2. What are the benefits of a normative approach to lifespan development?

Answers

Answer 1

A normative approach to lifespan development involves studying and comparing the typical patterns of development and behavior across different individuals or groups of people at various ages. Here are some benefits of using this approach:

Identifying developmental milestones: A normative approach helps to identify the typical milestones and achievements that people reach at different ages, such as crawling, walking, talking, and reading. This can help parents, educators, and healthcare professionals to monitor and assess a child's development and provide appropriate support and interventions when necessary.

Understanding individual differences: While a normative approach focuses on typical patterns of development, it also recognizes that there are individual differences in development and behavior. By comparing people's development to the norm, we can better understand how and why some individuals may differ from the norm, such as in terms of their physical, cognitive, or socioemotional development.

Informing public policies and interventions: A normative approach can help to inform public policies and interventions that support healthy development across the lifespan. For example, knowledge about the typical milestones of development can inform early childhood education programs, while information about the typical age-related changes in cognition and memory can inform policies related to employment and retirement.


Related Questions

Challenge: Draw a complex circuit. This circuit should have four light bulbs (two in parallel and
two in series), two switches (one to turn off series lights and one to turn off parallel lights), and
one battery.

Answers

The circuit would have one battery with a positive and negative terminal. Connected to the positive terminal would be one switch and then two light bulbs in series. The other end of the two light bulbs in series would be connected to the negative terminal of the battery. Connected in parallel to the two light bulbs in series would be another two light bulbs. The positive end of the first parallel light bulb would be connected to the positive end of the second parallel light bulb. The other ends of both parallel light bulbs would be connected to the negative terminal of the battery. The first switch would be connected to the two light bulbs in series and would turn off only those two light bulbs when switched. The second switch would be connected to the two light bulbs in parallel and would turn off only those two light bulbs when switched.

What is a series connection?

In electronics, a series connection refers to a circuit in which the components (such as resistors, capacitors, or light bulbs) are connected end-to-end in a single path, so that the same current flows through each component in turn.

In a series connection, the voltage applied to the circuit is divided among the components according to their individual resistance or impedance values. The total resistance of a series circuit is equal to the sum of the individual resistances of each component.

In a series connection, the total voltage across the circuit is equal to the sum of the individual voltage drops across each component.

To know more about battery, visit:

https://brainly.com/question/19225854

#SPJ1

what are some ways that electric fields are simular to magnetic fields

Answers

Answer:

Obey inverse square law obey superposition principlelong range forces.linear current source Idl produces magnetic field just as linear charge source produces electric field.

pls mrk me brainliest

A student attaches a rope to a 33 kg box, and drags it to the left with constant velocity of 1.11 m/s. The tension in the rope is 283 N at an angle of 33° to the ground.

How much does the box weigh?
323.4N

Find the x and y components of the applied (tension) force:

Fx =
237.34N

Fy =
154.13 N

How much friction must be present?

How much Normal force must be present?

Answers

Answer: To find the frictional force and normal force, we need to first find the gravitational force acting on the box, which is equal to its weight. We can find weight by multiplying the mass of the box by the acceleration due to gravity:

Weight = m * g

Weight = 33 kg * 9.8 m/s^2

Weight = 323.4 N

To find the x and y components of the tension force, we can use trigonometry:

Fx = Tension * cos(33°)

Fx = 283 N * cos(33°)

Fx = 237.34 N

Fy = Tension * sin(33°)

Fy = 283 N * sin(33°)

Fy = 154.13 N

Since the box is moving with constant velocity, we know that the net force on the box is zero. Therefore, the frictional force must be equal in magnitude and opposite in direction to the x component of the tension force:

Friction = -Fx

Friction = -237.34 N

The normal force is equal in magnitude and opposite in direction to the y component of the tension force:

Normal force = -Fy

Normal force = -154.13 N

Explanation:

Why does nuclear fusion require high temperatures and high densities? (Select all that apply.)

to overcome the repulsive force between the protons

to overcome attractive forces between protons and electrons

because it produces so much energy

because it occurs in the Sun

so there are enough collisions for fusion to occur

Answers

They get enough energy and high temperature to break their equal electric repulsion. The strong nuclear force will defeat the electric barrier once the nuclei are nearer & they can fuse as a final result.

Why is nuclear power so powerful?

A strong nuclear force can be used in this situation. Meson exchange between nucleons produces the intense nuclear force between them. This conversation is comparable to two persons striking a tennis ball or ping-pong ball back back and forwards continually.

How do nuclear weapons get made?

The much more fundamental powerful force, also known as the strong interaction, has a byproduct known as the nuclear force. The quarks—elementary particles that make up protons and neutrons—are bound together by the strong interaction, which is an attractive force.

