Choose the left side that makes a True statement, and shows at the sum of the given complex numbers is 10Choose the left side that makes a true statement, and shows that the product of the given complex numbers is 40

Choose The Left Side That Makes A True Statement, And Shows At The Sum Of The Given Complex Numbers Is

Answers

Answer 1

For statement one:

We need to add up to complex numbers and their sum must give us equal to 10.

Also, we need to use the complex numbers:

5+i√15 and 5-i√15.

Then, we can use:

(5+i√15)+( 5-i√15) =

5+i√15+5-i√15 =

5+5+ i√15-i√15 =

= 10 + 0

= 10

For the second statement:

We need to show the product of complex numbers:

Then, we use:

(5+i√15)(5-i√15))=

5*5 - 5*i√15) +5*i√15) +√15*√15=

25 + 0 + 15=

40


Related Questions

9. If L 1 equals 120 then what is the measure of its supplement <2=

Answers

Supplementary angles are angles whose addition sums up to 180 degrees.

Therefore, if angle 1 measures 120, then its supplement which is angle 2, must mean both add up to 180.

Hence, you have

Angle 1 + Angle 2 = 180

120 + Angle 2 = 180

Subtract 120 from both sides of the equation

Angle 2 = 180 - 120

Angle 2 = 60 degrees

By definiton, two angles are complimentary angles if they both add up to 90 degrees. Hence if angle L5 equals 50 degrees, then its compliment would be derived as 90 - 50 which equals 40. The compliment of angle L5 which is 50 degrees, equals 40 degrees.

Which expression is equivalent to (6 – 3x) + 9x ? 1 A. 8x + 2 B. 8x + 3 C. 10x-2 D. 10x - 6

Answers

Given to solve the expression:

[tex]\frac{1}{3}(6-3x)+9x[/tex]

step 1: Expand the bracket by multiplying each term by the factor outside

[tex]\begin{gathered} (\frac{1}{3}\times6)-(\frac{1}{3}\times3x)+9x \\ 2-x+9x \end{gathered}[/tex]

step 2: Simplify the expression obtained in step 1

[tex]\begin{gathered} 2-x+9x\text{ } \\ =2+8x \\ =8x+2 \\ \\ \text{The answer is \lbrack{}Option }A\rbrack \end{gathered}[/tex]

Substitute the given values into the given formula and alone the unknown variable if necessary round to one decimal place

Answers

Answer:

c = 15

Explanation:

The perimter, P = 37

The side lengths of the triangle are:

a = 10, b = 12, c = ?

The perimeter of the triangle is given by the formula:

P = a + b + c

Substitute a = 10, b = 12, and P = 37 into the formula P = a + b + c and solve for c

37 = 10 + 12 + c

37 = 22 + c

c = 37 - 22

c = 15

What is the measure of ?ХvO A. 46°42°42"38°NуvO B. 42°O C. 40°O D. 38°

Answers

The value Z is denoted as the center of the circle. Therefore, arc UV and arc XY should be the same .

[tex]undefined[/tex]

Answer: A. 42°

Step-by-step explanation:

Hope this helps :)

select all of the following equations which represent a function?

Answers

To verify that something is a function, we use the horizontal line rule. That is, if the horizontal line passes through two points, then the graph is not a function, like this:

Then the circles and the ellipses are not functions. Then the functions in the problem would be:

1, 3 and 6.

A train travels at 100 mph any equation can be written that compares the time with the distance to find the domain and range

Answers

ok

speed = distance / time

time = distance/speed

[tex]\text{ time = }\frac{dis\tan ce\text{ }}{speed}[/tex][tex]\text{ time = }\frac{dis\tan ce\text{ }}{100}[/tex]

or

[tex]\text{ distance = 100 x time}[/tex]

mrs smith took her 3 kids and 3 of thejr friends to the Strawberry field. how many kids are there?

Answers

Mrs.Smith took : her 3 kids + 3 of their friends = 3 + ( 3x 3 ) = 12 kids

Answer:

There are 3 kids, and 3 friends.

3 + 3 = 6

there are a total of 6 kids.

PLEASE HURRY ASAP
Determine which integer in the solution set will make the equation true.

4s − 14 = −6
S: {−1, 0, 1, 2}

Answers

The solution of the equation is s=2.

Linear Function

An equation can be represented by a linear function. The standard form for the linear equation is: y= mx+b , for example, y=7x+1. Where:

m= the slope. It can be calculated for Δy/Δx .

b= the constant term that represents the y-intercept.

