The frictional force exerted by the bullet on the tree is approximately 10,142.49 N
Elaborating:We can calculate the force using the formula: F = K/d
where d is the distance over which the frictional force acts, which in this case is the depth to which the bullet penetrates the tree.
F = (493.57 J)/(0.0486 m)
F = 10,142.49 N
What is the force of friction?The force that prevents an object from moving when it comes into contact with another object is known as the frictional force. It occurs as a result of objects' surface irregularities, which cause them to resist movement when in contact with one another.
What factors determine the magnitude of the frictional force?How much frictional power relies upon a few elements, for example, the idea of the surfaces in touch, the power squeezing the items together, and the speed at which they move comparative with one another. In mechanics, engineering, and materials science, among other fields of physics, the frictional force is an essential phenomenon.
Learn more about friction:
brainly.com/question/13000653
#SPJ1
it may seem strange that the selected velocity does not depend on either the mass or the charge of the particle. (for example, would the velocity of a neutral particle be selected by passage through this device?) the explanation of this is that the mass and the charge control the resolution of the device--particles with the wrong velocity will be accelerated away from the straight line and will not pass through the exit slit. if the acceleration depends strongly on the velocity, then particles with just slightly wrong velocities will feel a substantial transverse acceleration and will not exit the selector. because the acceleration depends on the mass and charge, these influence the sharpness (resolution) of the transmitted particles.
The selected velocity does not depend on either the mass or the charge of the particle. It is because the mass and the charge control the resolution of the device--particles with the wrong velocity will be accelerated away from the straight line .
If the acceleration depends strongly on the velocity, then particles with just slightly wrong velocities will feel a substantial transverse acceleration and will not exit the selector. Because the acceleration depends on the mass and charge, these influence the sharpness (resolution) of the transmitted particles.
Thus, even if the particles have different charges or masses, they can have the same velocity when passing through the selector. So, the velocity of a neutral particle would be selected by passage through this device, as it is independent of both mass and charge.
For more information on charge mass and velocity relation refer https://brainly.com/question/14344386
#SPJ11
a charged particle traveling along the x axis enters an electric field directed vertically upward along the y-axis. if the charged particle experiences a force downward because of this field, what is the sign of the charge on this particle?
A charged particle with a negative charge will experience a force downward when entering an electric field directed vertically upward along the y-axis. This is because opposite charges attract and the negatively charged particle will be attracted to the positively charged electric field.
F = qE
where F is the force on the particle,
q is the charge on the particle, and
E is the electric field strength.
Since the charged particle experiences a force that is directed vertically downwards, its charge must be negative because the electric field is directed vertically upwards. Therefore, the answer is the charge on the particle is negative.Learn more about electric fields: https://brainly.com/question/14372859
#SPJ11
The thermal energy of a system increases by 600 j, and 1400 j of heat is added to the system. how much work did the system do? responses a. 600 j b. 800 j c. 1400 j d. 2000 j
The correct answer is B. The system did 800 J of work.
ΔU = Q - W
we are given that ΔU = 600 J and Q = 1400 J.
W = Q - ΔU
W = 1400 J - 600 J
W = 800 J
Thermal energy is a type of energy that is related to the temperature of a system or object. It is a form of kinetic energy that results from the movement of particles in a substance. The faster the particles move, the higher the temperature and the greater the thermal energy of the substance.
In physics, thermal energy is often associated with heat transfer between two objects that are at different temperatures. This transfer of energy can occur through conduction, convection, or radiation. For example, when you touch a hot stove, the thermal energy from the stove is transferred to your hand, causing a sensation of heat.
To learn more about Thermal energy visit here:
brainly.com/question/18989562
#SPJ4
8. Antares is a red giant located at a distance of 5.246 x 10¹m from Earth and has a luminosity of 3.1 x 10"W. C
Calculate the intensity of radiation reaching Earth from Antares.
9. The closest star to Earth (apart from the Sun) is Proxima Centauri, located at a
distance of 4.014 x 10m. It has a luminosity of 6.5 x 10"W.
Calculate the intensity of radiation reaching Earth from Proxima Centauri.
10. The star Vega has a luminosity of 1.5 x 10 W and a surface area of 4.18 x 10¹m².
Calculate the surface temperature of Vega and its Amax value (maximum spectral wavelength intensity).
11. The star Sirius has a luminosity of 9.7 x 10 W and a surface area of 1.8 x 10¹ m².
Calculate the surface temperature of Sirius and its Amax value (maximum spectral wavelength intensity).
Answer:
see the explanation part
Explanation:
8.We can use the inverse square law to calculate the intensity of radiation reaching Earth from Antares. The inverse square law states that the intensity of radiation from a point source decreases as the square of the distance from the source increases.
The formula for the intensity of radiation is:
I = L / (4πd²)
where I is the intensity, L is the luminosity, and d is the distance from the source.