To know more about nuclear force visit:

https://brainly.com/question/20298137

#SPJ1

why does a person at the depth of the lake doesn't burst​

Answers

Answer:

Because the body regulates water pressure well because we are mostly composed of water

Which angle (A,B, or C) is the diffraction angle?
B because it’s closest to the center line

Answers

As waves come into contact with a barrier or aperture, they experience the phenomenon known as diffraction, which causes them to bend and disperse.

Which diffraction angle has the highest value?

Diffracted light has maximum intensities at angles m given by dsinm=m when light is usually incident on a diffraction grating. Thus, the 3rd-order maxima can arise at 90° (or a smaller angle) and there won't be any 4th-order maxima because the maximum angle for diffraction maxima is 90°.

What factors affect angle of diffraction?

Light's wavelength determines the amount of diffraction, with longer wavelengths diffracted at a greater angle than shorter ones (in effect, red light are diffracted at a higher angle than is blue and violet light).

To know more about diffraction visit:-

https://brainly.com/question/16096548

#SPJ1

Answer:

it is B

Explanation:

A rifle with a weight of 35 N fires a 5.5g bullet with a speed of 270m/s. Find the recoil speed of the rifle

Answers

The recoil speed of the 35N rifle is 0.42 meters per second.

What is the recoil speed of the rifle?

To find the recoil speed of the rifle, we can use the principle of conservation of momentum.

According to this principle, the total momentum before firing the bullet is equal to the total momentum after firing the bullet.

Initially, the rifle and bullet are at rest, so their total momentum is zero.

p_initial = 0

After firing the bullet, the momentum of the bullet is:

p_bullet = m_bullet × v_bullet

p_bullet = ( 5.5 / 1000 )kg × 270m/s

p_bullet = 1.485 kg m/s

By conservation of momentum, the momentum of the rifle in the opposite direction is also equal to 1.485 kg m/s.

Let the recoil speed of the rifle be v_recoil. Then:

p_rifle = m_rifle × v_recoil

v_recoil = p_rifle / m_rifle

Note that weight of the rifle = 35N, then mass = 35/9.8 kg

v_recoil = 1.485 kgm/s / ( 35/9.8 kg )

v_recoil = 0.42 m/s

Therefore, the recoil speed of the rifle is 0.42 m/s.

Learn about velocity here:

brainly.com/question/18084516

#SPJ1

ANSWER 5 QUESTIONS FOR 35 POINTS PLS!!!

Answers

1. The problem in correlating the rock layers of location D is that there are no clear index fossils that can be used to determine the relative age of the rock layers.

2. Yes, there can be a problem in determining the time span of any rock layers without the use of index fossils. The age of a rock layer can only be estimated by comparing it to the ages of other rock layers in the area, which is done by examining the sequence of the layers and the type of fossils found in them. However, this method only provides a relative age range and not an exact age.

3. While fossils can provide important clues to the relative age of rock layers, they cannot be used to determine the exact age of a layer. This is because the age of a rock layer is determined by the decay of radioactive isotopes in the rock, which is a process that occurs over a long period of time.

4. The feature(s) of the fossils that make them ineffective in dating the relative age of rock layers is that they are not index fossils. Index fossils are usually species that have a widespread distribution and existed for a short period of time, making them useful for dating rock layers over a large area. The fossils listed (clam, nautilus, fusulina, sea urchin, gingko, and snail) may have existed for long periods of time, making them less useful for dating the relative age of rock layers.

What are fossil?

Index fossils are distinctive fossils that are used to establish and compare the relative ages of rock layers in different locations. Without index fossils, it becomes difficult to determine which layers are older or younger relative to each other.

The "missing" rock layer could have been eroded away or never deposited in that location. This can occur due to natural processes such as erosion or deposition in a different location, or due to human activity such as mining or excavation. Without the missing layer, it becomes more difficult to accurately date the other rock layers in the area.

Learn more about rock on;

https://brainly.com/question/26046551

#SPJ1

1. What was the problem in correlating the rock layers of location D? Explain.

2. Was there a problem in determining the time span of any rock layers? Explain.

3. Why can't you determine the EXACT age of a layer of rock by simply observing fossils in a rock layer? What constraints you in making this determination?

4. There are fossils in location D that are not index fossils. What feature(s) of these fossils make them ineffective in dating the relative age (as a range of time) of rock layers? Note: The names of the fossils are listed below.  What "problem" most likely occurred that led to the missing rock layer? Explain

a frictionless roller coaster is given an initial speed of vi=10.00m/s , at the initial height h=100:00m,has a mass m=1000.0kg

Answers

Answer: Using conservation of energy, we can find the final speed of the roller coaster at the bottom of the hill:

Initial energy (at the top) = Potential energy + Kinetic energy

1/2 * m * vi^2 + m * g * h = 1/2 * m * vf^2 + m * g * 0

where m = 1000.0 kg is the mass of the roller coaster, vi = 10.00 m/s is the initial speed, h = 100.00 m is the initial height, g = 9.81 m/s^2 is the acceleration due to gravity, and vf is the final speed at the bottom of the hill.

