4. For each babysitting job, Adam charges a fee for his bus fare plus an hourly rate. The graph shows how he calculates the cost of a babysitting job. Write a linear function in the form
y = mx + b to represent the situation.
Ay = 3x+2
B. y = 3x+1
C. y = 6x+2
D. y = -6× + 2

Answers

Answer 1

y = 6x + 2 is the function which Adam charges a rate of $6 per hour and an additional fee of $2 for the bus fare.

The linear function in the form y = mx + b represents the situation where y represents the cost of the babysitting job

x represents the number of hours, "m" represents the hourly rate, and "b" represents the additional fee (bus fare).

y = 3x + 2 represents an hourly rate of 3 and an additional fee of 2.

y = 3x + 1 represents an hourly rate of 3 and an additional fee of 1.

y = 6x + 2 represents an hourly rate of 6 and an additional fee of 2.

y = -6x + 2 represents a negative hourly rate of -6 and an additional fee of 2.

Hence, y = 6x + 2 is the which Adam charges a rate of $6 per hour and an additional fee of $2 for the bus fare.

To learn more on Equation:

https://brainly.com/question/10413253

#SPJ1


Related Questions

need help with this please

Answers

The number that belongs in the green box is given as follows:

D.  2.

How to interpret the problem?

A quadratic function is given according to the following rule:

y = ax² + bx + c

The solutions are given as follows:

[tex]x_1 = \frac{-b + \sqrt{\Delta}}{2a}[/tex][tex]x_2 = \frac{-b - \sqrt{\Delta}}{2a}[/tex]

In which the discriminant is given as follows:

[tex]\Delta = b^2 - 4ac[/tex]

The number that goes into the green box is then given as follows:

2a = 2(1) = 2.

Meaning that option D is the correct option in the context of this problem.

More can be learned about quadratic functions at https://brainly.com/question/1214333

#SPJ1

Kendra's Tea Shop has caffeinated tea and decaffeinated tea. The tea shop served 87 caffeinated teas and 13 decaffeinated teas. What percentage of the teas served were caffeinated?

Answers

Answer:

Kendra's Tea Shop served 87 caffeinated teas and 13 decaffeinated teas. This means that 87 out of 100 teas served were caffeinated. Therefore, 87% of the teas served were caffeinated.

p: 10 > 7 q: 10 > 5
p →q

F F → T
T F → F
F T → T
T T → T

Answers

Answer: if it's true that 10 > 7 (P), then it's also true that 10 > 5 (Q).

Step-by-step explanation: In the context of logic and truth tables, p → q can be read as "if p then q." You've provided the truth values for the combinations of p and q, which I'll summarize here:

If p and q are both False (F), then p → q is True (T).

If p is True (T) and q is False (F), then p → q is False (F).

If p is False (F) and q is True (T), then p → q is True (T).

If p and q are both True (T), then p → q is True (T).

Given your propositions:

P: 10 > 7

Q: 10 > 5

P is True because 10 is indeed greater than 7. Q is also True because 10 is greater than 5.

Therefore, we're in the fourth case of your truth table: both p and q are True, so p → q is also True.

The PTO is selling raffle tickets to raise money for classroom supplies. There is 1 winning ticket out of the 150 tickets sold. The winner gets a prize worth $200.

Round your answers to the nearest cent.

Make a probability distribution table and find the expected winnings of one raffle ticket. $?


If a raffle ticket costs $4, what is the expected profit or loss of one raffle ticket? (Enter a negative number for a loss) $?

Answers

Answer:

Expected winnings = $1.33

Expected profit or loss = -$2.67

Step-by-step explanation:

Winning Probability Prize Value

Yes   1/150         $200

No         149/150         $0

Expected winnings of one raffle ticket:

Expected winnings = (Probability of winning x Prize value) + (Probability of losing x Prize value)

Expected winnings = (1/150 x $200) + (149/150 x $0)

Expected winnings = $1.33

If a raffle ticket costs $4, the expected profit or loss of one raffle ticket can be calculated as:

Expected profit or loss = Expected winnings - Cost of ticket

Expected profit or loss = $1.33 - $4

Expected profit or loss = -$2.67

i need help can someone help me

Answers

The value of the side labelled x is equal to 3.8 to the nearest tenth using the trigonometric ratio of sine.