Substituting the values given in the problem, we get:
I = (3.1 x 10^26 W) / (4π x (5.246 x 10^16 m)^2)
I = 3.1 x 10^26 / (4π x 2.754 x 10^33)
I = 7.1 x 10^-8 W/m²
Therefore, the intensity of radiation reaching Earth from Antares is 7.1 x 10^-8 W/m².
9.We can use the same formula as in the previous question to calculate the intensity of radiation reaching Earth from Proxima Centauri:
I = L / (4πd²)
where I is the intensity, L is the luminosity, and d is the distance from the source.
Substituting the values given in the problem, we get:
I = (6.5 x 10^24 W) / (4π x (4.014 x 10^16 m)^2)
I = 6.5 x 10^24 / (4π x 6.431 x 10^32)
I = 4.0 x 10^-15 W/m²
Therefore, the intensity of radiation reaching Earth from Proxima Centauri is 4.0 x 10^-15 W/m².
10.We can use the Stefan-Boltzmann law to calculate the surface temperature of Vega:
L = 4πR²σT⁴
where L is the luminosity, R is the radius of the star, σ is the Stefan-Boltzmann constant, and T is the surface temperature.
We can rearrange this equation to solve for T:
T = (L / (4πR²σ))^(1/4)
We can also use Wien's displacement law to calculate the Amax value:
Amax = b / T
where Amax is the maximum spectral wavelength intensity, b is Wien's displacement constant, and T is the surface temperature.
Substituting the values given in the problem, we get:
T = [(1.5 x 10^28 W) / (4π x (4.18 x 10^11 m)² x 5.67 x 10^-8 W/(m²K⁴))]^(1/4)
T = 9,667 K
Amax = (2.898 x 10^-3 m·K) / 9,667 K
Amax = 3.0 x 10^-7 m
Therefore, the surface temperature of Vega is approximately 9,667 K, and its Amax value is approximately 3.0 x 10^-7 m.
11.We can use the same formulas as in the previous question to calculate the surface temperature and Amax value of Sirius:
Surface temperature:
L = 4πR²σT⁴
T = (L / (4πR²σ))^(1/4)
where L is the luminosity, R is the radius of the star, σ is the Stefan-Boltzmann constant, and T is the surface temperature.
Substituting the values given in the problem, we get:
T = [(9.7 x 10^26 W) / (4π x (1.8 x 10^11 m)² x 5.67 x 10^-8 W/(m²K⁴))]^(1/4)
T = 9,940 K
Amax value:
Amax = b / T
where Amax is the maximum spectral wavelength intensity, b is Wien's displacement constant, and T is the surface temperature.
Substituting the value of T we calculated above, we get:
Amax = (2.898 x 10^-3 m·K) / 9,940 K
Amax = 2.91 x 10^-7 m
Therefore, the surface temperature of Sirius is approximately 9,940 K, and its Amax value is approximately 2.91 x 10^-7 m.
Compare the gravitational force between earth and mars in the gravitational force between a newborn baby in a doctor the greater forces between which pair?
A newborn infant and a doctor are pulled apart by much less gravitational force than the distance between Earth and Mars.
The gravitational force between Earth and Mars can be calculated using the formula F = G(m1m2)/r^2, where G is the universal gravitational constant, m1 and m2 are the masses of the two objects, and r is the distance between their centers. The mass of Earth is about 5.97 x 10^24 kg, the mass of Mars is about 6.39 x 10^23 kg, and the average distance between them is about 225 million km. Using these values and the formula, we can calculate that the gravitational force between Earth and Mars is about 2.7 x 10^22 N.
On the other hand, the gravitational force between a newborn baby and a doctor can be calculated using their masses and the distance between them. Assuming an average newborn baby mass of 3.5 kg and an average doctor mass of 75 kg, and a distance of 1 meter between them, we can calculate that the gravitational force between them is about 2.2 x 10^-8 N.
Clearly, the gravitational force between Earth and Mars is much greater than the force between a newborn baby and a doctor. The greater forces are between the larger and more massive objects, such as planets or stars, due to their greater masses and distances.
To learn more about gravitational force refer to:
brainly.com/question/12528243
#SPJ4
what are the differences in your experimental results between the perfectly elastic and inelastic collisions?
The main difference between perfectly elastic and inelastic collisions is that In a perfectly elastic collision, the total kinetic energy of the system is conserved, while in an inelastic collision, the total kinetic energy of the system decreases.
Perfectly elastic collisions result in no loss of kinetic energy, whereas inelastic collisions result in a loss of kinetic energy. Collisions in which the kinetic energy is conserved are known as perfectly elastic collisions. Two billiard balls colliding are an example of a perfectly elastic collision because they have the same mass, and there is no deformation of the ball. As a result, in a perfectly elastic collision, both momentum and kinetic energy are conserved.In contrast, in an inelastic collision, kinetic energy is not conserved.