For the given example: m=7and b=1.

For solving this question you should replace x for the given values ( −1, 0, 1, 2) in the equation 4s − 14 = −6. If you obtain -6, the value of s is a solution.

For s= -1 -> 4*(-1)-14= -4 -14= -20. Therefore, s=-1 is not the solution.

For s= 0 -> 4*(0)-14= 0 -14= -14. Therefore, s=0 is not the solution.

For s= 1 -> 4*(1)-14= 4 -14= -10. Therefore, s= 1 is not the solution.

For s= 2 -> 4*(2)-14= 8 -14= -6. Therefore, s=2 is the  solution.

Read more about the linear equations here:

brainly.com/question/2030026

#SPJ1

help meeeeeeeeee pleaseee !!!!!

Answers

The values of the functions evaluated are:

a. (f + g)(x) = 9x + 1

b. (f + g)(x) = -7x + 1

c. (f * g)(x) = 8x² - 55x - 72

d. (f/g)(x) = (x - 8)/(8x + 9)

How to Evaluate Functions?

To evaluate a function expression, we are to input the given value of x and solve by combining like terms and simplifying to find the value of the given function expression.

Given the functions:

f(x) = x - 8

g(x) = 8x + 9

a. Find (f + g)(x): This implies that we are to add the two functions f(x) and g(x) together.

(f + g)(x) = x - 8 + 8x + 9

(f + g)(x) = 9x + 1

b. Find (f - g)(x): This implies that we are to subtract g(x) from f(x).

(f - g)(x) = x - 8 - 8x + 9

(f + g)(x) = -7x + 1

c. Find (f * g)(x): This implies that we are to multiply the functions, g(x) and f(x) together.

(f * g)(x) = (x - 8) * (8x + 9)

(f * g)(x) = 8x² - 55x - 72

d. Find (f/g)(x): This implies that we are to find the quotient of the functions, f(x) and g(x).

(f/g)(x) = (x - 8)/(8x + 9)

Learn more about evaluating functions on:

https://brainly.com/question/2284360

#SPJ1

omg i lost my tutor in the middle of math i need another one btw in fith grade not in middle school yet

Answers

[tex]\frac{6}{10}\text{/}\frac{1}{5}[/tex]

by definition the division of fractions can be found by

[tex]\frac{\frac{a}{b}}{\frac{c}{d}}=\frac{b\cdot c}{a\cdot d}[/tex]

According to this

[tex]\frac{\frac{6}{10}}{\frac{1}{5}}=\frac{6\cdot5}{10\cdot1}=\frac{30}{10}=3[/tex]

Complete the table for y=-3x + 5 and graph the resulting line. -

Answers

We fill the table as follows:

*We assign values for x and solve for y, that is:

*x = 0:

[tex]y=-3(0)+5\Rightarrow y=5[/tex]

So, the value of y when x = 0 is 5.

*x = 1:

[tex]y=-3(1)+5\Rightarrow y=2[/tex]

So, the value of y when x = 1 is 2.

*x = 2:

[tex]y=-3(2)+5\Rightarrow y=-1[/tex]

So, the value of y when x = 2 is -1.

*x = 3:

[tex]y=-3(3)+5\Rightarrow y=-4[/tex]

So, the value of y when x = 3 is -4.

***The table should look like this:

x | y

0 | 5

1 | 2

2 | -1

3 | -4

***The graph is:

Marcy baked 132 cookies . She is packaging boxes of eight cookies to give as a gift to he friends how many boxes will she make .

Answers

She will make 16 boxes.

To answer this question we simply have to divide the number of cookies (132) by the number of cookies that each box can contain.

Mathematically speaking:

[tex]132/8\text{ }[/tex][tex]16.5[/tex]

Since we can´t have half boxes, we have to round the number to 16.

16 boxes.

use and show all conversion factors to convert 352 inches per second to miles per hour. 352 inches divided by 1 second

Answers

Okay, here we have this:

We need to convert 352 inches per second to miles per hour. So we obtain the following:

[tex]\begin{gathered} \frac{352in}{1sc}\cdot\frac{1mile}{63360in}\cdot\frac{3600sc}{1h} \\ =\frac{20\text{miles}}{h} \end{gathered}[/tex]

Finally we obtain that 352 inches per second 20 are miles per hour.

HELP PLEASEEEEE!!!!!!

Answers

The solutions of the indices are;

1)  2^7

2) 3^-4

3) 3^4

4) 2^4

What is the power?

