Explain how to find the point equidistant from all three vertices in the given triangle. Choose the correct answer below. A. Find the intersection of the perpendicular bisectors of each side of the triangle B. Find the intersection of all of the midsegments of the triangle, C. Find the intersection of the angle bisectors of each angle of the triangle, D. Find the midpoint of the line segment that bisects Angle B.

Answers

Answer 1

ANSWER:

The correct option is the following:

C. Find the intersection of the angle bisectors of each angle of the triangle,

EXPLANATION:

The point that equidistant is the point at which the three bisectors of the internal angles of the triangle intersect, and it is the center of the circumference inscribed in the triangle and equidistant from its three sides.

IMPORTANT NOTE:

Any point on the bisector of an angle of a triangle equidistant from the sides that define that angle.


Related Questions

What is the measure of ?ХvO A. 46°42°42"38°NуvO B. 42°O C. 40°O D. 38°

Answers

The value Z is denoted as the center of the circle. Therefore, arc UV and arc XY should be the same .

[tex]undefined[/tex]

Answer: A. 42°

Step-by-step explanation:

Hope this helps :)

On a 7 question multiple-choice test, where each question has 2 answers, what would be the probability of getting at least one question wrong?Give your answer as a fraction

Answers

Solution

- This is a Binomial probability question. The formula for Binomial probability is:

[tex]\begin{gathered} P(r)=\sum\text{ }^nC_rp^rq^{n-r} \\ where, \\ n=The\text{ total number of trials} \\ r=\text{ The number of successful trials\lparen where answer is correct\rparen} \\ p=\text{ The probability of success \lparen The probability of getting a question } \\ right) \end{gathered}[/tex]

- We have been given:

[tex]\begin{gathered} n=7 \\ \text{ since there can only be two answers, it means that the} \\ \text{ probability of getting a question correct is:} \\ p=\frac{1}{2} \\ q=1-p=\frac{1}{2} \\ \\ \text{ The probability of getting at least 1 question wrong means the } \\ probability\text{ of getting 1, 2, 3, 4, 5, 6, or 7 question wrong.} \\ \\ \text{ Instead of calculating all these probabilities, we can simply say} \\ P(1)+P(2)+P(3)+P(4)+P(5)+P(6)+P(7)=1-P(0) \end{gathered}[/tex]

- Thus, we have:

[tex]\begin{gathered} P(0)=^7C_0(\frac{1}{2})^0(\frac{1}{2})^7 \\ P(0)=\frac{1}{128} \\ \\ 1-P(0)=1-\frac{1}{128}=\frac{127}{128} \end{gathered}[/tex]

Final Answer

The answer is

[tex]\frac{127}{128}[/tex]

helppppppppppppppppppppppppppp

Answers

Step-by-step explanation:

make the fractions decimals and put them on the plot

Marcy baked 132 cookies . She is packaging boxes of eight cookies to give as a gift to he friends how many boxes will she make .

Answers

She will make 16 boxes.

To answer this question we simply have to divide the number of cookies (132) by the number of cookies that each box can contain.

Mathematically speaking:

[tex]132/8\text{ }[/tex][tex]16.5[/tex]

Since we can´t have half boxes, we have to round the number to 16.

16 boxes.

9. If L 1 equals 120 then what is the measure of its supplement <2=

Answers

Supplementary angles are angles whose addition sums up to 180 degrees.

Therefore, if angle 1 measures 120, then its supplement which is angle 2, must mean both add up to 180.

Hence, you have

Angle 1 + Angle 2 = 180

120 + Angle 2 = 180

Subtract 120 from both sides of the equation

Angle 2 = 180 - 120

Angle 2 = 60 degrees

By definiton, two angles are complimentary angles if they both add up to 90 degrees. Hence if angle L5 equals 50 degrees, then its compliment would be derived as 90 - 50 which equals 40. The compliment of angle L5 which is 50 degrees, equals 40 degrees.

Jordan plotted the graph below to show the relationship between the temperature of his city and the number of cups of hot chocolate he sold daily:A scatter plot is shown with the title Jordans Hot Chocolate Sales. The x axis is labeled High Temperature and the y axis is labeled Cups of Hot Chocolate Sold. Data points are located at 20 and 20, 30 and 18, 40 and 20, 35 and 15, 50 and 20, 45 and 20, 60 and 14, 65 and 18, 80 and 10, 70 and 8, 40 and 2.Part A: In your own words, describe the relationship between the temperature of the city and the number of cups of hot chocolate sold. (2 points)Part B: Describe how you can make the line of best fit. Write the approximate slope and y-intercept of the line of best fit. Show your work, including the points that you use to calculate the slope and y-intercept. (3 points)

Answers

A.