Simplifying and solving for vf:

vf = sqrt(2 * g * h + vi^2)

Substituting the given values:

vf = sqrt(2 * 9.81 m/s^2 * 100.00 m + (10.00 m/s)^2)

vf = sqrt(1962.2)

vf ≈ 44.3 m/s

Therefore, the final speed of the roller coaster at the bottom of the hill is approximately 44.3 m/s.

Using P = M x V what is the momentum of an object with a mass of 750 kg and velocity of 15 m/s

Answers

Answer:

p = 11250 kg·m/s

Explanation:

Explanation:

it goes like this p=MV which is

M=750,V=15

p= 750x15=11250n

The VR(and so IMA) of the inclined plane

Answers

I hope this helps you

I hope you can help me with this problem thank you.

Answers

374 is lower I think and 270 c is lower

Which above element is the most active nonmetal?

A. cerium (Ce)
B. potassium (K)
C. xenon (Xe)
D. iodine (I)
E. gold (Au)

Answers

Please give brainliest
Answer is D. Iodine

Answer:

D. iodine (I) is the most active nonmetal in the options given.

Which of the following ideas provided an important step towards a more complete understanding of blackbody radiation

Answers

The following theories contributed significantly to a more full knowledge of black body radiation. Light is made up of separate pieces that must be absorbed together.

What is the cause of black body radiation?

A black body is an object that absorbed all radiation falling on it at all wavelengths. When a black body is at a constant temperature, its emission exhibits a temperature-dependent frequency distribution. It emits what is known as black-body radiation.

What exactly is the black body radiation experiment?

One of the first experiments that led to quantum mechanics was blackbody radiation. It all started with the basic observation that when you heat a metal, it first turns red, then yellow, and finally white hot as the temperature rises.

To know more about black body radiation visit:

https://brainly.com/question/10260243

#SPJ9

A concave mirror has a focal length of 8.0 cm. A candle is located at a distance of 5.0 cm from the mirror. Calculate the image distance.

A -13.3 cm
B -3.0 cm
C 00.075 cm
D 3.1 cm

Answers

Using the mirror equation, 1/f = 1/do + 1/di, where f is the focal length, do is the object distance, and di is the image distance, we can solve for di:

1/8 = 1/5 + 1/di

Multiplying both sides by 40di:

5di = 8di + 32

Simplifying:

3di = 32

di = 10.67 cm

Since the image is formed behind the mirror, the image distance is negative. Therefore, the answer is approximately -10.7 cm, which is closest to option A, -13.3 cm.

So the answer is A, -13.3 cm.

The distance of the image from the concave mirror is -13.3 cm. So, A is the correct option.

What is meant by a concave mirror ?

Concave mirror is defined as the type of mirror, that has a reflecting surface which is curved inwards. It is also known as converging mirror.

Here,

Focal length of the mirror, f = 8 cm

Distance of the candle from the mirror, u = -5 cm

According to the mirror formula,

1/f = 1/v + 1/u

where v is the image distance.

Applying the values of f and u in the equation,

1/-8 = 1/v + 1/-5

1/v = (1/-8) - (1/-5)

1/v = 1/5 - 1/8

1/v = 3/40

Therefore,

v = 40/3 = 13.33 cm

Image distance, v = -13.3 cm

Hence,

The distance of the image from the concave mirror is -13.3 cm.

To learn more about concave mirror, click:

https://brainly.com/question/12966853

#SPJ2

8. A unique property of water because of its chemical structure is that it's _____ dense when it's a solid than when it's a liquid.
A. less
B. equally
C. inversely
D. more

Answers

A unique property of water because of its chemical structure is that it's A. less dense when it's a solid than when it's a liquid.

What is water?

Water is an incredibly unique substance, and its physical properties are largely due to its chemical structure. Water is a polar molecule, meaning it has a positively charged end and a negatively charged end, which creates an attraction between molecules of water that is known as hydrogen bonding.

This hydrogen bonding is responsible for a number of the unique properties of water, one of which is its density. Water is less dense when it is a solid than when it is a liquid. This is counterintuitive to most substances, which are more dense when they are solid than when they are liquid. The explanation for this is that when water freezes, the hydrogen bonds between the molecules force them to move further apart, resulting in a decrease in density.