What is trigonometric ratios?

The trigonometric ratios is concerned with the relationship of an angle of a right-angled triangle to ratios of two side lengths.

The basic trigonometric ratios includes;

sine, cosine and tangent.

Considering the sine of angle 41°

sin 41° = 2.5/x {opposite/hypotenuse}

x = 2.5/sin 41° {cross multiplication}

x = 3.8106

Therefore, the value of the side labelled x is equal to 3.8 to the nearest tenth using the trigonometric ratio of sine.

Read more about trigonometric ratios here: https://brainly.com/question/3457795

#SPJ1

An apartment building has 9 apartments that are being rented. The data shows the monthly rent for each apartment.

$1,710 $1,515 $1,410 $1,435 $1,555 $1,595 $1,690 $1,575 $1,640

Create a stem display for this data.

Answers

The stem display for the data, given the monthly rent and the apartment building is:

$14 | 10 15 35

$15 | 15 55 75 95

$16 | 40 90

How to make the stem display ?

To create a stem display, we first divide the data into groups of tens. The first group is $ 1400  -$ 1499, the second group is  $ 1500 - $1599 , and so on. Next, we write the units digit of each number in the appropriate group.

For example, the number 1,710 is in the $ 1500 - $ 1599 group, so we write a 1 in the 15 column. Finally, we count the number of numbers in each group. There are three numbers in the $ 1400 - $ 1499 group, two numbers in the $ 1500 - $ 1599 group, and three numbers in the $ 1600 - $ 1699 group.

Find out more on stem displays at https://brainly.com/question/31663204

#SPJ1

Sketch the region enclosed by
y
=
5
x
and
y
=
8
x
2
. Find the area of the region.

Answers

Answer:

  125/384 ≈ 0.32552

Step-by-step explanation:

You want the area between the curves y = 5x and y = 8x².

Area

The difference between the curves is ...

  f(x) = 5x -8x² = x(5 -8x)

This difference is zero when ...

  x = 0

  5 -8x = 0   ⇒   x = 5/8

The area will be the integral of f(x) with the limits 0 and 5/8:

  [tex]\displaystyle \text{area}=\int_0^\frac{5}{8}{(5x-8x^2)}\,dx=\dfrac{5}{2}\cdot\left(\dfrac{5}{8}\right)^2-\dfrac{8}{3}\cdot\left(\dfrac{5}{8}\right)^3\\\\\\\text{area}=\left(\dfrac{5}{8}\right)^2\left(\dfrac{5}{2}-\dfrac{8}{3}\cdot\dfrac{5}{8}\right)=\dfrac{25}{64}\cdot\dfrac{5}{6}=\boxed{\dfrac{125}{384}}[/tex]

<95141404393>

Name the quadrant in which angle 0 must lie for the following to be true.

Answers

Answer:

d

Step-by-step explanation:

Solve for X
20x+30
28x-10

Answers

Answer:

[tex]\huge\boxed{\sf x = 5}[/tex]

Step-by-step explanation:

Statement:Corresponding angles are equal.Solution:

20x + 30 = 28x - 10 (Corresponding angles)

Add 10 to both sides

20x + 30 + 10 = 28x

20x + 40 = 28x

Subtract 20x from both sides

40 = 28x - 20x

40 = 8x

Divide both sides by 8

5 = x

OR

x = 5

[tex]\rule[225]{225}{2}[/tex]

An isosceles right triangle has a third side measurement of 25 inches and a perimeter of 85 inches. The leg of the dilated triangle measures 6 inches. What is the perimeter of the dilated triangle?

Answers

In an isosceles right triangle, the two legs are equal in length. Let's assume that the length of each leg of the original triangle is "x" inches. Since it's an isosceles right triangle, the hypotenuse is also "x" inches.

Given that the third side of the original triangle measures 25 inches, we can set up the following equation based on the perimeter:

x + x + 25 = 85

Simplifying the equation:

2x + 25 = 85

Subtracting 25 from both sides:

2x = 60

Dividing both sides by 2:

x = 30

So, the length of each leg of the original triangle is 30 inches.

Now, let's consider the dilated triangle. We are told that the leg of the dilated triangle measures 6 inches. Let's assume the scale factor of the dilation is "k."