Overall it has a relation that there are more sold cups when the temperature is lower. On the other hand, based on the 40 degrees part, that have to different values of two different days, we can say is not the only factor.

B.

The best lineal approach is the line created with the points at 20 and 80 degrees. First the slope:

[tex]m=\frac{y1-y2}{x1-x2}=\frac{20-10}{20-80}=\frac{10}{-60}=-\frac{1}{6}[/tex]

Now the intercept with y axis, b:

[tex]\begin{gathered} y=mx+b \\ 20=20(-\frac{1}{6})+b \\ 20+\frac{20}{6}=b=23.33=\frac{70}{3} \end{gathered}[/tex]

The final line formula is:

[tex]y=-\frac{x}{6}+\frac{70}{3}[/tex]

Which expression is equivalent to (6 – 3x) + 9x ? 1 A. 8x + 2 B. 8x + 3 C. 10x-2 D. 10x - 6

Answers

Given to solve the expression:

[tex]\frac{1}{3}(6-3x)+9x[/tex]

step 1: Expand the bracket by multiplying each term by the factor outside

[tex]\begin{gathered} (\frac{1}{3}\times6)-(\frac{1}{3}\times3x)+9x \\ 2-x+9x \end{gathered}[/tex]

step 2: Simplify the expression obtained in step 1

[tex]\begin{gathered} 2-x+9x\text{ } \\ =2+8x \\ =8x+2 \\ \\ \text{The answer is \lbrack{}Option }A\rbrack \end{gathered}[/tex]

omg i lost my tutor in the middle of math i need another one btw in fith grade not in middle school yet

Answers

[tex]\frac{6}{10}\text{/}\frac{1}{5}[/tex]

by definition the division of fractions can be found by

[tex]\frac{\frac{a}{b}}{\frac{c}{d}}=\frac{b\cdot c}{a\cdot d}[/tex]

According to this

[tex]\frac{\frac{6}{10}}{\frac{1}{5}}=\frac{6\cdot5}{10\cdot1}=\frac{30}{10}=3[/tex]

Is (6, –21) a solution to the equation y = –5x − –9?

Answers

Answer:

Explanation:

Given the equation:

[tex]y=-5x-(-9)[/tex]

When x=6:

Use the Rational Zeros Theorem to find all the real zeros of the polynomial function. Use the zeros to factor f over the real numbers. Hint solve this problem using P and Q's and synthetic division f(x) = x^3 + 2x^2 - 5x - 6A -3, -1, 2; f(x) = (x + 3)(x + 1)(x - 2)B-1; f(x) = (x + 1)(x2 + x - 6)C-3; f(x) = (x + 3)(x2 - x - 2)D-2, 1, 3; f(x) = (x + 2)(x - 1)(x - 3)

Answers

[tex]f(x)=x^3+2x^2-5x-6[/tex]

Since all coefficients are integers, we can apply the rational zeros theorem.

The trailing coefficient is -6 with the following factors (possible values for p):

[tex]p\colon\pm1,\pm2,\pm3,\pm6[/tex]

The leading coefficient is 1, with factors:

[tex]q=\pm1[/tex]

Therefore, all the possible values of p/q are:

[tex]\frac{p}{q}\colon\pm\frac{1}{1},\pm\frac{2}{1},\pm\frac{3}{1},\pm\frac{6}{1}[/tex]

Simplifying, the possible rational roots are:

[tex]\pm1,\pm2,\pm3,\pm6[/tex]

Next, we have to check if they are roots of the polynomials by synthetic division, in which the remainder should be equal to 0.