This is why ice floats on top of liquid water, and it is why bodies of water don’t freeze from the bottom up.

Learn more about water here:

https://brainly.com/question/1313076

#SPJ1

the angle at which sunlight hits earth is different on different parts of the globe. the diagrams show how sunlight hits two places on earth on the same day in winter.


Which two statments are most likely true.

Answers

Sunlight reflects off of Earth's curving surface at an angle that crosses the equator. Farther than the equator, sunlight is less concentrated or intense, which results in less warming of the Earth's surface.

Why did the Earth begin to warm up?

More carbon dioxide, methane, & nitrous oxide are present in the upper orbit today than they have been in the previous 800,000 years. These releases of greenhouse gases have amplified the greenhouse effect and raised the earth's surface temperature.

When was the planet last noticeably warmer than it is now?

Based on paleoclimatic information from fossil records, ice cores, sediments, and other methods of studying Earth's past, Gavin Schmidt, a climate scientist with NASA, estimated that it was approximately 125,000 years ago.

To know more about warming visit:

https://brainly.com/question/12003124

#SPJ1

This discussion will require you to interview and talk to an older family member, parent(s), or someone who knew you intimately during the first two years of your life.

You will first need to read "The Developing Person Through the Life Span 11th Edition" chapters 5, 6, and 7 to prepare to respond to the discussion prompt and to interview and talk to individuals who knew you during the first two years of your life.


Consider the first two years of your life with respect to:

- physical development;

- cognitive development; and

- psychosocial development.


Then take this opportunity to talk to individuals who remember this stage of your development, including

- language development;

- memory skills;

- motor skills;

- early emotions and temperament; and

- early attachment.

And finally, what role did your race, ethnicity, gender, and culture play in your development during your first two years of life, and how you were socialized during those years?

Answers

The creation of an individual's ethnic identity also includes their self-categorization Thermodynamics  within and psychological ties to their ethnic group (s).

How does a child's social maturation depend on their ethnicity?

Children's ethnicity gives them a sense of connection and helps them to understand who there are and where she came from. Nonetheless, ethnicity can cause conflicts between people, and children who belong to a minority ethnic group may grow despite looking less significant in society.

What function does ethnicity serve?

They point out that ethnicity, as a scientific term, enables researchers to distinguish between different people-groups based on their lineage, language, customs, philosophy, culture, or country without relying on the physical qualities that are essential to the notion of ethnicity (Atkinson et al., 1998).

To know more about Thermodynamics visit:

https://brainly.com/question/1368306

#SPJ1

Normal air has a density of 1.22 kg/m^3. Air that has been heated in a hot air balloon has a density of 0.95 kg/m^3. The hot air balloon has a total volume of 3000 m^3.
a. What is the mass of air in the balloon? (1 point)





b. What is the buoyant force acting on the balloon? (1 point)




c. If the basket and riders in the balloon have a mass of 400 kg, what is the acceleration of the balloon? (1 point)






d. What is the minimum volume the balloon can have before it goes downward instead of upward? (1 point)


e. As the balloon rises, the lower air pressure causes the air around the balloon to become less dense. How does this affect the buoyancy of the balloon? (1 point)





f. As the balloon rises, the atmospheric pressure decreases, causing the volume of the balloon to increase. How does this affect the buoyancy of the balloon? (1 point)

Answers

a) The mass of air in the balloon is 2850 kg.

b) The buoyant force acting on the balloon is 93258.6 N.

c) The acceleration of the balloon and the riders is 24.8 m/s².

d) the minimum volume the balloon can have before it goes downward instead of upward is 14118.5 m³.

e) The balloon will start to rise more slowly or may even stop rising altogether.

f) The balloon will rise more quickly or may even accelerate.

a. The mass of air in the balloon can be calculated by multiplying the density of the air by the volume of the balloon:

Mass of air = Density of air × Volume of balloon

Mass of air = 0.95 kg/m³ × 3000 m³

Mass of air = 2850 kg

Therefore, the mass of air in the balloon is 2850 kg.

b. The buoyant force acting on the balloon can be calculated using Archimedes' principle, which states that the buoyant force is equal to the weight of the fluid displaced by the object:

Buoyant force = Density of fluid × Volume of fluid displaced x Gravity

Buoyant force = (Density of air - Density of balloon) × Volume of balloon × Gravity

Buoyant force = (1.22 kg/m³ - 0.95 kg/m³) × 3000 m³ × 9.81 m/s²

Buoyant force = 93258.6 N

Therefore, the buoyant force acting on the balloon is 93258.6 N.

c. The net force acting on the balloon and the riders is equal to the buoyant force minus the weight of the system:

