which we do the addition of numbers, subtraction, multiplication, and division. It has a basic four operators that is +, -, ×, and ÷.
It is given that:
Bernard says “When you halve a whole number that ends in 8, you always get a number that ends in 4”
It can be written mathematically:
Let's suppose the number is '18' (ends with 8)
The half of 18 = 9 (doesn't end with 4)
Let's suppose the number is '38' (ends with 8)
The half of 38 = 19 (doesn't end with 4)
Thus, Bernard is wrong because When you halve a whole number that ends in 8, you always cannot get a number that ends in 4”
Learn more about the arithmetic operation here:
brainly.com/question/20595275
#SPJ2
On a coordinate plane, a line goes through points (1, 9) and (4, 3).
What is the slope of a line that contains the points (1, 9) and (4, 3)?
Answer:
yes
Step-by-step explanation:
l,l,;,;,;,;l,;,;
What is the volume of a cylinder with a radius of 1.5 inches and a height of 9 inches round your answer to the nearest hundredthWhat is the volume of a cylinder with a radius of 1.5 inches and a height of 9 inches round your answer to the nearest hundredth
Answer:
V = 63.62
Step-by-step explanation:
Answer: 63.62 cubic inches
Step-by-step explanation:
REMEMBER :: VOLUME OF CYLINDER = πr^2h
r= 1.5 in.
h= 9 in.
V= π (1.5)^2 (9)
V= π (2.25) (9)
V= π (20.25)
V~63.6172512...
nearest hundredth = 63.62 cubic inches
If f(x) = x2 + 2x + 3, what is the average rate of change of Rx) over the interval (-4, 6]?
Answer:
Step-by-step explanation:
The average rate of change of a function over an interval is simply the slope over the interval because:
[tex]let \: g(x)=f'(x)\\\frac{\int\limits^b_a {g(x)} \, dx }{b-a}(the\:average\:value\:of\:g)=\frac{f(b)-f(a)}{b-a}[/tex]
We have to know f(6) and f(-4)
[tex]f(x) = x^2 + 2x + 3\\f(6) = 6^2 + 2(6) + 3\\f(6) = 36 + 12 + 3\\f(6) = 51\\\\f(-4) = (-4)^2 + 2(-4) + 3\\f(-4) = 16 - 8 + 3\\f(-4) = 11\\\\\frac{f(6)-f(-4)}{6-(-4)} = \frac{51-11}{10} = \frac{40}{10} = 4[/tex]
PLEASE HELP PLEASE I NEED IT TODAY
Answer:
D
:) Hope this helps.
Step-by-step explanation:
which expression is equivalent to sin(pi/12)cos(7pi/12)-cos(pi/12)sin(7pi/12)? a) cos(-pi/2) b) sin(-pi/2) c) cos(2pi/3) d) sin(2pi/3)
Answer:A
Step-by-step explanation:
Edge 2020
[tex]sin(\frac{\pi }{12})cos(\frac{7\pi}{12}) -cos(\frac{\pi }{12})sin(\frac{7\pi }{12})[/tex] is equivalent to [tex]sin(\frac{-\pi }{2} )[/tex].
What is trigonometric expression?Trigonometric expressions are non-routine appearing problems. They are unfamiliar because the language of trigonometry looks foreign and complicated. In order to learn how to simplify or reduce the complexity of trigonometric expressions, we first need to examine the identities we need to utilize.
It is one of the identities of trigonometry
sinAcosB - cosAsinB = sin(A - B)
Given expression
[tex]sin(\frac{\pi }{12})cos(\frac{7\pi}{12}) -cos(\frac{\pi }{12})sin(\frac{7\pi }{12})[/tex]
It is in form of sinAcosB - cosAsinB = sin(A - B)
⇒ [tex]sin(\frac{\pi }{12})cos(\frac{7\pi}{12}) -cos(\frac{\pi }{12})sin(\frac{7\pi }{12})[/tex] = [tex]sin(\frac{\pi }{12}-\frac{7\pi }{12} )[/tex]
⇒ [tex]sin(\frac{\pi }{12})cos(\frac{7\pi}{12}) -cos(\frac{\pi }{12})sin(\frac{7\pi }{12})[/tex] = [tex]sin(\frac{-6\pi }{12} )[/tex]
⇒ [tex]sin(\frac{\pi }{12})cos(\frac{7\pi}{12}) -cos(\frac{\pi }{12})sin(\frac{7\pi }{12})[/tex] = [tex]sin(\frac{-\pi }{2} )[/tex]
Hence [tex]sin(\frac{\pi }{12})cos(\frac{7\pi}{12}) -cos(\frac{\pi }{12})sin(\frac{7\pi }{12})[/tex] is equivalent to [tex]sin(\frac{-\pi }{2} )[/tex].
Find out more information about trigonometric expression here
https://brainly.com/question/2142049
#SPJ2
Evaluate: 21x: 8 when x = 4*
Answer:
10.5
Step-by-step explanation:
21(4) / 8
84 / 8
10.5