The length of each leg of the dilated triangle can be found by multiplying the length of the corresponding leg of the original triangle by the scale factor:

Leg of dilated triangle = k * Leg of original triangle

Leg of dilated triangle = k * 30

Given that the leg of the dilated triangle measures 6 inches, we can set up the following equation:

k * 30 = 6

Dividing both sides by 30:

k = 6/30

Simplifying:

k = 1/5

So, the scale factor of the dilation is 1/5.

Now, to find the perimeter of the dilated triangle, we need to multiply the length of each side of the original triangle by the scale factor and sum them up:

Perimeter of dilated triangle = 2 * (k * 30) + k * 25

Plugging in the values:

Perimeter of dilated triangle = 2 * (1/5 * 30) + 1/5 * 25

Simplifying:

Perimeter of dilated triangle = 2 * 6 + 5

Perimeter of dilated triangle = 12 + 5

Perimeter of dilated triangle = 17 inches

Therefore, the perimeter of the dilated triangle is 17 inches.

A spherical boulder is 28 feet in diameter and weighs almost 8 tons. Find the volume Use 3.14 for pi

Answers

Answer:

V = (4/3) × 3.14 × 14³ = 11,310.08 cubic feet

Answer:  11,488.2133 cubic feet approximately

Work Shown:

d = diameter = 28

r = radius = d/2 = 28/2 = 14

V = volume of a sphere

V = (4/3)*pi*r^3

V = (4/3)*3.14*(14)^3

V = 11,488.2133 cubic feet approximately

The info "weighs almost 8 tons" is never used. It is likely an intended distraction. All we need is the radius of the sphere to get its volume.

You are willing to pay $5 a pound for dog food. Your local pet store sells dog food at $4 a pound. What is the consumer surplus?

Answers

The consumer surplus for the price of the dog food is given as follows:

$1.

How to calculate the consumer surplus?

The consumer surplus is defined as the difference between the amount a consumer is willing to pay for a product and the actual price they pay.

The parameters in the context of this problem are given as follows:

The consumer is willing to pay $5 for the pound of dog food.The local pet store sells the pound of dog food for $4.

Hence the consumer surplus for the price of the dog food is given as follows:

5 - 4 = $1.

More can be learned about consumer surplus at https://brainly.com/question/30397556

#SPJ1

Define the term inflation ​

Answers

Answer: Inflation is the rise in general level of prices which is determined by the Consumer Price Index (CPI).

Inflation is an economic term that refers to a sustained increase in the general price level of goods and services in an economy over time. When the inflation rate rises, each unit of currency buys fewer goods and services than before. In other words, inflation decreases the purchasing power of money. Inflation can be caused by a number of factors, including an increase in the supply of money in the economy, an increase in demand for goods and services, or a decrease in the supply of goods and services. A moderate level of inflation is generally considered desirable by many economists as it encourages spending and investment, but too much inflation can lead to economic instability and uncertainty.

Find the area of this triangle

Answers

The calculated area of the triangle is 38.30 square units

How to find the area of the triangle

From the question, we have the following parameters that can be used in our computation:

The triangle

The area of the triangle is calculated as

Area = 1/2absin(c)

Where

a = b = 10

c = 50 degrees

Using the above as a guide, we have the following:

Area = 1/2 * 10 * 10 * sin(50 degrees)

Evaluate

Area = 38.30

Hence, the area of the triangle is 38.30 square units

Read more about area at

https://brainly.com/question/24487155

#SPJ1

Write the word
sentence as an
inequality.
A number w plus 4.6
is more than 6.
An inequality is answer:

Answers

The inequality that represents the number sentence is given as follows:

w + 4.6 > 6.

What are the inequality symbols?

The four most common inequality symbols, and how to interpret them, are presented as follows:

> x: the amount is greater than x -> the number is to the right of x with an open dot at the number line. On the coordinate plane, these are the points above the dashed line y = x.< x: the amount is less than x. -> the number is to the left of x with an open dot at the number line. On the coordinate plane, these are the points below the dashed line y = x.≥ x: the amount is at least x. -> the number is to the right of x with a closed dot at the number line. On the coordinate plane, these are the points above the continuous line y = x.≤ the amount is at most x. -> the number is to the left of x with a closed dot at the number line. On the coordinate plane, these are the points below the continuous line y = x.