Net force = Buoyant force - Weight of system

Net force = 93258.6 N - 400 kg × 9.81 m/s²

Net force = 88836.6 N

The acceleration of the system can be calculated using Newton's second law:

Net force = Mass of system × Acceleration

Acceleration = Net force / Mass of system

Acceleration = 88836.6 N / (400 kg + 2850 kg)

Acceleration = 24.8 m/s²

Therefore, the acceleration of the balloon and the riders is 24.8 m/s².

d. The minimum volume the balloon can have before it goes downward instead of upward can be calculated by setting the buoyant force equal to the weight of the system:

Buoyant force = Weight of system

(Density of air - Density of balloon) × Volume of balloon × Gravity = (Mass of air + Mass of system) × Gravity

Volume of balloon = (Mass of air + Mass of system) / (Density of air - Density of balloon)

Volume of balloon = (2850 kg + 400 kg) / (1.22 kg/m³ - 0.95 kg/m³)

Volume of balloon = 14118.5 m³

Therefore, the minimum volume the balloon can have before it goes downward instead of upward is 14118.5 m³.

e. As the balloon rises, the lower air pressure causes the air around the balloon to become less dense. This means that the density of the fluid that the balloon displaces decreases, which reduces the buoyant force acting on the balloon. As a result, the balloon will start to rise more slowly or may even stop rising altogether if the density of the displaced air becomes equal to the density of the balloon.

f. As the balloon rises, the atmospheric pressure decreases, causing the volume of the balloon to increase. This expansion of the balloon increases the volume of air that it displaces, which in turn increases the buoyant force acting on the balloon. As a result, the balloon will rise more quickly or may even accelerate if the expansion of the balloon is significant enough.

To know more about Archimedes' principle

brainly.com/question/787619

#SPJ1

A
consists of a period of non-strenuous activity that slowly
prepares the body for more vigorous exercise.

Answers

The period of non-strenuous activity that slowly prepares the body for more vigorous exercise is called a warm-up. A warm-up is an essential part of any exercise routine as it helps to prepare the body physically and mentally for more intense physical activity.

Explain non-strengthening activity that gradually prepares the body for more strenuous exercise?

During a warm-up, the body's muscles, heart, and lungs gradually increase their activity levels, and the body's temperature begins to rise. This gradual increase in activity and temperature helps to reduce the risk of injury and improves performance during more intense exercise.

A typical warm-up can last between 5 to 15 minutes, depending on the intensity of the upcoming exercise. Some common warm-up activities include light aerobic exercises like jogging or cycling, dynamic stretching, and mobility exercises.

It is important to note that a warm-up should not be too strenuous activity , as this can cause fatigue and decrease performance during the main workout. Instead, it should be a gentle and gradual increase in activity level to prepare the body for the upcoming exercise.

To learn more about strenuous activity, visit: https://brainly.com/question/4996577

#SPJ1

Bumblebees are skilled aerialists, able to fly with confidence around and through the leaves and stems of plants. In one test of bumblebee aerial navigation, bees in level flight flew at a constant 0.40 m/s, turning right and left as they navigated an obstacle-filled track. While turning, the bees maintained a reasonably constant centripetal acceleration of 4.0 m/s2
a) What is the radius of curvature for such a turn?
b) How much time is required for a bee to execute a 90∘ turn?

Answers

The turn's radius of curvature is 0.04 meters. A 90 degree turn is completed by the bee in 0.628 seconds on average.

How is the radius of curvature for such a turn determined?

The radius of curvature of the turn can be calculated using the centripetal acceleration equation:

a = v² / r

where r is the radius of curvature, v is the speed, and an is the centripetal acceleration. When we rearrange this equation to account for r, we obtain:

r = v² / a

Inputting the values provided yields:

0.04 m is equal to r = (0.40 m/s)2 / 4.0 m/s2.

As a result, the turn's radius of curvature is 0.04 meters.

How long does it take a bee to complete a 90-degree turn?

We can use the equation for the circumference of a circle to determine how long it takes the bee to complete a 90-degree turn:

C = 2πr

C/4 = (2πr)/4 = πr/2

The result of substituting the r value we discovered before is:

πr/2 = (π/2) (0.04 m) = 0.063 m

We can divide the distance travelled by the speed to determine the required amount of time:

t = d/v

t = (2πr)/v

When we replace the values we discovered above, we obtain:

t = (2π)(0.04 m) / 0.40 m/s = 0.628 s

As a result, the bee needs about 0.628 seconds to complete a 90-degree turn.