In an inelastic collision, two or more bodies come together and stick to one another after colliding. When two cars collide, for example, they do not bounce off each other; instead, they become deformed and stick together. A loss of kinetic energy is present in inelastic collisions because the deformation causes some of the energy to be converted to heat, sound, and other forms of energy that are not associated.
Therefore, the differences in the experimental results between perfectly elastic and inelastic collisions are due to the fact that inelastic collisions cause kinetic energy to be lost, while perfectly elastic collisions do not cause kinetic energy to be lost.
To know more about Elastic Collision refer here :
https://brainly.com/question/7221794
#SPJ11
Pablo and Jacob are running a half marathon. Jacob is d=54. 9m
behind Pablo, and both are running at the same speed, v0=3. 98m/s
. At a particular moment, Jacob begins to accelerate forward at a constant rate of a=0. 054m/s2
Jacob will catch up to Pablo in approximately 31.8 seconds.
What is constant rate?A constant rate is a fixed or unchanging speed at which a process occurs. It is a measurement of how much something changes in a given amount of time. For example, if a car is traveling at a constant rate of 60 miles per hour, it will cover 60 miles in one hour, regardless of any changes in speed or direction.
What is a constant rate example?An example of constant rate is the speed of a car traveling on a highway with no traffic or other obstacles. As long as the car maintains a steady speed, the rate of its movement remains constant. Another example could be the rate at which a chemical reaction proceeds under stable conditions.
To know more about rate constant visit:
https://brainly.com/question/15053008
#SPJ1
to stretch an ideal spring 7.00 cm from its unstretched length, 14.0 j of work must be done.what magnitude force is needed to stretch the spring 7.00 cm from its unstretched length?
The magnitude force that is needed to stretch the spring 7.00 cm from its unstretched length is 200 N.
The spring constant, symbolized by k, is a spring's characteristic measure of stiffness, which represents the force required to stretch or compress it per unit length. When a force is exerted on a spring, it compresses or stretches proportionally to the applied force.
The equation for spring potential energy is:
PEspring = 1/2kx²where k is the spring constant, x is the distance the spring is compressed or stretched, and PEspring is the potential energy stored in the spring.
Here, the distance x is given as 7.00 cm=0.07mand potential energy PEspring is given as 14.0 J
Substitute these values into the spring potential energy equation and solve for k.14.0 J=1/2k (0.07 m)²K= 14.0 J/ (0.5 × 0.07 m²)K=400 N/m
To stretch the spring by 7.00 cm, we first compute the amount of potential energy stored in the spring as it is stretched from its original position. PEspring = 1/2kx²PEspring = 1/2 × 400 N/m × (0.07 m)²PEspring = 0.98 J
To find the force required to stretch the spring, use the equation: F = ∆PEspring/ ∆xF = (14.0 J - 0 J)/ (0.07 m - 0 m)F = 200 N
Therefore, the magnitude force that is needed to stretch the spring 7.00 cm from its unstretched length is 200 N.
Know more about spring constant
https://brainly.com/question/22712638
#SPJ11
Question:
Which of the following are possible statements of the second law of thermodynamics?
a. It is possible to construct a heat engine operating in a cycle that extracts heat from a reservoir and delivers an equal amount of work.
b. All Carnot engines operating between the same two temperatures have the same efficiency, irrespective of the nature of the working substance.
c. It is possible to construct a refrigerator operating in a cycle whose sole effect is to transfer heat from a cooler object to a hotter one.
d. It is theoretically possible to convert heat into work with 100% efficiency.
The correct answer according to the second law of thermodynamics is b. All Carnot engines operating between the same two temperatures have the same efficiency, irrespective of the nature of the working substance.
The second law of thermodynamics states that it is impossible to convert heat into work with 100% efficiency, and that there will always be some loss of energy in the form of heat.
Therefore, option a and d are incorrect.
Additionally, option c violates the second law of thermodynamics, as it is impossible to transfer heat from a cooler object to a hotter one without the input of work.
Option b, however, is a correct statement of the second law of thermodynamics.
Carnot engines are theoretical engines that operate at maximum possible efficiency, and their efficiency is determined only by the temperatures of the heat reservoirs they operate between.
Therefore, all Carnot engines operating between the same two temperatures will have the same efficiency, regardless of the nature of the working substance.
In conclusion, the correct answer to the question according to the second law of thermodynamics is option b. All Carnot engines operating between the same two temperatures have the same efficiency, irrespective of the nature of the working substance.
To know more about second law of thermodynamics, refer here:
https://brainly.com/question/7206767#
#SPJ11
If earth was suddenly removed from the solar system what would happen to the moon? :
a- The moon would fall toward earths former location
b- he moon would move straight out of the solar system
c- The moon would continue to move in its current orbit
d- The moon would move into a new orbit under the influence of the sun
Without experiencing a major change in its orbit, the moon would keep revolving around the sun in the same direction.
