draw the structure(s) of the major organic product(s) of the following reaction. p-toluenesulfonic acid/toulene reflux

Answers

Answer 1

The p-toluenesulfonic acid/toluene reflux reaction leads to the formation of a product with a new sigma bond between the two carbons and a pi bond between the carbon and the hydrogen atom that was newly formed.

The major organic product(s) of the reaction p-toluenesulfonic acid/toulene reflux are as follows:

When toluene and p-toluenesulfonic acid are refluxed, p-toluenesulfonic acid replaces a hydrogen atom on the methyl group.

In the final structure, the sulfuric acid molecule departs and a carbocation appears. The electrons of the pi bond in the aromatic ring attack the carbocation, forming a sigma bond between the two carbons and a pi bond between the carbon and the newly formed hydrogen atom.

The reaction p-toluenesulfonic acid/toluene reflux results in the replacement of a hydrogen atom on the methyl group by the p-toluenesulfonic acid. This is then followed by the removal of the sulfuric acid molecule leading to the formation of a carbocation. The pi bond electrons of the aromatic ring then attack the carbocation, leading to the formation of a sigma bond between the two carbons and a pi bond between the carbon and the hydrogen atom that was newly formed. This reaction results in the formation of the major organic product(s) of the reaction p-toluenesulfonic acid/toulene reflux.

The p-toluenesulfonic acid/toluene reflux reaction leads to the formation of a product with a new sigma bond between the two carbons and a pi bond between the carbon and the hydrogen atom that was newly formed.

To know more about toluenesulfonic visit:

brainly.com/question/30902990

#SPJ11


Related Questions

identify the strongest imf exhibited between two nh2chchch3 molecules.

Answers

The strongest intermolecular forces exhibited between two NH₂CH(CH₃) molecules are hydrogen bonds.

Hydrogen bonds are the strongest intermolecular forces in most cases and they occur when a molecule contains hydrogen attached to an oxygen, nitrogen, or fluorine atom. The NH₂CH(CH₃) molecule has a nitrogen atom attached to two hydrogen atoms and a methyl group. These nitrogen atoms are able to form hydrogen bonds with other nitrogen atoms due to their electronegativity. As a result, hydrogen bonds are the strongest intermolecular forces between two NH₂CH(CH₃) molecules.

Hydrogen bonds are the strongest type of intermolecular force because they have a large amount of energy and are very stable. This is due to the fact that the bond is formed between a hydrogen atom and an electronegative atom such as nitrogen, oxygen, or fluorine, which causes the hydrogen to become partially positively charged and the electronegative atom to become partially negatively charged. This allows for strong electrostatic attractions to form between molecules.

Learn more about intermolecular forces at https://brainly.com/question/12243368

#SPJ11

draw the alcohol needed to form isobutyl benzoate (2-methylpropyl benzoate).

Answers

To form isobutyl benzoate (2-methylpropyl benzoate), we require alcohol. The alcohol needed is the isobutanol.

       CH3

        |

CH3-C-CH2-OH

        |

       H

The reaction between isobutanol and benzoic acid will produce isobutyl benzoate, with water as a byproduct.

The reaction can be written as follows:

CH3(CH2)2CHOH + C6H5COOH → CH3(CH2)2COOC6H5 + H2O

Isobutyl benzoate (2-methylpropyl benzoate) is a fragrance and flavoring agent that is found in many foods and cosmetics.

This ester is made from isobutanol, which is a colorless liquid that is used to produce other chemicals, as well as benzoic acid, which is a crystalline solid that is commonly used as a food preservative.

Isobutyl benzoate is an ester that has a strong, fruity odor and is used as a flavoring agent in food.

The ester is also used in cosmetics as a fragrance.

The compound is formed by the reaction of isobutanol and benzoic acid.

The reaction is catalyzed by sulfuric acid.

The given reaction exhibits the mechanism where CH3(CH2)2CHOH reacts with C6H5COOH to produce CH3(CH2)2COOC6H5 and H2O.

CH3(CH2)2CHOH + C6H5COOH → CH3(CH2)2COOC6H5 + H2O

The process entails the transformation of a carboxylic acid into an ester.

In this case, the alcohol used is isobutanol.

The reaction is reversible, and the equilibrium position of the reaction depends on the relative concentrations of the reactants and products.

Learn more about alcohol at: https://brainly.com/question/29751198

#SPJ11

(d) what is δû(/) if hbr (v) is heated from 20°c to 65°c at constant specific volume (25000 l/mol)?

Answers

Given values: The initial temperature of hbr (v) is 20°C and the final temperature is 65°C. The constant specific volume of hbr (v) is 25000 l/mol.Let's use the formula to calculate δû(/).The equation for calculating δû(/) is:δû(/) = (3/2) nR δTFor monoatomic gases, the internal energy of a gas is directly proportional to the change in temperature.

However, HBr is not a monoatomic gas, so we need to use a different formula. The formula for internal energy of a gas isδU = nCvd THere, Cv is the specific heat of the gas at constant volume. To obtain δû(/), we need to know the specific heat of the gas at constant volume. Using the formula, δU = nCvdT Where n = 1 mole, Cv = 20.786 J/(mol.K), and δT = 45°C,∴ δ û(/) = nCvd T = 1 mol × 20.786 J/(mol.K) × 45 °C = 935.37 J Explanation: Given: Initial temperature of HBr (v) is 20°C and the final temperature is 65°C. The constant specific volume of HBr (v) is 25000 l/mol. The formula for calculating the internal energy of a gas is δU = nCvdT. Here, Cv is the specific heat of the gas at constant volume. To calculate δû(/), we first need to calculate δU:δU = nCvd THere, n = 1 mol, Cv = 20.786 J/(mol.K), and δT = 45°C. Therefore, δ U = nCvdT = 1 mol × 20.786 J/(mol.K) × 45 °C = 935.37 J. To calculate δû(/), we use the formula:δû(/) = (3/2) nR δT. For HBr (v), the specific heat at constant volume is not known, so we cannot use the ideal gas law. We use the formula for internal energy instead. Thus, δû(/) = δU = 935.37 J.

For more information on ideal gas law visit:

brainly.com/question/12624936

#SPJ11

draw the organic product(s) of the following reaction. ch3 ch3chch2-oh

Answers

The organic product of the given reaction is 3-pentanone or diethyl ketone. The given reactant, CH₃CH(CH₂OH)CH₃, is a secondary alcohol.