To learn more about radius of curvature visit:

brainly.com/question/30652458

#SPJ1

in a car race along a straight race course betv,ieen Yaw and Kofi. both staried from rest but Kofi leaves the statiing line 2.00 s after Yaw does. Yav,; and Kofi maintain acceleration of 4.00 m S2 and 5.00 m S·2 respectively.​

Answers

Kofi overtakes Yaw after 4.00 s.Kofi travels 40.00 m before he catches Yaw.Motion problem

We can use the following kinematic equations to solve the problem:

v = u + ats = ut + 1/2 at^2v^2 = u^2 + 2as

For Yaw:

a = 4.00 m/s^2

t = time taken by Kofi + 2.00 s (since Yaw started 2.00 s earlier)

s = distance covered by Yaw when Kofi starts

Using the equation s = ut + 1/2 at^2, we get:

s = 0 + 1/2 (4.00) (2.00)^2

s = 8.00 m

For Kofi:

a = 5.00 m/s^2

We want to find the time when Kofi overtakes Yaw, so we can use the equation:

s = ut + 1/2 at^2

Let t be the time taken by Kofi to overtake Yaw. At that time, their positions will be the same, so the distance covered by Kofi will be equal to the distance covered by Yaw plus 8.00 m. Hence,

1/2 (5.00) t^2 = 1/2 (4.00) (t - 2.00)^2 + 8.00

Simplifying and solving for t, we get:

t = 4.00 s

Therefore, Kofi overtakes Yaw after 4.00 s.

To find the distance Kofi travels before he catches Yaw, we can use the same equation:

s = ut + 1/2 at^2

Using t = 4.00 s and a = 5.00 m/s^2, we get:

s = 0 + 1/2 (5.00) (4.00)^2

s = 40.00 m

Therefore, Kofi travels 40.00 m before he catches Yaw.

More on motion can be found here: https://brainly.com/question/28712225

#SPJ1

in a car race along a straight race course between Yaw and Kofi. both start from rest but Kofi leaves the starting line 2.00 s after Yaw does. Yav,; and Kofi maintain acceleration of 4.00 m S2 and 5.00 m S·2 respectively.​

Calculate the time at which kofi overtakes yaw

Calculate the distance kofi travels before he catches yaw.

a copper water tank of mass 20 kg contains 150 kg of water at 15°C calculate the energy needed to heat the water and the tank to 55°C

copper shc - 385j/kg
water shc - 4200j/kg

Answers

Answer: 25230800 Joules

Explanation: We can treat the copper tank and the water inside as two different objects since they have different specific heats. We will utilize Q=Mcdelta(t) in this problem where M is mass, c is specific heat, and delta t is the change in temperature.

Since we are treating the copper and water separately we can make a Mcdelta(t) for each one of them. This gives us Q=(mass of copper)(specific heat of copper)(delta(t))+(mass of water)(specific heat of water)(delta(t)). The delta t will be the same because both the copper and water are at 15 celsius. Now we just do some calculations.

Q=(mass of copper)(specific heat of copper)(delta(t))+(mass of water)(specific heat of water)(delta(t))

Q=(20)(385)(55-15)+(150)(4200)(55-15)

Q=30800+25200000

Q=25230800 J

This number may seem absurdly high but there is 150 kg of water being heated up which is 150 liters(A LOT!).

Hope this helps!

Complete the following:
When light is incident parallel to the principal axis and then strikes a converging lens,

A. the light will remain parallel after refracting through the lens
B. the light will remail parallel after refracting backwards from the lens
C. the light will refract through the focal point on the opposite side of the lens
D. the light will refract through the focal point on the same side as the object

Answers

Answer:

c

Explanation:

trust

In the same liquid, the pressures are equal at all points that are
A. the same distance below the liquid surface.
B. along the vertical walls of the container.
C. not touching any immersed objects.
D. not in the sunlight.

Answers

The correct option is A. which states that in the same liquid, the pressures are equal at all points that are at the same distance below the liquid surface.

This is because the pressure is determined by the weight of the liquid column above it, which is the same for all points at the same depth. The pressure along the vertical walls of the container is not equal because the liquid is in hydrostatic equilibrium which means that the pressure is not the same at all points in the liquid, and since the walls are vertical, the pressure is the same along them. The pressure at any point not touching any immersed objects is not equal to the pressure at any other point not touching any immersed objects because the pressure is determined by the weight of the liquid column above it, which is the same for all points not touching any immersed objects. The pressure is not affected by factors such as sunlight since the pressure at any point  in the sunlight is equal to the pressure at any other point not in the sunlight.

To learn more about pressure click here https://brainly.com/question/29341536

#SPJ1

30 POINTS - the cone moves with simple harmonic motion and it emits

Answers

The cone emits a single-frequency sound of 100 Hz and moves in a straightforward harmonic manner. The cone moves a maximum of 2.0 millimetres when it is making a loud sound.

What moves with simple harmonic motion?