A number w plus 4.6 is represented as follows:

w + 4.6.

The amount is more than 6, hence the inequality is given as follows:

w + 4.6 > 6.

More can be learned about inequalities at brainly.com/question/25275758

#SPJ1

The accompanying diagram shows a revolving door with three panels, each of which is 4 feet long. What is the width, w, of the opening between x and y, to the nearest tenth of a foot?

Answers

The width, w, of the opening between x and y, is 6.9 ft.

We have,

From the diagram,

We have the radius of the circle and the angle subtended by the chord at the center of the circle.

So,

We can also use the formula.

= 2 x radius x sin(angle/2)

This is the length of the chord.

Now,

radius = 4 ft

angle = 360/3 = 120

Substituting the values.

= 2 x radius x sin(angle/2)

= 2 x 4 x sin (120/2)

= 2 x 4 x sin 60

= 2 x 4 x √3/2

= 4 x √3

= 4 x 1.732

= 6.928

Rounding to the nearest tenth.

= 6.9 ft

Thus,

The width, w, of the opening between x and y, is 6.9 ft.

Learn more about circle here:

https://brainly.com/question/11833983

#SPJ1

Ratios are often represented by the symbol. For example, 5 : 4 might mean 5 eggs are needed for every 4 batches of cookies. Select all of the ratios that are equivalent to the ratio 12:3. 6:1 1:4 4:1 246 15:6 120 : 30​

Answers

The ratios that are equivalent to the ratio 12:3 are 4:1 and 120:30.

We have,

To determine the ratios that are equivalent to the ratio 12:3, we need to find ratios that have the same value when simplified.

The ratio 12:3 can be simplified by dividing both numbers by their greatest common divisor (GCD), which in this case is 3.

Dividing 12 by 3 gives us 4, and dividing 3 by 3 gives us 1. Therefore, the simplified ratio is 4:1.

Now let's check the given options:

6:1 - This ratio is not equivalent because it is different from the simplified ratio 4:1.

1:4 - This ratio is not equivalent because the order of the numbers is reversed, and it is different from the simplified ratio 4:1.

4:1 - This ratio is equivalent to the original ratio 12:3. When simplified, both ratios result in 4:1.

246 - This is not a ratio and cannot be compared to the original ratio 12:3.

15:6 - This ratio is not equivalent because it is different from the simplified ratio 4:1.

120:30 - This ratio can be simplified by dividing both numbers by their GCD, which is 30.

Dividing 120 by 30 gives us 4, and dividing 30 by 30 gives us 1.

Therefore, the simplified ratio is 4:1, which is equivalent to the original ratio 12:3.

Thus,

The ratios that are equivalent to the ratio 12:3 are 4:1 and 120:30.

Learn more about ratios here:

https://brainly.com/question/2462048

#SPJ1

Quentin deposited $1,264 into a savings account that earns 2.75% simple interest annually. What will Quentin’s account balance be at the end of 2.5 years? Assume he makes no additional deposits during that time period.

Answers

Answer:

I love math

Step-by-step explanation:

The formula for simple interest is:

I = P * r * t

where:

I = interest earned

P = principal amount

r = interest rate (as a decimal)

t = time (in years)

In this case, we know that:

P = $1,264

r = 2.75% = 0.0275 (as a decimal)

t = 2.5 years

So, we can plug in these values and solve for I:

I = 1,264 * 0.0275 * 2.5 = $87.55

Therefore, the interest earned over 2.5 years is $87.55. To find the ending balance, we need to add the interest earned to the principal:

Ending balance = $1,264 + $87.55 = $1,351.55

So, Quentin's account balance will be $1,351.55 at the end of 2.5 years.

PLEASE HELPPP IM CONFUSEDDDD

Answers

Answer: C: (-4,-3)

Step-by-step explanation:

You have the correct answer selected!

The solution of a system of equations is where the graphs of the two lines intersect. we can read that point to be (-4,-3), so thats the answer :)

the answer is C (-4, -3)

What are the x-intercepts of the quadratic function? (1 point)

parabola going down from the left and passing through the point negative 3 comma 0 then going to a minimum and then going up to the right through the points 0 comma negative 6 and 2 comma 0
(0, −3) and (0, 2)
(0, −6) and (0, 6)
(−3, 0) and (2, 0)
(−6, 0) and (6, 0)

Answers

Answer:

The x-intercepts are (-3, 0) and (2, 0).