We know that in this case, we would have to apply the laws of indices and the particular law that we are to apply in each case is dependent on the nature of the problem that have been posed. Let us recall that we are asked to ensure that we express the answer or the solution to the problem as a single power.

1) 64 * 256/128

2^6 * 2^8/2^7

2^6 + 8 - 7 = 2^7

2) 3^4/3^3 * 3^5

3^4 - (3 + 5) = 3^-4

3) 3^9/ (3^4)^1/2 * 3^3

3^9/ 3^2 * 3^3

3^9 - (2 + 3)

3^4

4) (2^3)^4 * 2^4 ÷ 32/ 2 * 64

2^12 * 2^4 ÷ 2^5/2^1 * 2^6

2^12 + 4 -5/2^1 + 6

2^16 -5/2^7

2^11/2^7

2^11 - 7

2^4

Learn more about laws of indices:https://brainly.com/question/27432311

#SPJ1

Jordan plotted the graph below to show the relationship between the temperature of his city and the number of cups of hot chocolate he sold daily:A scatter plot is shown with the title Jordans Hot Chocolate Sales. The x axis is labeled High Temperature and the y axis is labeled Cups of Hot Chocolate Sold. Data points are located at 20 and 20, 30 and 18, 40 and 20, 35 and 15, 50 and 20, 45 and 20, 60 and 14, 65 and 18, 80 and 10, 70 and 8, 40 and 2.Part A: In your own words, describe the relationship between the temperature of the city and the number of cups of hot chocolate sold. (2 points)Part B: Describe how you can make the line of best fit. Write the approximate slope and y-intercept of the line of best fit. Show your work, including the points that you use to calculate the slope and y-intercept. (3 points)

Answers

A.

Overall it has a relation that there are more sold cups when the temperature is lower. On the other hand, based on the 40 degrees part, that have to different values of two different days, we can say is not the only factor.

B.

The best lineal approach is the line created with the points at 20 and 80 degrees. First the slope:

[tex]m=\frac{y1-y2}{x1-x2}=\frac{20-10}{20-80}=\frac{10}{-60}=-\frac{1}{6}[/tex]

Now the intercept with y axis, b:

[tex]\begin{gathered} y=mx+b \\ 20=20(-\frac{1}{6})+b \\ 20+\frac{20}{6}=b=23.33=\frac{70}{3} \end{gathered}[/tex]

The final line formula is:

[tex]y=-\frac{x}{6}+\frac{70}{3}[/tex]

In the diagram shown, ray CD is perpendicular to ray CE. If the measure of DCF is 115then what is the measure of ECF?

Answers

m∠FCE =25º

1) Since the measure of ∠DCF = 115º and ∠DCE = 90º then by the Angle Addition postulate we can state that

∠DCF = ∠DCE +∠FCE Plugging into that the given values

115º = 90º + ∠FCE Subtracting 90º from both sides

115-90=∠FCE

25º =∠FCE

2) Then the measure of ∠FCE is 25º

Given the definitions of f(a) and g(x) below, find the value of (19)( 1),f (x) = x2 + 3x – 11g(x) = 3a + 6

Answers

The given functions are,

[tex]\begin{gathered} f(x)=x^2+3x-11_{} \\ g(x)=3x+6 \end{gathered}[/tex]

Fog can be determined as,

[tex]\begin{gathered} \text{fog}=f(g(x)) \\ =f(3x+6) \\ =(3x+6)^2+3(3x+6)-11 \\ =9x^2+36+36x+9x+18-11 \\ =9x^2+45x+43 \end{gathered}[/tex]

The value of fog(-1) can be determined as,

[tex]\begin{gathered} \text{fog}(-1)=9(-1)^2+45(-1)+43 \\ =9-45+43 \\ =7 \end{gathered}[/tex]

Thus, the requried value is 7.

Write an absolute value inequality that represents all real numbers more than 4 units away from x

Answers

We have to write as inequality the following

"All real numbers more than 4 units away from x"

"4 units away from x" means four units plus x. So, the expression would be

[tex]|x|>4[/tex]

Where x represents real numbers.

This expression is referring to all real numbers more than 4 units and less than -4 units because according to the property of absolute values for inequalities, we have

[tex]|x|>x-4\rightarrow x>x-4,or,x<-(x-4)[/tex]

This is represented in the following graph to see it better

For x=1

[tex]\begin{gathered} |1|>x-4\rightarrow1>1-4,or,1<-(1-4) \\ 1>-3 \\ 1<3 \end{gathered}[/tex]

Both results are true.