Simple harmonic motion is a particular type of periodic motion of a body that arises from a dynamic equilibrium between an inertial force that is proportional to the acceleration of the body away from the static equilibrium position and a restoring force on the moving object that is directly proportional to the magnitude of the object's displacement and acts towards the object's equilibrium position.

In mechanics and physics, SHM is sometimes used to refer to this motion. If friction or any other energy dissipation is not present, it leads to an oscillation that is represented by a sinusoid and that lasts indefinitely.

Learn more about  harmonic motion

https://brainly.com/question/30404816

#SPJ1

Starting from rest at a height equal to the radius of the circular track, a block of mass 24 kg slides down a quarter circular track under the influence of gravity with friction present (of coefficient μ). The radius of the track is 26 m.
The acceleration of gravity is 9.8 m/s2 .

If the kinetic energy of the block at the bottom of the track is 3700 J, what is the work done against friction?
Answer in units of J.

Answers

Answer: The initial potential energy of the block is converted into kinetic energy at the bottom of the track, and some work is done against friction. We can use conservation of energy to find the work done against friction:

Initial potential energy = Final kinetic energy + Work against friction

The initial potential energy is mgh, where m is the mass of the block, g is the acceleration due to gravity, and h is the initial height of the block (which is equal to the radius of the track):

Initial potential energy = mgh = (24 kg)(9.8 m/s^2)(26 m) = 60432 J

The final kinetic energy is given as 3700 J.

Plugging these values into the equation above, we can solve for the work done against friction:

Work against friction = Initial potential energy - Final kinetic energy

= 60432 J - 3700 J

= 56732 J

Therefore, the work done against friction is 56732 J

Explanation:

Assume the two radii of the thin convex lens surfaces to be equal for each of the two convex lenses used in this experiment and the index of refraction of their glass to be 1.5. From the relationship given in equation, determine the radius of curvature for each of the two thin convex lenses that you need

Answers

The radius of curvature for each surface of the thin convex lenses is 4 times the focal length (f).

A convex lens is what?

Two spherical surfaces often make up an optical lens. The lens is referred to as a biconvex lens or just a convex lens if those surfaces are curved outwards. These lenses have the ability to focus an outside light beam to a spot on the opposite side by converging it.

Is the convex lens's radius of curvature positive or negative?

The radius of curvature is always positive for convex lenses and always negative for concave lenses.

The relationship between the focal length (f), radius of curvature (R), and index of refraction (n) for a thin convex lens is,

1/f = (n - 1) * (1/R1 - 1/R2)

where R1 and R2 are the radii of curvature of the two surfaces of the lens.

Since the two radii of curvature for each of the two convex lenses are equal, we can simplify the equation to:

1/f = (n - 1) * (2/R)

R = radius of curvature for each surface of the lens.

We can rearrange this equation

R = 2 * f / (n - 1)

Substituting the given values of n = 1.5

R = 2 * f / 0.5

R = 4 * f

To know more about the convex lenses visit:

https://brainly.com/question/12323990

#SPJ1

A highway is to be built between two towns, one of which lies 32.0km south and 72.0km west of the other. What is the shortest length of highway that can be built between the two towns, and at which angle would this highway be directed with respect to due west

Answers

The shortest distance that can be travelled by road between the two towns, and at what angle would it face due west is 78.79km and Ф is 23.3°

We can create a right triangle with legs that are 32 km and 72 km apart if we join the tips of the distances from the west and south. The hypotenuse is the unidentified shortest length. The Pythagorean theorem enables us to state that According to the Pythagorean Theorem, The sum of the squares of the lengths of a right triangle's legs equals the square of the hypotenuse's length.

In other words, a² + b² = c² for the triangle depicted below.

The right triangle's legs, a and b, are perpendicular sides, and the hypotenuse, c, is the side that faces away from the right angle.

This program is frequently employed in building projects and essentially anything that includes right triangles, like as roofs for homes, and soon.

h² = (32 km)² + (72 km)².

h²=1024+5184

h²=6208

h=√6208

h=78.79km

Angle=tan⁻¹(Ф)

so tan(Ф)=32/72

tan(Ф)=0.444

Ф=tan⁻¹(0.444)

  =23.3Degrees

H is equal to 78.79 in terms of value. As a result, the shortest  length of the route is about 78.79 km and angleФ is 23.3°.