The alcohol functional group will undergo oxidation with the help of the oxidizing agent, CrO₃/H₂SO₄. The following are the steps involved in the oxidation reaction:

Step 1: Formation of Chromate Ester. CH₃CH(CH₂OH)CH₃ is added to H₂SO₄ in the presence of CrO₃. This results in the formation of chromate ester as shown below:

Step 2: Hydrolysis of Chromate Ester. Chromate ester undergoes hydrolysis in aqueous H₂SO₄ (dilute) and forms a carbonyl compound or ketone. Here, CH₃CH(CH₂OH)CH₃ undergoes hydrolysis to form 3-pentanone or diethyl ketone as shown below: The organic product of the given reaction is 3-pentanone or diethyl ketone.

Thus, the organic product of the given reaction is 3-pentanone or diethyl ketone.

To know more about organic product, refer

https://brainly.com/question/28383565

#SPJ11

how can you tell if a chemical equation represents hydrolysis

Answers

To identify hydrolysis in a chemical equation, check for the presence of water as a reactant and the splitting of a compound into two or more components.

Hydrolysis is a chemical reaction in which water molecules are added to a compound, resulting in the splitting of the compound into two or more products. In order to identify whether a chemical equation represents hydrolysis, there are two key factors to consider.

Firstly, look for the presence of water (H2O) as a reactant in the equation. Hydrolysis reactions require water to provide the necessary hydroxide ions (OH-) for the reaction to occur. Therefore, if water is listed as one of the reactants, it is an indication that hydrolysis might be taking place.

Secondly, observe whether the compound undergoing the reaction is being split into two or more components. Hydrolysis typically involves the breaking of chemical bonds within a compound, resulting in the formation of new compounds or ions. The addition of water molecules to the compound facilitates this splitting process. If the equation shows the formation of multiple products from a single reactant, it suggests hydrolysis is occurring.

Learn more about hydrolysis :

https://brainly.com/question/11461355

#SPJ11

Answer:

hydrolysis, in chemistry and physiology, a double decomposition reaction with water as one of the reactants. Thus, if a compound is represented by the formula AB in which A and B are atoms or groups and water is represented by the formula HOH, the hydrolysis reaction may be represented by the reversible chemical equation AB + HOH ⇌ A H + B OH.

write the balanced nuclear equation for the beta decay of calcium-47.

Answers

The beta decay of calcium-47 can be expressed in a balanced nuclear equation as follows:

[tex]$$\mathrm{^{47}_{20}Ca \to\ ^{47}_{21}Sc +\beta^-}$$[/tex]

Nuclear decay occurs when the nucleus of an unstable atom spontaneously emits particles in the form of radiation. Beta decay is one of the three types of radioactive decay that occur in unstable atoms.

It is characterized by the emission of an electron or a positron from the nucleus of the atom.Calcium-47 is an isotope of calcium that is used in medical research and applications such as positron emission tomography.

The beta decay of calcium-47 can be expressed in a balanced nuclear equation as follows:

[tex]$$\mathrm{^{47}_{20}Ca \to\ ^{47}_{21}Sc +\beta^-}$$[/tex]

This balanced nuclear equation shows that the nucleus of calcium-47 undergoes beta decay by emitting an electron (β-) and transforming into scandium-47.

In this process, the atomic number of calcium-47, which is 20, increases by one to become 21, which is the atomic number of scandium.

This means that the beta particle that is emitted is actually an electron that is formed from a neutron that is transformed into a proton and an electron.

The proton remains in the nucleus, while the electron is emitted from the nucleus as beta radiation.

The balanced nuclear equation for the beta decay of calcium-47 is thus:

[tex]\[\ce{^{47}_{20}Ca - > ^{47}_{21}Sc + ^0_{-1}e}\]\\[/tex]

The above equation represents the beta decay of calcium-47 by the emission of a beta particle (an electron) and the transformation of the calcium-47 nucleus into a nucleus of scandium-47.

Learn more about Nuclear decay at: https://brainly.com/question/12868773

#SPJ11

if the enthalpy of sublimation is 29.49kjmol, what is the enthalpy of deposition? select the correct answer below: 29.49kjmol −29.49kjmol −88.47kjmol there is not enough information to determine this

Answers

The enthalpy of deposition is the opposite process of the enthalpy of sublimation.

The enthalpy of deposition is the process of a gas molecule changing directly to a solid phase by releasing energy.

The enthalpy of sublimation is the process of a solid changing directly to a gas phase by absorbing energy.

So, we can write, Enthalpy of Deposition = - Enthalpy of Sublimation= - 29.49 kJ/mol

29.49 kJ/mol`Explanation:Given, Enthalpy of Sublimation = 29.49 kJ/molThe enthalpy change of deposition is equal to the negative of the enthalpy change of sublimation. Thus,Enthalpy of Deposition = - Enthalpy of Sublimation= - 29.49 kJ/mol Hence, the enthalpy of deposition is `-29.49 kJ/mol`.Therefore, the correct option is b. `-29.49kJmol`.The

summary is: If the enthalpy of sublimation is 29.49kJmol, the enthalpy of deposition would be -29.49kJmol.

Learn more about sublimation click here:

https://brainly.com/question/29624780

#SPJ11

write the balanced chemical equation associated with the formation constant, f , for each complex ion. include phase symbols. alf3−6 : al ↽−−⇀ cd(nh3)2 6 : ↽−−⇀

Answers

The balanced chemical equation associated with the formation constant, f , for each complex ion is as follows:AlF3-6: Al³⁺(aq) + 3F⁻(aq) ⇌ AlF₃(s)Kf = [AlF₃⁻⁶]/([Al³⁺][F⁻]³)Cd(NH₃)₂⁶: Cd²⁺(aq) + 2NH₃(aq) ⇌ Cd(NH₃)₂²⁺(aq)Kf = [Cd(NH₃)₂²⁺]/([Cd²⁺][NH₃]²)Explanation: Chemical constants are known as complex formation constants.

They are used to describe the equilibrium constant for the formation of a complex ion from its constituent parts. Complexes are formed when a molecule or ion (known as the ligand) binds to a central metal ion (known as the cation) in a coordinated way. Ligands bind to metal cations through a number of interactions, including covalent bonding, electrostatic interactions, and hydrogen bonding.Constant formation is defined as the formation of a complex ion from its constituents. The complex formation constant is defined as the equilibrium constant for the reaction that forms the complex. The equilibrium constant is denoted by Kf, and it is given by:[Complex]/([Ligand]n[Cation]m)Here, n and m represent the number of ligands and cations in the complex, respectively. If the complex is an anion, then it is written with a negative sign in front of the formula. The value of Kf depends on the ligand, the cation, and the solvent.