If the Earth was suddenly removed from the solar system, the moon would continue to move in its current orbit. This is because the moon's orbit is not only influenced by the gravitational pull of the Earth, but also by the gravitational pull of the sun. The gravitational force of the sun on the moon is much stronger than the gravitational force of the Earth on the moon, as the sun is much more massive than the Earth.
Therefore, the moon would continue to orbit around the sun in its current path, without any significant change in its orbit. However, the absence of the Earth would cause significant changes in the rest of the solar system, as the gravitational interactions between the planets would be altered.
To learn more about gravitational pull refer to:
brainly.com/question/13467280
#SPJ4
Having landed on a newly discovered planet,
an astronaut sets up a simple pendulum of
length 1.04 m and finds that it makes 475
complete oscillations in 1320 s. The amplitude of the oscillations is very small compared
to the pendulum’s length.
What is the gravitational acceleration on
the surface of this planet?
Answer in units of m/s^2.
Answer:
17.215 m/s^2
Explanation:
L = 0.825 m
It completes 397 oscillations in 546 s.
Time period is defined as the time taken to complete one oscillation.
So, Time period, T = 546 / 397 = 1.375 s
Let g be the gravitational acceleration at that planet.
Use the formula for the time period
g = 17.215 m/s^2
Amy wishes to measure the specific heat capacity of a piece of metal. She places the 75 g piece of metal in a pan of boiling water, then drops it into a cup holding 50 g of water at 22°C. The metal and the water come to an equilibrium temperature of 25°C.
a. Calculate the heat gained by the water.
b. Calculate the heat lost by the metal.
c. Calculate the specific heat of the metal.
Answer:
QL = heat lost = Sm * Mm * ΔTm
QL = Sm * 75 g * (212 - 25) = 14,000 Sm heat lost by metal
QG = 1 cal/gm deg C * 50 g * (25 - 22) = 150 cal / gm deg C gained water
Since heat loss = heat gained
Sm = 150 / 14,000 = .010 cal / gm deg C
Determine the molar mass of a gas if the volume of 0. 05 g of the gas is 50cc at 27°c and 76cm Hg pressure
If the volume of 0. 05 g of the gas is 50cc at 27°c and 76cm Hg pressure the molar mass of the gas is approximately 81.97 g/mol.
To determine the molar mass of the gas, we can use the ideal gas law:
PV = nRT
where P is the pressure, V is the volume, n is the number of moles, R is the gas constant, and T is the temperature in Kelvin.
First, we need to convert the given values to the appropriate units. The volume is given in cc, which is equivalent to mL, so we can convert it to m^3:
V = 50 cc = 50 x 10^-6 m^3
The temperature is given in degrees Celsius, so we need to convert it to Kelvin:
T = 27°C + 273.15 = 300.15 K
The pressure is given in cm Hg, so we need to convert it to Pa:
P = 76 cm Hg x (1 m/100 cm) x (133.32 Pa/1 cm Hg) = 101325.12 Pa
Now we can solve for the number of moles of gas:
n = PV/RT
where R = 8.314 J/(mol·K) is the gas constant.
n = (101325.12 Pa) x (50 x 10^-6 m^3) / (8.314 J/(mol·K) x 300.15 K)
n = 0.000610 mol
Finally, we can calculate the molar mass of the gas:
molar mass = mass / moles
Since the mass of the gas is given as 0.05 g, we have:
molar mass = 0.05 g / 0.000610 mol
molar mass = 81.97 g/mol
Therefore, the molar mass of the gas is approximately 81.97 g/mol.
For such more questions on molar mass:
brainly.com/question/30337794
#SPJ11
A charged cloud system produces an electric field in the air near the earth surface. When a particle (q=-2. 0x10^-9) is acted on by a downward electrostatic force of 3. 0x10^-6 N when placed in this field, determine the magnitude of the electric field
The correct option is 4, the gravitational and electrostatic force, respectively, exerted on a proton placed in this field are: 2.9 × [tex]10^{-17}[/tex]N and 1.64 × [tex]10^{-26}[/tex]N.