To find this absolute value inequality we used the following property

[tex]|x|>a\rightarrow a>b,or,a<-b[/tex]

Where the absolute value inequality has "more than" we rewrite the expression in two inequalities.

find the x value (6x+9)° (4x-19)°

Answers

In this problem m and n are parallel lines, and the first angle is an exteriar angle an the secon is a interior angle.

this two condition give us that the two angles are complementary anlges so the sum of them should be 180 so:

[tex]6x+9+4x-19=180[/tex]

and we can solve for x so:

[tex]\begin{gathered} 10x-10=180 \\ 10x=180+10 \\ x=\frac{190}{10} \\ x=19 \end{gathered}[/tex]

Use the Rational Zeros Theorem to find all the real zeros of the polynomial function. Use the zeros to factor f over the real numbers. Hint solve this problem using P and Q's and synthetic division f(x) = x^3 + 2x^2 - 5x - 6A -3, -1, 2; f(x) = (x + 3)(x + 1)(x - 2)B-1; f(x) = (x + 1)(x2 + x - 6)C-3; f(x) = (x + 3)(x2 - x - 2)D-2, 1, 3; f(x) = (x + 2)(x - 1)(x - 3)

Answers

[tex]f(x)=x^3+2x^2-5x-6[/tex]

Since all coefficients are integers, we can apply the rational zeros theorem.

The trailing coefficient is -6 with the following factors (possible values for p):

[tex]p\colon\pm1,\pm2,\pm3,\pm6[/tex]

The leading coefficient is 1, with factors:

[tex]q=\pm1[/tex]

Therefore, all the possible values of p/q are:

[tex]\frac{p}{q}\colon\pm\frac{1}{1},\pm\frac{2}{1},\pm\frac{3}{1},\pm\frac{6}{1}[/tex]

Simplifying, the possible rational roots are:

[tex]\pm1,\pm2,\pm3,\pm6[/tex]

Next, we have to check if they are roots of the polynomials by synthetic division, in which the remainder should be equal to 0.

0. Dividing ,f (x), by ,x−1,. Remainder = ,-8, ,+1, is ,NOT ,a root.

,

1. Dividing ,f (x), by x+,1,. Remainder = 0, ,-1, ,IS ,a root.

,

2. Dividing ,f (x), by x-2. Remainder = 0, ,+2, ,IS ,a root.

,

3. Dividing ,f (x), by ,x+2,. Remainder = ,4, ,-2, is ,NOT ,a root.

,

4. Dividing ,f (x), by ,x−3,. Remainder = 24,, ,+3, is ,NOT ,a root.

,

5. Dividing ,f (x), by ,x+3,. Remainder = 0,, ,-3, IS ,a root.

,

6. Dividing ,f (x), by ,x−6,. Remainder = 252,, ,+6, is ,NOT ,a root.

,

7. Dividing ,f (x), by ,x+6,. Remainder = -120,, ,-6, is ,NOT ,a root.

Actual rational roots: A. -3, -1, 2; f(x) = (x + 3)(x + 1)(x - 2)

Is (6, –21) a solution to the equation y = –5x − –9?

Answers

Answer:

Explanation:

Given the equation:

[tex]y=-5x-(-9)[/tex]

When x=6:

Solve system of equations using the method of substitution. Identify wether the system represents parallel, coincident, or parallel lines.5x+2y=167.5x+3y=24

Answers

Given

5x+2y=16 ---(1)

7.5x+3y=24 ----(2)

Find

1) value of x and y

2) Type of system

Explanation

From equation (1)

[tex]\begin{gathered} 5x+2y=16 \\ 5x=16-2y \\ x=\frac{16-2y}{5} \end{gathered}[/tex]

Putting this value of x in equation 2

[tex]\begin{gathered} 7.5x+3y=24 \\ 7.5(\frac{16-2y}{5})+3y=24 \\ 1.5(16-2y)+3y=24 \\ 24-3y+3y=24 \end{gathered}[/tex]

From here we cannot find the values of x and y as 3y and -3y will cancel each other. Hence there is not a particular solution

Checking the type of system

From these equations we get

[tex]\frac{a1}{a2}=\frac{b1}{b2}=\frac{c1}{c2}[/tex]

Therefore the lines are coincident to each other

Therefore the lines have infinte solutions

Final Answer

Therefore the lines have infinte solutions

The lines are coincident to each other

The relation between the number of batteries (n) and the maximum height reached by the drone (h) in feet (ft) is given. Complete the table and check the correct box(es) given below.