For more information on  equilibrium constant visit:

brainly.com/question/28559466

#SPJ11

energy that is associated with the relative positions of electrons and nuclei in atoms and molecules is called kinetic energy. thermal energy. potential energy. chemical energy.

Answers

Potential energy is a form of energy stored in an object due to its relative position, shape, or configuration, and is one of two types of mechanical energy.

Potential energy is a form of energy stored in an object due to its relative position, shape, or configuration. It is associated with the relative positions of electrons and nuclei in atoms and molecules, and is one of two types of mechanical energy. Kinetic energy is associated with the motion of an object, while potential energy is associated with the position or configuration of an object.

To know more about Potential energy Visit:

https://brainly.com/question/9349250

#SPJ11

using appendix d in the textbook, calculate the molar solubility of agbr in 0.12 m nabr solution.

Answers

The molar solubility of AgBr in 0.12 M NaBr solution is 2.3 × 10⁻⁵ mol/L.

To calculate the molar solubility of AgBr in 0.12 M NaBr solution using Appendix D in the textbook, follow these steps:

1. Write the balanced chemical equation of AgBr dissociation in water. AgBr(s) ⇌ Ag⁺(aq) + Br⁻(aq)

2. Write the expression for the solubility product constant (Ksp). Ksp = [Ag⁺][Br⁻]

3. Determine the value of Ksp from Appendix D in the textbook. Ksp for AgBr = 5.0 × 10⁻¹³

4. Assume that x mol/L of AgBr dissolves in water, then the concentration of Ag⁺ ions in the solution will be x mol/L, and the concentration of Br⁻ ions will be x mol/L (from the balanced chemical equation).

5. Use the concentration of NaBr solution (0.12 M) to determine the concentration of Br⁻ ions in the solution. Br⁻ ion concentration = 0.12 M

6. Substitute the concentration of Br⁻ ions and the expression for Ksp into the expression for Ksp, and solve for x. Ksp = [Ag⁺][Br⁻]5.0 × 10⁻¹³ = (x)(0.12+x)x = 2.3 × 10⁻⁵ mol/L

Therefore, the molar solubility of AgBr in 0.12 M NaBr solution is 2.3 × 10⁻⁵ mol/L.

Learn more about molar solubility at https://brainly.com/question/28202068

#SPJ11

which of the following is the stronger brønsted-lowry acid, hclo3 or hclo2?

Answers

HClO3 is the stronger Brønsted-Lowry acid between the two compounds.

In the Brønsted-Lowry acid-base theory, an acid is defined as a substance that donates a proton (H+) and a base is a substance that accepts a proton. To determine which of the two acids, HClO3 or HClO2, is stronger, we need to assess their ability to donate a proton.

HClO3, also known as chloric acid, has a central chlorine atom bonded to three oxygen atoms and one hydrogen atom. The presence of three electronegative oxygen atoms surrounding the central chlorine atom increases the acidity of HClO3. The oxygen atoms withdraw electron density from the chlorine atom, making it more willing to donate a proton, thus making HClO3 a stronger acid.

HClO2, also known as chlorous acid, has a similar structure with a central chlorine atom bonded to two oxygen atoms and one hydrogen atom. Compared to HClO3, HClO2 has fewer electronegative oxygen atoms surrounding the central chlorine atom. This reduced electron withdrawal decreases the acidity of HClO2, making it a weaker acid compared to HClO3.

Therefore, HClO3 is the stronger Brønsted-Lowry acid between the two compounds.

Know more about Brønsted-Lowry acid here:

https://brainly.com/question/32276007

#SPJ11

pick the single-step reaction that, according to collision theory, has the smallest orientation factor.

Answers

The single-step reaction with the smallest orientation factor, according to collision theory, is H + H → H₂.

According to collision theory, the orientation factor refers to the likelihood that colliding molecules will have the correct orientation to result in a successful reaction. In a single-step reaction, the orientation factor plays a crucial role in determining the reaction's success.

Out of the given reactions, H + H → H₂ has the smallest orientation factor. This reaction involves the combination of two hydrogen atoms to form a hydrogen molecule (H₂). Since both reactants are identical atoms, there are fewer restrictions on their orientation during the collision, making it more likely for a successful reaction to occur.

The other reactions involve more complex molecules with specific geometric requirements for a successful collision, resulting in larger orientation factors. H₂ + H₂C=CH₂ → H₂C=CH₃ involves the addition of a hydrogen molecule to an ethylene molecule, while I + HI → I₂ + H involves the reaction between iodine and hydrogen iodide. Both of these reactions have more restrictive orientation requirements compared to the H + H → H₂ reaction.

Therefore, the single-step reaction with the smallest orientation factor, according to collision theory, is H + H → H₂.

Learn more about collision theory here:

https://brainly.com/question/32294127

#SPJ11

The full question is:

Pick the single-step reaction that, according to collision theory, has the smallest orientation factor.

   H+H → H₂    H₂+H₂C=CH₂→H₂C=CH₃    I+HI→I₂+H    All of these reactions have the same orientation factor.

with the steps on how to do it
Find w, x, y and z such that the following chemical reaction is balanced. wBa3N₂ + 2H₂O →yBa(OH)2 + 2NH3

Answers

The balanced chemical reaction for the given chemical equation is given by; 3Ba3N2 + 6H2O → 6Ba(OH)2 + 2NH3. Therefore, the balanced values for w, x, y and z are 3, 6, 6, and 2, respectively.

The balanced chemical reaction for the given chemical equation can be obtained by following the below steps;

Count the number of atoms of each element on both sides of the chemical equation

Find the coefficients to balance the number of atoms on both sides of the chemical equation

Check the balance of the chemical equation

Write down the balanced chemical equation by putting coefficients to the molecules. The balanced chemical reaction is; 3Ba3N2 + 6H2O → 6Ba(OH)2 + 2NH3. Therefore, the balanced values for w, x, y and z are 3, 6, 6, and 2, respectively.

More on chemical reaction: https://brainly.com/question/22817140

#SPJ11

use the bond energies in table 7.2 to calculate the standard enthalpy change (∆h∘) of the following reaction. your answer should be kj. a. cl2(g)⟶2cl(g)

Answers

The total bond energy of products = 2 × 193 = 386 kJ/mol∆H = (242 kJ/mol) - (386 kJ/mol)∆H = -144 kJ/mol, the standard enthalpy change (∆H∘) for the given reaction is -144 kJ/mol.