0. Dividing ,f (x), by ,x−1,. Remainder = ,-8, ,+1, is ,NOT ,a root.

,

1. Dividing ,f (x), by x+,1,. Remainder = 0, ,-1, ,IS ,a root.

,

2. Dividing ,f (x), by x-2. Remainder = 0, ,+2, ,IS ,a root.

,

3. Dividing ,f (x), by ,x+2,. Remainder = ,4, ,-2, is ,NOT ,a root.

,

4. Dividing ,f (x), by ,x−3,. Remainder = 24,, ,+3, is ,NOT ,a root.

,

5. Dividing ,f (x), by ,x+3,. Remainder = 0,, ,-3, IS ,a root.

,

6. Dividing ,f (x), by ,x−6,. Remainder = 252,, ,+6, is ,NOT ,a root.

,

7. Dividing ,f (x), by ,x+6,. Remainder = -120,, ,-6, is ,NOT ,a root.

Actual rational roots: A. -3, -1, 2; f(x) = (x + 3)(x + 1)(x - 2)

A train travels at 100 mph any equation can be written that compares the time with the distance to find the domain and range

Answers

ok

speed = distance / time

time = distance/speed

[tex]\text{ time = }\frac{dis\tan ce\text{ }}{speed}[/tex][tex]\text{ time = }\frac{dis\tan ce\text{ }}{100}[/tex]

or

[tex]\text{ distance = 100 x time}[/tex]

Write the ordered pair with no spaces (x,y) of point C for j(x).

Answers

This problem is about functions.

In this case, we don't have function j(x) defined in order to find its ordered pairs.

However, assuming that function j(x) is a function of f(x), we can deduct that points C is

[tex]C(0,0)[/tex]

A 14 m long ladder is placed against a tree. The top of the ladder reaches a point
13 m up the tree.

How far away is the base of the ladder from the base of the tree?

Give your answer in metres (m) to 1 d.p.

Answers

Answer:

Approximately 5.2 meters

Step-by-step explanation:

This formation will make a right triangle. The ground to the point in the tree is one of the legs. The base of the tree to the base of ladder is another leg and the length of the ladder is the hypotenuse. In this case, we already have the hypotenuse and one of the legs, so we need to find the value of another leg.

We can do so by using the Pythagorean Theorem which is [tex]a^2+b^2=c^2\\[/tex].

a and b represent the values of the two legs, and c is the hypotenuse. Since we already have the hypotenuse, we can change this equation a bit to find the other leg.

Let's assign the missing value, b in the theorem.

The new equation will be [tex]b^2=c^2-a^2[/tex].

We can insert the values for c and a and solve for b.

The new equation will be [tex]b^2 = 14^2-13^2[/tex].

[tex]b^2=196-169[/tex]

[tex]b^2=27[/tex]

[tex]\sqrt{b^2} =\sqrt{27}[/tex]

The square root of [tex]b^2[/tex] cancels out.

The approximate square root of 27 is 5.19 which we can round to 5.2.

The relation between the number of batteries (n) and the maximum height reached by the drone (h) in feet (ft) is given. Complete the table and check the correct box(es) given below.

Answers

We use the equation: h = 100(n + 2), so:

For n = 1:

[tex]h=100(1+2)=100(3)=300[/tex]

For n = 3:

[tex]h=100(3+2)=100(5)=500[/tex]

We can see that this is the correct equation. Therefore, given h we find n:

For h = 700

[tex]\begin{gathered} 700=100(n+2) \\ \frac{700}{100}=\frac{100}{100}(n+2) \\ 7=n+2 \\ 7-2=n+2-2 \\ n=5 \end{gathered}[/tex]

For h = 900

[tex]\begin{gathered} 900=100(n+2) \\ \frac{900}{100}=\frac{100}{100}(n+2) \\ 9=n+2 \\ 9-2=n+2-2 \\ n=7 \end{gathered}[/tex]

Answer:

(n): 1 3 5 7

(h): 300 500 700 900

Correct equation: h = 100(n + 2)

Function g is a transformation of the parent function exponential function. Which statements are true about function g?

Answers

For the given function, The following are true statements:

Four units separate function g from function f.There is a y-intercept for function g. (0,4)Function g has a range of (3,∞ ).Over the range (-, ∞), function g is positive.

It may be seen from the graph below that

The g function's graph is 4 units higher than the parent exponential function's graph.

All of the input values for which the function is defined are referred to as the function's domain. The domain of the function is (-, ∞ ) according to the graph of function g.

The location where a function's graph crosses the y-axis is known as the y-intercept. G's graph crosses the y-axis at (0, 4). As a result, the Function g's y-intercept is (0,4).

growing function g across the range (- ∞, 0).

Function output values are referred to as the function's range. It can be seen from the graph that the range of function g is (3, ∞ ).