Electrostatic force on charge particle,
3 × [tex]10^{-6}[/tex]N
Charge on a particle,
q = 16.2 × [tex]10^{-19}[/tex]C
Calculation of gravitational force:
F = qE
3 × [tex]10^{-6}[/tex] = 16.2 × [tex]10^{-9}[/tex]E
E = 3 × [tex]10^{-6}[/tex] / 16.2 × [tex]10^{-9}[/tex]
= 3 × [tex]10^3[/tex] / 16.2
Electrostatic force on proton,
= qE = 1.6 ×[tex]10^{-19}[/tex] × 3 × [tex]10^3[/tex] / 16.2
= 2.9 × [tex]10^{-17}[/tex]N
The gravitational force on the proton,
= mass of proton × acceleration due to gravity
= 1.67 × [tex]10^{-27}[/tex] × 9.8
= 1.64 × [tex]10^{-26}[/tex]N
Hence, the gravitational and electrostatic force, respectively, exerted on a proton placed in this field are:
2.9 × [tex]10^{-17}[/tex]N and 1.64 × [tex]10^{-26}[/tex]N
The electrostatic force, also known as the Coulombic force, is a fundamental force of nature that governs the interactions between electrically charged particles. This force arises from the attraction or repulsion between electric charges, which can be positive or negative. Like charges repel each other, while opposite charges attract.
Electrostatic force plays a crucial role in a wide range of physical phenomena, including the behavior of atoms and molecules, the functioning of electronic devices, and the behavior of charged particles in electric and magnetic fields. It is also responsible for the behavior of lightning, the spark from static electricity, and the attraction between a comb and hair. The electrostatic force is one of the four fundamental forces of nature, along with gravity, the strong nuclear force, and the weak nuclear force.
To learn more about Electrostatic force visit here:
brainly.com/question/20202974
#SPJ4
Complete Question: -
A charged cloud system produces an electric field in the air near the earth's surface. A particle of charge 16.2 × [tex]10^{-19}[/tex]C is acted on by a downward electrostatic force of 3 × [tex]10^{-6}[/tex]N when placed in this field. The gravitational and electrostatic force, respectively, exerted on a proton placed in this field are
(1) 1.64 × [tex]10^{-26}[/tex]N, 2.4 × [tex]10^{-16}[/tex]N
(2) 1.64 × [tex]10^{-26}[/tex]N, 2.9 × [tex]10^{-16}[/tex]N
(3) 1.56 × [tex]10^{-18}[/tex]N, 2.4 ×[tex]10^{-16}[/tex]N
(4) 2.9 × [tex]10^{-17}[/tex]N, 1.64× [tex]10^{-26}[/tex]N
a wire carrying more electrons will transfer more energy than a wire giving fewer electrons. is this statement accurate? explain!
Answer:
Yes because provided the current is the same.
The man is pushing this boulder to the right, but it will not move. Which of the following statements correctly describes the net force?
a)The net force is acting upward.
b) The net force is acting to the right.
C) The net force is zero, and all forces are balanced.
D) The net force is acting to the left.
Answer : The man is pushing this boulder to the right, but it will not move, The net force is acting to the left. The correct answer is option D
The net force acting on the boulder is the vector sum of all forces acting on the boulder. In this case, since the man is pushing the boulder to the right, there is an applied force to the right.
However, if the boulder is not moving, the net force must be zero, meaning that there must be an equal and opposite force acting to the left. Therefore, the correct statement is: The net force is acting to the left.
To understand this, we must consider the two components of net force: magnitude and direction. The magnitude of the net force is determined by how hard the man is pushing the boulder, while the direction is determined by the vector sum of all forces acting on the boulder.
Therefore, the correct statement is: The net force is acting to the left.
Know more about forces here:
https://brainly.com/question/26115859
#SPJ11
How long will it take a 500w heater to melt 100grams of ice at 0degrees celsius
Ice has a 333J/g latent heat of fusion.it will take approximately 66.8 seconds for a 500W heater to melt 100 grams of ice at 0 degrees Celsius. .To deliver a required amount of energy, l
At 0 degrees Celsius, how can ice melt?Liquid water freezes at temperature below 32°F (0°C); this temperature is known as the water freezing point. Normal water ice melts or transforms from a solid into a liquid (water) at temperatures over 32°F (0°C); 32°F (0°C) is indeed the melting point.
where:
Q = energy required (in joules)
m = mass of ice (in grams)
Lf = latent heat of fusion for water (334 J/g)
Substituting the given values, we get:
Q = 100 g * 334 J/g = 33400 J
The rate at which the heater provides energy is given by its power, which is 500W.
To calculate the time it takes to melt the ice, we can use the formula:
t = Q / P
where:
t = time (in seconds)
Q = energy required (in joules)
P = power of the heater (in watts)
Substituting the given values, we get:
t = 33400 J / 500 W = 66.8 seconds
What happens at Celsius's absolute zero?In fact, the lowest temperature that can be imagined is absolute zero. In absolute zero, neither heat nor motion are present. Absolute zero is found at a temperature of about 0 kelvin, or -273.15 degrees Celsius, and -460 degrees Fahrenheit.