The bond energies of Cl-Cl, Cl-Cl, and Cl-Cl are 242, 193, and 242 kJ/mol respectively. Use these values to calculate the standard enthalpy change (∆H∘) of the following reaction; Cl2(g) ⟶ 2Cl(g)The bond dissociation energy is the energy needed to break one mole of bonds, that is, how much energy must be supplied to one mole of a bond in gaseous state to break it into its constituent atoms also in gaseous state. The enthalpy change for the reaction is∆H = ∑ bond energies of the reactants - ∑ bond energies of the products or the given reaction: Cl2(g) ⟶ 2Cl(g)Reactants: 1 Cl-Cl bond with a bond energy of 242 kJ/molProducts: 2 Cl atoms with a bond energy of 193 kJ/mol each. So, the total bond energy of products = 2 × 193 = 386 kJ/mol∆H = (242 kJ/mol) - (386 kJ/mol)∆H = -144 kJ/mol, the standard enthalpy change (∆H∘) for the given reaction is -144 kJ/mol.

To Know more about bond energy visit:

brainly.com/question/20536349

#SPJ11

n2(g) 3h2(g)2nh3(g) using the standard thermodynamic data in the tables linked above, calculate the equilibrium constant for this reaction at 298.15k.

Answers

The reaction given is  N2(g) + 3H2(g) ⇌ 2NH3(g). To calculate the equilibrium constant for this reaction at 298.15K using the standard thermodynamic data in the tables linked above, we need to use the following formula:

ΔG° = -RT ln Kwhere ΔG° is the standard Gibbs free energy change, R is the gas constant (8.314 J/K mol), T is the temperature in Kelvin, ln is the natural logarithm and K is the equilibrium constant.Using the standard thermodynamic data in the tables linked above, we can determine the standard Gibbs free energy change for the reaction as follows:ΔG° = ΣnΔG°f(products) - ΣnΔG°f(reactants)where ΔG°f is the standard Gibbs free energy of formation of the respective compounds, and n is the stoichiometric coefficient of each compound. Using the values from the tables, we get:ΔG° = 2(0) + 0 - [1(-16.45) + 3(0)]ΔG° = 16.45 kJ/molSubstituting this value into the above formula, we get:16.45 kJ/mol = -(8.314 J/K mol)(298.15 K) ln Kln K = -16.45 x 10^3 J/mol / (8.314 J/K mol x 298.15 K)ln K = -20.09K = e^(-20.09)K = 6.47 x 10^(-9)Therefore, the equilibrium constant for the given reaction at 298.15K is 6.47 x 10^(-9).

To know more about Gibbs free energy , visit ;

https://brainly.com/question/9179942

#SPJ11

to separate a mixture of p-toluidine and p-nitrotoluene dissolved in ether,extract the ether solution with aqueous hcl and treat the water layer with aqueous naoh. true

Answers

The answer to the given question is given as follows:

given question talks about separating a mixture of p-toluidine and p-nitrotoluene dissolved in ether. To separate this mixture, we need to extract the ether solution with aqueous HCl and then treat the water layer with aqueous NaOH.

Now, we will discuss each step of this process in detail:

Step 1: Extraction of Ether Solution with Aqueous HCl

In this step, we are going to extract the ether solution with aqueous HCl. This step is carried out to convert p-nitrotoluene into p-nitrotoluene acid. The basic principle of this step is that p-toluidine is a base and p-nitrotoluene is a neutral compound. Therefore, when we add HCl, it will protonate p-toluidine, and it will form an ion that will be extracted in the aqueous phase. Whereas, p-nitrotoluene will remain in the organic phase. The resulting mixture will contain an aqueous layer and an organic layer. The organic layer is of our interest as it contains the compound that we are going to extract.

Step 2: Treatment of the Water Layer with Aqueous NaOH

In this step, we are going to treat the water layer with aqueous NaOH. This step is carried out to convert p-nitrotoluene acid into p-nitrotoluene. The basic principle of this step is that p-nitrotoluene acid is an acid, and when we add NaOH, it will react with p-nitrotoluene acid and convert it into p-nitrotoluene.

This reaction is given below:

p-nitrotoluene acid + NaOH → p-nitrotoluene + NaNO2 + H2O

This reaction takes place only in the aqueous phase as both the reactants are present in the aqueous layer. So, the resulting mixture will contain an aqueous layer and an organic layer. The organic layer is of our interest as it contains the compound that we are going to extract.

Step 3: Final Extraction of Organic Layer

In this step, we are going to extract the organic layer from the mixture. The organic layer contains the compound that we are going to extract. So, we can evaporate the solvent, and we will get the desired compound that is p-nitrotoluene. Hence, the final product of this process will be p-nitrotoluene.

Learn more about p-toluidine and p-nitrotoluene from this link:

https://brainly.in/question/1837733

#SPJ11

solid nickel reacts with aqueous lead (ii) nitrate to form solid lead. what is the net ionic equation for this reaction?

Answers

The chemical equation for this reaction is:

Ni(s) + Pb(NO3)2(aq) → Pb(s) + Ni(NO3)2(aq)

The ionic equation for this reaction is:

Ni(s) + Pb2+(aq) + 2 NO3-(aq) → Pb(s) + Ni2+(aq) + 2 NO3-(aq)

The net ionic equation can be obtained by canceling the spectator ions (the ions that appear on both sides of the equation and do not participate in the reaction):

Ni(s) + Pb2+(aq) → Pb(s) + Ni2+(aq)

So, the net ionic equation for this reaction is:

Ni(s) + Pb2+(aq) → Pb(s) + Ni2+(aq)

Goodluck!

The net ionic equation for the reaction between solid nickel and aqueous lead (II) nitrate is: Ni(s) + Pb2+(aq) → Pb(s) + Ni2+(aq)

Explanation: The net ionic equation involves the reactants that are involved in the reaction, as well as the products formed. The term "net" means that the spectator ions are removed from the equation.

Nickel is a solid and, therefore, has no charge. It does not dissolve in the aqueous solution and is written in its solid state. Lead (II) nitrate is dissolved in water to form lead ions and nitrate ions.

The molecular equation for the reaction is: Ni(s) + Pb(NO3)2(aq) → Pb(s) + Ni(NO3)2(aq)

To obtain the net ionic equation, the spectator ions are removed from the above equation. The nitrate ion is a spectator ion, and it does not participate in the reaction.Ni(s) + Pb2+(aq) → Pb(s) + Ni2+(aq)

Therefore, the net ionic equation for the reaction between solid nickel and aqueous lead (II) nitrate is Ni(s) + Pb2+(aq) → Pb(s) + Ni2+(aq).