To learn more about functions, https://brainly.com/question/21145944

#SPJ9

use and show all conversion factors to convert 352 inches per second to miles per hour. 352 inches divided by 1 second

Answers

Okay, here we have this:

We need to convert 352 inches per second to miles per hour. So we obtain the following:

[tex]\begin{gathered} \frac{352in}{1sc}\cdot\frac{1mile}{63360in}\cdot\frac{3600sc}{1h} \\ =\frac{20\text{miles}}{h} \end{gathered}[/tex]

Finally we obtain that 352 inches per second 20 are miles per hour.

In the diagram shown, ray CD is perpendicular to ray CE. If the measure of DCF is 115then what is the measure of ECF?

Answers

m∠FCE =25º

1) Since the measure of ∠DCF = 115º and ∠DCE = 90º then by the Angle Addition postulate we can state that

∠DCF = ∠DCE +∠FCE Plugging into that the given values

115º = 90º + ∠FCE Subtracting 90º from both sides

115-90=∠FCE

25º =∠FCE

2) Then the measure of ∠FCE is 25º

how many pennies are in a dollar

Answers

Answer: 100

Step-by-step explanation:

$1 =100 pennies

mrs smith took her 3 kids and 3 of thejr friends to the Strawberry field. how many kids are there?

Answers

Mrs.Smith took : her 3 kids + 3 of their friends = 3 + ( 3x 3 ) = 12 kids

Answer:

There are 3 kids, and 3 friends.

3 + 3 = 6

there are a total of 6 kids.

Given the definitions of f(a) and g(x) below, find the value of (19)( 1),f (x) = x2 + 3x – 11g(x) = 3a + 6

Answers

The given functions are,

[tex]\begin{gathered} f(x)=x^2+3x-11_{} \\ g(x)=3x+6 \end{gathered}[/tex]

Fog can be determined as,

[tex]\begin{gathered} \text{fog}=f(g(x)) \\ =f(3x+6) \\ =(3x+6)^2+3(3x+6)-11 \\ =9x^2+36+36x+9x+18-11 \\ =9x^2+45x+43 \end{gathered}[/tex]

The value of fog(-1) can be determined as,

[tex]\begin{gathered} \text{fog}(-1)=9(-1)^2+45(-1)+43 \\ =9-45+43 \\ =7 \end{gathered}[/tex]

Thus, the requried value is 7.

The height of a pole is 15 feet. A line with banners is connected to the top of the poleto a point that is 8 feet from the base of the pole on the ground. How long would theline with banners need to be in order for the pole to be at a 90° angle with the ground?Explain your reasoning.

Answers

In order to have a 90º angle (right angle) the length of the line with banners needs to fullfit the Pythagorean theorem: In a right triangle the squared hypotenuse is equal to the sum of the legs squared:

[tex]h^2=l^2+l^2[/tex]

In the given situation the hypotenusa is the line with banners, and the legs are the pole and the 8ft ground from the base of the pole to the end of the line with banners:

h= x

l= 15ft

l= 8ft

[tex]x^2=(15ft)^2+(8ft)^2[/tex]

Solve the equation to find the value of x:

[tex]\begin{gathered} x^2=225ft^2+64ft^2 \\ x^2=289ft^2 \\ x=\sqrt[]{289ft^2} \\ x=17ft \end{gathered}[/tex]Then, to make a right triangle the length of the line witg banners need to be 17ft

PLEASE HURRY ASAP
Determine which integer in the solution set will make the equation true.

4s − 14 = −6
S: {−1, 0, 1, 2}

Answers

The solution of the equation is s=2.

Linear Function

An equation can be represented by a linear function. The standard form for the linear equation is: y= mx+b , for example, y=7x+1. Where:

m= the slope. It can be calculated for Δy/Δx .

b= the constant term that represents the y-intercept.

For the given example: m=7and b=1.

For solving this question you should replace x for the given values ( −1, 0, 1, 2) in the equation 4s − 14 = −6. If you obtain -6, the value of s is a solution.

For s= -1 -> 4*(-1)-14= -4 -14= -20. Therefore, s=-1 is not the solution.

For s= 0 -> 4*(0)-14= 0 -14= -14. Therefore, s=0 is not the solution.

For s= 1 -> 4*(1)-14= 4 -14= -10. Therefore, s= 1 is not the solution.

For s= 2 -> 4*(2)-14= 8 -14= -6. Therefore, s=2 is the  solution.