To know more about energy visit:
https://brainly.com/question/1932868
#SPJ1
The "hang time" of a punt is measured to be 4.30 s
.If the ball was kicked at an angle of 68.0 ∘ above the horizontal and was caught at the same level from which it was kicked, what was its initial speed?
t^2=10.97 sin(68)-3.05cos(68)/4.905cos(68)
t=2.2164
10.97/cos68 x 2.21= vo
I got v0=13.25
13.25/1000=.0133 x 3600=47.88 kh/m(which is wrong)
13.25 m/s = 47.88 km/h was roughly how fast the punt was moving at the time.
What, in physics, is speed, and what is its unit?The rate at which distance and time change is what is meant by speed. It has the aspect of temporal and spatial distance. The combination of a fundamental units of distance and time is what is described as the System of units ( si of speed. As a result, the SI unit for speed is the meter per second.
Describe velocity and speed.In contrast to velocity, which describes the speed and direction of the an object's movement, speed is the rate of movement along a path. Instead, velocity is a vector while speed is a scalar quantity.
t = (2 * v0 * sin) g
where (9.81 m/s2) is the acceleration caused by gravity.
In order to find t, we must solve for it as follows: t = (2 * v0 * sin) / g 4.30 ≈ (2 * v0 * sin68) / 9.81 v0 = (4.30 * 9.81) / (3 ) * sin68)
0.194 = 13.25 m/s
We may multiply this by 3.6 to get the speed in km/h: 13.25 m/s * 3.6 ≈ 47.88 km/h
To know more about speed visit:
https://brainly.com/question/28224010
#SPJ1
The initial speed 13.25 m/s = 47.88 km/h was roughly how fast the punt was moving at the time.
Speed in physics is measured in what unit?Speed refers to the rate at which distance and time change. It has a temporal and spatial distance component. The System of units (s of speed) is the amalgamation of fundamental units of time and distance. Consequently, the meter per second is the SI unit for speed.
Depict speed and speed :Speed is the rate of movement along a path, in contrast to velocity, which describes the speed and direction of an object's movement. Speed, on the other hand, is a scalar quantity while velocity is a vector.
t = (2 × v₀ × sin) g
where (9.81 m/s2) is the acceleration caused by gravity.
In order to find t, we must solve for it as follows:
t = (2 × v₀ × sin) / g 4.30 ≈ (2 × v₀ × sin 68) / 9.81 v₀
= (4.30 × 9.81) / (3 ) × sin 68)
0.194 = 13.25 m/s
We may multiply this by 3.6 to get the speed in km/h:
13.25 m/s × 3.6 ≈ 47.88 km/h
Learn more about speed :
brainly.com/question/28224010
#SPJ1
a 4.50 cm tall object is placed in front a convex mirror with a focal length of -(5.25 a) cm. if the magnification is 1/(2 b), what is the distance from the object to the mirror? give your answer in centimeters (cm) and with 3 significant figures
The distance between the object and the mirror is 13.96 cm, given to 3 significant figures.
The given data are as follows:Object height, h1= 4.50 cmFocal length of the convex mirror, f = −(5.25a) Magnification, m = 1/(2b)We are supposed to find the distance between the object and the mirror, u using the mirror formula. We can use the formula,1/f = 1/u + 1/vSince the mirror is convex, the focal length f is negative.
Therefore, substituting the values in the formula, we get,1/(-5.25a) = 1/u + 1/v⇒ −0.1905 = 1/u + 1/v…… (1)The magnification of an object is given by,m = −v/u where, m is the magnification, u is the distance of the object from the mirror and v is the distance of the image from the mirror. Substituting the values of m and solving for v, we get,v = m×u= (1/(2b))×u…… (2)
We are now supposed to solve the above equations to find the value of u. To do that, we have to substitute equation (2) into (1). On substituting, we get,−0.1905 = 1/u + 1/[(1/(2b))×u]Simplifying the above equation and cross multiplying, we get,(1/(2b))u − 0.1905u = −1On further simplification and solving for u, we get,u = 13.96 cm…… (3).
Learn more about convex mirror here:
https://brainly.com/question/3627454
#SPJ11
D. Volume
10. If a tricycle drove to a passenger's house that is 20 meters away from the station
in 10 minutes. What is the speed of the tricycle?
The speed of the tricycle while going to passenger's home from the station is 0.03m/s.
The equation of motion says, V = D/T where, V is the speed, D is the distance covered and T is the time taken. Here it is given that the tricycle takes 20 minutes to reach a passenger's home that is 20m away from the station, So, putting the value in the standard form of the values,
10 minutes = 600 seconds.
Speed =distance/time
Speed = 20/600
Speed = 0.03 m/s.
So, the speed of the tricycle is 0.03m/s.
To know more about speed, visit,
https://brainly.com/question/27888149
#SPJ4
A woman walks 200m east and then 100m south. Find the total distance travelled and then find the resultant displacement.
Answer:
300m
Explanation:
It is very simple.