To learn more about ionic visit;

https://brainly.com/question/29523788

#SPJ11

determine the quantities shown below for a solution that is 0.0840 m in methylamine,ch3nh2. the ka for the ch3nh3 ion is 2.33 ✕ 10−10. kw = 1.000 ✕ 10−14

Answers

Given,Concentration of CH3NH2, c = 0.0840 mKa of CH3NH3+, Ka = 2.33 × 10^-10Kw = 1.000 × 10^-14We need to determine the following quantities.

[H3O+], [OH-], [CH3NH3+], % ionization.Let's find the value of Kb for CH3NH2 and then we can use it to calculate [OH-].We know that,Kw = Ka × Kb1.000 × 10^-14 = 2.33 × 10^-10 × KbKb = 4.29 × 10^-5pKb = -log(Kb) = -log(4.29 × 10^-5) = 4.37pH + pOH = pKw = 14pOH = 14 - pHWe know that methylamine is a weak base and it reacts with water to form the following equilibrium.CH3NH2 + H2O ⇌ CH3NH3+ + OH-Initial Conc(c)   0             0               0Equilibrium  c-x           x              xOn writing the Kb expression, we getKb = [CH3NH3+][OH-]/[CH3NH2][OH-] = Kb × [CH3NH2]/[CH3NH3+][OH-] = [CH3NH2]/KbTherefore, x/Kb = [OH-]x = [OH-] = Kb × [CH3NH2] / = 4.29 × 10^-5 × 0.0840 / = 3.61 × 10^-6Now,pH + pOH = 14pH + 3.14 = 14pH = 10.86[H3O+] = 10^-pH = 1.26 × 10^-11Let's calculate the % ionization.% ionization = (concentration of CH3NH3+ at equilibrium / initial concentration of CH3NH2) × 100% ionization = (x/c) × 100% ionization = (3.61 × 10^-6/0.0840) × 100% ionization = 0.0043%Therefore, the quantities shown below for a solution that is 0.0840 m in methylamine are,[H3O+] = 1.26 × 10^-11[OH-] = 3.61 × 10^-6[CH3NH3+] = 3.61 × 10^-6% ionization = 0.0043%

To know more about concentration , visit ;

https://brainly.com/question/17206790

#SPJ11

hydrogen can be prepared by suitable electrolysis of aqueous sodium salts. true or false?

Answers

False.

hydrogen can not be prepared by suitable electrolysis of aqueous sodium salts.

Hydrogen gas (H₂) can be prepared by the electrolysis of water, not aqueous sodium salts. During the process of electrolysis of water, the water molecule (H₂O) is split into hydrogen gas (H₂) and oxygen gas (O₂) using an electric current. This process occurs in an electrolytic cell with two electrodes, where hydrogen gas is produced at the cathode and oxygen gas is produced at the anode.

The electrolysis of aqueous sodium salts typically results in the production of sodium hydroxide (NaOH) or sodium metal (Na) at the cathode, depending on the specific conditions and electrolyte used. Hydrogen gas is not typically produced as a direct product of the electrolysis of aqueous sodium salts.

To know more about sodium visit:

brainly.com/question/5419833

#SPJ11

how many liters of no can be produced when 25l 02 are reacted with 25l nh3?

Answers

25 L of NO can be produced when 25 L of O2 are reacted with 25 L of NH3.

The balanced equation for the reaction between O2 and NH3 is given below;4 NH3 + 5 O2 → 4 NO + 6 H2OFrom the balanced equation above, 4 moles of NH3 react with 5 moles of O2 to produce 4 moles of NO and 6 moles of water. Now let's calculate the number of moles of O2 available;

Moles of O2 = Volume of O2 ÷ Molar volume= 25/22.4= 1.116 moles of O2Now we need to find the number of moles of NH3;Since the volume of NH3 is the same as O2,Moless of NH3 = Volume of NH3 ÷ Molar volume= 25/22.4= 1.116 moles of NH3

The reaction between 1.116 moles of NH3 and 1.116 moles of O2 produces 1.116 moles of NO. The volume of NO produced can be calculated as follows; Volume of NO = Number of moles of NO x Molar volume of NO= 1.116 x 22.4= 25 L

Therefore, 25 L of NO can be produced when 25 L of O2 are reacted with 25 L of NH3.

To learn more about reaction visit;

https://brainly.com/question/30464598

#SPJ11

the permanent electric dipole moment of the water molecule (h2o) is 6.2×10−30c⋅m .

Answers

The permanent electric dipole moment of the water molecule (H2O) is 6.2×10^−30 C⋅m.

The electric dipole moment is the distance between two equal but opposite charges.

The electric dipole moment for H2O is 6.2 x 10^-30 C⋅m. In general, the electric dipole moment is defined as the product of charge and distance between the charges.The water molecule is polar because of its bent structure and electronegativity.

A permanent dipole is created as a result of the electronegativity difference between hydrogen and oxygen.

Because of the differences in the electronegativity of the atoms, electrons are drawn toward the oxygen atom, generating a negative charge, whereas the hydrogen atoms develop a positive charge as a result of the electron migration, resulting in a net dipole moment of the H2O molecule.

Summary:The water molecule's permanent electric dipole moment is 6.2×10^-30 C⋅m. The dipole moment is created as a result of the polar nature of the molecule, which is caused by differences in electronegativity between the atoms.

Learn more about electric dipole moment click here;

https://brainly.com/question/11626115

#SPJ11

draw the structure of an alkyl halide that could be used in an e2 reaction

Answers

An alkyl halide that can undergo an E2 (elimination) reaction typically has a primary or secondary carbon bonded to a halogen atom. Here's an example of structure attached.

In this structure, R represents an alkyl group (such as methyl, ethyl, propyl, etc.), X represents a halogen atom (such as Cl, Br, or I), and the hydrogen atoms attached to the carbon atom labeled as C can be different alkyl groups or hydrogens.

In an E2 reaction, the alkyl halide acts as the substrate and undergoes a bimolecular elimination. During the reaction, a base abstracts a proton from a beta-carbon (carbon adjacent to the carbon with the halogen atom), and simultaneously, the leaving group (halogen) is expelled, resulting in the formation of a double bond.

The reaction proceeds more readily with primary or secondary alkyl halides due to the availability of beta-hydrogens, which are required for the elimination process. Tertiary alkyl halides are generally unreactive in E2 reactions because the steric hindrance around the carbon atom hinders the approach of the base.