Learn more about shortest distance here

https://brainly.com/question/1550786

#SPJ1

How to solve it please i need explanation

Answers

Answer:

8 N

Explanation:

The net force formula is F = m×a

a = 2 m/s^2, m2 = 4 kg

So, now we can find F:

F = 4 × 2 = 8 N

Other Questions
1. What type of essay is "A Nice Place to Visit"? 2. What is Baker's main point (thesis)? 3. Identify all the rhetorical devices and methods of proof. 4. Discuss Baker's characteristics of a truly "great city". Compare and contrast this to your own view of a "great city". What city do you think is "great"? Why? testing many different trading rules until you find one that would have worked in the past is called . what are gore's and bush's positions on full public financing of federal elections Determine the value of x Consider a situation where over the course of a 24-mile long run, a runner becomes increasingly tired. In the first hour he runs 12 miles, in the second hour 6 miles, in the third hour 3 miles, and so on, so that each hour he runs half the distance to go. How long will it take to finish the race? Which action could help improve your credit history?Make a major purchase that you can't afford right nowAlways pay your credit card bill on time.Only get a debit card and avoid credit cards.Leave credit card bills outstanding. A conductor of square with sides of length 2d, carries a current I uniformly distributed throughout its cross-sectional area. The current in the conductor is directed out of the screen. Ampres law is applied along the circle that touches the four sides of the conductor. Select the expression that correctly represents the magnitude of the integral around the circle. Group of answer choices0(d2I)0(2dI)0(I/4)0(4I/) What was Equianos purpose in writing this chapter of his narrative? To describe the horrors of the trade of enslaved people To argue for an end to the abolitionist movement To describe growing up in Africa To compare slavery in the 1700s to that of earlier times Dragon Sports Inc. Manufactures and sells two products, baseball bats and baseball gloves. The fixed costs are $282,100, and the sales mix is 30% bats and 70% gloves. The unit selling price and the unit variable cost for each product are as follows: Products Unit Selling Price Unit Variable Cost Bats $40 $30 Gloves 100 60 a. Compute the break-even sales (units) for the overall enterprise product, E The following information relates to the Thomas Taylor Company. Date Ending Inventory (End-of-Year Prices) Price Index December 31, 2016 $ 65,200 100 December 31, 2017 106,560 120 December 31, 2018 114,444 132 December 31, 2019 130,287 137 December 31, 2020 122,980 143 Use the dollar-value LIFO method to compute the ending inventory for Taylor Company for 2016 through 2020. Ending Inventory2016 $2017 $2018 $2019 $2020 $ Can you compare the energy in different types of nuts? 7Check my work mode: This shows what is comect or incomect for the work you have completed so far does not indie1Loong Corporation, a calendar year accrual besis corporation, reported $1 million of net income after tax on its financial statementsprepared in accordance with GAAP. The corporation's books and records reveal the following informationLuong's federal income tax expense per books was $200,000- Luong's book income included $10,000 of dividends received from a domestic corporation in which Luong owns a 25 percent stockinterest and $4,000 of dividends from a domestic corporation in which Luong owns a 5 percent stock interest- Luong recognized $10,000 of capital losses this year and no capital gains- Luong recorded $8,000 of book expense for meals not provided by a restaurant and $10,000 of book expense for entertainment- Luong's depreciation expense for book purposes totaled $400,000 MACRS depreciation was $475.000Required:& Compute Luong's federal taxable income and regular tax liability& Prepare a Schedule M-1, page 6, Form 120, reconciling Luong's book and taxable income.Required AComplete this question by entering your answers in the tabs below.Answer is complete but not entirely correct.Compute Loong's federal taxable income and regular tax liabilityNote: Enter your answers in whole dollars not in millions.Amount Complete the sentences with the right form of the verbs in the present perfect.A) ______ you ever ______ (be) to Europe?B) Julia ______ (read) more than fifty books this year.C) "______ you ________ (see) John lately?"D) I ______ (finish) the book you lent me. I loved it!E) "_______ Martin _______ (got) the job he applied for?" "Yes, he has."F) Lou ______ never ________ (travel) abroad.G) The students _______ (meet) their dearliiness.PLS the daily high temperature for chattanooga is normally distributed with mean 79 and standard deviation 4. find the probability that a randomly chosen temperature is between 70 and 75. Karen has two dogs. The larger dog weighs 1. 4 pounds more than the smaller dog. The combined weight of the two dogs is 12. 6 pounds The students at Porterville Elementary sold raffle tickets, each for the same price, for a fundraiser. The equation below shows how much money was raised with t tickets sold.$800 = $16tWhat is the unit rate in the equation above? A. $784 per raffle ticket B. $16 per raffle ticket C. $50 per raffle ticket D. $800 per raffle ticket At a restaurant you only have $30 to spend on dinner. In addition to the cost of the meal you must pay a 8% sales tax and leave a 20% tip. What is the most expensive item you can order? Is basalt sectile or brittle Stressed syllables in unforeseeable, confidential, certification, ceremoniously, probation,indication I dont know what 28x76 is