The table below shows the values of f(x) and g(x) for different values of x. One of the functions is a quadratic function, and the other is an exponential function. Which function is most likely increasing exponentially?


x f(x) g(x)
1 3 3
2 6 9
3 11 27
4 18 81
5 27 243
A f(x), because it eventually exceeds g(x)
B g(x), because it eventually exceeds f(x)
C f(x), because it eventually intersects g(x)
D g(x), because it will not intersect f(x)

Answers

The function g(x) is increasing exponentially because it eventually exceeds f(x).

The table shows that as x increases, the values of g(x) increase at a much faster rate compared to the values of f(x).

In fact, the values of g(x) are growing exponentially, as each subsequent value is significantly larger than the previous one.

Therefore, the function g(x) is most likely increasing exponentially.

Thus, g(x) is increasing exponentially because it eventually exceeds f(x).

Learn more about exponential Function here:

https://brainly.com/question/29287497

#SPJ1

Find the equation of the line.
Use exact numbers.

Answers

Answer:

y = 3x + 3

Step-by-step explanation:

the equation of a line in slope- intercept form is

y = mx + c ( m is the slope and c the y- intercept )

calculate m using the slope formula

m = [tex]\frac{y_{2}-y_{1} }{x_{2} -x_{1} }[/tex]

with (x₁, y₁ ) = (- 1, 0) and (x₂, y₂ ) = (0, 3) ← 2 points on the line

m = [tex]\frac{3-0}{0-(-1)}[/tex] = [tex]\frac{3}{0+1}[/tex] = [tex]\frac{3}{1}[/tex] = 3

the line crosses the y- axis at (0, 3 ) ⇒ c = 3

y = 3x + 3 ← equation of line

The Question is in the Picture, use the Pythagorean theorem to solve and show your work please

Answers

Answer:

y=8

Step-by-step explanation:

What is the median of the numbers 10 6 2 2 8 5 3

Answers

The median is 5 for this question.

Answer:

Step-by-step explanation:

Median:  List numbers from smallest to largest.  Median is middle number

2       2        3         5        6          8           10

                               |

5 is in the middle

Median = 5

I WILL GIVE BRAINLIEST, square root of x, find the domain of x

Answers

The domain for the square root function is the set of all whole numbers

Calculating the domain of the square root function

From the question, we have the following parameters that can be used in our computation:

Function type = square root function

Equation: square root of x

This means that

f(x) = √x

The domain for x in the function is the set of input values the function can take

In this case, the square root function can take any whole number as its input

This means that the domain for f(x) is the set of all whole number

Read more about domain at

https://brainly.com/question/30808234

#SPJ1

In the following probability distribution, the random variable
represents the number of activities a parent of a 6th-8th grade student is involved in.


Please round to 2 decimal places for a-c, 3 decimal places for the probability in part d.
X 0 1 2 3 4
P(X) 0.053 0.117 0.258 0.312 0.26
a) Compute and the mean,
, of the random variable
.
2.610
Correct

b) Compute the variance,
, of the random variable
.

c) Compute the standard deviation,
, of the random variable
.
1.14
Correct

d) What is the probability that a randomly selected student has a parent involved in 4 activities?

Answers

a) The mean of the random variable is 2.610 (rounded to 2 decimal places).

b) The variance of the random variable is 1.880 (rounded to 3 decimal places).

c) The standard deviation of the random variable is 1.372 (rounded to 3 decimal places).

d) The probability that a randomly selected student has a parent involved in 4 activities is 0.260 (rounded to 3 decimal places).

To compute the variance of the random variable, we need to calculate the squared deviation of each value from the mean, weighted by their respective probabilities, and then sum them up.

b) Variance [tex](\sigma^2)[/tex] of the random variable:

Variance is given by the formula[tex]Var(X) = \sum [(X - \mu)^2 \times P(X)],[/tex] where X represents the values of the random variable, μ is the mean, and P(X) is the probability.