200m+100m= 300m
Calculating Wave Speed, Frequency and Wavelength Complete each question and show all work. This worksheet is designed to give you some practice using the general wave equation: v=λƒ. (wave speed = wavelength * frequency) 1. ) Frequency = 100 Hz Wavelength = 100mm Speed = 2. ) Frequency = 200 Hz Wavelength = 200 km Speed = 3. ) Frequency =. 27 Hz Wavelength = 150 m Speed = 4. ) Frequency = 2. 7 Hz Wavelength = Speed= 460 m/s 5. ) Frequency = Wavelength = 502 m Speed= 1000 m/s 6. ) Frequency = Wavelength = 3. 26 cm Speed = 14 m/s 7. ) Frequency = 97 Hz Wavelength = 13. 78 m Speed = 8. ) Frequency = 780 Hz Wavelength = 1378 mm
1) the speed of the wave is 10 m/s. 2) The speed of the wave is 40 m/s. 3) The speed of the wave is 40.5 m/s. 4) The wavelength of the wave is 170.37 m. 5) The frequency of the wave is 1.99 Hz. 6) The frequency of the wave is 4.29 Hz. 7) The speed of the wave is 1334.46 m/s. 8) The speed of the wave is 1.075 m/s.
1. ) Frequency = 100 Hz Wavelength = 100mm Speed =?
To calculate the speed we can use the formula:
v=λƒ
where v represents wave speed, λ represents wavelength and ƒ represents frequency. Substituting given values in the formula we get
v = 0.1 * 100v = 10 m/s
2)Frequency = 200 Hz Wavelength = 200 km Speed =?
To calculate the speed we can use the formula:
v=λƒ.
Substituting given values in the formula we get
v = 200 * 10⁻³ * 200v = 40 m/s .
3)Frequency =. 27 Hz Wavelength = 150 m Speed =?
To calculate the speed we can use the formula:
v=λƒ.
Substituting given values in the formula we get
v = 150 * 0.27v = 40.5 m/s
4.) Frequency = 2. 7 Hz Wavelength = Speed= 460 m/s
To calculate the speed we can use the formula:
v=λƒ.
Substituting given values in the formula we get
λ = 460 / 2.7λ
= 170.37 m
5. ) Frequency = Wavelength = 502 m Speed= 1000 m/s
To calculate the frequency we can use the formula:
v=λƒ
Substituting given values in the formula we get
1000 = 502 * ƒƒ
= 1.99 Hz
6. ) Frequency = Wavelength = 3. 26 cm Speed = 14 m/s
v=λƒ
Substituting given values in the formula we get
14 = 3.26 * ƒƒ
= 4.29 Hz
7. ) Frequency = 97 Hz Wavelength = 13. 78 m Speed = ?
v=λƒ
Substituting given values in the formula we get
v = 13.78 * 97v
= 1334.46 m/s
8. ) Frequency = 780 Hz Wavelength = 1378 mm Speed = ?
v=λƒ
v = 1.378 * 10⁻³ * 780v
= 1.075 m/s
For such more questions on Wave speed:
brainly.com/question/29798763
#SPJ11
Consider this question posed at the beginning of this task:
Will two charged objects (sticky tape) create electric force fields that allow them to interact without touching?
Did the investigation answer the question? Explain whether the investigation gave enough evidence to support the idea that invisible electric force fields exist.
The investigation presented did offer proof in favor of the existence of imperceptible electric force fields.
What is electric force?The force between two charged objects is the electric force, sometimes referred to as the Coulomb force. The interaction of charged particles produces this fundamental force of nature. The magnitudes of the charges on the two objects and the separation between them define the strength of the electric force.
The tape was observed to interact without touching when it was charged by rubbing the tape against one another. The formation of an electric field surrounding the charged tape, which pulls on other nearby charged items, can be used to explain this interaction.
Even though the electric field surrounding the charged tape was not explicitly measured or quantified, the observed interaction between the tape offers a weak indirection for its presence. Hence, the investigation did offer sufficient proof to back up the existence of undetectable electric force fields.
To know more about electric force, visit:
https://brainly.com/question/20935307
#SPJ1
Select the correct answer from each drop-down menu.
Jason is collecting evidence at a crime scene. He finds a bullet casing and unused ammunition. What should he look for on the casing itself? What will the unused ammunition tell him?
Jason should look for markings called__1__ on the casing. The unused ammunition will help determine if the casing was from the same__2__ as the unused ammunition.
Reset
Next
1. Rifling, casting, impression
2. Store, gun, lot
Answer:
Impression & Gun
Explanation:
What happens to the capacitance of a parallel plate capacitor when it is connected to a battery and dielectric is inserted?
(pls help fast it's urgent)
Answer:
After the dielectric is inserted the capacitance is increased hence the stored energy is also increased . It may be noted here that since voltage between the capacitor V0 is constant the electric field between the plates also remains constant .