Answers

We use the equation: h = 100(n + 2), so:

For n = 1:

[tex]h=100(1+2)=100(3)=300[/tex]

For n = 3:

[tex]h=100(3+2)=100(5)=500[/tex]

We can see that this is the correct equation. Therefore, given h we find n:

For h = 700

[tex]\begin{gathered} 700=100(n+2) \\ \frac{700}{100}=\frac{100}{100}(n+2) \\ 7=n+2 \\ 7-2=n+2-2 \\ n=5 \end{gathered}[/tex]

For h = 900

[tex]\begin{gathered} 900=100(n+2) \\ \frac{900}{100}=\frac{100}{100}(n+2) \\ 9=n+2 \\ 9-2=n+2-2 \\ n=7 \end{gathered}[/tex]

Answer:

(n): 1 3 5 7

(h): 300 500 700 900

Correct equation: h = 100(n + 2)

Write the ordered pair with no spaces (x,y) of point C for j(x).

Answers

This problem is about functions.

In this case, we don't have function j(x) defined in order to find its ordered pairs.

However, assuming that function j(x) is a function of f(x), we can deduct that points C is

[tex]C(0,0)[/tex]

Which of the following is an equation of a line that is parallel to y = 4x - 5 and has a y-intercept of (0, 7)?

Answers

Answer:

Step-by-step explanation:

To start your equation is in the format y=mx+b.

For a line to be parallel it must have the same slope (m) so we know 4 must remain the same. x & y will not change since they represent the variables. y=4x (so far) then the point (0,7) as stated is the y intercept. 0 is the x value and 7 is the y we need to add 7 to our equation.

final equation y=4x+7

What is the largestNumber of these wooden Els that can be packed in a box that is 2 cm x 4 cm x 6 cm

Answers

The largest number of the wooden Els with it's total surface area that can be packed in the 2cm×4cm×6cm box is 2 wooden Els.

Total Surface Area of Solid Shapes

In finding the total surface area of a solid cuboid, add the areas of all 6 faces. We can also label the length (l), width (w), and height (h) and use the formula, SA=2(lw+lh+hw), to find the surface area.

For the box, l=2cm, w=4cm and h=6cm

total surface area of box=2(2×6+2×4+6×4) cm square units

total surface area of box=2(44) cm square units

total surface area of box=88cm square units

For the top cuboid of the wooden El, l=3cm, w=1cm and h=2cm

total surface area of top El cuboid=22cm square units

For the bottom cuboid of the wooden El, l=1cm, w=1cm and h=2cm

total surface area of bottom El cuboid=10cm square units

total surface area of the El=32cm square units

(88cm²/32cm²)=2.75

This implies that only two(2) whole Els with total surface area of 32cm² can be packed in the box.

Know more about surface area of cuboid here: https://brainly.com/question/16519513

#SPJ1

How do I solve this and what is the answer

Answers

Answer:

157.5°

Explanation:

To convert from radians to degrees, multiply the angle in radians by 180/π.

Therefore, 7π/8 radians in degrees will be:

[tex]\begin{gathered} \frac{7\pi}{8}\text{ radians=}\frac{7\pi}{8}\times\frac{180}{\pi} \\ =\frac{7}{8}\times180 \\ =157.5\degree \end{gathered}[/tex]

On a 7 question multiple-choice test, where each question has 2 answers, what would be the probability of getting at least one question wrong?Give your answer as a fraction

Answers

Solution

- This is a Binomial probability question. The formula for Binomial probability is:

[tex]\begin{gathered} P(r)=\sum\text{ }^nC_rp^rq^{n-r} \\ where, \\ n=The\text{ total number of trials} \\ r=\text{ The number of successful trials\lparen where answer is correct\rparen} \\ p=\text{ The probability of success \lparen The probability of getting a question } \\ right) \end{gathered}[/tex]

- We have been given:

[tex]\begin{gathered} n=7 \\ \text{ since there can only be two answers, it means that the} \\ \text{ probability of getting a question correct is:} \\ p=\frac{1}{2} \\ q=1-p=\frac{1}{2} \\ \\ \text{ The probability of getting at least 1 question wrong means the } \\ probability\text{ of getting 1, 2, 3, 4, 5, 6, or 7 question wrong.} \\ \\ \text{ Instead of calculating all these probabilities, we can simply say} \\ P(1)+P(2)+P(3)+P(4)+P(5)+P(6)+P(7)=1-P(0) \end{gathered}[/tex]

- Thus, we have:

[tex]\begin{gathered} P(0)=^7C_0(\frac{1}{2})^0(\frac{1}{2})^7 \\ P(0)=\frac{1}{128} \\ \\ 1-P(0)=1-\frac{1}{128}=\frac{127}{128} \end{gathered}[/tex]

Final Answer

The answer is

[tex]\frac{127}{128}[/tex]

how can you use the vertical line test and the horizontal line test to determine whether a graph represents a function and whether the graph is invertible?