Read more about the linear equations here:

brainly.com/question/2030026

#SPJ1

Solve each equation for the variable. h/2 + 3.5 = 7.1

Answers

To answer this question, we can proceed as follows:

[tex]\frac{h}{2}+3.5=7.1[/tex]

1. Subtract 3.5 to both sides of the equation:

[tex]\frac{h}{2}+3.5-3.5=7.1-3.5\Rightarrow\frac{h}{2}+0=3.6[/tex]

2. Multiply by 2 to both sides of the equation:

[tex]2\cdot\frac{h}{2}=2\cdot3.6\Rightarrow h=7.2[/tex]

We can check this result as follows:

[tex]\frac{7.2}{2}+3.5=3.6+3.5=7.1\Rightarrow7.1=7.1[/tex]

This result is TRUE. Then, the value for h = 7.2.

Complete the table for y=-3x + 5 and graph the resulting line. -

Answers

We fill the table as follows:

*We assign values for x and solve for y, that is:

*x = 0:

[tex]y=-3(0)+5\Rightarrow y=5[/tex]

So, the value of y when x = 0 is 5.

*x = 1:

[tex]y=-3(1)+5\Rightarrow y=2[/tex]

So, the value of y when x = 1 is 2.

*x = 2:

[tex]y=-3(2)+5\Rightarrow y=-1[/tex]

So, the value of y when x = 2 is -1.

*x = 3:

[tex]y=-3(3)+5\Rightarrow y=-4[/tex]

So, the value of y when x = 3 is -4.

***The table should look like this:

x | y

0 | 5

1 | 2

2 | -1

3 | -4

***The graph is:

HELP PLEASEEEEE!!!!!!

Answers

The solutions of the indices are;

1)  2^7

2) 3^-4

3) 3^4

4) 2^4

What is the power?

We know that in this case, we would have to apply the laws of indices and the particular law that we are to apply in each case is dependent on the nature of the problem that have been posed. Let us recall that we are asked to ensure that we express the answer or the solution to the problem as a single power.

1) 64 * 256/128

2^6 * 2^8/2^7

2^6 + 8 - 7 = 2^7

2) 3^4/3^3 * 3^5

3^4 - (3 + 5) = 3^-4

3) 3^9/ (3^4)^1/2 * 3^3

3^9/ 3^2 * 3^3

3^9 - (2 + 3)

3^4

4) (2^3)^4 * 2^4 ÷ 32/ 2 * 64

2^12 * 2^4 ÷ 2^5/2^1 * 2^6

2^12 + 4 -5/2^1 + 6

2^16 -5/2^7

2^11/2^7

2^11 - 7

2^4

Learn more about laws of indices:https://brainly.com/question/27432311

#SPJ1

what does this mean i dont get it please help me thanks, :)

Answers

It means that you are supposed to group The like terms together and simplify them

you will find that 2t is the liketerm with -5t and -u is a like term with -6u

As a results we have

[tex] = 2t - 5t - u - 6u \\ = - 3t - 7u[/tex]

as indicated I have shown you the answer .

good luck

how can you use the vertical line test and the horizontal line test to determine whether a graph represents a function and whether the graph is invertible?

Answers

In this case, we'll have to carry out several steps to find the solution.

Step 01:

Data

vertical line test = ?

horizontal line test = ?

Step 02:

vertical line test ===> function

any vertical line intersect the graph at only one point

horizontal line test ===> invertible

any horizontal line intersect the graph at only one point

graph:

horizontal line test = red

vertical line test = brown

That is the full solution.

select all of the following equations which represent a function?

Answers

To verify that something is a function, we use the horizontal line rule. That is, if the horizontal line passes through two points, then the graph is not a function, like this:

Then the circles and the ellipses are not functions. Then the functions in the problem would be:

1, 3 and 6.

find the x value (6x+9)° (4x-19)°

Answers

In this problem m and n are parallel lines, and the first angle is an exteriar angle an the secon is a interior angle.

this two condition give us that the two angles are complementary anlges so the sum of them should be 180 so:

[tex]6x+9+4x-19=180[/tex]

and we can solve for x so:

[tex]\begin{gathered} 10x-10=180 \\ 10x=180+10 \\ x=\frac{190}{10} \\ x=19 \end{gathered}[/tex]

1. what is the area of the board shown on the scale drawing? explain how you found the area.2. how can Adam use the scale factor to find the area of the actual electronics board? remember, he uses a different method than Jason.3. what is the area of the actual electronics board?