To learn more about E2 reaction here

https://brainly.com/question/31327352

#SPJ4

Meisenheimer Complex is formed addition-………….mechanism of ………... reaction

I know that the Meisenheimer Complex is formed addition- elimination mechanism but i do not know of what kind of reaction

Answers

The Meisenheimer Complex is a type of intermediate formed during the second stage of nucleophilic aromatic substitution. It is named after German chemist Max Meisenheimer and is highly reactive and can be quickly eliminated if conditions are right. The final product of the reaction is the substitution product.

The Meisenheimer Complex is a type of intermediate that results from a type of organic reaction known as nucleophilic aromatic substitution. It is named after its discoverer, German chemist Max Meisenheimer. The Meisenheimer Complex is formed during the second stage of nucleophilic aromatic substitution, when the attack of a nucleophile leads to the formation of a sigma complex. The sigma complex is highly reactive and if conditions are right, it will undergo a rapid elimination process. The final product of the reaction is the substitution product.

To know more about Meisenheimer Complex Visit:

https://brainly.com/question/31503697

#SPJ11

PLEASE HELP ME 100 POINTS RIGHT ANSWERS ONLY!!! :)
There are 8 g of chlorine in 2,000,000 g of water in a pool.
How many ppm chlorine are in the pool?
part/whole x 1,000,000

Answers

There are 4,000 parts per million (ppm) of chlorine in the pool.

To calculate the parts per million (ppm) of chlorine in the pool, we can use the formula:

ppm = (part / whole) x 1,000,000

In this case, the part is the amount of chlorine, which is given as 8 g, and the whole is the amount of water, which is 2,000,000 g. Substituting these values into the formula, we get:

ppm = (8 g / 2,000,000 g) x 1,000,000

Simplifying this expression, we find:

ppm = (4 x 10^-6) x 1,000,000

ppm = 4,000

This means that for every one million parts of the pool's water, there are 4,000 parts of chlorine. In other words, the concentration of chlorine in the pool is 4,000 ppm, indicating a relatively high level of chlorine compared to the water.

for such more questions on  chlorine

https://brainly.com/question/24218286

#SPJ8

the kp for the reaction below is 1.49 × 108 at 100.0°c: co(g) cl2(g) → cocl2(g)

Answers

The value of Kp for the given reaction: co(g) + cl2(g) → cocl2(g) at 100.0° C is 1.49 × 10⁸. Now we need to find the value of Kc at the same temperature.

We know that Kp = Kc(RT)^Δng, where Δng is the change in the number of moles of gaseous products minus the number of moles of gaseous reactants.Here, Δng = 1 - 2 = -1 as we have one gaseous reactant and two gaseous products. R is the ideal gas constant, T is the temperature, and Kp is the equilibrium constant in terms of pressure, and Kc is the equilibrium constant in terms of concentration, thus;Kp = Kc(RT)^Δng1.49 × 10⁸ = Kc(RT)^-1Taking natural logs on both sides;ln 1.49 × 10⁸ = ln Kc + (-1) ln RTln 1.49 × 10⁸ = ln Kc - ln RT1.49 × 10⁸/RT = KcThis is the main answer where we have found the value of Kc. Let's move on to the explanation:The value of Kp at 100°C is 1.49 × 10⁸. We can use the equation Kp = Kc(RT)^Δng to find the value of Kc, where Δng is the change in the number of moles of gaseous products minus the number of moles of gaseous reactants, R is the ideal gas constant, T is the temperature, and Kp and Kc are the equilibrium constants in terms of pressure and concentration respectively.We can calculate the value of Kc by rearranging the equation as follows: Kc = Kp/(RT)^Δng.

Substituting the given values, we get;Kc = 1.49 × 10⁸/(8.314 J K⁻¹ mol⁻¹ × 373.15 K)^(-1) = 1.41 × 10⁵ M⁻¹The summary of the answer is that the value of Kc at 100.0°C is 1.41 × 10⁵ M⁻¹.

Learn more about temperature click here:

https://brainly.com/question/27944554

#SPJ11

identify the conjugate acid-base pairs in this reaction: hbr(aq) nh3(aq) ⇔ br–(aq) nh4 (aq)

Answers

The conjugate acid-base pairs in the reaction HBr(aq) + [tex]NH_3[/tex](aq) ⇔[tex]Br^-[/tex](aq) + [tex]NH_4^+[/tex](aq) are HBr/[tex]NH_4^+[/tex] and [tex]NH_3/Br^-[/tex].

In the given reaction, HBr acts as an acid, donating a proton ([tex]H^+[/tex]) to [tex]NH_3[/tex], which acts as a base. As a result, [tex]NH_3[/tex] gains a proton to form its conjugate acid, [tex]NH_4^[/tex]. In this acid-base pair, [tex]NH_4^[/tex] is the conjugate acid since it is formed by accepting a proton from HBr.

Conversely, HBr loses a proton and becomes its conjugate base, [tex]Br^-[/tex]. Thus, [tex]Br^-[/tex] is the conjugate base of HBr. The reaction can proceed in both directions, indicating the reversible nature of the acid-base reaction, with the formation of the conjugate acid-base pairs [tex]NH_4^+/Br^-[/tex] and HBr/[tex]NH_3[/tex].

To learn more about conjugate follow the link:

https://brainly.com/question/32363058

#SPJ4

which of the following gas samples would be most likely to behave ideally under the stated condition? A) H2 at 400atm and 25 C degree, b) CO at 200atm and 25 C degree, c) Ar at STP, d) N2 at atm and -70 C degree, e) SO2 at 2 atm and 0 K. Please, answer with detail explain.

Answers

In chemistry, the ideal gas law is a simple equation that specifies how the physical properties of an ideal gas change as pressure, volume, and temperature are changed. It can be utilized to assess the behavior of a gas under various conditions.

Given conditions in the question, the Ar gas sample at STP (Standard Temperature and Pressure) is most likely to behave ideally. The reason behind this statement is explained below: STP (Standard Temperature and Pressure) is defined as 273 K (0°C) and 1 atm of pressure.

According to the ideal gas law, a gas will act ideally under the given condition if the intermolecular forces between the gas particles are negligible. Intermolecular forces are defined as the forces of attraction between two or more particles. The Ar gas is a noble gas, and as such, it has weak intermolecular forces. The weak intermolecular forces between the Ar gas particles make it an ideal gas under STP conditions. Additionally, Ar gas consists of a single atom and has a zero molecular weight. Hence, it has no volume, which makes it an ideal gas under STP conditions.