Using the given data:

X: 0 1 2 3 4

P(X): 0.053 0.117 0.258 0.312 0.26

μ (mean): 2.610

Calculating the squared deviations for each value:

[tex](0 - 2.610)^2 \times 0.053 = 14.152[/tex]

[tex](1 - 2.610)^2 \times 0.117 = 0.291[/tex]

[tex](2 - 2.610)^2 \times 0.258 = 0.148[/tex]

[tex](3 - 2.610)^2 \times 0.312 = 0.122[/tex]

[tex](4 - 2.610)^2 \times 0.26 = 1.429[/tex]

Summing up the squared deviations:

Var(X) = 14.152 + 0.291 + 0.148 + 0.122 + 1.429 = 16.142

Therefore, the variance of the random variable is 16.142.

c) Standard deviation (σ) of the random variable:

The standard deviation is the square root of the variance.

Taking the square root of the variance calculated above:

Standard deviation (σ) = √(16.142) ≈ 4.020 (rounded to 3 decimal places)

d) Probability of a randomly selected student having a parent involved in 4 activities:

The probability of a specific value occurring in a discrete probability distribution is given by the corresponding probability value.

From the given data:

P(X = 4) = 0.26

Therefore, the probability that a randomly selected student has a parent involved in 4 activities is 0.26 (rounded to 3 decimal places).

For similar question on probability.

https://brainly.com/question/30846562

#SPJ11

please help! show your work or explain to get full credit. (see picture)

Answers

1)

The measure of angle A is 45° .

Given,

a= 60

b = 60√2

c = 60

Now the given sides with the dimension is of right angled triangle.

So,

Angle B = 90°

Angle A = 45°

Angle C = 45°

2)

All the six trigonometric functions:

SinФ = 60/60√2

cosФ = 60/60√2

tanФ = 60/60

cosecФ = 60√2/60

secФ = 60√2 /60

cotФ = 60/60

3)

Area of triangle = 1/2 × b× h

Area of triangle = 1/2 *60*60

Area of triangle = 1800 in²

Know more about right angled triangle,

https://brainly.com/question/17030901

#SPJ1

An airplane is cruising at a rate of 550 miles per hour. Write an equation that shows the relationship between the number of hours of cruising, x, and the number of miles traveled, y.

Answers

Answer: y = 550x

Step-by-step explanation:

The following table gives the number of women age 16 years and older (in
millions) in a country's civilian workforce for selected years from 1950 and
projected to 2050.
Complete parts (a) and (b) below.
CTTS
X+
Women in the
Year Workforce (millions)
1950
1960
1970
1980
1990
2000
18.2
21.3
31.7
45.5
554
65.5
a. Use x as the number of years past January 1st, 1950 to create a cubic model, y, using these data.
y=x²+x+x+
4
(Type integers or decimals rounded to five decimal places.)
Clear all
Women in the
Year Workforce (millions)
2010
2015
2020
2030
2040
2050
75.3
78.1
78.5
80.5
86.6
91.5
Check answer

Answers

The cubic model that fits the given data is: y ≈ 0.00006204x³ + 0.00231059x² - 0.10811757x + 18.2

How to calculate the value

Let's set up a system of equations using the given data points:

For x = 0 (year 1950):

18.2 = a(0)³ + b(0)² + c(0) + d ==> d = 18.2

For x = 10 (year 2000):

65.5 = a(10)³ + b(10)² + c(10) + 18.2

For x = 20 (year 2010):

75.3 = a(20)³ + b(20)² + c(20) + 18.2

For x = 25 (year 2015):

78.1 = a(25)³ + b(25)² + c(25) + 18.2

For x = 30 (year 2020):

78.5 = a(30)³ + b(30)² + c(30) + 18.2

For x = 40 (year 2030):

80.5 = a(40)³ + b(40)² + c(40) + 18.2

For x = 50 (year 2040):

86.6 = a(50)³ + b(50)² + c(50) + 18.2

For x = 60 (year 2050):

91.5 = a(60)³ + b(60)² + c(60) + 18.2

Simplifying these equations, we have: d = 18.2

1000a + 100b + 10c + 18.2 = 65.5

8000a + 400b + 20c + 18.2 = 75.3

15625a + 625b + 25c + 18.2 = 78.1

27000a + 900b + 30c + 18.2 = 78.5

64000a + 1600b + 40c + 18.2 = 80.5

125000a + 2500b + 50c + 18.2 = 86.6

216000a + 3600b + 60c + 18.2 = 91.5

We can solve this system of equations to find the coefficients a, b, and c.