Answers

Answer:

1. 1800 square cm.

2. See below

3. 45000 square cm.

Explanation:

Part 1

The dimensions of the drawing are 36cm by 50cm.

[tex]\begin{gathered} \text{The area of the board}=36\times50 \\ =1800\operatorname{cm}^2 \end{gathered}[/tex]

Part 2

Given a scale factor, k

If the area of the scale drawing is A; then we can find the area of the actual board by multiplying the area of the scale drawing by the square of k.

Part 3

[tex]\begin{gathered} \text{Area of the scale drawing}=1800\operatorname{cm}^2 \\ \text{Scale Factor,k=5} \end{gathered}[/tex]

Therefore, the area of the actual drawing will be:

[tex]\begin{gathered} 1800\times5^2 \\ =45,000\operatorname{cm}^2 \end{gathered}[/tex]

Other Questions
multiple select question select all that apply excessive inventory on hand, especially in the work in process inventory account, may lead to blank . multiple select question. price increases in direct materials obsolete goods inefficient operations high defect rates define what a voucher is by completing the following sentence. a voucher is an (internal/external) document (or file) used to accumulate information to (reduce/control) cash payments and to ensure that a transaction is properly recorded. What generalizations can you make about the political experience of those who took part in the convention?. There are 4 options on the dessert menu at a restaurant. Bill and Laura like all of the choices equallyeach choose a dessert at random from the menu. What is the probability that Bill will choose apple pLaura will choose strawberry cheesecake for dessert? Express your answer as a decimal. If necessalyour answer to the nearest thousandth.0 0.938O 0.063O 0.25O 0.083 mark's manufacturing's average age of accounts receivable is 45 days, the average age of accounts payable is 40 days, and the average age of inventory is 69 days. assuming a 365-day year, what is the length of its cash conversion cycle? a. 78 days b. 67 days c. 74 days d. 63 days e. 70 days Stella needed to get her computer fixed. She took it to the repair store. The technicianat the store worked on the computer for 4 hours and charged her $59 for parts. Thetotal was $359. Which tape diagram could be used to represent the context if zrepresents the cost of labor per hour? are you a soc or a greaser? why? what are the differences? examine the characteristics of each group, its actions, and the choices they made. use specific examples from the outsiders. PLEASE ANSWER ASAP! On average, there is enough wind in the UK each year to supply all of the UK's electricity needs.Explain why the UK may still need power stations that use fuel to generate electricity.(2 marks) Please help with this practice question which of the following is true of ethics and its application to the business environment? conflicts rarely occur between an individual's ethics and a business organization's ethics. employers prefer to hire individuals whose ethics conflict with that of the business organization. personal values have no place in business, where decisions should be made according to organizational values and norms. the ethical norms and values of a business can have a powerful influence on its employees. A Plote Boundary where two plates move toward each other is called part a. A delivery drone, hovering at an altitude of 260. m above the ground, drops a package. ("dropped" means that it was stationary when released ). How long will it take to reach the ground? part b. What will be the velocity of the package the instant before it hits the ground? 10 1/3 make sure the answer is a fraction and that u explain whenever the professor asks a question in class, matt looks anywhere in the classroom except at the professor so that she won't call on him. he is afraid of giving a wrong answer and making a fool of himself in front of his classmates. what type of goal orientation is matt demonstrating? richard sands is the ceo of constellation brands, the world's largest wine producer. he has the legitimate power and right to make decisions about how the division is run and to influence others to carry out these decisions. he has: CALCULATO 11 i You spin the spinner, flip a coin, then spin the spinner again. Find the probability of the compound event. Write your answer as a fraction or percent. If necessary round your answer to the nearest hundredth. 1 2 3 The probability of spinning blue, flipping heads, then spinning a 1 is assuming that your organization has 500 users, and that only 40 of these users need to regularly print contract documents, how could you design a print device and print server solution that would minimize printing costs and environmental footprint? I don't know who to do this assignmentAn employees total weekly pay equals the hourly wage multiplied by the total number of regular hours plus any overtime pay. Overtime pay equals the total overtime hours multiplied by 1.5 times the hourly wage. Write a program that takes as inputs the hourly wage, total regular hours, and total overtime hours and displays an employees total weekly pay. What is one of the major roles district courts play in the federal judiciary? If $5000 is invested at 9% annual simple interest, how long does it take to be worth $9050?