Answers

In this case, we'll have to carry out several steps to find the solution.

Step 01:

Data

vertical line test = ?

horizontal line test = ?

Step 02:

vertical line test ===> function

any vertical line intersect the graph at only one point

horizontal line test ===> invertible

any horizontal line intersect the graph at only one point

graph:

horizontal line test = red

vertical line test = brown

That is the full solution.

Pablo Is choosing at random from a bag of colored marbles. The probability he will choose a red marble is1/9What are the odds in favor of him choosing a redmarble?

Answers

Given:

[tex]\text{The probability to choose a red marble=}\frac{1}{9}[/tex]

The odds in favour of Pablo chosing a re marble is 1 : 8

Other Questions
Write the equation of the line that passes through the points (3,1)(3,1) and (-7,-1)(7,1). Put your answer in fully simplified point-slope form, unless it is a vertical or horizontal line. which statement about medication and schizophrenia is the least accurate? a. medication is very helpful for some, moderately helpful for others, and ineffective for the remainder of those suffering from schizophrenia. b. the approaches to treating schizophrenia have vastly improved over the last several decades. c. medication can alleviate some problems, but it can also create new ones. d. medication is the only effective way to treat schizophrenia. Mr. Washington is putting his DVDs on a shelf that is 10 23 inches long. If each DVD is 1120 inches wide, how many DVDs can he put side-by-side on the shelf? DVDs The ratio of boys to girls in a school is 5:4. if there are 500 girls , how many boys are there in the school? Which of the following are among the counsels offered to the young Philip IV by Gaspar de Guzmn? Select all that apply.The bulk of governmental officials should come from the rank of the grandees.The monarch should keep ministers dependent on royal approval.Ecclesiastical appointments should be made in consultation with the papacy.The monarchy should ensure that the people have sufficient bread in order to keep down rebellion.None of the infantes should be allowed to hold high administrative office. Which of the following represents the dimensions of the room Identify and describe what new religion developed in South Asia due to the interaction between Hinduism and Islam Phospholipids are found in a limited number of foods. They consists of a glycerol backbone with two fatty acids and a compound that contains phosphate. Why are they important in food and in the body?. During the great depression, john maynard keynes quipped that "in the long run, we are all dead" in response to classical economists assertions that?. 3. Solve using the Laws of Sines Make a drawing to graphically represent what the following word problem states. to. Two fire watch towers are 30 miles apart, with Station B directly south of Station A. Both stations saw a fire on the mountain to the south. The direction from Station A to the fire was N32 W. The direction from Station B to the fire was N40 E. How far (to the nearest mile) is Station B from the fire? A basketball player jumps for a rebound and reaches a maximum height of 1.5 m. with what speed did he jump off the floor? How long was he in the air? Which of the following would be a good name for the function that takes the length of a race and returns the time needed to complete it? Which question can be answered by finding the quotient of ? A. Jared makes of a goodie bag per hour. How many can he make in of an hour? B. Jared makes of a goodie bag per hour. How many can he make in of an hour? C. Jared has of an hour left to finish making goodie bags. It takes him of an hour to make each goodie bag. How many goodie bags can he make? D. Jared has of an hour left to finish making goodie bags. It takes him of an hour to make each goodie bag. How many goodie bags can he make? A piece of rock weighs 5 Newtons. A force F is applied to it and it produces an acceleration of a. Now, if there is a second piece of rock, what force needs to be applied to the second piece of rock to produce an acceleration of 8a? Starting with a gas of N2 in a balloon of temperature 148.5C and volume 241.8mL, what is its final volume if you cool it to -96.4C? which of the following are independent of the mass of an object falling freely near earth's surface: (may have more than 1 answer) 1) acceleration of the object 2) gravitational force acting on the object 3) gravitational force acting on the object 4) magnitude of the gravitational field what is the mass on grams of 0.56 moles of NaCl Which statement best describes the area of the triangle shown below? PLEASE HELP I WILL GIVE BRAINLYEST!! ALGEBRA 1 HW What is Zeldins experience before running for Governor?