A diverging mirror has a focal length of 20cm. An object is placed 30 cm from the mirror. Determine the image distance
The image distance is 60 cm if An object is placed 30 cm from the diverging mirror has a focal length of 20cm.
What is diverging mirror ?A concave mirror, also known as a converging mirror, has an inwardly recessed reflecting surface (away from the incident light). Concave mirrors focus light inward to a single focal point. They are used to concentrate light. Concave mirrors, unlike convex mirrors, produce different image types depending on the distance between the object and the mirror.
The mirrors are referred to as "converging mirrors" because they collect light that falls on them and refocus parallel incoming rays toward a focus. This is due to the fact that light is reflected at different angles at different spots on the mirror due to the fact that the normal to the mirror surface varies at each spot.
use mirror formula
[tex]\frac{1}{f}[/tex] = [tex]\frac{1}{v}[/tex] + [tex]\frac{1}{u}[/tex]
The image distance is 60 cm
To know more about diverging mirror , visit ;
brainly.com/question/12696265
#SPJ1
i ball of mass 14.8 g is dropped from the height of 2.1 m and bounces back only to height of 0.7 m. what is the magnitude of total impulse imparted by the ball on the floor?
The magnitude of total impulse imparted by the ball on the floor is 0.114 N·s.
We can use the law of conservation of energy to find the velocity of the ball just before it hits the floor:
Initial potential energy = mgh
= (0.0148 kg)(9.81 m/s²)(2.1 m)
= 0.307 J
Final kinetic energy = (1/2)mv²
Setting these two equal and solving for v, we get:
v = \sqrt{((2 * 0.307 J) / 0.0148 kg)}= 3.87 m/s
Now, we can use the impulse-momentum theorem to find the magnitude of the impulse imparted by the ball on the floor:
Impulse = Δp = mΔv
where Δv is the change in velocity of the ball.
The ball's velocity changes from 3.87 m/s downward to 3.87 m/s upward, so:
Δv = 2(3.87 m/s) = 7.74 m/s
Therefore, the impulse imparted by the ball on the floor is:
Impulse = mΔv = (0.0148 kg)(7.74 m/s) = 0.114 N·s
So the magnitude of the total impulse imparted by the ball on the floor is approximately 0.114 N·s.
To learn more about 'impulse':
https://brainly.com/question/2193212
#SPJ11
Hi please help me solve this question… I’m confused…
Answer:
To calculate the work done by the teenager, we need to know the force applied and the distance moved.
Since we don't know the force applied, we can assume that it's equal to the weight of the teenager. The weight of the teenager can be calculated by multiplying their mass by the acceleration due to gravity, which is approximately 9.81 m/s^2:
weight = mass * acceleration due to gravity
weight = 46 kg * 9.81 m/s^2
weight = 451.26 N
The distance moved is equal to the height of 44 steps:
distance = height of 1 step * 44 steps
distance = 20 cm * 44
distance = 880 cm or 8.8 m
Now we can calculate the work done by the teenager using the formula:
work = force * distance * cos(theta)
where theta is the angle between the force and the direction of movement. Since the teenager is moving vertically upward, the angle theta is 0 degrees, and the cos(0) is equal to 1. Therefore, we can simplify the formula to:
work = force * distance
Plugging in the values we have calculated, we get:
work = 451.26 N * 8.8 m
work = 3977.488 J
Therefore, the work done by the teenager to get to your room is approximately 3977.5 joules.
A convex lens has a focal length of 8.00 cm. The image of a candle appears at a distance of 16.0 cm from the lens. Calculate the object distance.
Answer:
Using the lens formula:
1/f = 1/di + 1/do
where:
f = focal length of the lens
di = image distance
do = object distance
We know that:
f = 8.00 cm
di = 16.0 cm
Substituting these values and solving for do, we get:
1/8.00 = 1/16.0 + 1/do
1/do = 1/8.00 - 1/16.0
1/do = 0.125 - 0.0625
1/do = 0.0625
do = 1/0.0625
do = 16.0 cm
Therefore, the object distance is 16.0 cm.
Pablo lifts a bag of flour 0.8 m from the floor to a table. He lifted the bag using a force of 20 N. How much work did Pablo do on the bag of flour?
The amount of work done by Pablo is 16 J.
Work done problemThe work done by Pablo on the bag of flour is given by the formula:
work = force x distance x cos(theta)
where force is the magnitude of the force applied, distance is the distance moved by the object, and theta is the angle between the direction of the force and the direction of the displacement. In this case, the angle between the direction of the force and the direction of the displacement is 0 degrees (since Pablo lifted the bag straight up), so cos(theta) = 1. Substituting the given values, we get:
work = 20 N x 0.8 m x 1 = 16 J
Therefore, Pablo did 16 J of work on the bag of flour.
More on work done can be found here: https://brainly.com/question/30073908
#SPJ1