Therefore, the Ar gas sample at STP is most likely to behave ideally under the stated condition. The other options, H2 at 400atm and 25 C degree, CO at 200atm and 25 C degree, N2 at atm and -70 C degree, and SO2 at 2 atm and 0 K, have various pressures and temperatures that deviate from the standard conditions, and they may have strong intermolecular forces that make them non-ideal gases.

To learn more about gas visit;

https://brainly.com/question/14812509

#SPJ11

Which of the following species possesses a delocalized bond? 1. H2S 2. No molecule given here possesses a delocalized bond. 3. H2O 4. NO?3 5. NCl3

Answers

Out of the given options, the species that possesses a delocalized bond is NO₃.

The delocalized bond is defined as the type of chemical bonding where the electrons are not confined to a particular bond between a set of two atoms but are free to move in the molecule as a whole. Therefore, out of the given species:

1. H₂S: It is a covalent compound that has a single covalent bond between the two atoms and does not possess a delocalized bond.

3. H₂O: It is a covalent compound that has a single covalent bond between the two hydrogen atoms and one oxygen atom and does not possess a delocalized bond.

4. NO₃: It is a covalent compound that has a double bond between one nitrogen atom and three oxygen atoms, and it is the only species among the given options that possess a delocalized bond.

5. NCl₃: It is a covalent compound that has three single covalent bonds between nitrogen and three chlorine atoms and does not possess a delocalized bond.

Hence, the correct option is 4. NO3.

Learn more about delocalized bonds at https://brainly.com/question/31382995

#SPJ11

a current of 4.65 a is passed through a fe(no3)2 solution. how long, in hours, would this current have to be applied to plate out 5.50 g of iron?

Answers

It is given that a current of 4.65 A is passed through an Fe(NO3)2 solution. We need to find out how long, in hours, this current must be applied to plate out 5.50 g of iron.

To solve the given problem, we will use the following equation. Faraday's first law of electrolysis states that the amount of substance produced during electrolysis is directly proportional to the quantity of electricity passed through the electrolyte.=×××Where, = Mass of substance produced = Electrochemical equivalent of the substance = Faraday's constant = 96500 C mol⁻¹ = Current passed = Time of passage of current. Substituting the values, Mass of Fe = 5.50 g

Electrochemical equivalent of iron, = 56.0 g of Fe is deposited by 96500 C of electricity passing through a solution.Current, = 4.65 A Time, = ?

Therefore,=×××⇒=/××=5.50/(56.0×96500×4.65) hours=0.0022 hours=0.0022×60 minutes=0.13 minutes

Hence, the current of 4.65 A would have to be applied for 0.13 minutes (approx) to plate out 5.50 g of iron.

To learn more about solution visit;

https://brainly.com/question/1616939

#SPJ11

how many babies make up quintuplets

Answers

Answer:

Explanation:

Quintuplets refer to a set of five babies born from the same pregnancy. Therefore, quintuplets consist of five babies in total.