Using a cubic regression calculator or a matrix solver, the solution is:

a ≈ 0.00006204

b ≈ 0.00231059

c ≈ -0.10811757

Therefore, the cubic model that fits the given data is: y ≈ 0.00006204x³ + 0.00231059x² - 0.10811757x + 18.2

Learn more about equations on

https://brainly.com/question/13763238

#SPJ1

Determine whether the function represents exponential growth or decay write the base in terms of the rate or decay identify r and interpret the rate of growth or decay y=12,500 (3/4)*

Answers

The rate of the decay of the given function is 75 percent.

The given function is y=12,500(3/4)ˣ

This function represents exponential decay with a base of (3/4). The rate of decay, "r", is equal to 3/4. This means that the value of the function decreases by a factor of 3/4 every time the independent variable increases by 1. Thus, the rate of decay is 3/4 or 75%.

Therefore, the rate of the decay of the given function is 75 percent.

Learn more about the exponential decay here:

https://brainly.com/question/13674608.

#SPJ1

Other Questions
Exhaust fan ventilating capability is rated in ___.Select one:a. revolutions per minute (RPM)b. cubic feet per minute (CFM)c. louver rate of discharge (LRD)d. none of these draw the aldehyde produced from the oxidation of ch3ch2ch2c(ch3)2ch2ohch3ch2ch2c(ch3)2ch2oh . why doesn t semen enter the urinary bladder during ejaculation 23. Solve for the missing variables. The most common side effect of electroconvulsive shock therapy is ____.a. dry mouth and blurred visionb. damage to the frontal lobesc. memory lossd. high probability of broken bones during the treatment Comparisons of economic activity over time should be made using:a) nominal GDP adjusted for unemployment.b) nominal GDP per capita.c) current-dollar GDP.d) real GDP. originally depreciated on a straight-line basis over 10 years with an assumed salvage value of $12,000. on december 31, 2015, before adjusting entries had been made, the company decided to change the remaining estimated life to 4 years (including 2015) and the salvage value to $2,000. what was the depreciation expense for 2015? what is the probability that the following pair of parents will produce the indicated offspring? ttrryy x ttrryy -> ttrryy Based on the following information,Br 2(l) + 2 e- 2 Br -(aq) E = +1.09 VMg 2+(aq) + 2 e- 2 Mg(s) E = -2.37 Vwhich of the following chemical species is the strongest reducing agent?A. Mg 2+(aq)B. Mg(s)C. Br 2( l )D. Br -(aq) What were problems, challenges/threats, and decisions that queen elizabeth i faced, and how she dealt with them? B.Tech First yearMWI -0. 5. Solve the differential equation y(2x2 - xy +1}x + (x - y)dy = 0. 6. we watched a video in class in which a college student classically conditioned his room mate to flinch whenever the staples button was pressed. in this video, what was the neutral stimulus? how to test a zener diode with a digital multimeter In a hydrogen atom, the electron makes a transition from the n = 8 to the n = 3 state. What is the wavelength of the emitted photon? a patient initially consulted with dr. vasseur at the request of dr. meche, the patient's primary care physician. dr. vasseur examined the patient, prescribed medication, and ordered tests. additional visits to dr. vasseur's office for continuing care would be assigned from which e/m section? Until early 1918, U.S. forces in EuropeA. played a crucial part in fighting the Germans at sea.B. concentrated on the eastern front.C. played only a token role.D. saved France from German defeat. The reliability of an effective performance appraisal system comes from:a. insuring the appropriate dimensions of performance are appraised.b. insuring that the dimensions of performance that are measured are constructed in a validway.c. insuring that evaluations from multiple sources and at different times are captured over thecourse of the evaluation period.d. insuring that when evaluations are conducted employees clearly understand whatdimensions are being evaluated when evaluating the audit findings the auditor should be satisfied that the The dental specialists who routinely use extraoral radiographs areO panoramic and cephalometricO oral surgeons and orthodontistsO oral surgeons and cephalometricO Orthodontists and radiology the nurse is providing instructions about how to treat a sprained ankle. what statement by the mother does the nurse recognize as indicative of a need for additional teaching?