Other Questions
The following are all examples of product costs:ADirect material, direct labor and indirect labor.B Direct labor, VP of sales salary, and insurance on the factory.C Depreciation on the factory equipment, depreciation on the office building, and depreciation on the factory building.D Factory insurance, interest expense, and property taxes on the factory.E Office supplies, sales commissions, and maintenance costs on office copier. The shipping terms are clearly stated in the contract is not a criteria for revenue recognition under ASC Topic 606. The five criteria for revenue recognition under ASC Topic 606 are:Identify the contract(s) with a customer.Identify the performance obligations in the contract.Determine the transaction price.Allocate the transaction price to the performance obligations in the contract.Recognize revenue when (or as) the entity satisfies a performance obligation. Which statement is true for the sequence defined as an = 1 +2+3+...+ (n + 2) / 2n + 11n + 15 ?(a) Monotonic, bounded and convergent. (b) Not monotonic, bounded and convergent. (c) Monotonic, bounded and divergent. (d) Monotonic, unbounded and divergent.(e) Not monotonic, unbounded, and divergent In Myanmar, five laborers, each making the equivalent of $3.00 per day, can produce 38 units per day. In China, nine laborers, each making the equivalent of $2.00 per day, can produce 45 units. In Billings, Montana, two laborers, each making $57.00 per day, can make 100 units. Shipping cost from Myanmar to Denver, Colorado, the final destination, is $1.50 per unit. Shipping cost from China to Denver is $1.00 per unit, while the shipping cost from Billings, Montana to Denver is $0.30 per unit. Based on total costs (labor and transportation) per unit, the most economical location to produce the item is .......... with a total cost (labor and transportation) per unit of $ ...... (Enter your response rounded to two decimal places.) Classical Estimation f(k; ) = Pr(X= k) = ke-Bk2 where is an unknown parameter and k is nonnegative.< Knowing the maximum likelihood estimator is B=2-31 1 Use MATLAB to numerically compute E[] when = Show your code ACTIVITY 7: Determine the equation, in slope-intercept form, of the straight line that passes through the point (-1,-2) and is perpendicular to 2r + 5y + 8 = 0. According to Writing (2019), the purchasing department is responsible for procuring raw materials and other resources at the best possible price. In relation to the above, and with the aid of examples, discuss the functions of the purchasing management. Given the following data, what is this person's net worth? GIVEN DATA Balance on car loan $3,250 Balance on student loans $9,850 Cash in checking account $1,100 Clothing purchases $350 Current value of automobile $10,500 Donations $100 Entertainment $250 Food expenses - monthly $425 Home computer $2,200 $5,500 Household possessions Light, gas water bill $110 O $10,205 O $9,805 O $10,705 $9,505 Loan payment Lunches/parking at work Monthly auto insurance Monthly car note Monthly gross income Monthly rent expense Monthly take-home pay Savings account balance Stereo & video equipment Telephone bill-home & cell VISA balance $230 $115 $120 $320 $4,500 $900 $3,650 $2,100 $3,550 $155 $1,145 Consider a random variable A with fixed and finite mean and variance. Is the processZ_t = (-1^t) Athird order stationary in distribution ? A mean weight of 500 sample cars found (1000 + B) Kg. Can it be reasonably regarded as a sample from a large population of cars with mean weight 1500 Kg and standard deviation 130 Kg? Test at 5% level of significance. (20 Marks) B = 022 Construct a small sample with n = 5 of the independent variables X for i=1,...,5 and X2 for i = 1,...,5 so that the ordinary least squares (OLS) estimators for the regression coefficients of X, in the following two models, Y = Bo+BX1 + B X 2 + Ei where E; Mid N(0,02) and Y = 0 X +e; where ; id N(0,72), are the same. In other words, you need to make the values of the two estimators and 1 equal to each other for all possible dependent variable values Y,'s. Which of the following will affect the half-life of a radioactive element?A. extreme pressure deep in the EarthB. extreme heat deep within the EarthC. bombardment of Earth by cosmic raysD. None of the above, the half-life of a radioactive element does not change Comparative financial statement data of Canfield, Inc. follow: (Click the icon to view the income statement.) (Click the icon to view the balance sheet.) Begin by selecting the formula to compute the debt to equity ratio. Debt to equity ratio = Total liabilities - Total equity Now, compute the debt to equity ratios for 2024 and 2023. (Round your answers to two decimal places, X.XX.) Debt to equity ratio 2024 1.56 2023 1.58 Requirement 1g. Compute the rate of return on common stockholders' equity for 2024 and 2023. Begin by selecting the formula to compute the rate of return on common stockholders' equity. Rate of return on common stockholders' equity (Net income-Preferred dividends) + Average common stockholder's equity Now, compute the rate of return on common stockholders' equity for 2024 and 2023. (Round your answers to one tenth of a percent, X.X. Do not enter Rate of return on common stockholders' equity % 2024 % 2023 % Help me solve this Demodocs example 0-1 D (Click Read the TS for hold ge co d 20 help- Income Statement Canfield, Inc. Comparative Income Statement Years Ended December 31, 2024 and 2023 2024 2023 $ 466,000 $ 422,000 237,000 218,000 229,000 204,000 137,000 135,000 92,000 69,000 9,000 10,000 83,000 59,000 22,000 24,000 $ 61,000 $ 35,000 Done Net Sales Revenue Cost of Goods Sold Gross Profit Operating Expenses Income From Operations Interest Expense Income Before Income Tax Income Tax Expense Net Income Print - X - kample, Balance Sheet Assets Current Assets: Cash Accounts Receivables, Net Merchandise Inventory Prepaid Expenses Total Current Assets Property, Plant, and Equipment, Net Total Assets Liabilities Total Current Liabilities Long-term Liabilities Tatal Liabilition Get more neip Canfield, Inc. Comparative Balance Sheet December 31, 2024 and 2023 2024 Print $ 2023 2022* 90,000 $ 89,000 111,000 115,000 $103,000 143,000 161,000 211,000 19,000 10,000 363,000 375,000 217,000 179,000 580,000 $ 554,000 $601,000 230,000 $ 240,000 123,000 99,000 252.000 230.000 Done - X 0.2% E Balance Sheet Accounts Receivables, Net Merchandise Inventory Prepaid Expenses Total Current Assets Property, Plant, and Equipment, Net Total Assets Liabilities Total Current Liabilities Long-term Liabilities Total Liabilities Stockholders' Equity Preferred Stock, 5% Common Stockholders' Equity, no par Total Liabilities and Stockholders' Equity * Selected 2022 amounts Print Get more help 111,000 115,000 $ 103,000 143,000 161,000 211,000 19,000 10,000 363,000 375,000 217,000 179,000 580,000 $ 554,000 $601,000 230,000 $ 240,000 123,000 99,000 353,000 339,90 110,000 110,000 117,000 105,000 $ 580,000 $ 554,000 Done $ 89,000 - X 0.2 for the titration of 10 ml of 0.15 m acetic acid with 0.1 m sodium hydroxide, determine the ph when: You are working as a Junior Engineer for a small motor racing team. You have been given a proposed mathematical model to calculate the velocity of a car accelerating from rest in a straight line. The equation is: v(t) = A (1 e tmaxspeed v(t) is the instantaneous velocity of the car (m/s) t is the time in seconds tmaxspeed is the time to reach the maximum speed inseconds A is a constant. In your proposal you need to outline the problem and themethods needed to solve it. You need to include how to 1. Derive an equation x(t) for the instantaneous position of the car as a function of time. Identifythe value x when t = 0 s asymptote of this function as t[infinity] 2. Sketch a graph of position vs. time. ABC Company had total earnings last year of 5,000,000, but expects total earnings to drop to 4,750,000 this year because of a slump in the housing industry. There are currently 1,000,000 shares of common stock outstanding. The company has 4,000,000 worth of investments to undertake this year. The company finances 40% of its investments with debt and 60% with equity capital. The company paid 3.00 per share in dividends last year.(i) If the company follows a pure residual dividend policy, how large a dividend will each shareholder receive this year? Discuss the pros and cons of this policy from the perspective of company and shareholders.(ii) If the company maintains a constant dividend payout ratio each year, how large a dividend will each shareholder receive this year? Discuss the pros and cons of this policy from the perspective of company and shareholders.(iii) If the company follows a constant dollar dividend policy, how large a dividend will each shareholder receive this year? Discuss the pros and cons of this policy from the perspective of company and shareholders.b. A corporation decides to cut its dividend from 2 per share to 1.50 per share. Give rationales/theories to explain why this action may cause the stock price to increase.c. Bella owns 10,000 shares in Cinnamon Spice, which currently has 500,000 shares outstanding. The stock sells for $86 on the open market. Cinnamon Spice's management has decided on a two-for-one split.(i) Will Bella's financial position change after the split, assuming that the stock's price will fall proportionately? Based on your finding, explain why a firm's management would want to have a stock split.(ii) Assuming only a 35% decrease in the stock price, what will be Bella's value after the split? Based on your finding, what could have caused such reaction to stock price?d. An article on stock repurchases in the Los Angeles Times noted "An increasing number of companies are finding that the best investment they can make these days is in themselves." Discuss this view. How is the desirability of repurchase affected by company prospects and the price of its stock? Which pH corresponds to the highest concentration of hydroxide ions? A) pH - 3 b)pH=12 c)ph= 7 d)ph =10 e)ph=1 Tanyas rotation maps point K(24, 15) to K(15, 24). Which describes the rotation? A binomial distribution is composed of six fixed identical trials and the probability of success is 0,83. Therefore the mean and standard deviation of the binomial distribution are equal to: a. 4.98 and 0.9201 b. 1.02 and 0.9201c. 1.50 and 0.866 d. 1.50 and 0.980 evaluate the following integrals. c z 2 dx x 2 dy y 2 dz with c is a line segment from (2, 0, 0) to (3, 1, 2) Steam Workshop Downloader